Git
Threads by month
- ----- 2026 -----
- April
- March
- February
- January
- ----- 2025 -----
- December
- November
- October
- September
- August
- July
- June
- May
- April
- March
- February
- January
- ----- 2024 -----
- December
- November
- October
- September
- August
- July
- June
- May
- April
- March
- February
- January
- ----- 2023 -----
- December
- November
- October
- September
- August
- July
- June
- May
- April
- March
- February
- January
- ----- 2022 -----
- December
- November
- October
- September
- August
- July
- June
- May
- April
- March
- February
- January
- ----- 2021 -----
- December
- November
- October
- September
- August
- July
- June
- May
- April
- March
- February
- January
- ----- 2020 -----
- December
- November
- October
- September
- August
- July
- June
- May
- April
- March
- February
- January
- ----- 2019 -----
- December
- November
- October
- September
- August
- July
- June
- May
- April
- March
- February
- January
- ----- 2018 -----
- December
- November
- October
- September
- August
- July
- June
- May
- April
- March
- February
- January
- ----- 2017 -----
- December
- November
- October
- September
- August
- July
- June
- May
- April
- March
- February
- January
- ----- 2016 -----
- December
- November
- October
- September
- August
- July
- June
- May
- April
- March
- February
- January
- ----- 2015 -----
- December
- November
- October
- September
- August
- July
- June
- May
- April
- March
- February
- January
- ----- 2014 -----
- December
- November
- October
- September
- August
- July
- June
- May
- April
- March
- February
- January
- ----- 2013 -----
- December
- November
- October
- September
- August
- July
- June
- May
- April
- March
- February
- January
- ----- 2012 -----
- December
- November
- October
- September
- August
- July
- June
- May
- April
- March
- February
- January
- ----- 2011 -----
- December
- November
- October
- September
- August
- July
- June
- May
- April
- March
- February
- January
- ----- 2010 -----
- December
- November
- October
- September
- August
- July
- June
- May
- April
- March
- February
April 2010
- 6 participants
- 240 discussions
[Phpmyadmin-git] [SCM] phpMyAdmin branch, master, updated. RELEASE_3_3_2-1587-g97a5c04
by Michal Čihař 15 Apr '10
by Michal Čihař 15 Apr '10
15 Apr '10
The branch, master has been updated
via 97a5c047d135990f106d2db1918dbf34d2b4c49d (commit)
from 32d85066078569987a88dd9951488519fdfa699e (commit)
- Log -----------------------------------------------------------------
commit 97a5c047d135990f106d2db1918dbf34d2b4c49d
Author: Michal Čihař <mcihar(a)novell.com>
Date: Thu Apr 15 10:23:22 2010 +0200
Convert end of lines.
-----------------------------------------------------------------------
Summary of changes:
test/wui.php | 38 +++++++++++++++++++-------------------
1 files changed, 19 insertions(+), 19 deletions(-)
diff --git a/test/wui.php b/test/wui.php
index 77898bc..d1f6f6c 100644
--- a/test/wui.php
+++ b/test/wui.php
@@ -1,19 +1,19 @@
-<?php
-/* vim: set expandtab sw=4 ts=4 sts=4: */
-/**
- * runs all defined tests
- *
- * @version $Id$
- * @package phpMyAdmin-test
- */
-
-/**
- *
- */
-require_once 'AllTests.php';
-
-echo '<pre>';
-AllTests::main();
-echo '</pre>';
-
-?>
\ No newline at end of file
+<?php
+/* vim: set expandtab sw=4 ts=4 sts=4: */
+/**
+ * runs all defined tests
+ *
+ * @version $Id$
+ * @package phpMyAdmin-test
+ */
+
+/**
+ *
+ */
+require_once 'AllTests.php';
+
+echo '<pre>';
+AllTests::main();
+echo '</pre>';
+
+?>
hooks/post-receive
--
phpMyAdmin
1
0
[Phpmyadmin-git] [SCM] phpMyAdmin branch, master, updated. RELEASE_3_3_2-1586-g32d8506
by Michal Čihař 15 Apr '10
by Michal Čihař 15 Apr '10
15 Apr '10
The branch, master has been updated
via 32d85066078569987a88dd9951488519fdfa699e (commit)
from c2de4dd8d99b13cc4dac8e8b4a8d127dcb0f3a13 (commit)
- Log -----------------------------------------------------------------
commit 32d85066078569987a88dd9951488519fdfa699e
Author: Michal Čihař <mcihar(a)novell.com>
Date: Thu Apr 15 10:17:58 2010 +0200
Add jquery ui theme to themes.
-----------------------------------------------------------------------
Summary of changes:
libraries/header_meta_style.inc.php | 1 +
.../jquery/images/ui-bg_flat_0_aaaaaa_40x100.png | Bin 0 -> 180 bytes
.../jquery/images/ui-bg_flat_75_ffffff_40x100.png | Bin 0 -> 178 bytes
.../jquery/images/ui-bg_glass_55_fbf9ee_1x400.png | Bin 0 -> 120 bytes
.../jquery/images/ui-bg_glass_65_ffffff_1x400.png | Bin 0 -> 105 bytes
.../jquery/images/ui-bg_glass_75_dadada_1x400.png | Bin 0 -> 111 bytes
.../jquery/images/ui-bg_glass_75_e6e6e6_1x400.png | Bin 0 -> 110 bytes
.../jquery/images/ui-bg_glass_95_fef1ec_1x400.png | Bin 0 -> 119 bytes
.../ui-bg_highlight-soft_75_cccccc_1x100.png | Bin 0 -> 101 bytes
.../jquery/images/ui-icons_222222_256x240.png | Bin 0 -> 4369 bytes
.../jquery/images/ui-icons_2e83ff_256x240.png | Bin 0 -> 4369 bytes
.../jquery/images/ui-icons_454545_256x240.png | Bin 0 -> 4369 bytes
.../jquery/images/ui-icons_888888_256x240.png | Bin 0 -> 4369 bytes
.../jquery/images/ui-icons_cd0a0a_256x240.png | Bin 0 -> 4369 bytes
.../jquery/jquery-ui-1.8.custom.css | 480 ++++++++++++++++++++
.../jquery/images/ui-bg_flat_0_aaaaaa_40x100.png | Bin 0 -> 180 bytes
.../jquery/images/ui-bg_flat_75_ffffff_40x100.png | Bin 0 -> 178 bytes
.../jquery/images/ui-bg_glass_55_fbf9ee_1x400.png | Bin 0 -> 120 bytes
.../jquery/images/ui-bg_glass_65_ffffff_1x400.png | Bin 0 -> 105 bytes
.../jquery/images/ui-bg_glass_75_dadada_1x400.png | Bin 0 -> 111 bytes
.../jquery/images/ui-bg_glass_75_e6e6e6_1x400.png | Bin 0 -> 110 bytes
.../jquery/images/ui-bg_glass_95_fef1ec_1x400.png | Bin 0 -> 119 bytes
.../ui-bg_highlight-soft_75_cccccc_1x100.png | Bin 0 -> 101 bytes
.../jquery/images/ui-icons_222222_256x240.png | Bin 0 -> 4369 bytes
.../jquery/images/ui-icons_2e83ff_256x240.png | Bin 0 -> 4369 bytes
.../jquery/images/ui-icons_454545_256x240.png | Bin 0 -> 4369 bytes
.../jquery/images/ui-icons_888888_256x240.png | Bin 0 -> 4369 bytes
.../jquery/images/ui-icons_cd0a0a_256x240.png | Bin 0 -> 4369 bytes
themes/original/jquery/jquery-ui-1.8.custom.css | 480 ++++++++++++++++++++
29 files changed, 961 insertions(+), 0 deletions(-)
create mode 100644 themes/darkblue_orange/jquery/images/ui-bg_flat_0_aaaaaa_40x100.png
create mode 100644 themes/darkblue_orange/jquery/images/ui-bg_flat_75_ffffff_40x100.png
create mode 100644 themes/darkblue_orange/jquery/images/ui-bg_glass_55_fbf9ee_1x400.png
create mode 100644 themes/darkblue_orange/jquery/images/ui-bg_glass_65_ffffff_1x400.png
create mode 100644 themes/darkblue_orange/jquery/images/ui-bg_glass_75_dadada_1x400.png
create mode 100644 themes/darkblue_orange/jquery/images/ui-bg_glass_75_e6e6e6_1x400.png
create mode 100644 themes/darkblue_orange/jquery/images/ui-bg_glass_95_fef1ec_1x400.png
create mode 100644 themes/darkblue_orange/jquery/images/ui-bg_highlight-soft_75_cccccc_1x100.png
create mode 100644 themes/darkblue_orange/jquery/images/ui-icons_222222_256x240.png
create mode 100644 themes/darkblue_orange/jquery/images/ui-icons_2e83ff_256x240.png
create mode 100644 themes/darkblue_orange/jquery/images/ui-icons_454545_256x240.png
create mode 100644 themes/darkblue_orange/jquery/images/ui-icons_888888_256x240.png
create mode 100644 themes/darkblue_orange/jquery/images/ui-icons_cd0a0a_256x240.png
create mode 100644 themes/darkblue_orange/jquery/jquery-ui-1.8.custom.css
create mode 100644 themes/original/jquery/images/ui-bg_flat_0_aaaaaa_40x100.png
create mode 100644 themes/original/jquery/images/ui-bg_flat_75_ffffff_40x100.png
create mode 100644 themes/original/jquery/images/ui-bg_glass_55_fbf9ee_1x400.png
create mode 100644 themes/original/jquery/images/ui-bg_glass_65_ffffff_1x400.png
create mode 100644 themes/original/jquery/images/ui-bg_glass_75_dadada_1x400.png
create mode 100644 themes/original/jquery/images/ui-bg_glass_75_e6e6e6_1x400.png
create mode 100644 themes/original/jquery/images/ui-bg_glass_95_fef1ec_1x400.png
create mode 100644 themes/original/jquery/images/ui-bg_highlight-soft_75_cccccc_1x100.png
create mode 100644 themes/original/jquery/images/ui-icons_222222_256x240.png
create mode 100644 themes/original/jquery/images/ui-icons_2e83ff_256x240.png
create mode 100644 themes/original/jquery/images/ui-icons_454545_256x240.png
create mode 100644 themes/original/jquery/images/ui-icons_888888_256x240.png
create mode 100644 themes/original/jquery/images/ui-icons_cd0a0a_256x240.png
create mode 100644 themes/original/jquery/jquery-ui-1.8.custom.css
diff --git a/libraries/header_meta_style.inc.php b/libraries/header_meta_style.inc.php
index a0cd326..1e656c5 100644
--- a/libraries/header_meta_style.inc.php
+++ b/libraries/header_meta_style.inc.php
@@ -56,4 +56,5 @@ if ($GLOBALS['text_dir'] == 'ltr') {
?>
<link rel="stylesheet" type="text/css" href="<?php echo defined('PMA_PATH_TO_BASEDIR') ? PMA_PATH_TO_BASEDIR : ''; ?>phpmyadmin.css.php?<?php echo PMA_generate_common_url(); ?>&js_frame=<?php echo isset($print_view) ? 'print' : 'right'; ?>&nocache=<?php echo $GLOBALS['PMA_Config']->getThemeUniqueValue(); ?>" />
<link rel="stylesheet" type="text/css" href="<?php echo defined('PMA_PATH_TO_BASEDIR') ? PMA_PATH_TO_BASEDIR : ''; ?>print.css" media="print" />
+ <link rel="stylesheet" type="text/css" href="<?php echo $GLOBALS['pmaThemePath']; ?>jquery/jquery-ui-1.8.custom.css" />
<meta name="robots" content="noindex,nofollow" />
diff --git a/themes/darkblue_orange/jquery/images/ui-bg_flat_0_aaaaaa_40x100.png b/themes/darkblue_orange/jquery/images/ui-bg_flat_0_aaaaaa_40x100.png
new file mode 100644
index 0000000..5b5dab2
Binary files /dev/null and b/themes/darkblue_orange/jquery/images/ui-bg_flat_0_aaaaaa_40x100.png differ
diff --git a/themes/darkblue_orange/jquery/images/ui-bg_flat_75_ffffff_40x100.png b/themes/darkblue_orange/jquery/images/ui-bg_flat_75_ffffff_40x100.png
new file mode 100644
index 0000000..ac8b229
Binary files /dev/null and b/themes/darkblue_orange/jquery/images/ui-bg_flat_75_ffffff_40x100.png differ
diff --git a/themes/darkblue_orange/jquery/images/ui-bg_glass_55_fbf9ee_1x400.png b/themes/darkblue_orange/jquery/images/ui-bg_glass_55_fbf9ee_1x400.png
new file mode 100644
index 0000000..ad3d634
Binary files /dev/null and b/themes/darkblue_orange/jquery/images/ui-bg_glass_55_fbf9ee_1x400.png differ
diff --git a/themes/darkblue_orange/jquery/images/ui-bg_glass_65_ffffff_1x400.png b/themes/darkblue_orange/jquery/images/ui-bg_glass_65_ffffff_1x400.png
new file mode 100644
index 0000000..42ccba2
Binary files /dev/null and b/themes/darkblue_orange/jquery/images/ui-bg_glass_65_ffffff_1x400.png differ
diff --git a/themes/darkblue_orange/jquery/images/ui-bg_glass_75_dadada_1x400.png b/themes/darkblue_orange/jquery/images/ui-bg_glass_75_dadada_1x400.png
new file mode 100644
index 0000000..5a46b47
Binary files /dev/null and b/themes/darkblue_orange/jquery/images/ui-bg_glass_75_dadada_1x400.png differ
diff --git a/themes/darkblue_orange/jquery/images/ui-bg_glass_75_e6e6e6_1x400.png b/themes/darkblue_orange/jquery/images/ui-bg_glass_75_e6e6e6_1x400.png
new file mode 100644
index 0000000..86c2baa
Binary files /dev/null and b/themes/darkblue_orange/jquery/images/ui-bg_glass_75_e6e6e6_1x400.png differ
diff --git a/themes/darkblue_orange/jquery/images/ui-bg_glass_95_fef1ec_1x400.png b/themes/darkblue_orange/jquery/images/ui-bg_glass_95_fef1ec_1x400.png
new file mode 100644
index 0000000..4443fdc
Binary files /dev/null and b/themes/darkblue_orange/jquery/images/ui-bg_glass_95_fef1ec_1x400.png differ
diff --git a/themes/darkblue_orange/jquery/images/ui-bg_highlight-soft_75_cccccc_1x100.png b/themes/darkblue_orange/jquery/images/ui-bg_highlight-soft_75_cccccc_1x100.png
new file mode 100644
index 0000000..7c9fa6c
Binary files /dev/null and b/themes/darkblue_orange/jquery/images/ui-bg_highlight-soft_75_cccccc_1x100.png differ
diff --git a/themes/darkblue_orange/jquery/images/ui-icons_222222_256x240.png b/themes/darkblue_orange/jquery/images/ui-icons_222222_256x240.png
new file mode 100644
index 0000000..b273ff1
Binary files /dev/null and b/themes/darkblue_orange/jquery/images/ui-icons_222222_256x240.png differ
diff --git a/themes/darkblue_orange/jquery/images/ui-icons_2e83ff_256x240.png b/themes/darkblue_orange/jquery/images/ui-icons_2e83ff_256x240.png
new file mode 100644
index 0000000..09d1cdc
Binary files /dev/null and b/themes/darkblue_orange/jquery/images/ui-icons_2e83ff_256x240.png differ
diff --git a/themes/darkblue_orange/jquery/images/ui-icons_454545_256x240.png b/themes/darkblue_orange/jquery/images/ui-icons_454545_256x240.png
new file mode 100644
index 0000000..59bd45b
Binary files /dev/null and b/themes/darkblue_orange/jquery/images/ui-icons_454545_256x240.png differ
diff --git a/themes/darkblue_orange/jquery/images/ui-icons_888888_256x240.png b/themes/darkblue_orange/jquery/images/ui-icons_888888_256x240.png
new file mode 100644
index 0000000..6d02426
Binary files /dev/null and b/themes/darkblue_orange/jquery/images/ui-icons_888888_256x240.png differ
diff --git a/themes/darkblue_orange/jquery/images/ui-icons_cd0a0a_256x240.png b/themes/darkblue_orange/jquery/images/ui-icons_cd0a0a_256x240.png
new file mode 100644
index 0000000..2ab019b
Binary files /dev/null and b/themes/darkblue_orange/jquery/images/ui-icons_cd0a0a_256x240.png differ
diff --git a/themes/darkblue_orange/jquery/jquery-ui-1.8.custom.css b/themes/darkblue_orange/jquery/jquery-ui-1.8.custom.css
new file mode 100644
index 0000000..a5e31ab
--- /dev/null
+++ b/themes/darkblue_orange/jquery/jquery-ui-1.8.custom.css
@@ -0,0 +1,480 @@
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+*/
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,Arial,sans-serif&fwDefau…
+*/
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; }
+.ui-widget-content a { color: #222222; }
+.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; }
+.ui-widget-header a { color: #222222; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #999999; background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; }
+.ui-state-error a, .ui-widget-content .ui-state-error a { color: #cd0a0a; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text { color: #cd0a0a; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; }
+.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
+.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/* Resizable
+----------------------------------*/
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* Accordion
+----------------------------------*/
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }/* Autocomplete
+----------------------------------*/
+.ui-autocomplete { position: absolute; cursor: default; }
+.ui-autocomplete-loading { background: white url('images/ui-anim_basic_16x16.gif') right center no-repeat; }
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/* Menu
+----------------------------------*/
+.ui-menu {
+ list-style:none;
+ padding: 2px;
+ margin: 0;
+ display:block;
+}
+.ui-menu .ui-menu {
+ margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+ margin:0;
+ padding: 0;
+ width: 100%;
+}
+.ui-menu .ui-menu-item a {
+ text-decoration:none;
+ display:block;
+ padding:.2em .4em;
+ line-height:1.5;
+ zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+ margin: -1px;
+}
+/* Button
+----------------------------------*/
+
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; }
+button.ui-button-icons-only { width: 3.7em; }
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4; }
+.ui-button-text-only .ui-button-text { padding: .4em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
+
+
+
+
+
+/* Dialog
+----------------------------------*/
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
+.ui-dialog .ui-dialog-titlebar { padding: .5em 1em .3em; position: relative; }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .2em 0; }
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
+/* Slider
+----------------------------------*/
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }/* Tabs
+----------------------------------*/
+.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
+.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { display: block; border: 0; padding: 1em 1.4em; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
+/* Datepicker
+----------------------------------*/
+.ui-datepicker { width: 17em; padding: .2em .2em 0; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}/* Progressbar
+----------------------------------*/
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file
diff --git a/themes/original/jquery/images/ui-bg_flat_0_aaaaaa_40x100.png b/themes/original/jquery/images/ui-bg_flat_0_aaaaaa_40x100.png
new file mode 100644
index 0000000..5b5dab2
Binary files /dev/null and b/themes/original/jquery/images/ui-bg_flat_0_aaaaaa_40x100.png differ
diff --git a/themes/original/jquery/images/ui-bg_flat_75_ffffff_40x100.png b/themes/original/jquery/images/ui-bg_flat_75_ffffff_40x100.png
new file mode 100644
index 0000000..ac8b229
Binary files /dev/null and b/themes/original/jquery/images/ui-bg_flat_75_ffffff_40x100.png differ
diff --git a/themes/original/jquery/images/ui-bg_glass_55_fbf9ee_1x400.png b/themes/original/jquery/images/ui-bg_glass_55_fbf9ee_1x400.png
new file mode 100644
index 0000000..ad3d634
Binary files /dev/null and b/themes/original/jquery/images/ui-bg_glass_55_fbf9ee_1x400.png differ
diff --git a/themes/original/jquery/images/ui-bg_glass_65_ffffff_1x400.png b/themes/original/jquery/images/ui-bg_glass_65_ffffff_1x400.png
new file mode 100644
index 0000000..42ccba2
Binary files /dev/null and b/themes/original/jquery/images/ui-bg_glass_65_ffffff_1x400.png differ
diff --git a/themes/original/jquery/images/ui-bg_glass_75_dadada_1x400.png b/themes/original/jquery/images/ui-bg_glass_75_dadada_1x400.png
new file mode 100644
index 0000000..5a46b47
Binary files /dev/null and b/themes/original/jquery/images/ui-bg_glass_75_dadada_1x400.png differ
diff --git a/themes/original/jquery/images/ui-bg_glass_75_e6e6e6_1x400.png b/themes/original/jquery/images/ui-bg_glass_75_e6e6e6_1x400.png
new file mode 100644
index 0000000..86c2baa
Binary files /dev/null and b/themes/original/jquery/images/ui-bg_glass_75_e6e6e6_1x400.png differ
diff --git a/themes/original/jquery/images/ui-bg_glass_95_fef1ec_1x400.png b/themes/original/jquery/images/ui-bg_glass_95_fef1ec_1x400.png
new file mode 100644
index 0000000..4443fdc
Binary files /dev/null and b/themes/original/jquery/images/ui-bg_glass_95_fef1ec_1x400.png differ
diff --git a/themes/original/jquery/images/ui-bg_highlight-soft_75_cccccc_1x100.png b/themes/original/jquery/images/ui-bg_highlight-soft_75_cccccc_1x100.png
new file mode 100644
index 0000000..7c9fa6c
Binary files /dev/null and b/themes/original/jquery/images/ui-bg_highlight-soft_75_cccccc_1x100.png differ
diff --git a/themes/original/jquery/images/ui-icons_222222_256x240.png b/themes/original/jquery/images/ui-icons_222222_256x240.png
new file mode 100644
index 0000000..b273ff1
Binary files /dev/null and b/themes/original/jquery/images/ui-icons_222222_256x240.png differ
diff --git a/themes/original/jquery/images/ui-icons_2e83ff_256x240.png b/themes/original/jquery/images/ui-icons_2e83ff_256x240.png
new file mode 100644
index 0000000..09d1cdc
Binary files /dev/null and b/themes/original/jquery/images/ui-icons_2e83ff_256x240.png differ
diff --git a/themes/original/jquery/images/ui-icons_454545_256x240.png b/themes/original/jquery/images/ui-icons_454545_256x240.png
new file mode 100644
index 0000000..59bd45b
Binary files /dev/null and b/themes/original/jquery/images/ui-icons_454545_256x240.png differ
diff --git a/themes/original/jquery/images/ui-icons_888888_256x240.png b/themes/original/jquery/images/ui-icons_888888_256x240.png
new file mode 100644
index 0000000..6d02426
Binary files /dev/null and b/themes/original/jquery/images/ui-icons_888888_256x240.png differ
diff --git a/themes/original/jquery/images/ui-icons_cd0a0a_256x240.png b/themes/original/jquery/images/ui-icons_cd0a0a_256x240.png
new file mode 100644
index 0000000..2ab019b
Binary files /dev/null and b/themes/original/jquery/images/ui-icons_cd0a0a_256x240.png differ
diff --git a/themes/original/jquery/jquery-ui-1.8.custom.css b/themes/original/jquery/jquery-ui-1.8.custom.css
new file mode 100644
index 0000000..a5e31ab
--- /dev/null
+++ b/themes/original/jquery/jquery-ui-1.8.custom.css
@@ -0,0 +1,480 @@
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+*/
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,Arial,sans-serif&fwDefau…
+*/
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; }
+.ui-widget-content a { color: #222222; }
+.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; }
+.ui-widget-header a { color: #222222; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #999999; background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; }
+.ui-state-error a, .ui-widget-content .ui-state-error a { color: #cd0a0a; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text { color: #cd0a0a; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; }
+.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
+.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/* Resizable
+----------------------------------*/
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* Accordion
+----------------------------------*/
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }/* Autocomplete
+----------------------------------*/
+.ui-autocomplete { position: absolute; cursor: default; }
+.ui-autocomplete-loading { background: white url('images/ui-anim_basic_16x16.gif') right center no-repeat; }
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/* Menu
+----------------------------------*/
+.ui-menu {
+ list-style:none;
+ padding: 2px;
+ margin: 0;
+ display:block;
+}
+.ui-menu .ui-menu {
+ margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+ margin:0;
+ padding: 0;
+ width: 100%;
+}
+.ui-menu .ui-menu-item a {
+ text-decoration:none;
+ display:block;
+ padding:.2em .4em;
+ line-height:1.5;
+ zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+ margin: -1px;
+}
+/* Button
+----------------------------------*/
+
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; }
+button.ui-button-icons-only { width: 3.7em; }
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4; }
+.ui-button-text-only .ui-button-text { padding: .4em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
+
+
+
+
+
+/* Dialog
+----------------------------------*/
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
+.ui-dialog .ui-dialog-titlebar { padding: .5em 1em .3em; position: relative; }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .2em 0; }
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
+/* Slider
+----------------------------------*/
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }/* Tabs
+----------------------------------*/
+.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
+.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { display: block; border: 0; padding: 1em 1.4em; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
+/* Datepicker
+----------------------------------*/
+.ui-datepicker { width: 17em; padding: .2em .2em 0; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}/* Progressbar
+----------------------------------*/
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file
hooks/post-receive
--
phpMyAdmin
1
0
[Phpmyadmin-git] [SCM] phpMyAdmin branch, master, updated. RELEASE_3_3_2-1585-gc2de4dd
by Michal Čihař 15 Apr '10
by Michal Čihař 15 Apr '10
15 Apr '10
The branch, master has been updated
via c2de4dd8d99b13cc4dac8e8b4a8d127dcb0f3a13 (commit)
from 979cc56f424baefc65ea8ebbcdf4a92118e4bc17 (commit)
- Log -----------------------------------------------------------------
commit c2de4dd8d99b13cc4dac8e8b4a8d127dcb0f3a13
Author: Michal Čihař <mcihar(a)novell.com>
Date: Thu Apr 15 09:34:52 2010 +0200
Add full uncompressed version of jquery ui.
-----------------------------------------------------------------------
Summary of changes:
db_structure.php | 2 +-
js/jquery/jquery-ui-1.8.custom.js |10889 +++++++++++++++++++++++++++++++++
js/jquery/jquery-ui-1.8.custom.min.js | 42 -
setup/index.php | 2 +-
sql.php | 2 +-
tbl_replace.php | 2 +-
tbl_select.php | 2 +-
tbl_structure.php | 2 +-
8 files changed, 10895 insertions(+), 48 deletions(-)
create mode 100644 js/jquery/jquery-ui-1.8.custom.js
delete mode 100644 js/jquery/jquery-ui-1.8.custom.min.js
diff --git a/db_structure.php b/db_structure.php
index 6bcc3bd..9f12ce9 100644
--- a/db_structure.php
+++ b/db_structure.php
@@ -12,7 +12,7 @@
require_once './libraries/common.inc.php';
require_once './libraries/Table.class.php';
-$GLOBALS['js_include'][] = 'jquery/jquery-ui-1.8.custom.min.js';
+$GLOBALS['js_include'][] = 'jquery/jquery-ui-1.8.custom.js';
/**
* Prepares the tables list if the user where not redirected to this script
diff --git a/js/jquery/jquery-ui-1.8.custom.js b/js/jquery/jquery-ui-1.8.custom.js
new file mode 100644
index 0000000..1c7f364
--- /dev/null
+++ b/js/jquery/jquery-ui-1.8.custom.js
@@ -0,0 +1,10889 @@
+/*!
+ * jQuery UI 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI
+ */
+;jQuery.ui || (function($) {
+
+//Helper functions and ui object
+$.ui = {
+ version: "1.8",
+
+ // $.ui.plugin is deprecated. Use the proxy pattern instead.
+ plugin: {
+ add: function(module, option, set) {
+ var proto = $.ui[module].prototype;
+ for(var i in set) {
+ proto.plugins[i] = proto.plugins[i] || [];
+ proto.plugins[i].push([option, set[i]]);
+ }
+ },
+ call: function(instance, name, args) {
+ var set = instance.plugins[name];
+ if(!set || !instance.element[0].parentNode) { return; }
+
+ for (var i = 0; i < set.length; i++) {
+ if (instance.options[set[i][0]]) {
+ set[i][1].apply(instance.element, args);
+ }
+ }
+ }
+ },
+
+ contains: function(a, b) {
+ return document.compareDocumentPosition
+ ? a.compareDocumentPosition(b) & 16
+ : a !== b && a.contains(b);
+ },
+
+ hasScroll: function(el, a) {
+
+ //If overflow is hidden, the element might have extra content, but the user wants to hide it
+ if ($(el).css('overflow') == 'hidden') { return false; }
+
+ var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop',
+ has = false;
+
+ if (el[scroll] > 0) { return true; }
+
+ // TODO: determine which cases actually cause this to happen
+ // if the element doesn't have the scroll set, see if it's possible to
+ // set the scroll
+ el[scroll] = 1;
+ has = (el[scroll] > 0);
+ el[scroll] = 0;
+ return has;
+ },
+
+ isOverAxis: function(x, reference, size) {
+ //Determines when x coordinate is over "b" element axis
+ return (x > reference) && (x < (reference + size));
+ },
+
+ isOver: function(y, x, top, left, height, width) {
+ //Determines when x, y coordinates is over "b" element
+ return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width);
+ },
+
+ keyCode: {
+ BACKSPACE: 8,
+ CAPS_LOCK: 20,
+ COMMA: 188,
+ CONTROL: 17,
+ DELETE: 46,
+ DOWN: 40,
+ END: 35,
+ ENTER: 13,
+ ESCAPE: 27,
+ HOME: 36,
+ INSERT: 45,
+ LEFT: 37,
+ NUMPAD_ADD: 107,
+ NUMPAD_DECIMAL: 110,
+ NUMPAD_DIVIDE: 111,
+ NUMPAD_ENTER: 108,
+ NUMPAD_MULTIPLY: 106,
+ NUMPAD_SUBTRACT: 109,
+ PAGE_DOWN: 34,
+ PAGE_UP: 33,
+ PERIOD: 190,
+ RIGHT: 39,
+ SHIFT: 16,
+ SPACE: 32,
+ TAB: 9,
+ UP: 38
+ }
+};
+
+//jQuery plugins
+$.fn.extend({
+ _focus: $.fn.focus,
+ focus: function(delay, fn) {
+ return typeof delay === 'number'
+ ? this.each(function() {
+ var elem = this;
+ setTimeout(function() {
+ $(elem).focus();
+ (fn && fn.call(elem));
+ }, delay);
+ })
+ : this._focus.apply(this, arguments);
+ },
+
+ enableSelection: function() {
+ return this
+ .attr('unselectable', 'off')
+ .css('MozUserSelect', '')
+ .unbind('selectstart.ui');
+ },
+
+ disableSelection: function() {
+ return this
+ .attr('unselectable', 'on')
+ .css('MozUserSelect', 'none')
+ .bind('selectstart.ui', function() { return false; });
+ },
+
+ scrollParent: function() {
+ var scrollParent;
+ if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
+ scrollParent = this.parents().filter(function() {
+ return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ } else {
+ scrollParent = this.parents().filter(function() {
+ return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ }
+
+ return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
+ },
+
+ zIndex: function(zIndex) {
+ if (zIndex !== undefined) {
+ return this.css('zIndex', zIndex);
+ }
+
+ if (this.length) {
+ var elem = $(this[0]), position, value;
+ while (elem.length && elem[0] !== document) {
+ // Ignore z-index if position is set to a value where z-index is ignored by the browser
+ // This makes behavior of this function consistent across browsers
+ // WebKit always returns auto if the element is positioned
+ position = elem.css('position');
+ if (position == 'absolute' || position == 'relative' || position == 'fixed')
+ {
+ // IE returns 0 when zIndex is not specified
+ // other browsers return a string
+ // we ignore the case of nested elements with an explicit value of 0
+ // <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
+ value = parseInt(elem.css('zIndex'));
+ if (!isNaN(value) && value != 0) {
+ return value;
+ }
+ }
+ elem = elem.parent();
+ }
+ }
+
+ return 0;
+ }
+});
+
+
+//Additional selectors
+$.extend($.expr[':'], {
+ data: function(elem, i, match) {
+ return !!$.data(elem, match[3]);
+ },
+
+ focusable: function(element) {
+ var nodeName = element.nodeName.toLowerCase(),
+ tabIndex = $.attr(element, 'tabindex');
+ return (/input|select|textarea|button|object/.test(nodeName)
+ ? !element.disabled
+ : 'a' == nodeName || 'area' == nodeName
+ ? element.href || !isNaN(tabIndex)
+ : !isNaN(tabIndex))
+ // the element and all of its ancestors must be visible
+ // the browser may report that the area is hidden
+ && !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length;
+ },
+
+ tabbable: function(element) {
+ var tabIndex = $.attr(element, 'tabindex');
+ return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable');
+ }
+});
+
+})(jQuery);
+/*!
+ * jQuery UI Widget 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function( $ ) {
+
+var _remove = $.fn.remove;
+
+$.fn.remove = function( selector, keepData ) {
+ return this.each(function() {
+ if ( !keepData ) {
+ if ( !selector || $.filter( selector, [ this ] ).length ) {
+ $( "*", this ).add( this ).each(function() {
+ $( this ).triggerHandler( "remove" );
+ });
+ }
+ }
+ return _remove.call( $(this), selector, keepData );
+ });
+};
+
+$.widget = function( name, base, prototype ) {
+ var namespace = name.split( "." )[ 0 ],
+ fullName;
+ name = name.split( "." )[ 1 ];
+ fullName = namespace + "-" + name;
+
+ if ( !prototype ) {
+ prototype = base;
+ base = $.Widget;
+ }
+
+ // create selector for plugin
+ $.expr[ ":" ][ fullName ] = function( elem ) {
+ return !!$.data( elem, name );
+ };
+
+ $[ namespace ] = $[ namespace ] || {};
+ $[ namespace ][ name ] = function( options, element ) {
+ // allow instantiation without initializing for simple inheritance
+ if ( arguments.length ) {
+ this._createWidget( options, element );
+ }
+ };
+
+ var basePrototype = new base();
+ // we need to make the options hash a property directly on the new instance
+ // otherwise we'll modify the options hash on the prototype that we're
+ // inheriting from
+// $.each( basePrototype, function( key, val ) {
+// if ( $.isPlainObject(val) ) {
+// basePrototype[ key ] = $.extend( {}, val );
+// }
+// });
+ basePrototype.options = $.extend( {}, basePrototype.options );
+ $[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
+ namespace: namespace,
+ widgetName: name,
+ widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name,
+ widgetBaseClass: fullName
+ }, prototype );
+
+ $.widget.bridge( name, $[ namespace ][ name ] );
+};
+
+$.widget.bridge = function( name, object ) {
+ $.fn[ name ] = function( options ) {
+ var isMethodCall = typeof options === "string",
+ args = Array.prototype.slice.call( arguments, 1 ),
+ returnValue = this;
+
+ // allow multiple hashes to be passed on init
+ options = !isMethodCall && args.length ?
+ $.extend.apply( null, [ true, options ].concat(args) ) :
+ options;
+
+ // prevent calls to internal methods
+ if ( isMethodCall && options.substring( 0, 1 ) === "_" ) {
+ return returnValue;
+ }
+
+ if ( isMethodCall ) {
+ this.each(function() {
+ var instance = $.data( this, name ),
+ methodValue = instance && $.isFunction( instance[options] ) ?
+ instance[ options ].apply( instance, args ) :
+ instance;
+ if ( methodValue !== instance && methodValue !== undefined ) {
+ returnValue = methodValue;
+ return false;
+ }
+ });
+ } else {
+ this.each(function() {
+ var instance = $.data( this, name );
+ if ( instance ) {
+ if ( options ) {
+ instance.option( options );
+ }
+ instance._init();
+ } else {
+ $.data( this, name, new object( options, this ) );
+ }
+ });
+ }
+
+ return returnValue;
+ };
+};
+
+$.Widget = function( options, element ) {
+ // allow instantiation without initializing for simple inheritance
+ if ( arguments.length ) {
+ this._createWidget( options, element );
+ }
+};
+
+$.Widget.prototype = {
+ widgetName: "widget",
+ widgetEventPrefix: "",
+ options: {
+ disabled: false
+ },
+ _createWidget: function( options, element ) {
+ // $.widget.bridge stores the plugin instance, but we do it anyway
+ // so that it's stored even before the _create function runs
+ this.element = $( element ).data( this.widgetName, this );
+ this.options = $.extend( true, {},
+ this.options,
+ $.metadata && $.metadata.get( element )[ this.widgetName ],
+ options );
+
+ var self = this;
+ this.element.bind( "remove." + this.widgetName, function() {
+ self.destroy();
+ });
+
+ this._create();
+ this._init();
+ },
+ _create: function() {},
+ _init: function() {},
+
+ destroy: function() {
+ this.element
+ .unbind( "." + this.widgetName )
+ .removeData( this.widgetName );
+ this.widget()
+ .unbind( "." + this.widgetName )
+ .removeAttr( "aria-disabled" )
+ .removeClass(
+ this.widgetBaseClass + "-disabled " +
+ this.namespace + "-state-disabled" );
+ },
+
+ widget: function() {
+ return this.element;
+ },
+
+ option: function( key, value ) {
+ var options = key,
+ self = this;
+
+ if ( arguments.length === 0 ) {
+ // don't return a reference to the internal hash
+ return $.extend( {}, self.options );
+ }
+
+ if (typeof key === "string" ) {
+ if ( value === undefined ) {
+ return this.options[ key ];
+ }
+ options = {};
+ options[ key ] = value;
+ }
+
+ $.each( options, function( key, value ) {
+ self._setOption( key, value );
+ });
+
+ return self;
+ },
+ _setOption: function( key, value ) {
+ this.options[ key ] = value;
+
+ if ( key === "disabled" ) {
+ this.widget()
+ [ value ? "addClass" : "removeClass"](
+ this.widgetBaseClass + "-disabled" + " " +
+ this.namespace + "-state-disabled" )
+ .attr( "aria-disabled", value );
+ }
+
+ return this;
+ },
+
+ enable: function() {
+ return this._setOption( "disabled", false );
+ },
+ disable: function() {
+ return this._setOption( "disabled", true );
+ },
+
+ _trigger: function( type, event, data ) {
+ var callback = this.options[ type ];
+
+ event = $.Event( event );
+ event.type = ( type === this.widgetEventPrefix ?
+ type :
+ this.widgetEventPrefix + type ).toLowerCase();
+ data = data || {};
+
+ // copy original event properties over to the new event
+ // this would happen if we could call $.event.fix instead of $.Event
+ // but we don't have a way to force an event to be fixed multiple times
+ if ( event.originalEvent ) {
+ for ( var i = $.event.props.length, prop; i; ) {
+ prop = $.event.props[ --i ];
+ event[ prop ] = event.originalEvent[ prop ];
+ }
+ }
+
+ this.element.trigger( event, data );
+
+ return !( $.isFunction(callback) &&
+ callback.call( this.element[0], event, data ) === false ||
+ event.isDefaultPrevented() );
+ }
+};
+
+})( jQuery );
+/*!
+ * jQuery UI Mouse 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.mouse", {
+ options: {
+ cancel: ':input,option',
+ distance: 1,
+ delay: 0
+ },
+ _mouseInit: function() {
+ var self = this;
+
+ this.element
+ .bind('mousedown.'+this.widgetName, function(event) {
+ return self._mouseDown(event);
+ })
+ .bind('click.'+this.widgetName, function(event) {
+ if(self._preventClickEvent) {
+ self._preventClickEvent = false;
+ event.stopImmediatePropagation();
+ return false;
+ }
+ });
+
+ this.started = false;
+ },
+
+ // TODO: make sure destroying one instance of mouse doesn't mess with
+ // other instances of mouse
+ _mouseDestroy: function() {
+ this.element.unbind('.'+this.widgetName);
+ },
+
+ _mouseDown: function(event) {
+ // don't let more than one widget handle mouseStart
+ // TODO: figure out why we have to use originalEvent
+ event.originalEvent = event.originalEvent || {};
+ if (event.originalEvent.mouseHandled) { return; }
+
+ // we may have missed mouseup (out of window)
+ (this._mouseStarted && this._mouseUp(event));
+
+ this._mouseDownEvent = event;
+
+ var self = this,
+ btnIsLeft = (event.which == 1),
+ elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false);
+ if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
+ return true;
+ }
+
+ this.mouseDelayMet = !this.options.delay;
+ if (!this.mouseDelayMet) {
+ this._mouseDelayTimer = setTimeout(function() {
+ self.mouseDelayMet = true;
+ }, this.options.delay);
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted = (this._mouseStart(event) !== false);
+ if (!this._mouseStarted) {
+ event.preventDefault();
+ return true;
+ }
+ }
+
+ // these delegates are required to keep context
+ this._mouseMoveDelegate = function(event) {
+ return self._mouseMove(event);
+ };
+ this._mouseUpDelegate = function(event) {
+ return self._mouseUp(event);
+ };
+ $(document)
+ .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ // preventDefault() is used to prevent the selection of text here -
+ // however, in Safari, this causes select boxes not to be selectable
+ // anymore, so this fix is needed
+ ($.browser.safari || event.preventDefault());
+
+ event.originalEvent.mouseHandled = true;
+ return true;
+ },
+
+ _mouseMove: function(event) {
+ // IE mouseup check - mouseup happened when mouse was out of window
+ if ($.browser.msie && !event.button) {
+ return this._mouseUp(event);
+ }
+
+ if (this._mouseStarted) {
+ this._mouseDrag(event);
+ return event.preventDefault();
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted =
+ (this._mouseStart(this._mouseDownEvent, event) !== false);
+ (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
+ }
+
+ return !this._mouseStarted;
+ },
+
+ _mouseUp: function(event) {
+ $(document)
+ .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ if (this._mouseStarted) {
+ this._mouseStarted = false;
+ this._preventClickEvent = (event.target == this._mouseDownEvent.target);
+ this._mouseStop(event);
+ }
+
+ return false;
+ },
+
+ _mouseDistanceMet: function(event) {
+ return (Math.max(
+ Math.abs(this._mouseDownEvent.pageX - event.pageX),
+ Math.abs(this._mouseDownEvent.pageY - event.pageY)
+ ) >= this.options.distance
+ );
+ },
+
+ _mouseDelayMet: function(event) {
+ return this.mouseDelayMet;
+ },
+
+ // These are placeholder methods, to be overriden by extending plugin
+ _mouseStart: function(event) {},
+ _mouseDrag: function(event) {},
+ _mouseStop: function(event) {},
+ _mouseCapture: function(event) { return true; }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Position 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function( $ ) {
+
+$.ui = $.ui || {};
+
+var horizontalPositions = /left|center|right/,
+ horizontalDefault = "center",
+ verticalPositions = /top|center|bottom/,
+ verticalDefault = "center",
+ _position = $.fn.position,
+ _offset = $.fn.offset;
+
+$.fn.position = function( options ) {
+ if ( !options || !options.of ) {
+ return _position.apply( this, arguments );
+ }
+
+ // make a copy, we don't want to modify arguments
+ options = $.extend( {}, options );
+
+ var target = $( options.of ),
+ collision = ( options.collision || "flip" ).split( " " ),
+ offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ],
+ targetWidth,
+ targetHeight,
+ basePosition;
+
+ if ( options.of.nodeType === 9 ) {
+ targetWidth = target.width();
+ targetHeight = target.height();
+ basePosition = { top: 0, left: 0 };
+ } else if ( options.of.scrollTo && options.of.document ) {
+ targetWidth = target.width();
+ targetHeight = target.height();
+ basePosition = { top: target.scrollTop(), left: target.scrollLeft() };
+ } else if ( options.of.preventDefault ) {
+ // force left top to allow flipping
+ options.at = "left top";
+ targetWidth = targetHeight = 0;
+ basePosition = { top: options.of.pageY, left: options.of.pageX };
+ } else {
+ targetWidth = target.outerWidth();
+ targetHeight = target.outerHeight();
+ basePosition = target.offset();
+ }
+
+ // force my and at to have valid horizontal and veritcal positions
+ // if a value is missing or invalid, it will be converted to center
+ $.each( [ "my", "at" ], function() {
+ var pos = ( options[this] || "" ).split( " " );
+ if ( pos.length === 1) {
+ pos = horizontalPositions.test( pos[0] ) ?
+ pos.concat( [verticalDefault] ) :
+ verticalPositions.test( pos[0] ) ?
+ [ horizontalDefault ].concat( pos ) :
+ [ horizontalDefault, verticalDefault ];
+ }
+ pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : horizontalDefault;
+ pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : verticalDefault;
+ options[ this ] = pos;
+ });
+
+ // normalize collision option
+ if ( collision.length === 1 ) {
+ collision[ 1 ] = collision[ 0 ];
+ }
+
+ // normalize offset option
+ offset[ 0 ] = parseInt( offset[0], 10 ) || 0;
+ if ( offset.length === 1 ) {
+ offset[ 1 ] = offset[ 0 ];
+ }
+ offset[ 1 ] = parseInt( offset[1], 10 ) || 0;
+
+ if ( options.at[0] === "right" ) {
+ basePosition.left += targetWidth;
+ } else if (options.at[0] === horizontalDefault ) {
+ basePosition.left += targetWidth / 2;
+ }
+
+ if ( options.at[1] === "bottom" ) {
+ basePosition.top += targetHeight;
+ } else if ( options.at[1] === verticalDefault ) {
+ basePosition.top += targetHeight / 2;
+ }
+
+ basePosition.left += offset[ 0 ];
+ basePosition.top += offset[ 1 ];
+
+ return this.each(function() {
+ var elem = $( this ),
+ elemWidth = elem.outerWidth(),
+ elemHeight = elem.outerHeight(),
+ position = $.extend( {}, basePosition );
+
+ if ( options.my[0] === "right" ) {
+ position.left -= elemWidth;
+ } else if ( options.my[0] === horizontalDefault ) {
+ position.left -= elemWidth / 2;
+ }
+
+ if ( options.my[1] === "bottom" ) {
+ position.top -= elemHeight;
+ } else if ( options.my[1] === verticalDefault ) {
+ position.top -= elemHeight / 2;
+ }
+
+ $.each( [ "left", "top" ], function( i, dir ) {
+ if ( $.ui.position[ collision[i] ] ) {
+ $.ui.position[ collision[i] ][ dir ]( position, {
+ targetWidth: targetWidth,
+ targetHeight: targetHeight,
+ elemWidth: elemWidth,
+ elemHeight: elemHeight,
+ offset: offset,
+ my: options.my,
+ at: options.at
+ });
+ }
+ });
+
+ if ( $.fn.bgiframe ) {
+ elem.bgiframe();
+ }
+ elem.offset( $.extend( position, { using: options.using } ) );
+ });
+};
+
+$.ui.position = {
+ fit: {
+ left: function( position, data ) {
+ var win = $( window ),
+ over = position.left + data.elemWidth - win.width() - win.scrollLeft();
+ position.left = over > 0 ? position.left - over : Math.max( 0, position.left );
+ },
+ top: function( position, data ) {
+ var win = $( window ),
+ over = position.top + data.elemHeight - win.height() - win.scrollTop();
+ position.top = over > 0 ? position.top - over : Math.max( 0, position.top );
+ }
+ },
+
+ flip: {
+ left: function( position, data ) {
+ if ( data.at[0] === "center" ) {
+ return;
+ }
+ var win = $( window ),
+ over = position.left + data.elemWidth - win.width() - win.scrollLeft(),
+ myOffset = data.my[ 0 ] === "left" ?
+ -data.elemWidth :
+ data.my[ 0 ] === "right" ?
+ data.elemWidth :
+ 0,
+ offset = -2 * data.offset[ 0 ];
+ position.left += position.left < 0 ?
+ myOffset + data.targetWidth + offset :
+ over > 0 ?
+ myOffset - data.targetWidth + offset :
+ 0;
+ },
+ top: function( position, data ) {
+ if ( data.at[1] === "center" ) {
+ return;
+ }
+ var win = $( window ),
+ over = position.top + data.elemHeight - win.height() - win.scrollTop(),
+ myOffset = data.my[ 1 ] === "top" ?
+ -data.elemHeight :
+ data.my[ 1 ] === "bottom" ?
+ data.elemHeight :
+ 0,
+ atOffset = data.at[ 1 ] === "top" ?
+ data.targetHeight :
+ -data.targetHeight,
+ offset = -2 * data.offset[ 1 ];
+ position.top += position.top < 0 ?
+ myOffset + data.targetHeight + offset :
+ over > 0 ?
+ myOffset + atOffset + offset :
+ 0;
+ }
+ }
+};
+
+// offset setter from jQuery 1.4
+if ( !$.offset.setOffset ) {
+ $.offset.setOffset = function( elem, options ) {
+ // set position first, in-case top/left are set even on static elem
+ if ( /static/.test( $.curCSS( elem, "position" ) ) ) {
+ elem.style.position = "relative";
+ }
+ var curElem = $( elem ),
+ curOffset = curElem.offset(),
+ curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0,
+ curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0,
+ props = {
+ top: (options.top - curOffset.top) + curTop,
+ left: (options.left - curOffset.left) + curLeft
+ };
+
+ if ( 'using' in options ) {
+ options.using.call( elem, props );
+ } else {
+ curElem.css( props );
+ }
+ };
+
+ $.fn.offset = function( options ) {
+ var elem = this[ 0 ];
+ if ( !elem || !elem.ownerDocument ) { return null; }
+ if ( options ) {
+ return this.each(function() {
+ $.offset.setOffset( this, options );
+ });
+ }
+ return _offset.call( this );
+ };
+}
+
+}( jQuery ));
+/*
+ * jQuery UI Draggable 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.draggable", $.ui.mouse, {
+ widgetEventPrefix: "drag",
+ options: {
+ addClasses: true,
+ appendTo: "parent",
+ axis: false,
+ connectToSortable: false,
+ containment: false,
+ cursor: "auto",
+ cursorAt: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ iframeFix: false,
+ opacity: false,
+ refreshPositions: false,
+ revert: false,
+ revertDuration: 500,
+ scope: "default",
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ snap: false,
+ snapMode: "both",
+ snapTolerance: 20,
+ stack: false,
+ zIndex: false
+ },
+ _create: function() {
+
+ if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
+ this.element[0].style.position = 'relative';
+
+ (this.options.addClasses && this.element.addClass("ui-draggable"));
+ (this.options.disabled && this.element.addClass("ui-draggable-disabled"));
+
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+ if(!this.element.data('draggable')) return;
+ this.element
+ .removeData("draggable")
+ .unbind(".draggable")
+ .removeClass("ui-draggable"
+ + " ui-draggable-dragging"
+ + " ui-draggable-disabled");
+ this._mouseDestroy();
+
+ return this;
+ },
+
+ _mouseCapture: function(event) {
+
+ var o = this.options;
+
+ // among others, prevent a drag on a resizable-handle
+ if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
+ return false;
+
+ //Quit if we're not on a valid handle
+ this.handle = this._getHandle(event);
+ if (!this.handle)
+ return false;
+
+ return true;
+
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options;
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ //If ddmanager is used for droppables, set the global draggable
+ if($.ui.ddmanager)
+ $.ui.ddmanager.current = this;
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Store the helper's css position
+ this.cssPosition = this.helper.css("position");
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.positionAbs = this.element.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ //Generate the original position
+ this.originalPosition = this.position = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+ (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+ //Set a containment if given in the options
+ if(o.containment)
+ this._setContainment();
+
+ //Trigger event + callbacks
+ if(this._trigger("start", event) === false) {
+ this._clear();
+ return false;
+ }
+
+ //Recache the helper size
+ this._cacheHelperProportions();
+
+ //Prepare the droppable offsets
+ if ($.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+
+ this.helper.addClass("ui-draggable-dragging");
+ this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+ return true;
+ },
+
+ _mouseDrag: function(event, noPropagation) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Call plugins and callbacks and use the resulting position if something is returned
+ if (!noPropagation) {
+ var ui = this._uiHash();
+ if(this._trigger('drag', event, ui) === false) {
+ this._mouseUp({});
+ return false;
+ }
+ this.position = ui.position;
+ }
+
+ if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+ if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+ if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ //If we are using droppables, inform the manager about the drop
+ var dropped = false;
+ if ($.ui.ddmanager && !this.options.dropBehaviour)
+ dropped = $.ui.ddmanager.drop(this, event);
+
+ //if a drop comes from outside (a sortable)
+ if(this.dropped) {
+ dropped = this.dropped;
+ this.dropped = false;
+ }
+
+ //if the original element is removed, don't bother to continue
+ if(!this.element[0] || !this.element[0].parentNode)
+ return false;
+
+ if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
+ var self = this;
+ $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
+ if(self._trigger("stop", event) !== false) {
+ self._clear();
+ }
+ });
+ } else {
+ if(this._trigger("stop", event) !== false) {
+ this._clear();
+ }
+ }
+
+ return false;
+ },
+
+ cancel: function() {
+
+ if(this.helper.is(".ui-draggable-dragging")) {
+ this._mouseUp({});
+ } else {
+ this._clear();
+ }
+
+ return this;
+
+ },
+
+ _getHandle: function(event) {
+
+ var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
+ $(this.options.handle, this.element)
+ .find("*")
+ .andSelf()
+ .each(function() {
+ if(this == event.target) handle = true;
+ });
+
+ return handle;
+
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options;
+ var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element);
+
+ if(!helper.parents('body').length)
+ helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
+
+ if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
+ helper.css("position", "absolute");
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if (typeof obj == 'string') {
+ obj = obj.split(' ');
+ }
+ if ($.isArray(obj)) {
+ obj = {left: +obj[0], top: +obj[1] || 0};
+ }
+ if ('left' in obj) {
+ this.offset.click.left = obj.left + this.margins.left;
+ }
+ if ('right' in obj) {
+ this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ }
+ if ('top' in obj) {
+ this.offset.click.top = obj.top + this.margins.top;
+ }
+ if ('bottom' in obj) {
+ this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ }
+ },
+
+ _getParentOffset: function() {
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ po = { top: 0, left: 0 };
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition == "relative") {
+ var p = this.element.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.element.css("marginLeft"),10) || 0),
+ top: (parseInt(this.element.css("marginTop"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var o = this.options;
+ if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+ if(o.containment == 'document' || o.containment == 'window') this.containment = [
+ 0 - this.offset.relative.left - this.offset.parent.left,
+ 0 - this.offset.relative.top - this.offset.parent.top,
+ $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+ ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+
+ if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
+ var ce = $(o.containment)[0]; if(!ce) return;
+ var co = $(o.containment).offset();
+ var over = ($(ce).css("overflow") != 'hidden');
+
+ this.containment = [
+ co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+ co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+ co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+ co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+ ];
+ } else if(o.containment.constructor == Array) {
+ this.containment = o.containment;
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) pos = this.position;
+ var mod = d == "absolute" ? 1 : -1;
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top // The absolute mouse position
+ + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ ),
+ left: (
+ pos.left // The absolute mouse position
+ + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+ var pageX = event.pageX;
+ var pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+ if(this.containment) {
+ if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+ if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+ }
+
+ if(o.grid) {
+ var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+ pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+ pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY // The absolute mouse position
+ - this.offset.click.top // Click offset (relative to the element)
+ - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ ),
+ left: (
+ pageX // The absolute mouse position
+ - this.offset.click.left // Click offset (relative to the element)
+ - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ )
+ };
+
+ },
+
+ _clear: function() {
+ this.helper.removeClass("ui-draggable-dragging");
+ if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
+ //if($.ui.ddmanager) $.ui.ddmanager.current = null;
+ this.helper = null;
+ this.cancelHelperRemoval = false;
+ },
+
+ // From now on bulk stuff - mainly helpers
+
+ _trigger: function(type, event, ui) {
+ ui = ui || this._uiHash();
+ $.ui.plugin.call(this, type, [event, ui]);
+ if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
+ return $.Widget.prototype._trigger.call(this, type, event, ui);
+ },
+
+ plugins: {},
+
+ _uiHash: function(event) {
+ return {
+ helper: this.helper,
+ position: this.position,
+ originalPosition: this.originalPosition,
+ offset: this.positionAbs
+ };
+ }
+
+});
+
+$.extend($.ui.draggable, {
+ version: "1.8"
+});
+
+$.ui.plugin.add("draggable", "connectToSortable", {
+ start: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options,
+ uiSortable = $.extend({}, ui, { item: inst.element });
+ inst.sortables = [];
+ $(o.connectToSortable).each(function() {
+ var sortable = $.data(this, 'sortable');
+ if (sortable && !sortable.options.disabled) {
+ inst.sortables.push({
+ instance: sortable,
+ shouldRevert: sortable.options.revert
+ });
+ sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache
+ sortable._trigger("activate", event, uiSortable);
+ }
+ });
+
+ },
+ stop: function(event, ui) {
+
+ //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
+ var inst = $(this).data("draggable"),
+ uiSortable = $.extend({}, ui, { item: inst.element });
+
+ $.each(inst.sortables, function() {
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+
+ inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
+ this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
+
+ //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
+ if(this.shouldRevert) this.instance.options.revert = true;
+
+ //Trigger the stop of the sortable
+ this.instance._mouseStop(event);
+
+ this.instance.options.helper = this.instance.options._helper;
+
+ //If the helper has been the original item, restore properties in the sortable
+ if(inst.options.helper == 'original')
+ this.instance.currentItem.css({ top: 'auto', left: 'auto' });
+
+ } else {
+ this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
+ this.instance._trigger("deactivate", event, uiSortable);
+ }
+
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), self = this;
+
+ var checkPos = function(o) {
+ var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
+ var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
+ var itemHeight = o.height, itemWidth = o.width;
+ var itemTop = o.top, itemLeft = o.left;
+
+ return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
+ };
+
+ $.each(inst.sortables, function(i) {
+
+ //Copy over some variables to allow calling the sortable's native _intersectsWith
+ this.instance.positionAbs = inst.positionAbs;
+ this.instance.helperProportions = inst.helperProportions;
+ this.instance.offset.click = inst.offset.click;
+
+ if(this.instance._intersectsWith(this.instance.containerCache)) {
+
+ //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
+ if(!this.instance.isOver) {
+
+ this.instance.isOver = 1;
+ //Now we fake the start of dragging for the sortable instance,
+ //by cloning the list group item, appending it to the sortable and using it as inst.currentItem
+ //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
+ this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true);
+ this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
+ this.instance.options.helper = function() { return ui.helper[0]; };
+
+ event.target = this.instance.currentItem[0];
+ this.instance._mouseCapture(event, true);
+ this.instance._mouseStart(event, true, true);
+
+ //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
+ this.instance.offset.click.top = inst.offset.click.top;
+ this.instance.offset.click.left = inst.offset.click.left;
+ this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
+ this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
+
+ inst._trigger("toSortable", event);
+ inst.dropped = this.instance.element; //draggable revert needs that
+ //hack so receive/update callbacks work (mostly)
+ inst.currentItem = inst.element;
+ this.instance.fromOutside = inst;
+
+ }
+
+ //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
+ if(this.instance.currentItem) this.instance._mouseDrag(event);
+
+ } else {
+
+ //If it doesn't intersect with the sortable, and it intersected before,
+ //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+ this.instance.cancelHelperRemoval = true;
+
+ //Prevent reverting on this forced stop
+ this.instance.options.revert = false;
+
+ // The out event needs to be triggered independently
+ this.instance._trigger('out', event, this.instance._uiHash(this.instance));
+
+ this.instance._mouseStop(event, true);
+ this.instance.options.helper = this.instance.options._helper;
+
+ //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
+ this.instance.currentItem.remove();
+ if(this.instance.placeholder) this.instance.placeholder.remove();
+
+ inst._trigger("fromSortable", event);
+ inst.dropped = false; //draggable revert needs that
+ }
+
+ };
+
+ });
+
+ }
+});
+
+$.ui.plugin.add("draggable", "cursor", {
+ start: function(event, ui) {
+ var t = $('body'), o = $(this).data('draggable').options;
+ if (t.css("cursor")) o._cursor = t.css("cursor");
+ t.css("cursor", o.cursor);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if (o._cursor) $('body').css("cursor", o._cursor);
+ }
+});
+
+$.ui.plugin.add("draggable", "iframeFix", {
+ start: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
+ $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
+ .css({
+ width: this.offsetWidth+"px", height: this.offsetHeight+"px",
+ position: "absolute", opacity: "0.001", zIndex: 1000
+ })
+ .css($(this).offset())
+ .appendTo("body");
+ });
+ },
+ stop: function(event, ui) {
+ $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers
+ }
+});
+
+$.ui.plugin.add("draggable", "opacity", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data('draggable').options;
+ if(t.css("opacity")) o._opacity = t.css("opacity");
+ t.css('opacity', o.opacity);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if(o._opacity) $(ui.helper).css('opacity', o._opacity);
+ }
+});
+
+$.ui.plugin.add("draggable", "scroll", {
+ start: function(event, ui) {
+ var i = $(this).data("draggable");
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
+ },
+ drag: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options, scrolled = false;
+
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
+
+ if(!o.axis || o.axis != 'x') {
+ if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
+ else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
+ else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
+ }
+
+ } else {
+
+ if(!o.axis || o.axis != 'x') {
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+ }
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(i, event);
+
+ }
+});
+
+$.ui.plugin.add("draggable", "snap", {
+ start: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options;
+ i.snapElements = [];
+
+ $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
+ var $t = $(this); var $o = $t.offset();
+ if(this != i.element[0]) i.snapElements.push({
+ item: this,
+ width: $t.outerWidth(), height: $t.outerHeight(),
+ top: $o.top, left: $o.left
+ });
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options;
+ var d = o.snapTolerance;
+
+ var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
+ y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
+
+ for (var i = inst.snapElements.length - 1; i >= 0; i--){
+
+ var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
+ t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
+
+ //Yes, I know, this is insane ;)
+ if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
+ if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = false;
+ continue;
+ }
+
+ if(o.snapMode != 'inner') {
+ var ts = Math.abs(t - y2) <= d;
+ var bs = Math.abs(b - y1) <= d;
+ var ls = Math.abs(l - x2) <= d;
+ var rs = Math.abs(r - x1) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
+ }
+
+ var first = (ts || bs || ls || rs);
+
+ if(o.snapMode != 'outer') {
+ var ts = Math.abs(t - y1) <= d;
+ var bs = Math.abs(b - y2) <= d;
+ var ls = Math.abs(l - x1) <= d;
+ var rs = Math.abs(r - x2) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
+ }
+
+ if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
+ (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
+
+ };
+
+ }
+});
+
+$.ui.plugin.add("draggable", "stack", {
+ start: function(event, ui) {
+
+ var o = $(this).data("draggable").options;
+
+ var group = $.makeArray($(o.stack)).sort(function(a,b) {
+ return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0);
+ });
+ if (!group.length) { return; }
+
+ var min = parseInt(group[0].style.zIndex) || 0;
+ $(group).each(function(i) {
+ this.style.zIndex = min + i;
+ });
+
+ this[0].style.zIndex = min + group.length;
+
+ }
+});
+
+$.ui.plugin.add("draggable", "zIndex", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data("draggable").options;
+ if(t.css("zIndex")) o._zIndex = t.css("zIndex");
+ t.css('zIndex', o.zIndex);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data("draggable").options;
+ if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Droppable 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.mouse.js
+ * jquery.ui.draggable.js
+ */
+(function($) {
+
+$.widget("ui.droppable", {
+ widgetEventPrefix: "drop",
+ options: {
+ accept: '*',
+ activeClass: false,
+ addClasses: true,
+ greedy: false,
+ hoverClass: false,
+ scope: 'default',
+ tolerance: 'intersect'
+ },
+ _create: function() {
+
+ var o = this.options, accept = o.accept;
+ this.isover = 0; this.isout = 1;
+
+ this.accept = $.isFunction(accept) ? accept : function(d) {
+ return d.is(accept);
+ };
+
+ //Store the droppable's proportions
+ this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
+
+ // Add the reference and positions to the manager
+ $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || [];
+ $.ui.ddmanager.droppables[o.scope].push(this);
+
+ (o.addClasses && this.element.addClass("ui-droppable"));
+
+ },
+
+ destroy: function() {
+ var drop = $.ui.ddmanager.droppables[this.options.scope];
+ for ( var i = 0; i < drop.length; i++ )
+ if ( drop[i] == this )
+ drop.splice(i, 1);
+
+ this.element
+ .removeClass("ui-droppable ui-droppable-disabled")
+ .removeData("droppable")
+ .unbind(".droppable");
+
+ return this;
+ },
+
+ _setOption: function(key, value) {
+
+ if(key == 'accept') {
+ this.accept = $.isFunction(value) ? value : function(d) {
+ return d.is(value);
+ };
+ }
+ $.Widget.prototype._setOption.apply(this, arguments);
+ },
+
+ _activate: function(event) {
+ var draggable = $.ui.ddmanager.current;
+ if(this.options.activeClass) this.element.addClass(this.options.activeClass);
+ (draggable && this._trigger('activate', event, this.ui(draggable)));
+ },
+
+ _deactivate: function(event) {
+ var draggable = $.ui.ddmanager.current;
+ if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+ (draggable && this._trigger('deactivate', event, this.ui(draggable)));
+ },
+
+ _over: function(event) {
+
+ var draggable = $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+ if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
+ this._trigger('over', event, this.ui(draggable));
+ }
+
+ },
+
+ _out: function(event) {
+
+ var draggable = $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+ if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+ this._trigger('out', event, this.ui(draggable));
+ }
+
+ },
+
+ _drop: function(event,custom) {
+
+ var draggable = custom || $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element
+
+ var childrenIntersection = false;
+ this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
+ var inst = $.data(this, 'droppable');
+ if(
+ inst.options.greedy
+ && !inst.options.disabled
+ && inst.options.scope == draggable.options.scope
+ && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element))
+ && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)
+ ) { childrenIntersection = true; return false; }
+ });
+ if(childrenIntersection) return false;
+
+ if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+ if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+ this._trigger('drop', event, this.ui(draggable));
+ return this.element;
+ }
+
+ return false;
+
+ },
+
+ ui: function(c) {
+ return {
+ draggable: (c.currentItem || c.element),
+ helper: c.helper,
+ position: c.position,
+ offset: c.positionAbs
+ };
+ }
+
+});
+
+$.extend($.ui.droppable, {
+ version: "1.8"
+});
+
+$.ui.intersect = function(draggable, droppable, toleranceMode) {
+
+ if (!droppable.offset) return false;
+
+ var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
+ y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
+ var l = droppable.offset.left, r = l + droppable.proportions.width,
+ t = droppable.offset.top, b = t + droppable.proportions.height;
+
+ switch (toleranceMode) {
+ case 'fit':
+ return (l < x1 && x2 < r
+ && t < y1 && y2 < b);
+ break;
+ case 'intersect':
+ return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
+ && x2 - (draggable.helperProportions.width / 2) < r // Left Half
+ && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
+ && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
+ break;
+ case 'pointer':
+ var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
+ draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
+ isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
+ return isOver;
+ break;
+ case 'touch':
+ return (
+ (y1 >= t && y1 <= b) || // Top edge touching
+ (y2 >= t && y2 <= b) || // Bottom edge touching
+ (y1 < t && y2 > b) // Surrounded vertically
+ ) && (
+ (x1 >= l && x1 <= r) || // Left edge touching
+ (x2 >= l && x2 <= r) || // Right edge touching
+ (x1 < l && x2 > r) // Surrounded horizontally
+ );
+ break;
+ default:
+ return false;
+ break;
+ }
+
+};
+
+/*
+ This manager tracks offsets of draggables and droppables
+*/
+$.ui.ddmanager = {
+ current: null,
+ droppables: { 'default': [] },
+ prepareOffsets: function(t, event) {
+
+ var m = $.ui.ddmanager.droppables[t.options.scope] || [];
+ var type = event ? event.type : null; // workaround for #2317
+ var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
+
+ droppablesLoop: for (var i = 0; i < m.length; i++) {
+
+ if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted
+ for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
+ m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue
+
+ m[i].offset = m[i].element.offset();
+ m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
+
+ if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables
+
+ }
+
+ },
+ drop: function(draggable, event) {
+
+ var dropped = false;
+ $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+ if(!this.options) return;
+ if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
+ dropped = dropped || this._drop.call(this, event);
+
+ if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ this.isout = 1; this.isover = 0;
+ this._deactivate.call(this, event);
+ }
+
+ });
+ return dropped;
+
+ },
+ drag: function(draggable, event) {
+
+ //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
+ if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
+
+ //Run through all droppables and check their positions based on specific tolerance options
+ $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+ if(this.options.disabled || this.greedyChild || !this.visible) return;
+ var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
+
+ var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
+ if(!c) return;
+
+ var parentInstance;
+ if (this.options.greedy) {
+ var parent = this.element.parents(':data(droppable):eq(0)');
+ if (parent.length) {
+ parentInstance = $.data(parent[0], 'droppable');
+ parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
+ }
+ }
+
+ // we just moved into a greedy child
+ if (parentInstance && c == 'isover') {
+ parentInstance['isover'] = 0;
+ parentInstance['isout'] = 1;
+ parentInstance._out.call(parentInstance, event);
+ }
+
+ this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
+ this[c == "isover" ? "_over" : "_out"].call(this, event);
+
+ // we just moved out of a greedy child
+ if (parentInstance && c == 'isout') {
+ parentInstance['isout'] = 0;
+ parentInstance['isover'] = 1;
+ parentInstance._over.call(parentInstance, event);
+ }
+ });
+
+ }
+};
+
+})(jQuery);
+/*
+ * jQuery UI Resizable 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.resizable", $.ui.mouse, {
+ widgetEventPrefix: "resize",
+ options: {
+ alsoResize: false,
+ animate: false,
+ animateDuration: "slow",
+ animateEasing: "swing",
+ aspectRatio: false,
+ autoHide: false,
+ containment: false,
+ ghost: false,
+ grid: false,
+ handles: "e,s,se",
+ helper: false,
+ maxHeight: null,
+ maxWidth: null,
+ minHeight: 10,
+ minWidth: 10,
+ zIndex: 1000
+ },
+ _create: function() {
+
+ var self = this, o = this.options;
+ this.element.addClass("ui-resizable");
+
+ $.extend(this, {
+ _aspectRatio: !!(o.aspectRatio),
+ aspectRatio: o.aspectRatio,
+ originalElement: this.element,
+ _proportionallyResizeElements: [],
+ _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
+ });
+
+ //Wrap the element if it cannot hold child nodes
+ if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
+
+ //Opera fix for relative positioning
+ if (/relative/.test(this.element.css('position')) && $.browser.opera)
+ this.element.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+ //Create a wrapper element and set the wrapper to the new current internal element
+ this.element.wrap(
+ $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
+ position: this.element.css('position'),
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight(),
+ top: this.element.css('top'),
+ left: this.element.css('left')
+ })
+ );
+
+ //Overwrite the original this.element
+ this.element = this.element.parent().data(
+ "resizable", this.element.data('resizable')
+ );
+
+ this.elementIsWrapper = true;
+
+ //Move margins to the wrapper
+ this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
+ this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
+
+ //Prevent Safari textarea resize
+ this.originalResizeStyle = this.originalElement.css('resize');
+ this.originalElement.css('resize', 'none');
+
+ //Push the actual element to our proportionallyResize internal array
+ this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
+
+ // avoid IE jump (hard set the margin)
+ this.originalElement.css({ margin: this.originalElement.css('margin') });
+
+ // fix handlers offset
+ this._proportionallyResize();
+
+ }
+
+ this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
+ if(this.handles.constructor == String) {
+
+ if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
+ var n = this.handles.split(","); this.handles = {};
+
+ for(var i = 0; i < n.length; i++) {
+
+ var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
+ var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
+
+ // increase zIndex of sw, se, ne, nw axis
+ //TODO : this modifies original option
+ if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });
+
+ //TODO : What's going on here?
+ if ('se' == handle) {
+ axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
+ };
+
+ //Insert into internal handles object and append to element
+ this.handles[handle] = '.ui-resizable-'+handle;
+ this.element.append(axis);
+ }
+
+ }
+
+ this._renderAxis = function(target) {
+
+ target = target || this.element;
+
+ for(var i in this.handles) {
+
+ if(this.handles[i].constructor == String)
+ this.handles[i] = $(this.handles[i], this.element).show();
+
+ //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
+ if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
+
+ var axis = $(this.handles[i], this.element), padWrapper = 0;
+
+ //Checking the correct pad and border
+ padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
+
+ //The padding type i have to apply...
+ var padPos = [ 'padding',
+ /ne|nw|n/.test(i) ? 'Top' :
+ /se|sw|s/.test(i) ? 'Bottom' :
+ /^e$/.test(i) ? 'Right' : 'Left' ].join("");
+
+ target.css(padPos, padWrapper);
+
+ this._proportionallyResize();
+
+ }
+
+ //TODO: What's that good for? There's not anything to be executed left
+ if(!$(this.handles[i]).length)
+ continue;
+
+ }
+ };
+
+ //TODO: make renderAxis a prototype function
+ this._renderAxis(this.element);
+
+ this._handles = $('.ui-resizable-handle', this.element)
+ .disableSelection();
+
+ //Matching axis name
+ this._handles.mouseover(function() {
+ if (!self.resizing) {
+ if (this.className)
+ var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
+ //Axis, default = se
+ self.axis = axis && axis[1] ? axis[1] : 'se';
+ }
+ });
+
+ //If we want to auto hide the elements
+ if (o.autoHide) {
+ this._handles.hide();
+ $(this.element)
+ .addClass("ui-resizable-autohide")
+ .hover(function() {
+ $(this).removeClass("ui-resizable-autohide");
+ self._handles.show();
+ },
+ function(){
+ if (!self.resizing) {
+ $(this).addClass("ui-resizable-autohide");
+ self._handles.hide();
+ }
+ });
+ }
+
+ //Initialize the mouse interaction
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+
+ this._mouseDestroy();
+
+ var _destroy = function(exp) {
+ $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
+ .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
+ };
+
+ //TODO: Unwrap at same DOM position
+ if (this.elementIsWrapper) {
+ _destroy(this.element);
+ var wrapper = this.element;
+ wrapper.after(
+ this.originalElement.css({
+ position: wrapper.css('position'),
+ width: wrapper.outerWidth(),
+ height: wrapper.outerHeight(),
+ top: wrapper.css('top'),
+ left: wrapper.css('left')
+ })
+ ).remove();
+ }
+
+ this.originalElement.css('resize', this.originalResizeStyle);
+ _destroy(this.originalElement);
+
+ return this;
+ },
+
+ _mouseCapture: function(event) {
+ var handle = false;
+ for (var i in this.handles) {
+ if ($(this.handles[i])[0] == event.target) {
+ handle = true;
+ }
+ }
+
+ return !this.options.disabled && handle;
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options, iniPos = this.element.position(), el = this.element;
+
+ this.resizing = true;
+ this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
+
+ // bugfix for http://dev.jquery.com/ticket/1749
+ if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
+ el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
+ }
+
+ //Opera fixing relative position
+ if ($.browser.opera && (/relative/).test(el.css('position')))
+ el.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+ this._renderProxy();
+
+ var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
+
+ if (o.containment) {
+ curleft += $(o.containment).scrollLeft() || 0;
+ curtop += $(o.containment).scrollTop() || 0;
+ }
+
+ //Store needed variables
+ this.offset = this.helper.offset();
+ this.position = { left: curleft, top: curtop };
+ this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalPosition = { left: curleft, top: curtop };
+ this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
+ this.originalMousePosition = { left: event.pageX, top: event.pageY };
+
+ //Aspect Ratio
+ this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
+
+ var cursor = $('.ui-resizable-' + this.axis).css('cursor');
+ $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
+
+ el.addClass("ui-resizable-resizing");
+ this._propagate("start", event);
+ return true;
+ },
+
+ _mouseDrag: function(event) {
+
+ //Increase performance, avoid regex
+ var el = this.helper, o = this.options, props = {},
+ self = this, smp = this.originalMousePosition, a = this.axis;
+
+ var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
+ var trigger = this._change[a];
+ if (!trigger) return false;
+
+ // Calculate the attrs that will be change
+ var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
+
+ if (this._aspectRatio || event.shiftKey)
+ data = this._updateRatio(data, event);
+
+ data = this._respectSize(data, event);
+
+ // plugins callbacks need to be called first
+ this._propagate("resize", event);
+
+ el.css({
+ top: this.position.top + "px", left: this.position.left + "px",
+ width: this.size.width + "px", height: this.size.height + "px"
+ });
+
+ if (!this._helper && this._proportionallyResizeElements.length)
+ this._proportionallyResize();
+
+ this._updateCache(data);
+
+ // calling the user callback at the end
+ this._trigger('resize', event, this.ui());
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ this.resizing = false;
+ var o = this.options, self = this;
+
+ if(this._helper) {
+ var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ if (!o.animate)
+ this.element.css($.extend(s, { top: top, left: left }));
+
+ self.helper.height(self.size.height);
+ self.helper.width(self.size.width);
+
+ if (this._helper && !o.animate) this._proportionallyResize();
+ }
+
+ $('body').css('cursor', 'auto');
+
+ this.element.removeClass("ui-resizable-resizing");
+
+ this._propagate("stop", event);
+
+ if (this._helper) this.helper.remove();
+ return false;
+
+ },
+
+ _updateCache: function(data) {
+ var o = this.options;
+ this.offset = this.helper.offset();
+ if (isNumber(data.left)) this.position.left = data.left;
+ if (isNumber(data.top)) this.position.top = data.top;
+ if (isNumber(data.height)) this.size.height = data.height;
+ if (isNumber(data.width)) this.size.width = data.width;
+ },
+
+ _updateRatio: function(data, event) {
+
+ var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
+
+ if (data.height) data.width = (csize.height * this.aspectRatio);
+ else if (data.width) data.height = (csize.width / this.aspectRatio);
+
+ if (a == 'sw') {
+ data.left = cpos.left + (csize.width - data.width);
+ data.top = null;
+ }
+ if (a == 'nw') {
+ data.top = cpos.top + (csize.height - data.height);
+ data.left = cpos.left + (csize.width - data.width);
+ }
+
+ return data;
+ },
+
+ _respectSize: function(data, event) {
+
+ var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
+ ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
+ isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
+
+ if (isminw) data.width = o.minWidth;
+ if (isminh) data.height = o.minHeight;
+ if (ismaxw) data.width = o.maxWidth;
+ if (ismaxh) data.height = o.maxHeight;
+
+ var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
+ var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
+
+ if (isminw && cw) data.left = dw - o.minWidth;
+ if (ismaxw && cw) data.left = dw - o.maxWidth;
+ if (isminh && ch) data.top = dh - o.minHeight;
+ if (ismaxh && ch) data.top = dh - o.maxHeight;
+
+ // fixing jump error on top/left - bug #2330
+ var isNotwh = !data.width && !data.height;
+ if (isNotwh && !data.left && data.top) data.top = null;
+ else if (isNotwh && !data.top && data.left) data.left = null;
+
+ return data;
+ },
+
+ _proportionallyResize: function() {
+
+ var o = this.options;
+ if (!this._proportionallyResizeElements.length) return;
+ var element = this.helper || this.element;
+
+ for (var i=0; i < this._proportionallyResizeElements.length; i++) {
+
+ var prel = this._proportionallyResizeElements[i];
+
+ if (!this.borderDif) {
+ var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
+ p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
+
+ this.borderDif = $.map(b, function(v, i) {
+ var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
+ return border + padding;
+ });
+ }
+
+ if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
+ continue;
+
+ prel.css({
+ height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
+ width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
+ });
+
+ };
+
+ },
+
+ _renderProxy: function() {
+
+ var el = this.element, o = this.options;
+ this.elementOffset = el.offset();
+
+ if(this._helper) {
+
+ this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
+
+ // fix ie6 offset TODO: This seems broken
+ var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
+ pxyoffset = ( ie6 ? 2 : -1 );
+
+ this.helper.addClass(this._helper).css({
+ width: this.element.outerWidth() + pxyoffset,
+ height: this.element.outerHeight() + pxyoffset,
+ position: 'absolute',
+ left: this.elementOffset.left - ie6offset +'px',
+ top: this.elementOffset.top - ie6offset +'px',
+ zIndex: ++o.zIndex //TODO: Don't modify option
+ });
+
+ this.helper
+ .appendTo("body")
+ .disableSelection();
+
+ } else {
+ this.helper = this.element;
+ }
+
+ },
+
+ _change: {
+ e: function(event, dx, dy) {
+ return { width: this.originalSize.width + dx };
+ },
+ w: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { left: sp.left + dx, width: cs.width - dx };
+ },
+ n: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { top: sp.top + dy, height: cs.height - dy };
+ },
+ s: function(event, dx, dy) {
+ return { height: this.originalSize.height + dy };
+ },
+ se: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ sw: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ },
+ ne: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ nw: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ }
+ },
+
+ _propagate: function(n, event) {
+ $.ui.plugin.call(this, n, [event, this.ui()]);
+ (n != "resize" && this._trigger(n, event, this.ui()));
+ },
+
+ plugins: {},
+
+ ui: function() {
+ return {
+ originalElement: this.originalElement,
+ element: this.element,
+ helper: this.helper,
+ position: this.position,
+ size: this.size,
+ originalSize: this.originalSize,
+ originalPosition: this.originalPosition
+ };
+ }
+
+});
+
+$.extend($.ui.resizable, {
+ version: "1.8"
+});
+
+/*
+ * Resizable Extensions
+ */
+
+$.ui.plugin.add("resizable", "alsoResize", {
+
+ start: function(event, ui) {
+
+ var self = $(this).data("resizable"), o = self.options;
+
+ var _store = function(exp) {
+ $(exp).each(function() {
+ $(this).data("resizable-alsoresize", {
+ width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10),
+ left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10)
+ });
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
+ if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
+ else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); }
+ }else{
+ _store(o.alsoResize);
+ }
+ },
+
+ resize: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
+
+ var delta = {
+ height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
+ top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
+ },
+
+ _alsoResize = function(exp, c) {
+ $(exp).each(function() {
+ var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left'];
+
+ $.each(css || ['width', 'height', 'top', 'left'], function(i, prop) {
+ var sum = (start[prop]||0) + (delta[prop]||0);
+ if (sum && sum >= 0)
+ style[prop] = sum || null;
+ });
+
+ //Opera fixing relative position
+ if (/relative/.test(el.css('position')) && $.browser.opera) {
+ self._revertToRelativePosition = true;
+ el.css({ position: 'absolute', top: 'auto', left: 'auto' });
+ }
+
+ el.css(style);
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
+ $.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); });
+ }else{
+ _alsoResize(o.alsoResize);
+ }
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable");
+
+ //Opera fixing relative position
+ if (self._revertToRelativePosition && $.browser.opera) {
+ self._revertToRelativePosition = false;
+ el.css({ position: 'relative' });
+ }
+
+ $(this).removeData("resizable-alsoresize-start");
+ }
+});
+
+$.ui.plugin.add("resizable", "animate", {
+
+ stop: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options;
+
+ var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ self.element.animate(
+ $.extend(style, top && left ? { top: top, left: left } : {}), {
+ duration: o.animateDuration,
+ easing: o.animateEasing,
+ step: function() {
+
+ var data = {
+ width: parseInt(self.element.css('width'), 10),
+ height: parseInt(self.element.css('height'), 10),
+ top: parseInt(self.element.css('top'), 10),
+ left: parseInt(self.element.css('left'), 10)
+ };
+
+ if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
+
+ // propagating resize, and updating values for each animation step
+ self._updateCache(data);
+ self._propagate("resize", event);
+
+ }
+ }
+ );
+ }
+
+});
+
+$.ui.plugin.add("resizable", "containment", {
+
+ start: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, el = self.element;
+ var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
+ if (!ce) return;
+
+ self.containerElement = $(ce);
+
+ if (/document/.test(oc) || oc == document) {
+ self.containerOffset = { left: 0, top: 0 };
+ self.containerPosition = { left: 0, top: 0 };
+
+ self.parentData = {
+ element: $(document), left: 0, top: 0,
+ width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
+ };
+ }
+
+ // i'm a node, so compute top, left, right, bottom
+ else {
+ var element = $(ce), p = [];
+ $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
+
+ self.containerOffset = element.offset();
+ self.containerPosition = element.position();
+ self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
+
+ var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width,
+ width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
+
+ self.parentData = {
+ element: ce, left: co.left, top: co.top, width: width, height: height
+ };
+ }
+ },
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options,
+ ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
+ pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
+
+ if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
+
+ if (cp.left < (self._helper ? co.left : 0)) {
+ self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
+ if (pRatio) self.size.height = self.size.width / o.aspectRatio;
+ self.position.left = o.helper ? co.left : 0;
+ }
+
+ if (cp.top < (self._helper ? co.top : 0)) {
+ self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
+ if (pRatio) self.size.width = self.size.height * o.aspectRatio;
+ self.position.top = self._helper ? co.top : 0;
+ }
+
+ self.offset.left = self.parentData.left+self.position.left;
+ self.offset.top = self.parentData.top+self.position.top;
+
+ var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
+ hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
+
+ var isParent = self.containerElement.get(0) == self.element.parent().get(0),
+ isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
+
+ if(isParent && isOffsetRelative) woset -= self.parentData.left;
+
+ if (woset + self.size.width >= self.parentData.width) {
+ self.size.width = self.parentData.width - woset;
+ if (pRatio) self.size.height = self.size.width / self.aspectRatio;
+ }
+
+ if (hoset + self.size.height >= self.parentData.height) {
+ self.size.height = self.parentData.height - hoset;
+ if (pRatio) self.size.width = self.size.height * self.aspectRatio;
+ }
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options, cp = self.position,
+ co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
+
+ var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
+
+ if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ if (self._helper && !o.animate && (/static/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ }
+});
+
+$.ui.plugin.add("resizable", "ghost", {
+
+ start: function(event, ui) {
+
+ var self = $(this).data("resizable"), o = self.options, cs = self.size;
+
+ self.ghost = self.originalElement.clone();
+ self.ghost
+ .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
+ .addClass('ui-resizable-ghost')
+ .addClass(typeof o.ghost == 'string' ? o.ghost : '');
+
+ self.ghost.appendTo(self.helper);
+
+ },
+
+ resize: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
+ }
+
+});
+
+$.ui.plugin.add("resizable", "grid", {
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
+ o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
+ var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
+
+ if (/^(se|s|e)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ }
+ else if (/^(ne)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ }
+ else if (/^(sw)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.left = op.left - ox;
+ }
+ else {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ self.position.left = op.left - ox;
+ }
+ }
+
+});
+
+var num = function(v) {
+ return parseInt(v, 10) || 0;
+};
+
+var isNumber = function(value) {
+ return !isNaN(parseInt(value, 10));
+};
+
+})(jQuery);
+/*
+ * jQuery UI Selectable 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.selectable", $.ui.mouse, {
+ options: {
+ appendTo: 'body',
+ autoRefresh: true,
+ distance: 0,
+ filter: '*',
+ tolerance: 'touch'
+ },
+ _create: function() {
+ var self = this;
+
+ this.element.addClass("ui-selectable");
+
+ this.dragged = false;
+
+ // cache selectee children based on filter
+ var selectees;
+ this.refresh = function() {
+ selectees = $(self.options.filter, self.element[0]);
+ selectees.each(function() {
+ var $this = $(this);
+ var pos = $this.offset();
+ $.data(this, "selectable-item", {
+ element: this,
+ $element: $this,
+ left: pos.left,
+ top: pos.top,
+ right: pos.left + $this.outerWidth(),
+ bottom: pos.top + $this.outerHeight(),
+ startselected: false,
+ selected: $this.hasClass('ui-selected'),
+ selecting: $this.hasClass('ui-selecting'),
+ unselecting: $this.hasClass('ui-unselecting')
+ });
+ });
+ };
+ this.refresh();
+
+ this.selectees = selectees.addClass("ui-selectee");
+
+ this._mouseInit();
+
+ this.helper = $(document.createElement('div'))
+ .css({border:'1px dotted black'})
+ .addClass("ui-selectable-helper");
+ },
+
+ destroy: function() {
+ this.selectees
+ .removeClass("ui-selectee")
+ .removeData("selectable-item");
+ this.element
+ .removeClass("ui-selectable ui-selectable-disabled")
+ .removeData("selectable")
+ .unbind(".selectable");
+ this._mouseDestroy();
+
+ return this;
+ },
+
+ _mouseStart: function(event) {
+ var self = this;
+
+ this.opos = [event.pageX, event.pageY];
+
+ if (this.options.disabled)
+ return;
+
+ var options = this.options;
+
+ this.selectees = $(options.filter, this.element[0]);
+
+ this._trigger("start", event);
+
+ $(options.appendTo).append(this.helper);
+ // position helper (lasso)
+ this.helper.css({
+ "z-index": 100,
+ "position": "absolute",
+ "left": event.clientX,
+ "top": event.clientY,
+ "width": 0,
+ "height": 0
+ });
+
+ if (options.autoRefresh) {
+ this.refresh();
+ }
+
+ this.selectees.filter('.ui-selected').each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.startselected = true;
+ if (!event.metaKey) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ });
+
+ $(event.target).parents().andSelf().each(function() {
+ var selectee = $.data(this, "selectable-item");
+ if (selectee) {
+ selectee.$element.removeClass("ui-unselecting").addClass('ui-selecting');
+ selectee.unselecting = false;
+ selectee.selecting = true;
+ selectee.selected = true;
+ // selectable SELECTING callback
+ self._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ return false;
+ }
+ });
+
+ },
+
+ _mouseDrag: function(event) {
+ var self = this;
+ this.dragged = true;
+
+ if (this.options.disabled)
+ return;
+
+ var options = this.options;
+
+ var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY;
+ if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; }
+ if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; }
+ this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
+
+ this.selectees.each(function() {
+ var selectee = $.data(this, "selectable-item");
+ //prevent helper from being selected if appendTo: selectable
+ if (!selectee || selectee.element == self.element[0])
+ return;
+ var hit = false;
+ if (options.tolerance == 'touch') {
+ hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
+ } else if (options.tolerance == 'fit') {
+ hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
+ }
+
+ if (hit) {
+ // SELECT
+ if (selectee.selected) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+ }
+ if (selectee.unselecting) {
+ selectee.$element.removeClass('ui-unselecting');
+ selectee.unselecting = false;
+ }
+ if (!selectee.selecting) {
+ selectee.$element.addClass('ui-selecting');
+ selectee.selecting = true;
+ // selectable SELECTING callback
+ self._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ }
+ } else {
+ // UNSELECT
+ if (selectee.selecting) {
+ if (event.metaKey && selectee.startselected) {
+ selectee.$element.removeClass('ui-selecting');
+ selectee.selecting = false;
+ selectee.$element.addClass('ui-selected');
+ selectee.selected = true;
+ } else {
+ selectee.$element.removeClass('ui-selecting');
+ selectee.selecting = false;
+ if (selectee.startselected) {
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ }
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ if (selectee.selected) {
+ if (!event.metaKey && !selectee.startselected) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ }
+ });
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+ var self = this;
+
+ this.dragged = false;
+
+ var options = this.options;
+
+ $('.ui-unselecting', this.element[0]).each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass('ui-unselecting');
+ selectee.unselecting = false;
+ selectee.startselected = false;
+ self._trigger("unselected", event, {
+ unselected: selectee.element
+ });
+ });
+ $('.ui-selecting', this.element[0]).each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass('ui-selecting').addClass('ui-selected');
+ selectee.selecting = false;
+ selectee.selected = true;
+ selectee.startselected = true;
+ self._trigger("selected", event, {
+ selected: selectee.element
+ });
+ });
+ this._trigger("stop", event);
+
+ this.helper.remove();
+
+ return false;
+ }
+
+});
+
+$.extend($.ui.selectable, {
+ version: "1.8"
+});
+
+})(jQuery);
+/*
+ * jQuery UI Sortable 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Sortables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.sortable", $.ui.mouse, {
+ widgetEventPrefix: "sort",
+ options: {
+ appendTo: "parent",
+ axis: false,
+ connectWith: false,
+ containment: false,
+ cursor: 'auto',
+ cursorAt: false,
+ dropOnEmpty: true,
+ forcePlaceholderSize: false,
+ forceHelperSize: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ items: '> *',
+ opacity: false,
+ placeholder: false,
+ revert: false,
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ scope: "default",
+ tolerance: "intersect",
+ zIndex: 1000
+ },
+ _create: function() {
+
+ var o = this.options;
+ this.containerCache = {};
+ this.element.addClass("ui-sortable");
+
+ //Get the items
+ this.refresh();
+
+ //Let's determine if the items are floating
+ this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) : false;
+
+ //Let's determine the parent's offset
+ this.offset = this.element.offset();
+
+ //Initialize mouse events for interaction
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass("ui-sortable ui-sortable-disabled")
+ .removeData("sortable")
+ .unbind(".sortable");
+ this._mouseDestroy();
+
+ for ( var i = this.items.length - 1; i >= 0; i-- )
+ this.items[i].item.removeData("sortable-item");
+
+ return this;
+ },
+
+ _mouseCapture: function(event, overrideHandle) {
+
+ if (this.reverting) {
+ return false;
+ }
+
+ if(this.options.disabled || this.options.type == 'static') return false;
+
+ //We have to refresh the items data once first
+ this._refreshItems(event);
+
+ //Find out if the clicked node (or one of its parents) is a actual item in this.items
+ var currentItem = null, self = this, nodes = $(event.target).parents().each(function() {
+ if($.data(this, 'sortable-item') == self) {
+ currentItem = $(this);
+ return false;
+ }
+ });
+ if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target);
+
+ if(!currentItem) return false;
+ if(this.options.handle && !overrideHandle) {
+ var validHandle = false;
+
+ $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; });
+ if(!validHandle) return false;
+ }
+
+ this.currentItem = currentItem;
+ this._removeCurrentsFromItems();
+ return true;
+
+ },
+
+ _mouseStart: function(event, overrideHandle, noActivation) {
+
+ var o = this.options, self = this;
+ this.currentContainer = this;
+
+ //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
+ this.refreshPositions();
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Get the next scrolling parent
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.currentItem.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ // Only after we got the offset, we can change the helper's position to absolute
+ // TODO: Still need to figure out a way to make relative sorting possible
+ this.helper.css("position", "absolute");
+ this.cssPosition = this.helper.css("position");
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ //Generate the original position
+ this.originalPosition = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+ (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+ //Cache the former DOM position
+ this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
+
+ //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
+ if(this.helper[0] != this.currentItem[0]) {
+ this.currentItem.hide();
+ }
+
+ //Create the placeholder
+ this._createPlaceholder();
+
+ //Set a containment if given in the options
+ if(o.containment)
+ this._setContainment();
+
+ if(o.cursor) { // cursor option
+ if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor");
+ $('body').css("cursor", o.cursor);
+ }
+
+ if(o.opacity) { // opacity option
+ if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity");
+ this.helper.css("opacity", o.opacity);
+ }
+
+ if(o.zIndex) { // zIndex option
+ if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex");
+ this.helper.css("zIndex", o.zIndex);
+ }
+
+ //Prepare scrolling
+ if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML')
+ this.overflowOffset = this.scrollParent.offset();
+
+ //Call callbacks
+ this._trigger("start", event, this._uiHash());
+
+ //Recache the helper size
+ if(!this._preserveHelperProportions)
+ this._cacheHelperProportions();
+
+
+ //Post 'activate' events to possible containers
+ if(!noActivation) {
+ for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); }
+ }
+
+ //Prepare possible droppables
+ if($.ui.ddmanager)
+ $.ui.ddmanager.current = this;
+
+ if ($.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+
+ this.dragging = true;
+
+ this.helper.addClass("ui-sortable-helper");
+ this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+ return true;
+
+ },
+
+ _mouseDrag: function(event) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ if (!this.lastPositionAbs) {
+ this.lastPositionAbs = this.positionAbs;
+ }
+
+ //Do scrolling
+ if(this.options.scroll) {
+ var o = this.options, scrolled = false;
+ if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') {
+
+ if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
+ else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity)
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
+
+ if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
+ else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity)
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
+
+ } else {
+
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+ }
+
+ //Regenerate the absolute position used for position checks
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Set the helper position
+ if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+ if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+
+ //Rearrange
+ for (var i = this.items.length - 1; i >= 0; i--) {
+
+ //Cache variables and intersection, continue if no intersection
+ var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item);
+ if (!intersection) continue;
+
+ if(itemElement != this.currentItem[0] //cannot intersect with itself
+ && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
+ && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
+ && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
+ //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container
+ ) {
+
+ this.direction = intersection == 1 ? "down" : "up";
+
+ if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) {
+ this._rearrange(event, item);
+ } else {
+ break;
+ }
+
+ this._trigger("change", event, this._uiHash());
+ break;
+ }
+ }
+
+ //Post events to containers
+ this._contactContainers(event);
+
+ //Interconnect with droppables
+ if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+ //Call callbacks
+ this._trigger('sort', event, this._uiHash());
+
+ this.lastPositionAbs = this.positionAbs;
+ return false;
+
+ },
+
+ _mouseStop: function(event, noPropagation) {
+
+ if(!event) return;
+
+ //If we are using droppables, inform the manager about the drop
+ if ($.ui.ddmanager && !this.options.dropBehaviour)
+ $.ui.ddmanager.drop(this, event);
+
+ if(this.options.revert) {
+ var self = this;
+ var cur = self.placeholder.offset();
+
+ self.reverting = true;
+
+ $(this.helper).animate({
+ left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
+ top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
+ }, parseInt(this.options.revert, 10) || 500, function() {
+ self._clear(event);
+ });
+ } else {
+ this._clear(event, noPropagation);
+ }
+
+ return false;
+
+ },
+
+ cancel: function() {
+
+ var self = this;
+
+ if(this.dragging) {
+
+ this._mouseUp();
+
+ if(this.options.helper == "original")
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+ else
+ this.currentItem.show();
+
+ //Post deactivating events to containers
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ this.containers[i]._trigger("deactivate", null, self._uiHash(this));
+ if(this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", null, self._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ }
+
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+ if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove();
+
+ $.extend(this, {
+ helper: null,
+ dragging: false,
+ reverting: false,
+ _noFinalSort: null
+ });
+
+ if(this.domPosition.prev) {
+ $(this.domPosition.prev).after(this.currentItem);
+ } else {
+ $(this.domPosition.parent).prepend(this.currentItem);
+ }
+
+ return this;
+
+ },
+
+ serialize: function(o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected);
+ var str = []; o = o || {};
+
+ $(items).each(function() {
+ var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/));
+ if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2]));
+ });
+
+ return str.join('&');
+
+ },
+
+ toArray: function(o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected);
+ var ret = []; o = o || {};
+
+ items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); });
+ return ret;
+
+ },
+
+ /* Be careful with the following core functions */
+ _intersectsWith: function(item) {
+
+ var x1 = this.positionAbs.left,
+ x2 = x1 + this.helperProportions.width,
+ y1 = this.positionAbs.top,
+ y2 = y1 + this.helperProportions.height;
+
+ var l = item.left,
+ r = l + item.width,
+ t = item.top,
+ b = t + item.height;
+
+ var dyClick = this.offset.click.top,
+ dxClick = this.offset.click.left;
+
+ var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;
+
+ if( this.options.tolerance == "pointer"
+ || this.options.forcePointerForContainers
+ || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])
+ ) {
+ return isOverElement;
+ } else {
+
+ return (l < x1 + (this.helperProportions.width / 2) // Right Half
+ && x2 - (this.helperProportions.width / 2) < r // Left Half
+ && t < y1 + (this.helperProportions.height / 2) // Bottom Half
+ && y2 - (this.helperProportions.height / 2) < b ); // Top Half
+
+ }
+ },
+
+ _intersectsWithPointer: function(item) {
+
+ var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
+ isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
+ isOverElement = isOverElementHeight && isOverElementWidth,
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (!isOverElement)
+ return false;
+
+ return this.floating ?
+ ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 )
+ : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) );
+
+ },
+
+ _intersectsWithSides: function(item) {
+
+ var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
+ isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (this.floating && horizontalDirection) {
+ return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf));
+ } else {
+ return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf));
+ }
+
+ },
+
+ _getDragVerticalDirection: function() {
+ var delta = this.positionAbs.top - this.lastPositionAbs.top;
+ return delta != 0 && (delta > 0 ? "down" : "up");
+ },
+
+ _getDragHorizontalDirection: function() {
+ var delta = this.positionAbs.left - this.lastPositionAbs.left;
+ return delta != 0 && (delta > 0 ? "right" : "left");
+ },
+
+ refresh: function(event) {
+ this._refreshItems(event);
+ this.refreshPositions();
+ return this;
+ },
+
+ _connectWith: function() {
+ var options = this.options;
+ return options.connectWith.constructor == String
+ ? [options.connectWith]
+ : options.connectWith;
+ },
+
+ _getItemsAsjQuery: function(connected) {
+
+ var self = this;
+ var items = [];
+ var queries = [];
+ var connectWith = this._connectWith();
+
+ if(connectWith && connected) {
+ for (var i = connectWith.length - 1; i >= 0; i--){
+ var cur = $(connectWith[i]);
+ for (var j = cur.length - 1; j >= 0; j--){
+ var inst = $.data(cur[j], 'sortable');
+ if(inst && inst != this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]);
+ }
+ };
+ };
+ }
+
+ queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]);
+
+ for (var i = queries.length - 1; i >= 0; i--){
+ queries[i][0].each(function() {
+ items.push(this);
+ });
+ };
+
+ return $(items);
+
+ },
+
+ _removeCurrentsFromItems: function() {
+
+ var list = this.currentItem.find(":data(sortable-item)");
+
+ for (var i=0; i < this.items.length; i++) {
+
+ for (var j=0; j < list.length; j++) {
+ if(list[j] == this.items[i].item[0])
+ this.items.splice(i,1);
+ };
+
+ };
+
+ },
+
+ _refreshItems: function(event) {
+
+ this.items = [];
+ this.containers = [this];
+ var items = this.items;
+ var self = this;
+ var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]];
+ var connectWith = this._connectWith();
+
+ if(connectWith) {
+ for (var i = connectWith.length - 1; i >= 0; i--){
+ var cur = $(connectWith[i]);
+ for (var j = cur.length - 1; j >= 0; j--){
+ var inst = $.data(cur[j], 'sortable');
+ if(inst && inst != this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
+ this.containers.push(inst);
+ }
+ };
+ };
+ }
+
+ for (var i = queries.length - 1; i >= 0; i--) {
+ var targetData = queries[i][1];
+ var _queries = queries[i][0];
+
+ for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) {
+ var item = $(_queries[j]);
+
+ item.data('sortable-item', targetData); // Data for target checking (mouse manager)
+
+ items.push({
+ item: item,
+ instance: targetData,
+ width: 0, height: 0,
+ left: 0, top: 0
+ });
+ };
+ };
+
+ },
+
+ refreshPositions: function(fast) {
+
+ //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
+ if(this.offsetParent && this.helper) {
+ this.offset.parent = this._getParentOffset();
+ }
+
+ for (var i = this.items.length - 1; i >= 0; i--){
+ var item = this.items[i];
+
+ var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
+
+ if (!fast) {
+ item.width = t.outerWidth();
+ item.height = t.outerHeight();
+ }
+
+ var p = t.offset();
+ item.left = p.left;
+ item.top = p.top;
+ };
+
+ if(this.options.custom && this.options.custom.refreshContainers) {
+ this.options.custom.refreshContainers.call(this);
+ } else {
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ var p = this.containers[i].element.offset();
+ this.containers[i].containerCache.left = p.left;
+ this.containers[i].containerCache.top = p.top;
+ this.containers[i].containerCache.width = this.containers[i].element.outerWidth();
+ this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
+ };
+ }
+
+ return this;
+ },
+
+ _createPlaceholder: function(that) {
+
+ var self = that || this, o = self.options;
+
+ if(!o.placeholder || o.placeholder.constructor == String) {
+ var className = o.placeholder;
+ o.placeholder = {
+ element: function() {
+
+ var el = $(document.createElement(self.currentItem[0].nodeName))
+ .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder")
+ .removeClass("ui-sortable-helper")[0];
+
+ if(!className)
+ el.style.visibility = "hidden";
+
+ return el;
+ },
+ update: function(container, p) {
+
+ // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
+ // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
+ if(className && !o.forcePlaceholderSize) return;
+
+ //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
+ if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); };
+ if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); };
+ }
+ };
+ }
+
+ //Create the placeholder
+ self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem));
+
+ //Append it after the actual current item
+ self.currentItem.after(self.placeholder);
+
+ //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
+ o.placeholder.update(self, self.placeholder);
+
+ },
+
+ _contactContainers: function(event) {
+
+ // get innermost container that intersects with item
+ var innermostContainer = null, innermostIndex = null;
+
+
+ for (var i = this.containers.length - 1; i >= 0; i--){
+
+ // never consider a container that's located within the item itself
+ if($.ui.contains(this.currentItem[0], this.containers[i].element[0]))
+ continue;
+
+ if(this._intersectsWith(this.containers[i].containerCache)) {
+
+ // if we've already found a container and it's more "inner" than this, then continue
+ if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0]))
+ continue;
+
+ innermostContainer = this.containers[i];
+ innermostIndex = i;
+
+ } else {
+ // container doesn't intersect. trigger "out" event if necessary
+ if(this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", event, this._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ }
+
+ // if no intersecting containers found, return
+ if(!innermostContainer) return;
+
+ // move the item into the container if it's not there already
+ if(this.containers.length === 1) {
+ this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+ this.containers[innermostIndex].containerCache.over = 1;
+ } else if(this.currentContainer != this.containers[innermostIndex]) {
+
+ //When entering a new container, we will find the item with the least distance and append our item near it
+ var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top'];
+ for (var j = this.items.length - 1; j >= 0; j--) {
+ if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue;
+ var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top'];
+ if(Math.abs(cur - base) < dist) {
+ dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
+ }
+ }
+
+ if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled
+ return;
+
+ this.currentContainer = this.containers[innermostIndex];
+ itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true);
+ this._trigger("change", event, this._uiHash());
+ this.containers[innermostIndex]._trigger("change", event, this._uiHash(this));
+
+ //Update the placeholder
+ this.options.placeholder.update(this.currentContainer, this.placeholder);
+
+ this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+ this.containers[innermostIndex].containerCache.over = 1;
+ }
+
+
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options;
+ var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem);
+
+ if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already
+ $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
+
+ if(helper[0] == this.currentItem[0])
+ this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };
+
+ if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width());
+ if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height());
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if (typeof obj == 'string') {
+ obj = obj.split(' ');
+ }
+ if ($.isArray(obj)) {
+ obj = {left: +obj[0], top: +obj[1] || 0};
+ }
+ if ('left' in obj) {
+ this.offset.click.left = obj.left + this.margins.left;
+ }
+ if ('right' in obj) {
+ this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ }
+ if ('top' in obj) {
+ this.offset.click.top = obj.top + this.margins.top;
+ }
+ if ('bottom' in obj) {
+ this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ }
+ },
+
+ _getParentOffset: function() {
+
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ po = { top: 0, left: 0 };
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition == "relative") {
+ var p = this.currentItem.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.currentItem.css("marginLeft"),10) || 0),
+ top: (parseInt(this.currentItem.css("marginTop"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var o = this.options;
+ if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+ if(o.containment == 'document' || o.containment == 'window') this.containment = [
+ 0 - this.offset.relative.left - this.offset.parent.left,
+ 0 - this.offset.relative.top - this.offset.parent.top,
+ $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+ ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+
+ if(!(/^(document|window|parent)$/).test(o.containment)) {
+ var ce = $(o.containment)[0];
+ var co = $(o.containment).offset();
+ var over = ($(ce).css("overflow") != 'hidden');
+
+ this.containment = [
+ co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+ co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+ co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+ co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+ ];
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) pos = this.position;
+ var mod = d == "absolute" ? 1 : -1;
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top // The absolute mouse position
+ + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ ),
+ left: (
+ pos.left // The absolute mouse position
+ + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ // This is another very weird special case that only happens for relative elements:
+ // 1. If the css position is relative
+ // 2. and the scroll parent is the document or similar to the offset parent
+ // we have to refresh the relative offset during the scroll so there are no jumps
+ if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
+ this.offset.relative = this._getRelativeOffset();
+ }
+
+ var pageX = event.pageX;
+ var pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+ if(this.containment) {
+ if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+ if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+ }
+
+ if(o.grid) {
+ var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+ pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+ pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY // The absolute mouse position
+ - this.offset.click.top // Click offset (relative to the element)
+ - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ ),
+ left: (
+ pageX // The absolute mouse position
+ - this.offset.click.left // Click offset (relative to the element)
+ - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ )
+ };
+
+ },
+
+ _rearrange: function(event, i, a, hardRefresh) {
+
+ a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling));
+
+ //Various things done here to improve the performance:
+ // 1. we create a setTimeout, that calls refreshPositions
+ // 2. on the instance, we have a counter variable, that get's higher after every append
+ // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
+ // 4. this lets only the last addition to the timeout stack through
+ this.counter = this.counter ? ++this.counter : 1;
+ var self = this, counter = this.counter;
+
+ window.setTimeout(function() {
+ if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
+ },0);
+
+ },
+
+ _clear: function(event, noPropagation) {
+
+ this.reverting = false;
+ // We delay all events that have to be triggered to after the point where the placeholder has been removed and
+ // everything else normalized again
+ var delayedTriggers = [], self = this;
+
+ // We first have to update the dom position of the actual currentItem
+ // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
+ if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem);
+ this._noFinalSort = null;
+
+ if(this.helper[0] == this.currentItem[0]) {
+ for(var i in this._storedCSS) {
+ if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = '';
+ }
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+ } else {
+ this.currentItem.show();
+ }
+
+ if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
+ if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
+ if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element
+ if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) {
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ }
+ };
+ };
+
+ //Post events to containers
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ if(this.containers[i].containerCache.over) {
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ //Do what was originally in plugins
+ if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor
+ if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity
+ if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index
+
+ this.dragging = false;
+ if(this.cancelHelperRemoval) {
+ if(!noPropagation) {
+ this._trigger("beforeStop", event, this._uiHash());
+ for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+ return false;
+ }
+
+ if(!noPropagation) this._trigger("beforeStop", event, this._uiHash());
+
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+
+ if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null;
+
+ if(!noPropagation) {
+ for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+
+ this.fromOutside = false;
+ return true;
+
+ },
+
+ _trigger: function() {
+ if ($.Widget.prototype._trigger.apply(this, arguments) === false) {
+ this.cancel();
+ }
+ },
+
+ _uiHash: function(inst) {
+ var self = inst || this;
+ return {
+ helper: self.helper,
+ placeholder: self.placeholder || $([]),
+ position: self.position,
+ originalPosition: self.originalPosition,
+ offset: self.positionAbs,
+ item: self.currentItem,
+ sender: inst ? inst.element : null
+ };
+ }
+
+});
+
+$.extend($.ui.sortable, {
+ version: "1.8"
+});
+
+})(jQuery);
+/*
+ * jQuery UI Accordion 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.accordion", {
+ options: {
+ active: 0,
+ animated: 'slide',
+ autoHeight: true,
+ clearStyle: false,
+ collapsible: false,
+ event: "click",
+ fillSpace: false,
+ header: "> li > :first-child,> :not(li):even",
+ icons: {
+ header: "ui-icon-triangle-1-e",
+ headerSelected: "ui-icon-triangle-1-s"
+ },
+ navigation: false,
+ navigationFilter: function() {
+ return this.href.toLowerCase() == location.href.toLowerCase();
+ }
+ },
+ _create: function() {
+
+ var o = this.options, self = this;
+ this.running = 0;
+
+ this.element.addClass("ui-accordion ui-widget ui-helper-reset");
+
+ // in lack of child-selectors in CSS we need to mark top-LIs in a UL-accordion for some IE-fix
+ if (this.element[0].nodeName == "UL") {
+ this.element.children("li").addClass("ui-accordion-li-fix");
+ }
+
+ this.headers = this.element.find(o.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all")
+ .bind("mouseenter.accordion", function(){ $(this).addClass('ui-state-hover'); })
+ .bind("mouseleave.accordion", function(){ $(this).removeClass('ui-state-hover'); })
+ .bind("focus.accordion", function(){ $(this).addClass('ui-state-focus'); })
+ .bind("blur.accordion", function(){ $(this).removeClass('ui-state-focus'); });
+
+ this.headers
+ .next()
+ .addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
+
+ if ( o.navigation ) {
+ var current = this.element.find("a").filter(o.navigationFilter);
+ if ( current.length ) {
+ var header = current.closest(".ui-accordion-header");
+ if ( header.length ) {
+ // anchor within header
+ this.active = header;
+ } else {
+ // anchor within content
+ this.active = current.closest(".ui-accordion-content").prev();
+ }
+ }
+ }
+
+ this.active = this._findActive(this.active || o.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");
+ this.active.next().addClass('ui-accordion-content-active');
+
+ //Append icon elements
+ this._createIcons();
+
+ // IE7-/Win - Extra vertical space in lists fixed
+ if ($.browser.msie) {
+ this.element.find('a').css('zoom', '1');
+ }
+
+ this.resize();
+
+ //ARIA
+ this.element.attr('role','tablist');
+
+ this.headers
+ .attr('role','tab')
+ .bind('keydown', function(event) { return self._keydown(event); })
+ .next()
+ .attr('role','tabpanel');
+
+ this.headers
+ .not(this.active || "")
+ .attr('aria-expanded','false')
+ .attr("tabIndex", "-1")
+ .next()
+ .hide();
+
+ // make sure at least one header is in the tab order
+ if (!this.active.length) {
+ this.headers.eq(0).attr('tabIndex','0');
+ } else {
+ this.active
+ .attr('aria-expanded','true')
+ .attr('tabIndex', '0');
+ }
+
+ // only need links in taborder for Safari
+ if (!$.browser.safari)
+ this.headers.find('a').attr('tabIndex','-1');
+
+ if (o.event) {
+ this.headers.bind((o.event) + ".accordion", function(event) {
+ self._clickHandler.call(self, event, this);
+ event.preventDefault();
+ });
+ }
+
+ },
+
+ _createIcons: function() {
+ var o = this.options;
+ if (o.icons) {
+ $("<span/>").addClass("ui-icon " + o.icons.header).prependTo(this.headers);
+ this.active.find(".ui-icon").toggleClass(o.icons.header).toggleClass(o.icons.headerSelected);
+ this.element.addClass("ui-accordion-icons");
+ }
+ },
+
+ _destroyIcons: function() {
+ this.headers.children(".ui-icon").remove();
+ this.element.removeClass("ui-accordion-icons");
+ },
+
+ destroy: function() {
+ var o = this.options;
+
+ this.element
+ .removeClass("ui-accordion ui-widget ui-helper-reset")
+ .removeAttr("role")
+ .unbind('.accordion')
+ .removeData('accordion');
+
+ this.headers
+ .unbind(".accordion")
+ .removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top")
+ .removeAttr("role").removeAttr("aria-expanded").removeAttr("tabindex");
+
+ this.headers.find("a").removeAttr("tabindex");
+ this._destroyIcons();
+ var contents = this.headers.next().css("display", "").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active");
+ if (o.autoHeight || o.fillHeight) {
+ contents.css("height", "");
+ }
+
+ return this;
+ },
+
+ _setOption: function(key, value) {
+ $.Widget.prototype._setOption.apply(this, arguments);
+
+ if (key == "active") {
+ this.activate(value);
+ }
+ if (key == "icons") {
+ this._destroyIcons();
+ if (value) {
+ this._createIcons();
+ }
+ }
+
+ },
+
+ _keydown: function(event) {
+
+ var o = this.options, keyCode = $.ui.keyCode;
+
+ if (o.disabled || event.altKey || event.ctrlKey)
+ return;
+
+ var length = this.headers.length;
+ var currentIndex = this.headers.index(event.target);
+ var toFocus = false;
+
+ switch(event.keyCode) {
+ case keyCode.RIGHT:
+ case keyCode.DOWN:
+ toFocus = this.headers[(currentIndex + 1) % length];
+ break;
+ case keyCode.LEFT:
+ case keyCode.UP:
+ toFocus = this.headers[(currentIndex - 1 + length) % length];
+ break;
+ case keyCode.SPACE:
+ case keyCode.ENTER:
+ this._clickHandler({ target: event.target }, event.target);
+ event.preventDefault();
+ }
+
+ if (toFocus) {
+ $(event.target).attr('tabIndex','-1');
+ $(toFocus).attr('tabIndex','0');
+ toFocus.focus();
+ return false;
+ }
+
+ return true;
+
+ },
+
+ resize: function() {
+
+ var o = this.options, maxHeight;
+
+ if (o.fillSpace) {
+
+ if($.browser.msie) { var defOverflow = this.element.parent().css('overflow'); this.element.parent().css('overflow', 'hidden'); }
+ maxHeight = this.element.parent().height();
+ if($.browser.msie) { this.element.parent().css('overflow', defOverflow); }
+
+ this.headers.each(function() {
+ maxHeight -= $(this).outerHeight(true);
+ });
+
+ this.headers.next().each(function() {
+ $(this).height(Math.max(0, maxHeight - $(this).innerHeight() + $(this).height()));
+ }).css('overflow', 'auto');
+
+ } else if ( o.autoHeight ) {
+ maxHeight = 0;
+ this.headers.next().each(function() {
+ maxHeight = Math.max(maxHeight, $(this).height());
+ }).height(maxHeight);
+ }
+
+ return this;
+ },
+
+ activate: function(index) {
+ // TODO this gets called on init, changing the option without an explicit call for that
+ this.options.active = index;
+ // call clickHandler with custom event
+ var active = this._findActive(index)[0];
+ this._clickHandler({ target: active }, active);
+
+ return this;
+ },
+
+ _findActive: function(selector) {
+ return selector
+ ? typeof selector == "number"
+ ? this.headers.filter(":eq(" + selector + ")")
+ : this.headers.not(this.headers.not(selector))
+ : selector === false
+ ? $([])
+ : this.headers.filter(":eq(0)");
+ },
+
+ // TODO isn't event.target enough? why the seperate target argument?
+ _clickHandler: function(event, target) {
+
+ var o = this.options;
+ if (o.disabled)
+ return;
+
+ // called only when using activate(false) to close all parts programmatically
+ if (!event.target) {
+ if (!o.collapsible)
+ return;
+ this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
+ .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
+ this.active.next().addClass('ui-accordion-content-active');
+ var toHide = this.active.next(),
+ data = {
+ options: o,
+ newHeader: $([]),
+ oldHeader: o.active,
+ newContent: $([]),
+ oldContent: toHide
+ },
+ toShow = (this.active = $([]));
+ this._toggle(toShow, toHide, data);
+ return;
+ }
+
+ // get the click target
+ var clicked = $(event.currentTarget || target);
+ var clickedIsActive = clicked[0] == this.active[0];
+
+ // TODO the option is changed, is that correct?
+ // TODO if it is correct, shouldn't that happen after determining that the click is valid?
+ o.active = o.collapsible && clickedIsActive ? false : $('.ui-accordion-header', this.element).index(clicked);
+
+ // if animations are still active, or the active header is the target, ignore click
+ if (this.running || (!o.collapsible && clickedIsActive)) {
+ return;
+ }
+
+ // switch classes
+ this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
+ .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
+ if (!clickedIsActive) {
+ clicked.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top")
+ .find(".ui-icon").removeClass(o.icons.header).addClass(o.icons.headerSelected);
+ clicked.next().addClass('ui-accordion-content-active');
+ }
+
+ // find elements to show and hide
+ var toShow = clicked.next(),
+ toHide = this.active.next(),
+ data = {
+ options: o,
+ newHeader: clickedIsActive && o.collapsible ? $([]) : clicked,
+ oldHeader: this.active,
+ newContent: clickedIsActive && o.collapsible ? $([]) : toShow,
+ oldContent: toHide
+ },
+ down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
+
+ this.active = clickedIsActive ? $([]) : clicked;
+ this._toggle(toShow, toHide, data, clickedIsActive, down);
+
+ return;
+
+ },
+
+ _toggle: function(toShow, toHide, data, clickedIsActive, down) {
+
+ var o = this.options, self = this;
+
+ this.toShow = toShow;
+ this.toHide = toHide;
+ this.data = data;
+
+ var complete = function() { if(!self) return; return self._completed.apply(self, arguments); };
+
+ // trigger changestart event
+ this._trigger("changestart", null, this.data);
+
+ // count elements to animate
+ this.running = toHide.size() === 0 ? toShow.size() : toHide.size();
+
+ if (o.animated) {
+
+ var animOptions = {};
+
+ if ( o.collapsible && clickedIsActive ) {
+ animOptions = {
+ toShow: $([]),
+ toHide: toHide,
+ complete: complete,
+ down: down,
+ autoHeight: o.autoHeight || o.fillSpace
+ };
+ } else {
+ animOptions = {
+ toShow: toShow,
+ toHide: toHide,
+ complete: complete,
+ down: down,
+ autoHeight: o.autoHeight || o.fillSpace
+ };
+ }
+
+ if (!o.proxied) {
+ o.proxied = o.animated;
+ }
+
+ if (!o.proxiedDuration) {
+ o.proxiedDuration = o.duration;
+ }
+
+ o.animated = $.isFunction(o.proxied) ?
+ o.proxied(animOptions) : o.proxied;
+
+ o.duration = $.isFunction(o.proxiedDuration) ?
+ o.proxiedDuration(animOptions) : o.proxiedDuration;
+
+ var animations = $.ui.accordion.animations,
+ duration = o.duration,
+ easing = o.animated;
+
+ if (easing && !animations[easing] && !$.easing[easing]) {
+ easing = 'slide';
+ }
+ if (!animations[easing]) {
+ animations[easing] = function(options) {
+ this.slide(options, {
+ easing: easing,
+ duration: duration || 700
+ });
+ };
+ }
+
+ animations[easing](animOptions);
+
+ } else {
+
+ if (o.collapsible && clickedIsActive) {
+ toShow.toggle();
+ } else {
+ toHide.hide();
+ toShow.show();
+ }
+
+ complete(true);
+
+ }
+
+ // TODO assert that the blur and focus triggers are really necessary, remove otherwise
+ toHide.prev().attr('aria-expanded','false').attr("tabIndex", "-1").blur();
+ toShow.prev().attr('aria-expanded','true').attr("tabIndex", "0").focus();
+
+ },
+
+ _completed: function(cancel) {
+
+ var o = this.options;
+
+ this.running = cancel ? 0 : --this.running;
+ if (this.running) return;
+
+ if (o.clearStyle) {
+ this.toShow.add(this.toHide).css({
+ height: "",
+ overflow: ""
+ });
+ }
+
+ // other classes are removed before the animation; this one needs to stay until completed
+ this.toHide.removeClass("ui-accordion-content-active");
+
+ this._trigger('change', null, this.data);
+ }
+
+});
+
+
+$.extend($.ui.accordion, {
+ version: "1.8",
+ animations: {
+ slide: function(options, additions) {
+ options = $.extend({
+ easing: "swing",
+ duration: 300
+ }, options, additions);
+ if ( !options.toHide.size() ) {
+ options.toShow.animate({height: "show"}, options);
+ return;
+ }
+ if ( !options.toShow.size() ) {
+ options.toHide.animate({height: "hide"}, options);
+ return;
+ }
+ var overflow = options.toShow.css('overflow'),
+ percentDone = 0,
+ showProps = {},
+ hideProps = {},
+ fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
+ originalWidth;
+ // fix width before calculating height of hidden element
+ var s = options.toShow;
+ originalWidth = s[0].style.width;
+ s.width( parseInt(s.parent().width(),10) - parseInt(s.css("paddingLeft"),10) - parseInt(s.css("paddingRight"),10) - (parseInt(s.css("borderLeftWidth"),10) || 0) - (parseInt(s.css("borderRightWidth"),10) || 0) );
+
+ $.each(fxAttrs, function(i, prop) {
+ hideProps[prop] = 'hide';
+
+ var parts = ('' + $.css(options.toShow[0], prop)).match(/^([\d+-.]+)(.*)$/);
+ showProps[prop] = {
+ value: parts[1],
+ unit: parts[2] || 'px'
+ };
+ });
+ options.toShow.css({ height: 0, overflow: 'hidden' }).show();
+ options.toHide.filter(":hidden").each(options.complete).end().filter(":visible").animate(hideProps,{
+ step: function(now, settings) {
+ // only calculate the percent when animating height
+ // IE gets very inconsistent results when animating elements
+ // with small values, which is common for padding
+ if (settings.prop == 'height') {
+ percentDone = ( settings.end - settings.start === 0 ) ? 0 :
+ (settings.now - settings.start) / (settings.end - settings.start);
+ }
+
+ options.toShow[0].style[settings.prop] =
+ (percentDone * showProps[settings.prop].value) + showProps[settings.prop].unit;
+ },
+ duration: options.duration,
+ easing: options.easing,
+ complete: function() {
+ if ( !options.autoHeight ) {
+ options.toShow.css("height", "");
+ }
+ options.toShow.css("width", originalWidth);
+ options.toShow.css({overflow: overflow});
+ options.complete();
+ }
+ });
+ },
+ bounceslide: function(options) {
+ this.slide(options, {
+ easing: options.down ? "easeOutBounce" : "swing",
+ duration: options.down ? 1000 : 200
+ });
+ }
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Autocomplete 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.position.js
+ */
+(function( $ ) {
+
+$.widget( "ui.autocomplete", {
+ options: {
+ minLength: 1,
+ delay: 300
+ },
+ _create: function() {
+ var self = this,
+ doc = this.element[ 0 ].ownerDocument;
+ this.element
+ .addClass( "ui-autocomplete-input" )
+ .attr( "autocomplete", "off" )
+ // TODO verify these actually work as intended
+ .attr({
+ role: "textbox",
+ "aria-autocomplete": "list",
+ "aria-haspopup": "true"
+ })
+ .bind( "keydown.autocomplete", function( event ) {
+ var keyCode = $.ui.keyCode;
+ switch( event.keyCode ) {
+ case keyCode.PAGE_UP:
+ self._move( "previousPage", event );
+ break;
+ case keyCode.PAGE_DOWN:
+ self._move( "nextPage", event );
+ break;
+ case keyCode.UP:
+ self._move( "previous", event );
+ // prevent moving cursor to beginning of text field in some browsers
+ event.preventDefault();
+ break;
+ case keyCode.DOWN:
+ self._move( "next", event );
+ // prevent moving cursor to end of text field in some browsers
+ event.preventDefault();
+ break;
+ case keyCode.ENTER:
+ // when menu is open or has focus
+ if ( self.menu.active ) {
+ event.preventDefault();
+ }
+ //passthrough - ENTER and TAB both select the current element
+ case keyCode.TAB:
+ if ( !self.menu.active ) {
+ return;
+ }
+ self.menu.select();
+ break;
+ case keyCode.ESCAPE:
+ self.element.val( self.term );
+ self.close( event );
+ break;
+ case keyCode.SHIFT:
+ case keyCode.CONTROL:
+ case 18:
+ // ignore metakeys (shift, ctrl, alt)
+ break;
+ default:
+ // keypress is triggered before the input value is changed
+ clearTimeout( self.searching );
+ self.searching = setTimeout(function() {
+ self.search( null, event );
+ }, self.options.delay );
+ break;
+ }
+ })
+ .bind( "focus.autocomplete", function() {
+ self.previous = self.element.val();
+ })
+ .bind( "blur.autocomplete", function( event ) {
+ clearTimeout( self.searching );
+ // clicks on the menu (or a button to trigger a search) will cause a blur event
+ // TODO try to implement this without a timeout, see clearTimeout in search()
+ self.closing = setTimeout(function() {
+ self.close( event );
+ }, 150 );
+ });
+ this._initSource();
+ this.response = function() {
+ return self._response.apply( self, arguments );
+ };
+ this.menu = $( "<ul></ul>" )
+ .addClass( "ui-autocomplete" )
+ .appendTo( "body", doc )
+ .menu({
+ focus: function( event, ui ) {
+ var item = ui.item.data( "item.autocomplete" );
+ if ( false !== self._trigger( "focus", null, { item: item } ) ) {
+ // use value to match what will end up in the input
+ self.element.val( item.value );
+ }
+ },
+ selected: function( event, ui ) {
+ var item = ui.item.data( "item.autocomplete" );
+ if ( false !== self._trigger( "select", event, { item: item } ) ) {
+ self.element.val( item.value );
+ }
+ self.close( event );
+ self.previous = self.element.val();
+ // only trigger when focus was lost (click on menu)
+ if ( self.element[0] !== doc.activeElement ) {
+ self.element.focus();
+ }
+ },
+ blur: function( event, ui ) {
+ if ( self.menu.element.is(":visible") ) {
+ self.element.val( self.term );
+ }
+ }
+ })
+ .zIndex( this.element.zIndex() + 1 )
+ // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
+ .css({ top: 0, left: 0 })
+ .hide()
+ .data( "menu" );
+ if ( $.fn.bgiframe ) {
+ this.menu.element.bgiframe();
+ }
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass( "ui-autocomplete-input ui-widget ui-widget-content" )
+ .removeAttr( "autocomplete" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-autocomplete" )
+ .removeAttr( "aria-haspopup" );
+ this.menu.element.remove();
+ $.Widget.prototype.destroy.call( this );
+ },
+
+ _setOption: function( key ) {
+ $.Widget.prototype._setOption.apply( this, arguments );
+ if ( key === "source" ) {
+ this._initSource();
+ }
+ },
+
+ _initSource: function() {
+ var array,
+ url;
+ if ( $.isArray(this.options.source) ) {
+ array = this.options.source;
+ this.source = function( request, response ) {
+ // escape regex characters
+ var matcher = new RegExp( $.ui.autocomplete.escapeRegex(request.term), "i" );
+ response( $.grep( array, function(value) {
+ return matcher.test( value.label || value.value || value );
+ }) );
+ };
+ } else if ( typeof this.options.source === "string" ) {
+ url = this.options.source;
+ this.source = function( request, response ) {
+ $.getJSON( url, request, response );
+ };
+ } else {
+ this.source = this.options.source;
+ }
+ },
+
+ search: function( value, event ) {
+ value = value != null ? value : this.element.val();
+ if ( value.length < this.options.minLength ) {
+ return this.close( event );
+ }
+
+ clearTimeout( this.closing );
+ if ( this._trigger("search") === false ) {
+ return;
+ }
+
+ return this._search( value );
+ },
+
+ _search: function( value ) {
+ this.term = this.element
+ .addClass( "ui-autocomplete-loading" )
+ // always save the actual value, not the one passed as an argument
+ .val();
+
+ this.source( { term: value }, this.response );
+ },
+
+ _response: function( content ) {
+ if ( content.length ) {
+ content = this._normalize( content );
+ this._suggest( content );
+ this._trigger( "open" );
+ } else {
+ this.close();
+ }
+ this.element.removeClass( "ui-autocomplete-loading" );
+ },
+
+ close: function( event ) {
+ clearTimeout( this.closing );
+ if ( this.menu.element.is(":visible") ) {
+ this._trigger( "close", event );
+ this.menu.element.hide();
+ this.menu.deactivate();
+ }
+ if ( this.previous !== this.element.val() ) {
+ this._trigger( "change", event );
+ }
+ },
+
+ _normalize: function( items ) {
+ // assume all items have the right format when the first item is complete
+ if ( items.length && items[0].label && items[0].value ) {
+ return items;
+ }
+ return $.map( items, function(item) {
+ if ( typeof item === "string" ) {
+ return {
+ label: item,
+ value: item
+ };
+ }
+ return $.extend({
+ label: item.label || item.value,
+ value: item.value || item.label
+ }, item );
+ });
+ },
+
+ _suggest: function( items ) {
+ var ul = this.menu.element
+ .empty()
+ .zIndex( this.element.zIndex() + 1 ),
+ menuWidth,
+ textWidth;
+ this._renderMenu( ul, items );
+ // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate
+ this.menu.deactivate();
+ this.menu.refresh();
+ this.menu.element.show().position({
+ my: "left top",
+ at: "left bottom",
+ of: this.element,
+ collision: "none"
+ });
+
+ menuWidth = ul.width( "" ).width();
+ textWidth = this.element.width();
+ ul.width( Math.max( menuWidth, textWidth ) );
+ },
+
+ _renderMenu: function( ul, items ) {
+ var self = this;
+ $.each( items, function( index, item ) {
+ self._renderItem( ul, item );
+ });
+ },
+
+ _renderItem: function( ul, item) {
+ return $( "<li></li>" )
+ .data( "item.autocomplete", item )
+ .append( "<a>" + item.label + "</a>" )
+ .appendTo( ul );
+ },
+
+ _move: function( direction, event ) {
+ if ( !this.menu.element.is(":visible") ) {
+ this.search( null, event );
+ return;
+ }
+ if ( this.menu.first() && /^previous/.test(direction) ||
+ this.menu.last() && /^next/.test(direction) ) {
+ this.element.val( this.term );
+ this.menu.deactivate();
+ return;
+ }
+ this.menu[ direction ]();
+ },
+
+ widget: function() {
+ return this.menu.element;
+ }
+});
+
+$.extend( $.ui.autocomplete, {
+ escapeRegex: function( value ) {
+ return value.replace( /([\^\$\(\)\[\]\{\}\*\.\+\?\|\\])/gi, "\\$1" );
+ }
+});
+
+}( jQuery ));
+
+/*
+ * jQuery UI Menu (not officially released)
+ *
+ * This widget isn't yet finished and the API is subject to change. We plan to finish
+ * it for the next release. You're welcome to give it a try anyway and give us feedback,
+ * as long as you're okay with migrating your code later on. We can help with that, too.
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Menu
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.menu", {
+ _create: function() {
+ var self = this;
+ this.element
+ .addClass("ui-menu ui-widget ui-widget-content ui-corner-all")
+ .attr({
+ role: "listbox",
+ "aria-activedescendant": "ui-active-menuitem"
+ })
+ .click(function(e) {
+ // temporary
+ e.preventDefault();
+ self.select();
+ });
+ this.refresh();
+ },
+
+ refresh: function() {
+ var self = this;
+
+ // don't refresh list items that are already adapted
+ var items = this.element.children("li:not(.ui-menu-item):has(a)")
+ .addClass("ui-menu-item")
+ .attr("role", "menuitem");
+
+ items.children("a")
+ .addClass("ui-corner-all")
+ .attr("tabindex", -1)
+ // mouseenter doesn't work with event delegation
+ .mouseenter(function() {
+ self.activate($(this).parent());
+ })
+ .mouseleave(function() {
+ self.deactivate();
+ });
+ },
+
+ activate: function(item) {
+ this.deactivate();
+ if (this.hasScroll()) {
+ var offset = item.offset().top - this.element.offset().top,
+ scroll = this.element.attr("scrollTop"),
+ elementHeight = this.element.height();
+ if (offset < 0) {
+ this.element.attr("scrollTop", scroll + offset);
+ } else if (offset > elementHeight) {
+ this.element.attr("scrollTop", scroll + offset - elementHeight + item.height());
+ }
+ }
+ this.active = item.eq(0)
+ .children("a")
+ .addClass("ui-state-hover")
+ .attr("id", "ui-active-menuitem")
+ .end();
+ this._trigger("focus", null, { item: item });
+ },
+
+ deactivate: function() {
+ if (!this.active) { return; }
+
+ this.active.children("a")
+ .removeClass("ui-state-hover")
+ .removeAttr("id");
+ this._trigger("blur");
+ this.active = null;
+ },
+
+ next: function() {
+ this.move("next", "li:first");
+ },
+
+ previous: function() {
+ this.move("prev", "li:last");
+ },
+
+ first: function() {
+ return this.active && !this.active.prev().length;
+ },
+
+ last: function() {
+ return this.active && !this.active.next().length;
+ },
+
+ move: function(direction, edge) {
+ if (!this.active) {
+ this.activate(this.element.children(edge));
+ return;
+ }
+ var next = this.active[direction]();
+ if (next.length) {
+ this.activate(next);
+ } else {
+ this.activate(this.element.children(edge));
+ }
+ },
+
+ // TODO merge with previousPage
+ nextPage: function() {
+ if (this.hasScroll()) {
+ // TODO merge with no-scroll-else
+ if (!this.active || this.last()) {
+ this.activate(this.element.children(":first"));
+ return;
+ }
+ var base = this.active.offset().top,
+ height = this.element.height(),
+ result = this.element.children("li").filter(function() {
+ var close = $(this).offset().top - base - height + $(this).height();
+ // TODO improve approximation
+ return close < 10 && close > -10;
+ });
+
+ // TODO try to catch this earlier when scrollTop indicates the last page anyway
+ if (!result.length) {
+ result = this.element.children(":last");
+ }
+ this.activate(result);
+ } else {
+ this.activate(this.element.children(!this.active || this.last() ? ":first" : ":last"));
+ }
+ },
+
+ // TODO merge with nextPage
+ previousPage: function() {
+ if (this.hasScroll()) {
+ // TODO merge with no-scroll-else
+ if (!this.active || this.first()) {
+ this.activate(this.element.children(":last"));
+ return;
+ }
+
+ var base = this.active.offset().top,
+ height = this.element.height();
+ result = this.element.children("li").filter(function() {
+ var close = $(this).offset().top - base + height - $(this).height();
+ // TODO improve approximation
+ return close < 10 && close > -10;
+ });
+
+ // TODO try to catch this earlier when scrollTop indicates the last page anyway
+ if (!result.length) {
+ result = this.element.children(":first");
+ }
+ this.activate(result);
+ } else {
+ this.activate(this.element.children(!this.active || this.first() ? ":last" : ":first"));
+ }
+ },
+
+ hasScroll: function() {
+ return this.element.height() < this.element.attr("scrollHeight");
+ },
+
+ select: function() {
+ this._trigger("selected", null, { item: this.active });
+ }
+});
+
+}(jQuery));
+/*
+ * jQuery UI Button 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Button
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function( $ ) {
+
+var lastActive,
+ baseClasses = "ui-button ui-widget ui-state-default ui-corner-all",
+ otherClasses = "ui-state-hover ui-state-active " +
+ "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon ui-button-text-only",
+ formResetHandler = function( event ) {
+ $( ":ui-button", event.target.form ).each(function() {
+ var inst = $( this ).data( "button" );
+ setTimeout(function() {
+ inst.refresh();
+ }, 1 );
+ });
+ },
+ radioGroup = function( radio ) {
+ var name = radio.name,
+ form = radio.form,
+ radios = $( [] );
+ if ( name ) {
+ if ( form ) {
+ radios = $( form ).find( "[name='" + name + "']" );
+ } else {
+ radios = $( "[name='" + name + "']", radio.ownerDocument )
+ .filter(function() {
+ return !this.form;
+ });
+ }
+ }
+ return radios;
+ };
+
+$.widget( "ui.button", {
+ options: {
+ text: true,
+ label: null,
+ icons: {
+ primary: null,
+ secondary: null
+ }
+ },
+ _create: function() {
+ this.element.closest( "form" )
+ .unbind( "reset.button" )
+ .bind( "reset.button", formResetHandler );
+
+ this._determineButtonType();
+ this.hasTitle = !!this.buttonElement.attr( "title" );
+
+ var self = this,
+ options = this.options,
+ toggleButton = this.type === "checkbox" || this.type === "radio",
+ hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ),
+ focusClass = "ui-state-focus";
+
+ if ( options.label === null ) {
+ options.label = this.buttonElement.html();
+ }
+
+ if ( this.element.is( ":disabled" ) ) {
+ options.disabled = true;
+ }
+
+ this.buttonElement
+ .addClass( baseClasses )
+ .attr( "role", "button" )
+ .bind( "mouseenter.button", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).addClass( "ui-state-hover" );
+ if ( this === lastActive ) {
+ $( this ).addClass( "ui-state-active" );
+ }
+ })
+ .bind( "mouseleave.button", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).removeClass( hoverClass );
+ })
+ .bind( "focus.button", function() {
+ // no need to check disabled, focus won't be triggered anyway
+ $( this ).addClass( focusClass );
+ })
+ .bind( "blur.button", function() {
+ $( this ).removeClass( focusClass );
+ });
+
+ if ( toggleButton ) {
+ this.element.bind( "change.button", function() {
+ self.refresh();
+ });
+ }
+
+ if ( this.type === "checkbox" ) {
+ this.buttonElement.bind( "click.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).toggleClass( "ui-state-active" );
+ self.buttonElement.attr( "aria-pressed", self.element[0].checked );
+ });
+ } else if ( this.type === "radio" ) {
+ this.buttonElement.bind( "click.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).addClass( "ui-state-active" );
+ self.buttonElement.attr( "aria-pressed", true );
+
+ var radio = self.element[ 0 ];
+ radioGroup( radio )
+ .not( radio )
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", false );
+ });
+ } else {
+ this.buttonElement
+ .bind( "mousedown.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).addClass( "ui-state-active" );
+ lastActive = this;
+ $( document ).one( "mouseup", function() {
+ lastActive = null;
+ });
+ })
+ .bind( "mouseup.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).removeClass( "ui-state-active" );
+ })
+ .bind( "keydown.button", function(event) {
+ if ( options.disabled ) {
+ return false;
+ }
+ if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) {
+ $( this ).addClass( "ui-state-active" );
+ }
+ })
+ .bind( "keyup.button", function() {
+ $( this ).removeClass( "ui-state-active" );
+ });
+
+ if ( this.buttonElement.is("a") ) {
+ this.buttonElement.keyup(function(event) {
+ if ( event.keyCode === $.ui.keyCode.SPACE ) {
+ // TODO pass through original event correctly (just as 2nd argument doesn't work)
+ $( this ).click();
+ }
+ });
+ }
+ }
+
+ // TODO: pull out $.Widget's handling for the disabled option into
+ // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can
+ // be overridden by individual plugins
+ this._setOption( "disabled", options.disabled );
+ },
+
+ _determineButtonType: function() {
+
+ if ( this.element.is(":checkbox") ) {
+ this.type = "checkbox";
+ } else {
+ if ( this.element.is(":radio") ) {
+ this.type = "radio";
+ } else {
+ if ( this.element.is("input") ) {
+ this.type = "input";
+ } else {
+ this.type = "button";
+ }
+ }
+ }
+
+ if ( this.type === "checkbox" || this.type === "radio" ) {
+ // we don't search against the document in case the element
+ // is disconnected from the DOM
+ this.buttonElement = this.element.parents().last()
+ .find( "[for=" + this.element.attr("id") + "]" );
+ this.element.addClass( "ui-helper-hidden-accessible" );
+
+ var checked = this.element.is( ":checked" );
+ if ( checked ) {
+ this.buttonElement.addClass( "ui-state-active" );
+ }
+ this.buttonElement.attr( "aria-pressed", checked );
+ } else {
+ this.buttonElement = this.element;
+ }
+ },
+
+ widget: function() {
+ return this.buttonElement;
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass( "ui-helper-hidden-accessible" );
+ this.buttonElement
+ .removeClass( baseClasses + " " + otherClasses )
+ .removeAttr( "role" )
+ .removeAttr( "aria-pressed" )
+ .html( this.buttonElement.find(".ui-button-text").html() );
+
+ if ( !this.hasTitle ) {
+ this.buttonElement.removeAttr( "title" );
+ }
+
+ $.Widget.prototype.destroy.call( this );
+ },
+
+ _setOption: function( key, value ) {
+ $.Widget.prototype._setOption.apply( this, arguments );
+ if ( key === "disabled" ) {
+ if ( value ) {
+ this.element.attr( "disabled", true );
+ } else {
+ this.element.removeAttr( "disabled" );
+ }
+ }
+ this._resetButton();
+ },
+
+ refresh: function() {
+ var isDisabled = this.element.is( ":disabled" );
+ if ( isDisabled !== this.options.disabled ) {
+ this._setOption( "disabled", isDisabled );
+ }
+ if ( this.type === "radio" ) {
+ radioGroup( this.element[0] ).each(function() {
+ if ( $( this ).is( ":checked" ) ) {
+ $( this ).button( "widget" )
+ .addClass( "ui-state-active" )
+ .attr( "aria-pressed", true );
+ } else {
+ $( this ).button( "widget" )
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", false );
+ }
+ });
+ } else if ( this.type === "checkbox" ) {
+ if ( this.element.is( ":checked" ) ) {
+ this.buttonElement
+ .addClass( "ui-state-active" )
+ .attr( "aria-pressed", true );
+ } else {
+ this.buttonElement
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", false );
+ }
+ }
+ },
+
+ _resetButton: function() {
+ if ( this.type === "input" ) {
+ if ( this.options.label ) {
+ this.element.val( this.options.label );
+ }
+ return;
+ }
+ var buttonElement = this.buttonElement,
+ buttonText = $( "<span></span>" )
+ .addClass( "ui-button-text" )
+ .html( this.options.label )
+ .appendTo( buttonElement.empty() )
+ .text(),
+ icons = this.options.icons,
+ multipleIcons = icons.primary && icons.secondary;
+ if ( icons.primary || icons.secondary ) {
+ buttonElement.addClass( "ui-button-text-icon" +
+ ( multipleIcons ? "s" : "" ) );
+ if ( icons.primary ) {
+ buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" );
+ }
+ if ( icons.secondary ) {
+ buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" );
+ }
+ if ( !this.options.text ) {
+ buttonElement
+ .addClass( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" )
+ .removeClass( "ui-button-text-icons ui-button-text-icon" );
+ if ( !this.hasTitle ) {
+ buttonElement.attr( "title", buttonText );
+ }
+ }
+ } else {
+ buttonElement.addClass( "ui-button-text-only" );
+ }
+ }
+});
+
+$.widget( "ui.buttonset", {
+ _create: function() {
+ this.element.addClass( "ui-buttonset" );
+ this._init();
+ },
+
+ _init: function() {
+ this.refresh();
+ },
+
+ _setOption: function( key, value ) {
+ if ( key === "disabled" ) {
+ this.buttons.button( "option", key, value );
+ }
+
+ $.Widget.prototype._setOption.apply( this, arguments );
+ },
+
+ refresh: function() {
+ this.buttons = this.element.find( ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" )
+ .filter( ":ui-button" )
+ .button( "refresh" )
+ .end()
+ .not( ":ui-button" )
+ .button()
+ .end()
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-corner-all ui-corner-left ui-corner-right" )
+ .filter( ":first" )
+ .addClass( "ui-corner-left" )
+ .end()
+ .filter( ":last" )
+ .addClass( "ui-corner-right" )
+ .end()
+ .end();
+ },
+
+ destroy: function() {
+ this.element.removeClass( "ui-buttonset" );
+ this.buttons
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-corner-left ui-corner-right" )
+ .end()
+ .button( "destroy" )
+
+ $.Widget.prototype.destroy.call( this );
+ }
+});
+
+}( jQuery ) );
+/*
+ * jQuery UI Dialog 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.button.js
+ * jquery.ui.draggable.js
+ * jquery.ui.mouse.js
+ * jquery.ui.position.js
+ * jquery.ui.resizable.js
+ */
+(function($) {
+
+var uiDialogClasses =
+ 'ui-dialog ' +
+ 'ui-widget ' +
+ 'ui-widget-content ' +
+ 'ui-corner-all ';
+
+$.widget("ui.dialog", {
+ options: {
+ autoOpen: true,
+ buttons: {},
+ closeOnEscape: true,
+ closeText: 'close',
+ dialogClass: '',
+ draggable: true,
+ hide: null,
+ height: 'auto',
+ maxHeight: false,
+ maxWidth: false,
+ minHeight: 150,
+ minWidth: 150,
+ modal: false,
+ position: 'center',
+ resizable: true,
+ show: null,
+ stack: true,
+ title: '',
+ width: 300,
+ zIndex: 1000
+ },
+ _create: function() {
+ this.originalTitle = this.element.attr('title');
+
+ var self = this,
+ options = self.options,
+
+ title = options.title || self.originalTitle || ' ',
+ titleId = $.ui.dialog.getTitleId(self.element),
+
+ uiDialog = (self.uiDialog = $('<div></div>'))
+ .appendTo(document.body)
+ .hide()
+ .addClass(uiDialogClasses + options.dialogClass)
+ .css({
+ zIndex: options.zIndex
+ })
+ // setting tabIndex makes the div focusable
+ // setting outline to 0 prevents a border on focus in Mozilla
+ .attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
+ if (options.closeOnEscape && event.keyCode &&
+ event.keyCode === $.ui.keyCode.ESCAPE) {
+
+ self.close(event);
+ event.preventDefault();
+ }
+ })
+ .attr({
+ role: 'dialog',
+ 'aria-labelledby': titleId
+ })
+ .mousedown(function(event) {
+ self.moveToTop(false, event);
+ }),
+
+ uiDialogContent = self.element
+ .show()
+ .removeAttr('title')
+ .addClass(
+ 'ui-dialog-content ' +
+ 'ui-widget-content')
+ .appendTo(uiDialog),
+
+ uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>'))
+ .addClass(
+ 'ui-dialog-titlebar ' +
+ 'ui-widget-header ' +
+ 'ui-corner-all ' +
+ 'ui-helper-clearfix'
+ )
+ .prependTo(uiDialog),
+
+ uiDialogTitlebarClose = $('<a href="#"></a>')
+ .addClass(
+ 'ui-dialog-titlebar-close ' +
+ 'ui-corner-all'
+ )
+ .attr('role', 'button')
+ .hover(
+ function() {
+ uiDialogTitlebarClose.addClass('ui-state-hover');
+ },
+ function() {
+ uiDialogTitlebarClose.removeClass('ui-state-hover');
+ }
+ )
+ .focus(function() {
+ uiDialogTitlebarClose.addClass('ui-state-focus');
+ })
+ .blur(function() {
+ uiDialogTitlebarClose.removeClass('ui-state-focus');
+ })
+ .click(function(event) {
+ self.close(event);
+ return false;
+ })
+ .appendTo(uiDialogTitlebar),
+
+ uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>'))
+ .addClass(
+ 'ui-icon ' +
+ 'ui-icon-closethick'
+ )
+ .text(options.closeText)
+ .appendTo(uiDialogTitlebarClose),
+
+ uiDialogTitle = $('<span></span>')
+ .addClass('ui-dialog-title')
+ .attr('id', titleId)
+ .html(title)
+ .prependTo(uiDialogTitlebar);
+
+ //handling of deprecated beforeclose (vs beforeClose) option
+ //Ticket #4669 http://dev.jqueryui.com/ticket/4669
+ //TODO: remove in 1.9pre
+ if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) {
+ options.beforeClose = options.beforeclose;
+ }
+
+ uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
+
+ if (options.draggable && $.fn.draggable) {
+ self._makeDraggable();
+ }
+ if (options.resizable && $.fn.resizable) {
+ self._makeResizable();
+ }
+
+ self._createButtons(options.buttons);
+ self._isOpen = false;
+
+ if ($.fn.bgiframe) {
+ uiDialog.bgiframe();
+ }
+ },
+ _init: function() {
+ if ( this.options.autoOpen ) {
+ this.open();
+ }
+ },
+
+ destroy: function() {
+ var self = this;
+
+ if (self.overlay) {
+ self.overlay.destroy();
+ }
+ self.uiDialog.hide();
+ self.element
+ .unbind('.dialog')
+ .removeData('dialog')
+ .removeClass('ui-dialog-content ui-widget-content')
+ .hide().appendTo('body');
+ self.uiDialog.remove();
+
+ if (self.originalTitle) {
+ self.element.attr('title', self.originalTitle);
+ }
+
+ return self;
+ },
+
+ widget: function() {
+ return this.uiDialog;
+ },
+
+ close: function(event) {
+ var self = this,
+ maxZ;
+
+ if (false === self._trigger('beforeClose', event)) {
+ return;
+ }
+
+ if (self.overlay) {
+ self.overlay.destroy();
+ }
+ self.uiDialog.unbind('keypress.ui-dialog');
+
+ self._isOpen = false;
+
+ if (self.options.hide) {
+ self.uiDialog.hide(self.options.hide, function() {
+ self._trigger('close', event);
+ });
+ } else {
+ self.uiDialog.hide();
+ self._trigger('close', event);
+ }
+
+ $.ui.dialog.overlay.resize();
+
+ // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+ if (self.options.modal) {
+ maxZ = 0;
+ $('.ui-dialog').each(function() {
+ if (this !== self.uiDialog[0]) {
+ maxZ = Math.max(maxZ, $(this).css('z-index'));
+ }
+ });
+ $.ui.dialog.maxZ = maxZ;
+ }
+
+ return self;
+ },
+
+ isOpen: function() {
+ return this._isOpen;
+ },
+
+ // the force parameter allows us to move modal dialogs to their correct
+ // position on open
+ moveToTop: function(force, event) {
+ var self = this,
+ options = self.options,
+ saveScroll;
+
+ if ((options.modal && !force) ||
+ (!options.stack && !options.modal)) {
+ return self._trigger('focus', event);
+ }
+
+ if (options.zIndex > $.ui.dialog.maxZ) {
+ $.ui.dialog.maxZ = options.zIndex;
+ }
+ if (self.overlay) {
+ $.ui.dialog.maxZ += 1;
+ self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ);
+ }
+
+ //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
+ // http://ui.jquery.com/bugs/ticket/3193
+ saveScroll = { scrollTop: self.element.attr('scrollTop'), scrollLeft: self.element.attr('scrollLeft') };
+ $.ui.dialog.maxZ += 1;
+ self.uiDialog.css('z-index', $.ui.dialog.maxZ);
+ self.element.attr(saveScroll);
+ self._trigger('focus', event);
+
+ return self;
+ },
+
+ open: function() {
+ if (this._isOpen) { return; }
+
+ var self = this,
+ options = self.options,
+ uiDialog = self.uiDialog;
+
+ self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null;
+ if (uiDialog.next().length) {
+ uiDialog.appendTo('body');
+ }
+ self._size();
+ self._position(options.position);
+ uiDialog.show(options.show);
+ self.moveToTop(true);
+
+ // prevent tabbing out of modal dialogs
+ if (options.modal) {
+ uiDialog.bind('keypress.ui-dialog', function(event) {
+ if (event.keyCode !== $.ui.keyCode.TAB) {
+ return;
+ }
+
+ var tabbables = $(':tabbable', this),
+ first = tabbables.filter(':first'),
+ last = tabbables.filter(':last');
+
+ if (event.target === last[0] && !event.shiftKey) {
+ first.focus(1);
+ return false;
+ } else if (event.target === first[0] && event.shiftKey) {
+ last.focus(1);
+ return false;
+ }
+ });
+ }
+
+ // set focus to the first tabbable element in the content area or the first button
+ // if there are no tabbable elements, set focus on the dialog itself
+ $([])
+ .add(uiDialog.find('.ui-dialog-content :tabbable:first'))
+ .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first'))
+ .add(uiDialog)
+ .filter(':first')
+ .focus();
+
+ self._trigger('open');
+ self._isOpen = true;
+
+ return self;
+ },
+
+ _createButtons: function(buttons) {
+ var self = this,
+ hasButtons = false,
+ uiDialogButtonPane = $('<div></div>')
+ .addClass(
+ 'ui-dialog-buttonpane ' +
+ 'ui-widget-content ' +
+ 'ui-helper-clearfix'
+ );
+
+ // if we already have a button pane, remove it
+ self.uiDialog.find('.ui-dialog-buttonpane').remove();
+
+ if (typeof buttons === 'object' && buttons !== null) {
+ $.each(buttons, function() {
+ return !(hasButtons = true);
+ });
+ }
+ if (hasButtons) {
+ $.each(buttons, function(name, fn) {
+ var button = $('<button type="button"></button>')
+ .text(name)
+ .click(function() { fn.apply(self.element[0], arguments); })
+ .appendTo(uiDialogButtonPane);
+ if ($.fn.button) {
+ button.button();
+ }
+ });
+ uiDialogButtonPane.appendTo(self.uiDialog);
+ }
+ },
+
+ _makeDraggable: function() {
+ var self = this,
+ options = self.options,
+ doc = $(document),
+ heightBeforeDrag;
+
+ function filteredUi(ui) {
+ return {
+ position: ui.position,
+ offset: ui.offset
+ };
+ }
+
+ self.uiDialog.draggable({
+ cancel: '.ui-dialog-content, .ui-dialog-titlebar-close',
+ handle: '.ui-dialog-titlebar',
+ containment: 'document',
+ start: function(event, ui) {
+ heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height();
+ $(this).height($(this).height()).addClass("ui-dialog-dragging");
+ self._trigger('dragStart', event, filteredUi(ui));
+ },
+ drag: function(event, ui) {
+ self._trigger('drag', event, filteredUi(ui));
+ },
+ stop: function(event, ui) {
+ options.position = [ui.position.left - doc.scrollLeft(),
+ ui.position.top - doc.scrollTop()];
+ $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
+ self._trigger('dragStop', event, filteredUi(ui));
+ $.ui.dialog.overlay.resize();
+ }
+ });
+ },
+
+ _makeResizable: function(handles) {
+ handles = (handles === undefined ? this.options.resizable : handles);
+ var self = this,
+ options = self.options,
+ // .ui-resizable has position: relative defined in the stylesheet
+ // but dialogs have to use absolute or fixed positioning
+ position = self.uiDialog.css('position'),
+ resizeHandles = (typeof handles === 'string' ?
+ handles :
+ 'n,e,s,w,se,sw,ne,nw'
+ );
+
+ function filteredUi(ui) {
+ return {
+ originalPosition: ui.originalPosition,
+ originalSize: ui.originalSize,
+ position: ui.position,
+ size: ui.size
+ };
+ }
+
+ self.uiDialog.resizable({
+ cancel: '.ui-dialog-content',
+ containment: 'document',
+ alsoResize: self.element,
+ maxWidth: options.maxWidth,
+ maxHeight: options.maxHeight,
+ minWidth: options.minWidth,
+ minHeight: self._minHeight(),
+ handles: resizeHandles,
+ start: function(event, ui) {
+ $(this).addClass("ui-dialog-resizing");
+ self._trigger('resizeStart', event, filteredUi(ui));
+ },
+ resize: function(event, ui) {
+ self._trigger('resize', event, filteredUi(ui));
+ },
+ stop: function(event, ui) {
+ $(this).removeClass("ui-dialog-resizing");
+ options.height = $(this).height();
+ options.width = $(this).width();
+ self._trigger('resizeStop', event, filteredUi(ui));
+ $.ui.dialog.overlay.resize();
+ }
+ })
+ .css('position', position)
+ .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
+ },
+
+ _minHeight: function() {
+ var options = this.options;
+
+ if (options.height === 'auto') {
+ return options.minHeight;
+ } else {
+ return Math.min(options.minHeight, options.height);
+ }
+ },
+
+ _position: function(position) {
+ var myAt = [],
+ offset = [0, 0],
+ isVisible;
+
+ position = position || $.ui.dialog.prototype.options.position;
+
+ // deep extending converts arrays to objects in jQuery <= 1.3.2 :-(
+// if (typeof position == 'string' || $.isArray(position)) {
+// myAt = $.isArray(position) ? position : position.split(' ');
+
+ if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) {
+ myAt = position.split ? position.split(' ') : [position[0], position[1]];
+ if (myAt.length === 1) {
+ myAt[1] = myAt[0];
+ }
+
+ $.each(['left', 'top'], function(i, offsetPosition) {
+ if (+myAt[i] === myAt[i]) {
+ offset[i] = myAt[i];
+ myAt[i] = offsetPosition;
+ }
+ });
+ } else if (typeof position === 'object') {
+ if ('left' in position) {
+ myAt[0] = 'left';
+ offset[0] = position.left;
+ } else if ('right' in position) {
+ myAt[0] = 'right';
+ offset[0] = -position.right;
+ }
+
+ if ('top' in position) {
+ myAt[1] = 'top';
+ offset[1] = position.top;
+ } else if ('bottom' in position) {
+ myAt[1] = 'bottom';
+ offset[1] = -position.bottom;
+ }
+ }
+
+ // need to show the dialog to get the actual offset in the position plugin
+ isVisible = this.uiDialog.is(':visible');
+ if (!isVisible) {
+ this.uiDialog.show();
+ }
+ this.uiDialog
+ // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
+ .css({ top: 0, left: 0 })
+ .position({
+ my: myAt.join(' '),
+ at: myAt.join(' '),
+ offset: offset.join(' '),
+ of: window,
+ collision: 'fit',
+ // ensure that the titlebar is never outside the document
+ using: function(pos) {
+ var topOffset = $(this).css(pos).offset().top;
+ if (topOffset < 0) {
+ $(this).css('top', pos.top - topOffset);
+ }
+ }
+ });
+ if (!isVisible) {
+ this.uiDialog.hide();
+ }
+ },
+
+ _setOption: function(key, value){
+ var self = this,
+ uiDialog = self.uiDialog,
+ isResizable = uiDialog.is(':data(resizable)'),
+ resize = false;
+
+ switch (key) {
+ //handling of deprecated beforeclose (vs beforeClose) option
+ //Ticket #4669 http://dev.jqueryui.com/ticket/4669
+ //TODO: remove in 1.9pre
+ case "beforeclose":
+ key = "beforeClose";
+ break;
+ case "buttons":
+ self._createButtons(value);
+ break;
+ case "closeText":
+ // convert whatever was passed in to a string, for text() to not throw up
+ self.uiDialogTitlebarCloseText.text("" + value);
+ break;
+ case "dialogClass":
+ uiDialog
+ .removeClass(self.options.dialogClass)
+ .addClass(uiDialogClasses + value);
+ break;
+ case "disabled":
+ if (value) {
+ uiDialog.addClass('ui-dialog-disabled');
+ } else {
+ uiDialog.removeClass('ui-dialog-disabled');
+ }
+ break;
+ case "draggable":
+ if (value) {
+ self._makeDraggable();
+ } else {
+ uiDialog.draggable('destroy');
+ }
+ break;
+ case "height":
+ resize = true;
+ break;
+ case "maxHeight":
+ if (isResizable) {
+ uiDialog.resizable('option', 'maxHeight', value);
+ }
+ resize = true;
+ break;
+ case "maxWidth":
+ if (isResizable) {
+ uiDialog.resizable('option', 'maxWidth', value);
+ }
+ resize = true;
+ break;
+ case "minHeight":
+ if (isResizable) {
+ uiDialog.resizable('option', 'minHeight', value);
+ }
+ resize = true;
+ break;
+ case "minWidth":
+ if (isResizable) {
+ uiDialog.resizable('option', 'minWidth', value);
+ }
+ resize = true;
+ break;
+ case "position":
+ self._position(value);
+ break;
+ case "resizable":
+ // currently resizable, becoming non-resizable
+ if (isResizable && !value) {
+ uiDialog.resizable('destroy');
+ }
+
+ // currently resizable, changing handles
+ if (isResizable && typeof value === 'string') {
+ uiDialog.resizable('option', 'handles', value);
+ }
+
+ // currently non-resizable, becoming resizable
+ if (!isResizable && value !== false) {
+ self._makeResizable(value);
+ }
+ break;
+ case "title":
+ // convert whatever was passed in o a string, for html() to not throw up
+ $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' '));
+ break;
+ case "width":
+ resize = true;
+ break;
+ }
+
+ $.Widget.prototype._setOption.apply(self, arguments);
+ if (resize) {
+ self._size();
+ }
+ },
+
+ _size: function() {
+ /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+ * divs will both have width and height set, so we need to reset them
+ */
+ var options = this.options,
+ nonContentHeight;
+
+ // reset content sizing
+ // hide for non content measurement because height: 0 doesn't work in IE quirks mode (see #4350)
+ this.element.css('width', 'auto')
+ .hide();
+
+ // reset wrapper sizing
+ // determine the height of all the non-content elements
+ nonContentHeight = this.uiDialog.css({
+ height: 'auto',
+ width: options.width
+ })
+ .height();
+
+ this.element
+ .css(options.height === 'auto' ? {
+ minHeight: Math.max(options.minHeight - nonContentHeight, 0),
+ height: 'auto'
+ } : {
+ minHeight: 0,
+ height: Math.max(options.height - nonContentHeight, 0)
+ })
+ .show();
+
+ if (this.uiDialog.is(':data(resizable)')) {
+ this.uiDialog.resizable('option', 'minHeight', this._minHeight());
+ }
+ }
+});
+
+$.extend($.ui.dialog, {
+ version: "1.8",
+
+ uuid: 0,
+ maxZ: 0,
+
+ getTitleId: function($el) {
+ var id = $el.attr('id');
+ if (!id) {
+ this.uuid += 1;
+ id = this.uuid;
+ }
+ return 'ui-dialog-title-' + id;
+ },
+
+ overlay: function(dialog) {
+ this.$el = $.ui.dialog.overlay.create(dialog);
+ }
+});
+
+$.extend($.ui.dialog.overlay, {
+ instances: [],
+ // reuse old instances due to IE memory leak with alpha transparency (see #5185)
+ oldInstances: [],
+ maxZ: 0,
+ events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
+ function(event) { return event + '.dialog-overlay'; }).join(' '),
+ create: function(dialog) {
+ if (this.instances.length === 0) {
+ // prevent use of anchors and inputs
+ // we use a setTimeout in case the overlay is created from an
+ // event that we're going to be cancelling (see #2804)
+ setTimeout(function() {
+ // handle $(el).dialog().dialog('close') (see #4065)
+ if ($.ui.dialog.overlay.instances.length) {
+ $(document).bind($.ui.dialog.overlay.events, function(event) {
+ // stop events if the z-index of the target is < the z-index of the overlay
+ return ($(event.target).zIndex() >= $.ui.dialog.overlay.maxZ);
+ });
+ }
+ }, 1);
+
+ // allow closing by pressing the escape key
+ $(document).bind('keydown.dialog-overlay', function(event) {
+ if (dialog.options.closeOnEscape && event.keyCode &&
+ event.keyCode === $.ui.keyCode.ESCAPE) {
+
+ dialog.close(event);
+ event.preventDefault();
+ }
+ });
+
+ // handle window resize
+ $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
+ }
+
+ var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay'))
+ .appendTo(document.body)
+ .css({
+ width: this.width(),
+ height: this.height()
+ });
+
+ if ($.fn.bgiframe) {
+ $el.bgiframe();
+ }
+
+ this.instances.push($el);
+ return $el;
+ },
+
+ destroy: function($el) {
+ this.oldInstances.push(this.instances.splice($.inArray($el, this.instances), 1)[0]);
+
+ if (this.instances.length === 0) {
+ $([document, window]).unbind('.dialog-overlay');
+ }
+
+ $el.remove();
+
+ // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+ var maxZ = 0;
+ $.each(this.instances, function() {
+ maxZ = Math.max(maxZ, this.css('z-index'));
+ });
+ this.maxZ = maxZ;
+ },
+
+ height: function() {
+ var scrollHeight,
+ offsetHeight;
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ scrollHeight = Math.max(
+ document.documentElement.scrollHeight,
+ document.body.scrollHeight
+ );
+ offsetHeight = Math.max(
+ document.documentElement.offsetHeight,
+ document.body.offsetHeight
+ );
+
+ if (scrollHeight < offsetHeight) {
+ return $(window).height() + 'px';
+ } else {
+ return scrollHeight + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).height() + 'px';
+ }
+ },
+
+ width: function() {
+ var scrollWidth,
+ offsetWidth;
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ scrollWidth = Math.max(
+ document.documentElement.scrollWidth,
+ document.body.scrollWidth
+ );
+ offsetWidth = Math.max(
+ document.documentElement.offsetWidth,
+ document.body.offsetWidth
+ );
+
+ if (scrollWidth < offsetWidth) {
+ return $(window).width() + 'px';
+ } else {
+ return scrollWidth + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).width() + 'px';
+ }
+ },
+
+ resize: function() {
+ /* If the dialog is draggable and the user drags it past the
+ * right edge of the window, the document becomes wider so we
+ * need to stretch the overlay. If the user then drags the
+ * dialog back to the left, the document will become narrower,
+ * so we need to shrink the overlay to the appropriate size.
+ * This is handled by shrinking the overlay before setting it
+ * to the full document size.
+ */
+ var $overlays = $([]);
+ $.each($.ui.dialog.overlay.instances, function() {
+ $overlays = $overlays.add(this);
+ });
+
+ $overlays.css({
+ width: 0,
+ height: 0
+ }).css({
+ width: $.ui.dialog.overlay.width(),
+ height: $.ui.dialog.overlay.height()
+ });
+ }
+});
+
+$.extend($.ui.dialog.overlay.prototype, {
+ destroy: function() {
+ $.ui.dialog.overlay.destroy(this.$el);
+ }
+});
+
+}(jQuery));
+/*
+ * jQuery UI Slider 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Slider
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+
+(function($) {
+
+// number of pages in a slider
+// (how many times can you page up/down to go through the whole range)
+var numPages = 5;
+
+$.widget("ui.slider", $.ui.mouse, {
+ widgetEventPrefix: "slide",
+ options: {
+ animate: false,
+ distance: 0,
+ max: 100,
+ min: 0,
+ orientation: 'horizontal',
+ range: false,
+ step: 1,
+ value: 0,
+ values: null
+ },
+ _create: function() {
+
+ var self = this, o = this.options;
+ this._keySliding = false;
+ this._mouseSliding = false;
+ this._animateOff = true;
+ this._handleIndex = null;
+ this._detectOrientation();
+ this._mouseInit();
+
+ this.element
+ .addClass("ui-slider"
+ + " ui-slider-" + this.orientation
+ + " ui-widget"
+ + " ui-widget-content"
+ + " ui-corner-all");
+
+ if (o.disabled) {
+ this.element.addClass('ui-slider-disabled ui-disabled');
+ }
+
+ this.range = $([]);
+
+ if (o.range) {
+
+ if (o.range === true) {
+ this.range = $('<div></div>');
+ if (!o.values) o.values = [this._valueMin(), this._valueMin()];
+ if (o.values.length && o.values.length != 2) {
+ o.values = [o.values[0], o.values[0]];
+ }
+ } else {
+ this.range = $('<div></div>');
+ }
+
+ this.range
+ .appendTo(this.element)
+ .addClass("ui-slider-range");
+
+ if (o.range == "min" || o.range == "max") {
+ this.range.addClass("ui-slider-range-" + o.range);
+ }
+
+ // note: this isn't the most fittingly semantic framework class for this element,
+ // but worked best visually with a variety of themes
+ this.range.addClass("ui-widget-header");
+
+ }
+
+ if ($(".ui-slider-handle", this.element).length == 0)
+ $('<a href="#"></a>')
+ .appendTo(this.element)
+ .addClass("ui-slider-handle");
+
+ if (o.values && o.values.length) {
+ while ($(".ui-slider-handle", this.element).length < o.values.length)
+ $('<a href="#"></a>')
+ .appendTo(this.element)
+ .addClass("ui-slider-handle");
+ }
+
+ this.handles = $(".ui-slider-handle", this.element)
+ .addClass("ui-state-default"
+ + " ui-corner-all");
+
+ this.handle = this.handles.eq(0);
+
+ this.handles.add(this.range).filter("a")
+ .click(function(event) {
+ event.preventDefault();
+ })
+ .hover(function() {
+ if (!o.disabled) {
+ $(this).addClass('ui-state-hover');
+ }
+ }, function() {
+ $(this).removeClass('ui-state-hover');
+ })
+ .focus(function() {
+ if (!o.disabled) {
+ $(".ui-slider .ui-state-focus").removeClass('ui-state-focus'); $(this).addClass('ui-state-focus');
+ } else {
+ $(this).blur();
+ }
+ })
+ .blur(function() {
+ $(this).removeClass('ui-state-focus');
+ });
+
+ this.handles.each(function(i) {
+ $(this).data("index.ui-slider-handle", i);
+ });
+
+ this.handles.keydown(function(event) {
+
+ var ret = true;
+
+ var index = $(this).data("index.ui-slider-handle");
+
+ if (self.options.disabled)
+ return;
+
+ switch (event.keyCode) {
+ case $.ui.keyCode.HOME:
+ case $.ui.keyCode.END:
+ case $.ui.keyCode.PAGE_UP:
+ case $.ui.keyCode.PAGE_DOWN:
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ ret = false;
+ if (!self._keySliding) {
+ self._keySliding = true;
+ $(this).addClass("ui-state-active");
+ self._start(event, index);
+ }
+ break;
+ }
+
+ var curVal, newVal, step = self._step();
+ if (self.options.values && self.options.values.length) {
+ curVal = newVal = self.values(index);
+ } else {
+ curVal = newVal = self.value();
+ }
+
+ switch (event.keyCode) {
+ case $.ui.keyCode.HOME:
+ newVal = self._valueMin();
+ break;
+ case $.ui.keyCode.END:
+ newVal = self._valueMax();
+ break;
+ case $.ui.keyCode.PAGE_UP:
+ newVal = curVal + ((self._valueMax() - self._valueMin()) / numPages);
+ break;
+ case $.ui.keyCode.PAGE_DOWN:
+ newVal = curVal - ((self._valueMax() - self._valueMin()) / numPages);
+ break;
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ if(curVal == self._valueMax()) return;
+ newVal = curVal + step;
+ break;
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ if(curVal == self._valueMin()) return;
+ newVal = curVal - step;
+ break;
+ }
+
+ self._slide(event, index, newVal);
+
+ return ret;
+
+ }).keyup(function(event) {
+
+ var index = $(this).data("index.ui-slider-handle");
+
+ if (self._keySliding) {
+ self._keySliding = false;
+ self._stop(event, index);
+ self._change(event, index);
+ $(this).removeClass("ui-state-active");
+ }
+
+ });
+
+ this._refreshValue();
+
+ this._animateOff = false;
+
+ },
+
+ destroy: function() {
+
+ this.handles.remove();
+ this.range.remove();
+
+ this.element
+ .removeClass("ui-slider"
+ + " ui-slider-horizontal"
+ + " ui-slider-vertical"
+ + " ui-slider-disabled"
+ + " ui-widget"
+ + " ui-widget-content"
+ + " ui-corner-all")
+ .removeData("slider")
+ .unbind(".slider");
+
+ this._mouseDestroy();
+
+ return this;
+ },
+
+ _mouseCapture: function(event) {
+
+ var o = this.options;
+
+ if (o.disabled)
+ return false;
+
+ this.elementSize = {
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight()
+ };
+ this.elementOffset = this.element.offset();
+
+ var position = { x: event.pageX, y: event.pageY };
+ var normValue = this._normValueFromMouse(position);
+
+ var distance = this._valueMax() - this._valueMin() + 1, closestHandle;
+ var self = this, index;
+ this.handles.each(function(i) {
+ var thisDistance = Math.abs(normValue - self.values(i));
+ if (distance > thisDistance) {
+ distance = thisDistance;
+ closestHandle = $(this);
+ index = i;
+ }
+ });
+
+ // workaround for bug #3736 (if both handles of a range are at 0,
+ // the first is always used as the one with least distance,
+ // and moving it is obviously prevented by preventing negative ranges)
+ if(o.range == true && this.values(1) == o.min) {
+ closestHandle = $(this.handles[++index]);
+ }
+
+ this._start(event, index);
+ this._mouseSliding = true;
+
+ self._handleIndex = index;
+
+ closestHandle
+ .addClass("ui-state-active")
+ .focus();
+
+ var offset = closestHandle.offset();
+ var mouseOverHandle = !$(event.target).parents().andSelf().is('.ui-slider-handle');
+ this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
+ left: event.pageX - offset.left - (closestHandle.width() / 2),
+ top: event.pageY - offset.top
+ - (closestHandle.height() / 2)
+ - (parseInt(closestHandle.css('borderTopWidth'),10) || 0)
+ - (parseInt(closestHandle.css('borderBottomWidth'),10) || 0)
+ + (parseInt(closestHandle.css('marginTop'),10) || 0)
+ };
+
+ normValue = this._normValueFromMouse(position);
+ this._slide(event, index, normValue);
+ this._animateOff = true;
+ return true;
+
+ },
+
+ _mouseStart: function(event) {
+ return true;
+ },
+
+ _mouseDrag: function(event) {
+
+ var position = { x: event.pageX, y: event.pageY };
+ var normValue = this._normValueFromMouse(position);
+
+ this._slide(event, this._handleIndex, normValue);
+
+ return false;
+
+ },
+
+ _mouseStop: function(event) {
+
+ this.handles.removeClass("ui-state-active");
+ this._mouseSliding = false;
+ this._stop(event, this._handleIndex);
+ this._change(event, this._handleIndex);
+ this._handleIndex = null;
+ this._clickOffset = null;
+
+ this._animateOff = false;
+ return false;
+
+ },
+
+ _detectOrientation: function() {
+ this.orientation = this.options.orientation == 'vertical' ? 'vertical' : 'horizontal';
+ },
+
+ _normValueFromMouse: function(position) {
+
+ var pixelTotal, pixelMouse;
+ if ('horizontal' == this.orientation) {
+ pixelTotal = this.elementSize.width;
+ pixelMouse = position.x - this.elementOffset.left - (this._clickOffset ? this._clickOffset.left : 0);
+ } else {
+ pixelTotal = this.elementSize.height;
+ pixelMouse = position.y - this.elementOffset.top - (this._clickOffset ? this._clickOffset.top : 0);
+ }
+
+ var percentMouse = (pixelMouse / pixelTotal);
+ if (percentMouse > 1) percentMouse = 1;
+ if (percentMouse < 0) percentMouse = 0;
+ if ('vertical' == this.orientation)
+ percentMouse = 1 - percentMouse;
+
+ var valueTotal = this._valueMax() - this._valueMin(),
+ valueMouse = percentMouse * valueTotal,
+ valueMouseModStep = valueMouse % this.options.step,
+ normValue = this._valueMin() + valueMouse - valueMouseModStep;
+
+ if (valueMouseModStep > (this.options.step / 2))
+ normValue += this.options.step;
+
+ // Since JavaScript has problems with large floats, round
+ // the final value to 5 digits after the decimal point (see #4124)
+ return parseFloat(normValue.toFixed(5));
+
+ },
+
+ _start: function(event, index) {
+ var uiHash = {
+ handle: this.handles[index],
+ value: this.value()
+ };
+ if (this.options.values && this.options.values.length) {
+ uiHash.value = this.values(index);
+ uiHash.values = this.values();
+ }
+ this._trigger("start", event, uiHash);
+ },
+
+ _slide: function(event, index, newVal) {
+
+ var handle = this.handles[index];
+
+ if (this.options.values && this.options.values.length) {
+
+ var otherVal = this.values(index ? 0 : 1);
+
+ if ((this.options.values.length == 2 && this.options.range === true) &&
+ ((index == 0 && newVal > otherVal) || (index == 1 && newVal < otherVal))){
+ newVal = otherVal;
+ }
+
+ if (newVal != this.values(index)) {
+ var newValues = this.values();
+ newValues[index] = newVal;
+ // A slide can be canceled by returning false from the slide callback
+ var allowed = this._trigger("slide", event, {
+ handle: this.handles[index],
+ value: newVal,
+ values: newValues
+ });
+ var otherVal = this.values(index ? 0 : 1);
+ if (allowed !== false) {
+ this.values(index, newVal, true);
+ }
+ }
+
+ } else {
+
+ if (newVal != this.value()) {
+ // A slide can be canceled by returning false from the slide callback
+ var allowed = this._trigger("slide", event, {
+ handle: this.handles[index],
+ value: newVal
+ });
+ if (allowed !== false) {
+ this.value(newVal);
+ }
+
+ }
+
+ }
+
+ },
+
+ _stop: function(event, index) {
+ var uiHash = {
+ handle: this.handles[index],
+ value: this.value()
+ };
+ if (this.options.values && this.options.values.length) {
+ uiHash.value = this.values(index);
+ uiHash.values = this.values();
+ }
+ this._trigger("stop", event, uiHash);
+ },
+
+ _change: function(event, index) {
+ if (!this._keySliding && !this._mouseSliding) {
+ var uiHash = {
+ handle: this.handles[index],
+ value: this.value()
+ };
+ if (this.options.values && this.options.values.length) {
+ uiHash.value = this.values(index);
+ uiHash.values = this.values();
+ }
+ this._trigger("change", event, uiHash);
+ }
+ },
+
+ value: function(newValue) {
+
+ if (arguments.length) {
+ this.options.value = this._trimValue(newValue);
+ this._refreshValue();
+ this._change(null, 0);
+ }
+
+ return this._value();
+
+ },
+
+ values: function(index, newValue) {
+
+ if (arguments.length > 1) {
+ this.options.values[index] = this._trimValue(newValue);
+ this._refreshValue();
+ this._change(null, index);
+ }
+
+ if (arguments.length) {
+ if ($.isArray(arguments[0])) {
+ var vals = this.options.values, newValues = arguments[0];
+ for (var i = 0, l = vals.length; i < l; i++) {
+ vals[i] = this._trimValue(newValues[i]);
+ this._change(null, i);
+ }
+ this._refreshValue();
+ } else {
+ if (this.options.values && this.options.values.length) {
+ return this._values(index);
+ } else {
+ return this.value();
+ }
+ }
+ } else {
+ return this._values();
+ }
+
+ },
+
+ _setOption: function(key, value) {
+
+ var i,
+ valsLength = 0;
+ if ( jQuery.isArray(this.options.values) ) {
+ valsLength = this.options.values.length;
+ };
+
+ $.Widget.prototype._setOption.apply(this, arguments);
+
+ switch (key) {
+ case 'disabled':
+ if (value) {
+ this.handles.filter(".ui-state-focus").blur();
+ this.handles.removeClass("ui-state-hover");
+ this.handles.attr("disabled", "disabled");
+ this.element.addClass("ui-disabled");
+ } else {
+ this.handles.removeAttr("disabled");
+ this.element.removeClass("ui-disabled");
+ }
+ case 'orientation':
+
+ this._detectOrientation();
+
+ this.element
+ .removeClass("ui-slider-horizontal ui-slider-vertical")
+ .addClass("ui-slider-" + this.orientation);
+ this._refreshValue();
+ break;
+ case 'value':
+ this._animateOff = true;
+ this._refreshValue();
+ this._change(null, 0);
+ this._animateOff = false;
+ break;
+ case 'values':
+ this._animateOff = true;
+ this._refreshValue();
+ for (i = 0; i < valsLength; i++) {
+ this._change(null, i);
+ }
+ this._animateOff = false;
+ break;
+ }
+
+ },
+
+ _step: function() {
+ var step = this.options.step;
+ return step;
+ },
+
+ _value: function() {
+ //internal value getter
+ // _value() returns value trimmed by min and max
+ var val = this.options.value;
+ val = this._trimValue(val);
+
+ return val;
+ },
+
+ _values: function(index) {
+ //internal values getter
+ // _values() returns array of values trimmed by min and max
+ // _values(index) returns single value trimmed by min and max
+
+ if (arguments.length) {
+ var val = this.options.values[index];
+ val = this._trimValue(val);
+
+ return val;
+ } else {
+ // .slice() creates a copy of the array
+ // this copy gets trimmed by min and max and then returned
+ var vals = this.options.values.slice();
+ for (var i = 0, l = vals.length; i < l; i++) {
+ vals[i] = this._trimValue(vals[i]);
+ }
+
+ return vals;
+ }
+
+ },
+
+ _trimValue: function(val) {
+ if (val < this._valueMin()) val = this._valueMin();
+ if (val > this._valueMax()) val = this._valueMax();
+
+ return val;
+ },
+
+ _valueMin: function() {
+ var valueMin = this.options.min;
+ return valueMin;
+ },
+
+ _valueMax: function() {
+ var valueMax = this.options.max;
+ return valueMax;
+ },
+
+ _refreshValue: function() {
+
+ var oRange = this.options.range, o = this.options, self = this;
+ var animate = (!this._animateOff) ? o.animate : false;
+
+ if (this.options.values && this.options.values.length) {
+ var vp0, vp1;
+ this.handles.each(function(i, j) {
+ var valPercent = (self.values(i) - self._valueMin()) / (self._valueMax() - self._valueMin()) * 100;
+ var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%';
+ $(this).stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate);
+ if (self.options.range === true) {
+ if (self.orientation == 'horizontal') {
+ (i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ left: valPercent + '%' }, o.animate);
+ (i == 1) && self.range[animate ? 'animate' : 'css']({ width: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate });
+ } else {
+ (i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ bottom: (valPercent) + '%' }, o.animate);
+ (i == 1) && self.range[animate ? 'animate' : 'css']({ height: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate });
+ }
+ }
+ lastValPercent = valPercent;
+ });
+ } else {
+ var value = this.value(),
+ valueMin = this._valueMin(),
+ valueMax = this._valueMax(),
+ valPercent = valueMax != valueMin
+ ? (value - valueMin) / (valueMax - valueMin) * 100
+ : 0;
+ var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%';
+ this.handle.stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate);
+
+ (oRange == "min") && (this.orientation == "horizontal") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ width: valPercent + '%' }, o.animate);
+ (oRange == "max") && (this.orientation == "horizontal") && this.range[animate ? 'animate' : 'css']({ width: (100 - valPercent) + '%' }, { queue: false, duration: o.animate });
+ (oRange == "min") && (this.orientation == "vertical") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ height: valPercent + '%' }, o.animate);
+ (oRange == "max") && (this.orientation == "vertical") && this.range[animate ? 'animate' : 'css']({ height: (100 - valPercent) + '%' }, { queue: false, duration: o.animate });
+ }
+
+ }
+
+});
+
+$.extend($.ui.slider, {
+ version: "1.8"
+});
+
+})(jQuery);
+/*
+ * jQuery UI Tabs 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+var tabId = 0,
+ listId = 0;
+
+$.widget("ui.tabs", {
+ options: {
+ add: null,
+ ajaxOptions: null,
+ cache: false,
+ cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
+ collapsible: false,
+ disable: null,
+ disabled: [],
+ enable: null,
+ event: 'click',
+ fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
+ idPrefix: 'ui-tabs-',
+ load: null,
+ panelTemplate: '<div></div>',
+ remove: null,
+ select: null,
+ show: null,
+ spinner: '<em>Loading…</em>',
+ tabTemplate: '<li><a href="#{href}"><span>#{label}</span></a></li>'
+ },
+ _create: function() {
+ this._tabify(true);
+ },
+
+ _setOption: function(key, value) {
+ if (key == 'selected') {
+ if (this.options.collapsible && value == this.options.selected) {
+ return;
+ }
+ this.select(value);
+ }
+ else {
+ this.options[key] = value;
+ this._tabify();
+ }
+ },
+
+ _tabId: function(a) {
+ return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') ||
+ this.options.idPrefix + (++tabId);
+ },
+
+ _sanitizeSelector: function(hash) {
+ return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":"
+ },
+
+ _cookie: function() {
+ var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + (++listId));
+ return $.cookie.apply(null, [cookie].concat($.makeArray(arguments)));
+ },
+
+ _ui: function(tab, panel) {
+ return {
+ tab: tab,
+ panel: panel,
+ index: this.anchors.index(tab)
+ };
+ },
+
+ _cleanup: function() {
+ // restore all former loading tabs labels
+ this.lis.filter('.ui-state-processing').removeClass('ui-state-processing')
+ .find('span:data(label.tabs)')
+ .each(function() {
+ var el = $(this);
+ el.html(el.data('label.tabs')).removeData('label.tabs');
+ });
+ },
+
+ _tabify: function(init) {
+
+ this.list = this.element.find('ol,ul').eq(0);
+ this.lis = $('li:has(a[href])', this.list);
+ this.anchors = this.lis.map(function() { return $('a', this)[0]; });
+ this.panels = $([]);
+
+ var self = this, o = this.options;
+
+ var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
+ this.anchors.each(function(i, a) {
+ var href = $(a).attr('href');
+
+ // For dynamically created HTML that contains a hash as href IE < 8 expands
+ // such href to the full page url with hash and then misinterprets tab as ajax.
+ // Same consideration applies for an added tab with a fragment identifier
+ // since a[href=#fragment-identifier] does unexpectedly not match.
+ // Thus normalize href attribute...
+ var hrefBase = href.split('#')[0], baseEl;
+ if (hrefBase && (hrefBase === location.toString().split('#')[0] ||
+ (baseEl = $('base')[0]) && hrefBase === baseEl.href)) {
+ href = a.hash;
+ a.href = href;
+ }
+
+ // inline tab
+ if (fragmentId.test(href)) {
+ self.panels = self.panels.add(self._sanitizeSelector(href));
+ }
+
+ // remote tab
+ else if (href != '#') { // prevent loading the page itself if href is just "#"
+ $.data(a, 'href.tabs', href); // required for restore on destroy
+
+ // TODO until #3808 is fixed strip fragment identifier from url
+ // (IE fails to load from such url)
+ $.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data
+
+ var id = self._tabId(a);
+ a.href = '#' + id;
+ var $panel = $('#' + id);
+ if (!$panel.length) {
+ $panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom')
+ .insertAfter(self.panels[i - 1] || self.list);
+ $panel.data('destroy.tabs', true);
+ }
+ self.panels = self.panels.add($panel);
+ }
+
+ // invalid tab href
+ else {
+ o.disabled.push(i);
+ }
+ });
+
+ // initialization from scratch
+ if (init) {
+
+ // attach necessary classes for styling
+ this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all');
+ this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
+ this.lis.addClass('ui-state-default ui-corner-top');
+ this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom');
+
+ // Selected tab
+ // use "selected" option or try to retrieve:
+ // 1. from fragment identifier in url
+ // 2. from cookie
+ // 3. from selected class attribute on <li>
+ if (o.selected === undefined) {
+ if (location.hash) {
+ this.anchors.each(function(i, a) {
+ if (a.hash == location.hash) {
+ o.selected = i;
+ return false; // break
+ }
+ });
+ }
+ if (typeof o.selected != 'number' && o.cookie) {
+ o.selected = parseInt(self._cookie(), 10);
+ }
+ if (typeof o.selected != 'number' && this.lis.filter('.ui-tabs-selected').length) {
+ o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
+ }
+ o.selected = o.selected || (this.lis.length ? 0 : -1);
+ }
+ else if (o.selected === null) { // usage of null is deprecated, TODO remove in next release
+ o.selected = -1;
+ }
+
+ // sanity check - default to first tab...
+ o.selected = ((o.selected >= 0 && this.anchors[o.selected]) || o.selected < 0) ? o.selected : 0;
+
+ // Take disabling tabs via class attribute from HTML
+ // into account and update option properly.
+ // A selected tab cannot become disabled.
+ o.disabled = $.unique(o.disabled.concat(
+ $.map(this.lis.filter('.ui-state-disabled'),
+ function(n, i) { return self.lis.index(n); } )
+ )).sort();
+
+ if ($.inArray(o.selected, o.disabled) != -1) {
+ o.disabled.splice($.inArray(o.selected, o.disabled), 1);
+ }
+
+ // highlight selected tab
+ this.panels.addClass('ui-tabs-hide');
+ this.lis.removeClass('ui-tabs-selected ui-state-active');
+ if (o.selected >= 0 && this.anchors.length) { // check for length avoids error when initializing empty list
+ this.panels.eq(o.selected).removeClass('ui-tabs-hide');
+ this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active');
+
+ // seems to be expected behavior that the show callback is fired
+ self.element.queue("tabs", function() {
+ self._trigger('show', null, self._ui(self.anchors[o.selected], self.panels[o.selected]));
+ });
+
+ this.load(o.selected);
+ }
+
+ // clean up to avoid memory leaks in certain versions of IE 6
+ $(window).bind('unload', function() {
+ self.lis.add(self.anchors).unbind('.tabs');
+ self.lis = self.anchors = self.panels = null;
+ });
+
+ }
+ // update selected after add/remove
+ else {
+ o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
+ }
+
+ // update collapsible
+ this.element[o.collapsible ? 'addClass' : 'removeClass']('ui-tabs-collapsible');
+
+ // set or update cookie after init and add/remove respectively
+ if (o.cookie) {
+ this._cookie(o.selected, o.cookie);
+ }
+
+ // disable tabs
+ for (var i = 0, li; (li = this.lis[i]); i++) {
+ $(li)[$.inArray(i, o.disabled) != -1 &&
+ !$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled');
+ }
+
+ // reset cache if switching from cached to not cached
+ if (o.cache === false) {
+ this.anchors.removeData('cache.tabs');
+ }
+
+ // remove all handlers before, tabify may run on existing tabs after add or option change
+ this.lis.add(this.anchors).unbind('.tabs');
+
+ if (o.event != 'mouseover') {
+ var addState = function(state, el) {
+ if (el.is(':not(.ui-state-disabled)')) {
+ el.addClass('ui-state-' + state);
+ }
+ };
+ var removeState = function(state, el) {
+ el.removeClass('ui-state-' + state);
+ };
+ this.lis.bind('mouseover.tabs', function() {
+ addState('hover', $(this));
+ });
+ this.lis.bind('mouseout.tabs', function() {
+ removeState('hover', $(this));
+ });
+ this.anchors.bind('focus.tabs', function() {
+ addState('focus', $(this).closest('li'));
+ });
+ this.anchors.bind('blur.tabs', function() {
+ removeState('focus', $(this).closest('li'));
+ });
+ }
+
+ // set up animations
+ var hideFx, showFx;
+ if (o.fx) {
+ if ($.isArray(o.fx)) {
+ hideFx = o.fx[0];
+ showFx = o.fx[1];
+ }
+ else {
+ hideFx = showFx = o.fx;
+ }
+ }
+
+ // Reset certain styles left over from animation
+ // and prevent IE's ClearType bug...
+ function resetStyle($el, fx) {
+ $el.css({ display: '' });
+ if (!$.support.opacity && fx.opacity) {
+ $el[0].style.removeAttribute('filter');
+ }
+ }
+
+ // Show a tab...
+ var showTab = showFx ?
+ function(clicked, $show) {
+ $(clicked).closest('li').addClass('ui-tabs-selected ui-state-active');
+ $show.hide().removeClass('ui-tabs-hide') // avoid flicker that way
+ .animate(showFx, showFx.duration || 'normal', function() {
+ resetStyle($show, showFx);
+ self._trigger('show', null, self._ui(clicked, $show[0]));
+ });
+ } :
+ function(clicked, $show) {
+ $(clicked).closest('li').addClass('ui-tabs-selected ui-state-active');
+ $show.removeClass('ui-tabs-hide');
+ self._trigger('show', null, self._ui(clicked, $show[0]));
+ };
+
+ // Hide a tab, $show is optional...
+ var hideTab = hideFx ?
+ function(clicked, $hide) {
+ $hide.animate(hideFx, hideFx.duration || 'normal', function() {
+ self.lis.removeClass('ui-tabs-selected ui-state-active');
+ $hide.addClass('ui-tabs-hide');
+ resetStyle($hide, hideFx);
+ self.element.dequeue("tabs");
+ });
+ } :
+ function(clicked, $hide, $show) {
+ self.lis.removeClass('ui-tabs-selected ui-state-active');
+ $hide.addClass('ui-tabs-hide');
+ self.element.dequeue("tabs");
+ };
+
+ // attach tab event handler, unbind to avoid duplicates from former tabifying...
+ this.anchors.bind(o.event + '.tabs', function() {
+ var el = this, $li = $(this).closest('li'), $hide = self.panels.filter(':not(.ui-tabs-hide)'),
+ $show = $(self._sanitizeSelector(this.hash));
+
+ // If tab is already selected and not collapsible or tab disabled or
+ // or is already loading or click callback returns false stop here.
+ // Check if click handler returns false last so that it is not executed
+ // for a disabled or loading tab!
+ if (($li.hasClass('ui-tabs-selected') && !o.collapsible) ||
+ $li.hasClass('ui-state-disabled') ||
+ $li.hasClass('ui-state-processing') ||
+ self._trigger('select', null, self._ui(this, $show[0])) === false) {
+ this.blur();
+ return false;
+ }
+
+ o.selected = self.anchors.index(this);
+
+ self.abort();
+
+ // if tab may be closed
+ if (o.collapsible) {
+ if ($li.hasClass('ui-tabs-selected')) {
+ o.selected = -1;
+
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
+ }
+
+ self.element.queue("tabs", function() {
+ hideTab(el, $hide);
+ }).dequeue("tabs");
+
+ this.blur();
+ return false;
+ }
+ else if (!$hide.length) {
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
+ }
+
+ self.element.queue("tabs", function() {
+ showTab(el, $show);
+ });
+
+ self.load(self.anchors.index(this)); // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
+
+ this.blur();
+ return false;
+ }
+ }
+
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
+ }
+
+ // show new tab
+ if ($show.length) {
+ if ($hide.length) {
+ self.element.queue("tabs", function() {
+ hideTab(el, $hide);
+ });
+ }
+ self.element.queue("tabs", function() {
+ showTab(el, $show);
+ });
+
+ self.load(self.anchors.index(this));
+ }
+ else {
+ throw 'jQuery UI Tabs: Mismatching fragment identifier.';
+ }
+
+ // Prevent IE from keeping other link focussed when using the back button
+ // and remove dotted border from clicked link. This is controlled via CSS
+ // in modern browsers; blur() removes focus from address bar in Firefox
+ // which can become a usability and annoying problem with tabs('rotate').
+ if ($.browser.msie) {
+ this.blur();
+ }
+
+ });
+
+ // disable click in any case
+ this.anchors.bind('click.tabs', function(){return false;});
+
+ },
+
+ destroy: function() {
+ var o = this.options;
+
+ this.abort();
+
+ this.element.unbind('.tabs')
+ .removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible')
+ .removeData('tabs');
+
+ this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
+
+ this.anchors.each(function() {
+ var href = $.data(this, 'href.tabs');
+ if (href) {
+ this.href = href;
+ }
+ var $this = $(this).unbind('.tabs');
+ $.each(['href', 'load', 'cache'], function(i, prefix) {
+ $this.removeData(prefix + '.tabs');
+ });
+ });
+
+ this.lis.unbind('.tabs').add(this.panels).each(function() {
+ if ($.data(this, 'destroy.tabs')) {
+ $(this).remove();
+ }
+ else {
+ $(this).removeClass([
+ 'ui-state-default',
+ 'ui-corner-top',
+ 'ui-tabs-selected',
+ 'ui-state-active',
+ 'ui-state-hover',
+ 'ui-state-focus',
+ 'ui-state-disabled',
+ 'ui-tabs-panel',
+ 'ui-widget-content',
+ 'ui-corner-bottom',
+ 'ui-tabs-hide'
+ ].join(' '));
+ }
+ });
+
+ if (o.cookie) {
+ this._cookie(null, o.cookie);
+ }
+
+ return this;
+ },
+
+ add: function(url, label, index) {
+ if (index === undefined) {
+ index = this.anchors.length; // append by default
+ }
+
+ var self = this, o = this.options,
+ $li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)),
+ id = !url.indexOf('#') ? url.replace('#', '') : this._tabId($('a', $li)[0]);
+
+ $li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true);
+
+ // try to find an existing element before creating a new one
+ var $panel = $('#' + id);
+ if (!$panel.length) {
+ $panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true);
+ }
+ $panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide');
+
+ if (index >= this.lis.length) {
+ $li.appendTo(this.list);
+ $panel.appendTo(this.list[0].parentNode);
+ }
+ else {
+ $li.insertBefore(this.lis[index]);
+ $panel.insertBefore(this.panels[index]);
+ }
+
+ o.disabled = $.map(o.disabled,
+ function(n, i) { return n >= index ? ++n : n; });
+
+ this._tabify();
+
+ if (this.anchors.length == 1) { // after tabify
+ o.selected = 0;
+ $li.addClass('ui-tabs-selected ui-state-active');
+ $panel.removeClass('ui-tabs-hide');
+ this.element.queue("tabs", function() {
+ self._trigger('show', null, self._ui(self.anchors[0], self.panels[0]));
+ });
+
+ this.load(0);
+ }
+
+ // callback
+ this._trigger('add', null, this._ui(this.anchors[index], this.panels[index]));
+ return this;
+ },
+
+ remove: function(index) {
+ var o = this.options, $li = this.lis.eq(index).remove(),
+ $panel = this.panels.eq(index).remove();
+
+ // If selected tab was removed focus tab to the right or
+ // in case the last tab was removed the tab to the left.
+ if ($li.hasClass('ui-tabs-selected') && this.anchors.length > 1) {
+ this.select(index + (index + 1 < this.anchors.length ? 1 : -1));
+ }
+
+ o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }),
+ function(n, i) { return n >= index ? --n : n; });
+
+ this._tabify();
+
+ // callback
+ this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0]));
+ return this;
+ },
+
+ enable: function(index) {
+ var o = this.options;
+ if ($.inArray(index, o.disabled) == -1) {
+ return;
+ }
+
+ this.lis.eq(index).removeClass('ui-state-disabled');
+ o.disabled = $.grep(o.disabled, function(n, i) { return n != index; });
+
+ // callback
+ this._trigger('enable', null, this._ui(this.anchors[index], this.panels[index]));
+ return this;
+ },
+
+ disable: function(index) {
+ var self = this, o = this.options;
+ if (index != o.selected) { // cannot disable already selected tab
+ this.lis.eq(index).addClass('ui-state-disabled');
+
+ o.disabled.push(index);
+ o.disabled.sort();
+
+ // callback
+ this._trigger('disable', null, this._ui(this.anchors[index], this.panels[index]));
+ }
+
+ return this;
+ },
+
+ select: function(index) {
+ if (typeof index == 'string') {
+ index = this.anchors.index(this.anchors.filter('[href$=' + index + ']'));
+ }
+ else if (index === null) { // usage of null is deprecated, TODO remove in next release
+ index = -1;
+ }
+ if (index == -1 && this.options.collapsible) {
+ index = this.options.selected;
+ }
+
+ this.anchors.eq(index).trigger(this.options.event + '.tabs');
+ return this;
+ },
+
+ load: function(index) {
+ var self = this, o = this.options, a = this.anchors.eq(index)[0], url = $.data(a, 'load.tabs');
+
+ this.abort();
+
+ // not remote or from cache
+ if (!url || this.element.queue("tabs").length !== 0 && $.data(a, 'cache.tabs')) {
+ this.element.dequeue("tabs");
+ return;
+ }
+
+ // load remote from here on
+ this.lis.eq(index).addClass('ui-state-processing');
+
+ if (o.spinner) {
+ var span = $('span', a);
+ span.data('label.tabs', span.html()).html(o.spinner);
+ }
+
+ this.xhr = $.ajax($.extend({}, o.ajaxOptions, {
+ url: url,
+ success: function(r, s) {
+ $(self._sanitizeSelector(a.hash)).html(r);
+
+ // take care of tab labels
+ self._cleanup();
+
+ if (o.cache) {
+ $.data(a, 'cache.tabs', true); // if loaded once do not load them again
+ }
+
+ // callbacks
+ self._trigger('load', null, self._ui(self.anchors[index], self.panels[index]));
+ try {
+ o.ajaxOptions.success(r, s);
+ }
+ catch (e) {}
+ },
+ error: function(xhr, s, e) {
+ // take care of tab labels
+ self._cleanup();
+
+ // callbacks
+ self._trigger('load', null, self._ui(self.anchors[index], self.panels[index]));
+ try {
+ // Passing index avoid a race condition when this method is
+ // called after the user has selected another tab.
+ // Pass the anchor that initiated this request allows
+ // loadError to manipulate the tab content panel via $(a.hash)
+ o.ajaxOptions.error(xhr, s, index, a);
+ }
+ catch (e) {}
+ }
+ }));
+
+ // last, so that load event is fired before show...
+ self.element.dequeue("tabs");
+
+ return this;
+ },
+
+ abort: function() {
+ // stop possibly running animations
+ this.element.queue([]);
+ this.panels.stop(false, true);
+
+ // "tabs" queue must not contain more than two elements,
+ // which are the callbacks for the latest clicked tab...
+ this.element.queue("tabs", this.element.queue("tabs").splice(-2, 2));
+
+ // terminate pending requests from other tabs
+ if (this.xhr) {
+ this.xhr.abort();
+ delete this.xhr;
+ }
+
+ // take care of tab labels
+ this._cleanup();
+ return this;
+ },
+
+ url: function(index, url) {
+ this.anchors.eq(index).removeData('cache.tabs').data('load.tabs', url);
+ return this;
+ },
+
+ length: function() {
+ return this.anchors.length;
+ }
+
+});
+
+$.extend($.ui.tabs, {
+ version: '1.8'
+});
+
+/*
+ * Tabs Extensions
+ */
+
+/*
+ * Rotate
+ */
+$.extend($.ui.tabs.prototype, {
+ rotation: null,
+ rotate: function(ms, continuing) {
+
+ var self = this, o = this.options;
+
+ var rotate = self._rotate || (self._rotate = function(e) {
+ clearTimeout(self.rotation);
+ self.rotation = setTimeout(function() {
+ var t = o.selected;
+ self.select( ++t < self.anchors.length ? t : 0 );
+ }, ms);
+
+ if (e) {
+ e.stopPropagation();
+ }
+ });
+
+ var stop = self._unrotate || (self._unrotate = !continuing ?
+ function(e) {
+ if (e.clientX) { // in case of a true click
+ self.rotate(null);
+ }
+ } :
+ function(e) {
+ t = o.selected;
+ rotate();
+ });
+
+ // start rotation
+ if (ms) {
+ this.element.bind('tabsshow', rotate);
+ this.anchors.bind(o.event + '.tabs', stop);
+ rotate();
+ }
+ // stop rotation
+ else {
+ clearTimeout(self.rotation);
+ this.element.unbind('tabsshow', rotate);
+ this.anchors.unbind(o.event + '.tabs', stop);
+ delete this._rotate;
+ delete this._unrotate;
+ }
+
+ return this;
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Datepicker 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Datepicker
+ *
+ * Depends:
+ * jquery.ui.core.js
+ */
+
+(function($) { // hide the namespace
+
+$.extend($.ui, { datepicker: { version: "1.8" } });
+
+var PROP_NAME = 'datepicker';
+var dpuuid = new Date().getTime();
+
+/* Date picker manager.
+ Use the singleton instance of this class, $.datepicker, to interact with the date picker.
+ Settings for (groups of) date pickers are maintained in an instance object,
+ allowing multiple different settings on the same page. */
+
+function Datepicker() {
+ this.debug = false; // Change this to true to start debugging
+ this._curInst = null; // The current instance in use
+ this._keyEvent = false; // If the last event was a key event
+ this._disabledInputs = []; // List of date picker inputs that have been disabled
+ this._datepickerShowing = false; // True if the popup picker is showing , false if not
+ this._inDialog = false; // True if showing within a "dialog", false if not
+ this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
+ this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
+ this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
+ this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
+ this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
+ this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
+ this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
+ this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
+ this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
+ this.regional = []; // Available regional settings, indexed by language code
+ this.regional[''] = { // Default regional settings
+ closeText: 'Done', // Display text for close link
+ prevText: 'Prev', // Display text for previous month link
+ nextText: 'Next', // Display text for next month link
+ currentText: 'Today', // Display text for current month link
+ monthNames: ['January','February','March','April','May','June',
+ 'July','August','September','October','November','December'], // Names of months for drop-down and formatting
+ monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
+ dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
+ dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
+ dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
+ weekHeader: 'Wk', // Column header for week of the year
+ dateFormat: 'mm/dd/yy', // See format options on parseDate
+ firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
+ isRTL: false, // True if right-to-left language, false if left-to-right
+ showMonthAfterYear: false, // True if the year select precedes month, false for month then year
+ yearSuffix: '' // Additional text to append to the year in the month headers
+ };
+ this._defaults = { // Global defaults for all the date picker instances
+ showOn: 'focus', // 'focus' for popup on focus,
+ // 'button' for trigger button, or 'both' for either
+ showAnim: 'show', // Name of jQuery animation for popup
+ showOptions: {}, // Options for enhanced animations
+ defaultDate: null, // Used when field is blank: actual date,
+ // +/-number for offset from today, null for today
+ appendText: '', // Display text following the input box, e.g. showing the format
+ buttonText: '...', // Text for trigger button
+ buttonImage: '', // URL for trigger button image
+ buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
+ hideIfNoPrevNext: false, // True to hide next/previous month links
+ // if not applicable, false to just disable them
+ navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
+ gotoCurrent: false, // True if today link goes back to current selection instead
+ changeMonth: false, // True if month can be selected directly, false if only prev/next
+ changeYear: false, // True if year can be selected directly, false if only prev/next
+ yearRange: 'c-10:c+10', // Range of years to display in drop-down,
+ // either relative to today's year (-nn:+nn), relative to currently displayed year
+ // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n)
+ showOtherMonths: false, // True to show dates in other months, false to leave blank
+ selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
+ showWeek: false, // True to show week of the year, false to not show it
+ calculateWeek: this.iso8601Week, // How to calculate the week of the year,
+ // takes a Date and returns the number of the week for it
+ shortYearCutoff: '+10', // Short year values < this are in the current century,
+ // > this are in the previous century,
+ // string value starting with '+' for current year + value
+ minDate: null, // The earliest selectable date, or null for no limit
+ maxDate: null, // The latest selectable date, or null for no limit
+ duration: '_default', // Duration of display/closure
+ beforeShowDay: null, // Function that takes a date and returns an array with
+ // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
+ // [2] = cell title (optional), e.g. $.datepicker.noWeekends
+ beforeShow: null, // Function that takes an input field and
+ // returns a set of custom settings for the date picker
+ onSelect: null, // Define a callback function when a date is selected
+ onChangeMonthYear: null, // Define a callback function when the month or year is changed
+ onClose: null, // Define a callback function when the datepicker is closed
+ numberOfMonths: 1, // Number of months to show at a time
+ showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
+ stepMonths: 1, // Number of months to step back/forward
+ stepBigMonths: 12, // Number of months to step back/forward for the big links
+ altField: '', // Selector for an alternate field to store selected dates into
+ altFormat: '', // The date format to use for the alternate field
+ constrainInput: true, // The input is constrained by the current date format
+ showButtonPanel: false, // True to show button panel, false to not show it
+ autoSize: false // True to size the input for the date format, false to leave as is
+ };
+ $.extend(this._defaults, this.regional['']);
+ this.dpDiv = $('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>');
+}
+
+$.extend(Datepicker.prototype, {
+ /* Class name added to elements to indicate already configured with a date picker. */
+ markerClassName: 'hasDatepicker',
+
+ /* Debug logging (if enabled). */
+ log: function () {
+ if (this.debug)
+ console.log.apply('', arguments);
+ },
+
+ // TODO rename to "widget" when switching to widget factory
+ _widgetDatepicker: function() {
+ return this.dpDiv;
+ },
+
+ /* Override the default settings for all instances of the date picker.
+ @param settings object - the new settings to use as defaults (anonymous object)
+ @return the manager object */
+ setDefaults: function(settings) {
+ extendRemove(this._defaults, settings || {});
+ return this;
+ },
+
+ /* Attach the date picker to a jQuery selection.
+ @param target element - the target input field or division or span
+ @param settings object - the new settings to use for this date picker instance (anonymous) */
+ _attachDatepicker: function(target, settings) {
+ // check for settings on the control itself - in namespace 'date:'
+ var inlineSettings = null;
+ for (var attrName in this._defaults) {
+ var attrValue = target.getAttribute('date:' + attrName);
+ if (attrValue) {
+ inlineSettings = inlineSettings || {};
+ try {
+ inlineSettings[attrName] = eval(attrValue);
+ } catch (err) {
+ inlineSettings[attrName] = attrValue;
+ }
+ }
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ var inline = (nodeName == 'div' || nodeName == 'span');
+ if (!target.id)
+ target.id = 'dp' + (++this.uuid);
+ var inst = this._newInst($(target), inline);
+ inst.settings = $.extend({}, settings || {}, inlineSettings || {});
+ if (nodeName == 'input') {
+ this._connectDatepicker(target, inst);
+ } else if (inline) {
+ this._inlineDatepicker(target, inst);
+ }
+ },
+
+ /* Create a new instance object. */
+ _newInst: function(target, inline) {
+ var id = target[0].id.replace(/([^A-Za-z0-9_])/g, '\\\\$1'); // escape jQuery meta chars
+ return {id: id, input: target, // associated target
+ selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
+ drawMonth: 0, drawYear: 0, // month being drawn
+ inline: inline, // is datepicker inline or not
+ dpDiv: (!inline ? this.dpDiv : // presentation div
+ $('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))};
+ },
+
+ /* Attach the date picker to an input field. */
+ _connectDatepicker: function(target, inst) {
+ var input = $(target);
+ inst.append = $([]);
+ inst.trigger = $([]);
+ if (input.hasClass(this.markerClassName))
+ return;
+ this._attachments(input, inst);
+ input.addClass(this.markerClassName).keydown(this._doKeyDown).
+ keypress(this._doKeyPress).keyup(this._doKeyUp).
+ bind("setData.datepicker", function(event, key, value) {
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key) {
+ return this._get(inst, key);
+ });
+ this._autoSize(inst);
+ $.data(target, PROP_NAME, inst);
+ },
+
+ /* Make attachments based on settings. */
+ _attachments: function(input, inst) {
+ var appendText = this._get(inst, 'appendText');
+ var isRTL = this._get(inst, 'isRTL');
+ if (inst.append)
+ inst.append.remove();
+ if (appendText) {
+ inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>');
+ input[isRTL ? 'before' : 'after'](inst.append);
+ }
+ input.unbind('focus', this._showDatepicker);
+ if (inst.trigger)
+ inst.trigger.remove();
+ var showOn = this._get(inst, 'showOn');
+ if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field
+ input.focus(this._showDatepicker);
+ if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked
+ var buttonText = this._get(inst, 'buttonText');
+ var buttonImage = this._get(inst, 'buttonImage');
+ inst.trigger = $(this._get(inst, 'buttonImageOnly') ?
+ $('<img/>').addClass(this._triggerClass).
+ attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
+ $('<button type="button"></button>').addClass(this._triggerClass).
+ html(buttonImage == '' ? buttonText : $('<img/>').attr(
+ { src:buttonImage, alt:buttonText, title:buttonText })));
+ input[isRTL ? 'before' : 'after'](inst.trigger);
+ inst.trigger.click(function() {
+ if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0])
+ $.datepicker._hideDatepicker();
+ else
+ $.datepicker._showDatepicker(input[0]);
+ return false;
+ });
+ }
+ },
+
+ /* Apply the maximum length for the date format. */
+ _autoSize: function(inst) {
+ if (this._get(inst, 'autoSize') && !inst.inline) {
+ var date = new Date(2009, 12 - 1, 20); // Ensure double digits
+ var dateFormat = this._get(inst, 'dateFormat');
+ if (dateFormat.match(/[DM]/)) {
+ var findMax = function(names) {
+ var max = 0;
+ var maxI = 0;
+ for (var i = 0; i < names.length; i++) {
+ if (names[i].length > max) {
+ max = names[i].length;
+ maxI = i;
+ }
+ }
+ return maxI;
+ };
+ date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ?
+ 'monthNames' : 'monthNamesShort'))));
+ date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ?
+ 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay());
+ }
+ inst.input.attr('size', this._formatDate(inst, date).length);
+ }
+ },
+
+ /* Attach an inline date picker to a div. */
+ _inlineDatepicker: function(target, inst) {
+ var divSpan = $(target);
+ if (divSpan.hasClass(this.markerClassName))
+ return;
+ divSpan.addClass(this.markerClassName).append(inst.dpDiv).
+ bind("setData.datepicker", function(event, key, value){
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key){
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+ this._setDate(inst, this._getDefaultDate(inst), true);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ },
+
+ /* Pop-up the date picker in a "dialog" box.
+ @param input element - ignored
+ @param date string or Date - the initial date to display
+ @param onSelect function - the function to call when a date is selected
+ @param settings object - update the dialog date picker instance's settings (anonymous object)
+ @param pos int[2] - coordinates for the dialog's position within the screen or
+ event - with x/y coordinates or
+ leave empty for default (screen centre)
+ @return the manager object */
+ _dialogDatepicker: function(input, date, onSelect, settings, pos) {
+ var inst = this._dialogInst; // internal instance
+ if (!inst) {
+ var id = 'dp' + (++this.uuid);
+ this._dialogInput = $('<input type="text" id="' + id +
+ '" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');
+ this._dialogInput.keydown(this._doKeyDown);
+ $('body').append(this._dialogInput);
+ inst = this._dialogInst = this._newInst(this._dialogInput, false);
+ inst.settings = {};
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ }
+ extendRemove(inst.settings, settings || {});
+ date = (date && date.constructor == Date ? this._formatDate(inst, date) : date);
+ this._dialogInput.val(date);
+
+ this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
+ if (!this._pos) {
+ var browserWidth = document.documentElement.clientWidth;
+ var browserHeight = document.documentElement.clientHeight;
+ var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
+ var scrollY = document.documentElement.scrollTop || document.body.scrollTop;
+ this._pos = // should use actual width/height below
+ [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
+ }
+
+ // move input on screen for focus, but hidden behind dialog
+ this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px');
+ inst.settings.onSelect = onSelect;
+ this._inDialog = true;
+ this.dpDiv.addClass(this._dialogClass);
+ this._showDatepicker(this._dialogInput[0]);
+ if ($.blockUI)
+ $.blockUI(this.dpDiv);
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ return this;
+ },
+
+ /* Detach a datepicker from its control.
+ @param target element - the target input field or division or span */
+ _destroyDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ $.removeData(target, PROP_NAME);
+ if (nodeName == 'input') {
+ inst.append.remove();
+ inst.trigger.remove();
+ $target.removeClass(this.markerClassName).
+ unbind('focus', this._showDatepicker).
+ unbind('keydown', this._doKeyDown).
+ unbind('keypress', this._doKeyPress).
+ unbind('keyup', this._doKeyUp);
+ } else if (nodeName == 'div' || nodeName == 'span')
+ $target.removeClass(this.markerClassName).empty();
+ },
+
+ /* Enable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _enableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = false;
+ inst.trigger.filter('button').
+ each(function() { this.disabled = false; }).end().
+ filter('img').css({opacity: '1.0', cursor: ''});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().removeClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ },
+
+ /* Disable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _disableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = true;
+ inst.trigger.filter('button').
+ each(function() { this.disabled = true; }).end().
+ filter('img').css({opacity: '0.5', cursor: 'default'});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().addClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ this._disabledInputs[this._disabledInputs.length] = target;
+ },
+
+ /* Is the first field in a jQuery collection disabled as a datepicker?
+ @param target element - the target input field or division or span
+ @return boolean - true if disabled, false if enabled */
+ _isDisabledDatepicker: function(target) {
+ if (!target) {
+ return false;
+ }
+ for (var i = 0; i < this._disabledInputs.length; i++) {
+ if (this._disabledInputs[i] == target)
+ return true;
+ }
+ return false;
+ },
+
+ /* Retrieve the instance data for the target control.
+ @param target element - the target input field or division or span
+ @return object - the associated instance data
+ @throws error if a jQuery problem getting data */
+ _getInst: function(target) {
+ try {
+ return $.data(target, PROP_NAME);
+ }
+ catch (err) {
+ throw 'Missing instance data for this datepicker';
+ }
+ },
+
+ /* Update or retrieve the settings for a date picker attached to an input field or division.
+ @param target element - the target input field or division or span
+ @param name object - the new settings to update or
+ string - the name of the setting to change or retrieve,
+ when retrieving also 'all' for all instance settings or
+ 'defaults' for all global defaults
+ @param value any - the new value for the setting
+ (omit if above is an object or to retrieve a value) */
+ _optionDatepicker: function(target, name, value) {
+ var inst = this._getInst(target);
+ if (arguments.length == 2 && typeof name == 'string') {
+ return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) :
+ (inst ? (name == 'all' ? $.extend({}, inst.settings) :
+ this._get(inst, name)) : null));
+ }
+ var settings = name || {};
+ if (typeof name == 'string') {
+ settings = {};
+ settings[name] = value;
+ }
+ if (inst) {
+ if (this._curInst == inst) {
+ this._hideDatepicker();
+ }
+ var date = this._getDateDatepicker(target, true);
+ extendRemove(inst.settings, settings);
+ this._attachments($(target), inst);
+ this._autoSize(inst);
+ this._setDateDatepicker(target, date);
+ this._updateDatepicker(inst);
+ }
+ },
+
+ // change method deprecated
+ _changeDatepicker: function(target, name, value) {
+ this._optionDatepicker(target, name, value);
+ },
+
+ /* Redraw the date picker attached to an input field or division.
+ @param target element - the target input field or division or span */
+ _refreshDatepicker: function(target) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._updateDatepicker(inst);
+ }
+ },
+
+ /* Set the dates for a jQuery selection.
+ @param target element - the target input field or division or span
+ @param date Date - the new date */
+ _setDateDatepicker: function(target, date) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._setDate(inst, date);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ }
+ },
+
+ /* Get the date(s) for the first entry in a jQuery selection.
+ @param target element - the target input field or division or span
+ @param noDefault boolean - true if no default date is to be used
+ @return Date - the current date */
+ _getDateDatepicker: function(target, noDefault) {
+ var inst = this._getInst(target);
+ if (inst && !inst.inline)
+ this._setDateFromField(inst, noDefault);
+ return (inst ? this._getDate(inst) : null);
+ },
+
+ /* Handle keystrokes. */
+ _doKeyDown: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ var handled = true;
+ var isRTL = inst.dpDiv.is('.ui-datepicker-rtl');
+ inst._keyEvent = true;
+ if ($.datepicker._datepickerShowing)
+ switch (event.keyCode) {
+ case 9: $.datepicker._hideDatepicker();
+ handled = false;
+ break; // hide on tab out
+ case 13: var sel = $('td.' + $.datepicker._dayOverClass, inst.dpDiv).
+ add($('td.' + $.datepicker._currentClass, inst.dpDiv));
+ if (sel[0])
+ $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
+ else
+ $.datepicker._hideDatepicker();
+ return false; // don't submit the form
+ break; // select the value on enter
+ case 27: $.datepicker._hideDatepicker();
+ break; // hide on escape
+ case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // previous month/year on page up/+ ctrl
+ case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // next month/year on page down/+ ctrl
+ case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // clear on ctrl or command +end
+ case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // current on ctrl or command +home
+ case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // -1 day on ctrl or command +left
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +left on Mac
+ break;
+ case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // -1 week on ctrl or command +up
+ case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // +1 day on ctrl or command +right
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +right
+ break;
+ case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // +1 week on ctrl or command +down
+ default: handled = false;
+ }
+ else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home
+ $.datepicker._showDatepicker(this);
+ else {
+ handled = false;
+ }
+ if (handled) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ },
+
+ /* Filter entered characters - based on date format. */
+ _doKeyPress: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ if ($.datepicker._get(inst, 'constrainInput')) {
+ var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'));
+ var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode);
+ return event.ctrlKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1);
+ }
+ },
+
+ /* Synchronise manual entry and field/alternate field. */
+ _doKeyUp: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ if (inst.input.val() != inst.lastVal) {
+ try {
+ var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
+ (inst.input ? inst.input.val() : null),
+ $.datepicker._getFormatConfig(inst));
+ if (date) { // only if valid
+ $.datepicker._setDateFromField(inst);
+ $.datepicker._updateAlternate(inst);
+ $.datepicker._updateDatepicker(inst);
+ }
+ }
+ catch (event) {
+ $.datepicker.log(event);
+ }
+ }
+ return true;
+ },
+
+ /* Pop-up the date picker for a given input field.
+ @param input element - the input field attached to the date picker or
+ event - if triggered by focus */
+ _showDatepicker: function(input) {
+ input = input.target || input;
+ if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger
+ input = $('input', input.parentNode)[0];
+ if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here
+ return;
+ var inst = $.datepicker._getInst(input);
+ if ($.datepicker._curInst && $.datepicker._curInst != inst) {
+ $.datepicker._curInst.dpDiv.stop(true, true);
+ }
+ var beforeShow = $.datepicker._get(inst, 'beforeShow');
+ extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {}));
+ inst.lastVal = null;
+ $.datepicker._lastInput = input;
+ $.datepicker._setDateFromField(inst);
+ if ($.datepicker._inDialog) // hide cursor
+ input.value = '';
+ if (!$.datepicker._pos) { // position below input
+ $.datepicker._pos = $.datepicker._findPos(input);
+ $.datepicker._pos[1] += input.offsetHeight; // add the height
+ }
+ var isFixed = false;
+ $(input).parents().each(function() {
+ isFixed |= $(this).css('position') == 'fixed';
+ return !isFixed;
+ });
+ if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
+ $.datepicker._pos[0] -= document.documentElement.scrollLeft;
+ $.datepicker._pos[1] -= document.documentElement.scrollTop;
+ }
+ var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
+ $.datepicker._pos = null;
+ // determine sizing offscreen
+ inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'});
+ $.datepicker._updateDatepicker(inst);
+ // fix width for dynamic number of date pickers
+ // and adjust position before showing
+ offset = $.datepicker._checkOffset(inst, offset, isFixed);
+ inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
+ 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
+ left: offset.left + 'px', top: offset.top + 'px'});
+ if (!inst.inline) {
+ var showAnim = $.datepicker._get(inst, 'showAnim');
+ var duration = $.datepicker._get(inst, 'duration');
+ var postProcess = function() {
+ $.datepicker._datepickerShowing = true;
+ var borders = $.datepicker._getBorders(inst.dpDiv);
+ inst.dpDiv.find('iframe.ui-datepicker-cover'). // IE6- only
+ css({left: -borders[0], top: -borders[1],
+ width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()});
+ };
+ inst.dpDiv.zIndex($(input).zIndex()+1);
+ if ($.effects && $.effects[showAnim])
+ inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
+ else
+ inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess);
+ if (!showAnim || !duration)
+ postProcess();
+ if (inst.input.is(':visible') && !inst.input.is(':disabled'))
+ inst.input.focus();
+ $.datepicker._curInst = inst;
+ }
+ },
+
+ /* Generate the date picker content. */
+ _updateDatepicker: function(inst) {
+ var self = this;
+ var borders = $.datepicker._getBorders(inst.dpDiv);
+ inst.dpDiv.empty().append(this._generateHTML(inst))
+ .find('iframe.ui-datepicker-cover') // IE6- only
+ .css({left: -borders[0], top: -borders[1],
+ width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()})
+ .end()
+ .find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a')
+ .bind('mouseout', function(){
+ $(this).removeClass('ui-state-hover');
+ if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover');
+ if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover');
+ })
+ .bind('mouseover', function(){
+ if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) {
+ $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
+ $(this).addClass('ui-state-hover');
+ if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover');
+ if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover');
+ }
+ })
+ .end()
+ .find('.' + this._dayOverClass + ' a')
+ .trigger('mouseover')
+ .end();
+ var numMonths = this._getNumberOfMonths(inst);
+ var cols = numMonths[1];
+ var width = 17;
+ if (cols > 1)
+ inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em');
+ else
+ inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');
+ inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-multi');
+ inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-rtl');
+ if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input &&
+ inst.input.is(':visible') && !inst.input.is(':disabled'))
+ inst.input.focus();
+ },
+
+ /* Retrieve the size of left and top borders for an element.
+ @param elem (jQuery object) the element of interest
+ @return (number[2]) the left and top borders */
+ _getBorders: function(elem) {
+ var convert = function(value) {
+ return {thin: 1, medium: 2, thick: 3}[value] || value;
+ };
+ return [parseFloat(convert(elem.css('border-left-width'))),
+ parseFloat(convert(elem.css('border-top-width')))];
+ },
+
+ /* Check positioning to remain on screen. */
+ _checkOffset: function(inst, offset, isFixed) {
+ var dpWidth = inst.dpDiv.outerWidth();
+ var dpHeight = inst.dpDiv.outerHeight();
+ var inputWidth = inst.input ? inst.input.outerWidth() : 0;
+ var inputHeight = inst.input ? inst.input.outerHeight() : 0;
+ var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft();
+ var viewHeight = document.documentElement.clientHeight + $(document).scrollTop();
+
+ offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
+ offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
+ offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
+
+ // now check if datepicker is showing outside window viewport - move to a better place if so.
+ offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ?
+ Math.abs(offset.left + dpWidth - viewWidth) : 0);
+ offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ?
+ Math.abs(dpHeight + inputHeight) : 0);
+
+ return offset;
+ },
+
+ /* Find an object's position on the screen. */
+ _findPos: function(obj) {
+ var inst = this._getInst(obj);
+ var isRTL = this._get(inst, 'isRTL');
+ while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) {
+ obj = obj[isRTL ? 'previousSibling' : 'nextSibling'];
+ }
+ var position = $(obj).offset();
+ return [position.left, position.top];
+ },
+
+ /* Hide the date picker from view.
+ @param input element - the input field attached to the date picker */
+ _hideDatepicker: function(input) {
+ var inst = this._curInst;
+ if (!inst || (input && inst != $.data(input, PROP_NAME)))
+ return;
+ if (this._datepickerShowing) {
+ var showAnim = this._get(inst, 'showAnim');
+ var duration = this._get(inst, 'duration');
+ var postProcess = function() {
+ $.datepicker._tidyDialog(inst);
+ this._curInst = null;
+ };
+ if ($.effects && $.effects[showAnim])
+ inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
+ else
+ inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' :
+ (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess);
+ if (!showAnim)
+ postProcess();
+ var onClose = this._get(inst, 'onClose');
+ if (onClose)
+ onClose.apply((inst.input ? inst.input[0] : null),
+ [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback
+ this._datepickerShowing = false;
+ this._lastInput = null;
+ if (this._inDialog) {
+ this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
+ if ($.blockUI) {
+ $.unblockUI();
+ $('body').append(this.dpDiv);
+ }
+ }
+ this._inDialog = false;
+ }
+ },
+
+ /* Tidy up after a dialog display. */
+ _tidyDialog: function(inst) {
+ inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');
+ },
+
+ /* Close date picker if clicked elsewhere. */
+ _checkExternalClick: function(event) {
+ if (!$.datepicker._curInst)
+ return;
+ var $target = $(event.target);
+ if ($target[0].id != $.datepicker._mainDivId &&
+ $target.parents('#' + $.datepicker._mainDivId).length == 0 &&
+ !$target.hasClass($.datepicker.markerClassName) &&
+ !$target.hasClass($.datepicker._triggerClass) &&
+ $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))
+ $.datepicker._hideDatepicker();
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustDate: function(id, offset, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ this._adjustInstDate(inst, offset +
+ (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
+ period);
+ this._updateDatepicker(inst);
+ },
+
+ /* Action for current link. */
+ _gotoToday: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
+ inst.selectedDay = inst.currentDay;
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth;
+ inst.drawYear = inst.selectedYear = inst.currentYear;
+ }
+ else {
+ var date = new Date();
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ }
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Action for selecting a new month/year. */
+ _selectMonthYear: function(id, select, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ inst._selectingMonthYear = false;
+ inst['selected' + (period == 'M' ? 'Month' : 'Year')] =
+ inst['draw' + (period == 'M' ? 'Month' : 'Year')] =
+ parseInt(select.options[select.selectedIndex].value,10);
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Restore input focus after not changing month/year. */
+ _clickMonthYear: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (inst.input && inst._selectingMonthYear && !$.browser.msie)
+ inst.input.focus();
+ inst._selectingMonthYear = !inst._selectingMonthYear;
+ },
+
+ /* Action for selecting a day. */
+ _selectDay: function(id, month, year, td) {
+ var target = $(id);
+ if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ var inst = this._getInst(target[0]);
+ inst.selectedDay = inst.currentDay = $('a', td).html();
+ inst.selectedMonth = inst.currentMonth = month;
+ inst.selectedYear = inst.currentYear = year;
+ this._selectDate(id, this._formatDate(inst,
+ inst.currentDay, inst.currentMonth, inst.currentYear));
+ },
+
+ /* Erase the input field and hide the date picker. */
+ _clearDate: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ this._selectDate(target, '');
+ },
+
+ /* Update the input field with the selected date. */
+ _selectDate: function(id, dateStr) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
+ if (inst.input)
+ inst.input.val(dateStr);
+ this._updateAlternate(inst);
+ var onSelect = this._get(inst, 'onSelect');
+ if (onSelect)
+ onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
+ else if (inst.input)
+ inst.input.trigger('change'); // fire the change event
+ if (inst.inline)
+ this._updateDatepicker(inst);
+ else {
+ this._hideDatepicker();
+ this._lastInput = inst.input[0];
+ if (typeof(inst.input[0]) != 'object')
+ inst.input.focus(); // restore focus
+ this._lastInput = null;
+ }
+ },
+
+ /* Update any alternate field to synchronise with the main field. */
+ _updateAlternate: function(inst) {
+ var altField = this._get(inst, 'altField');
+ if (altField) { // update alternate field too
+ var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat');
+ var date = this._getDate(inst);
+ var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
+ $(altField).each(function() { $(this).val(dateStr); });
+ }
+ },
+
+ /* Set as beforeShowDay function to prevent selection of weekends.
+ @param date Date - the date to customise
+ @return [boolean, string] - is this date selectable?, what is its CSS class? */
+ noWeekends: function(date) {
+ var day = date.getDay();
+ return [(day > 0 && day < 6), ''];
+ },
+
+ /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
+ @param date Date - the date to get the week for
+ @return number - the number of the week within the year that contains this date */
+ iso8601Week: function(date) {
+ var checkDate = new Date(date.getTime());
+ // Find Thursday of this week starting on Monday
+ checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7));
+ var time = checkDate.getTime();
+ checkDate.setMonth(0); // Compare with Jan 1
+ checkDate.setDate(1);
+ return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1;
+ },
+
+ /* Parse a string value into a date object.
+ See formatDate below for the possible formats.
+
+ @param format string - the expected format of the date
+ @param value string - the date in the above format
+ @param settings Object - attributes include:
+ shortYearCutoff number - the cutoff year for determining the century (optional)
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return Date - the extracted date value or null if value is blank */
+ parseDate: function (format, value, settings) {
+ if (format == null || value == null)
+ throw 'Invalid arguments';
+ value = (typeof value == 'object' ? value.toString() : value + '');
+ if (value == '')
+ return null;
+ var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff;
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ var year = -1;
+ var month = -1;
+ var day = -1;
+ var doy = -1;
+ var literal = false;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Extract a number from the string value
+ var getNumber = function(match) {
+ lookAhead(match);
+ var size = (match == '@' ? 14 : (match == '!' ? 20 :
+ (match == 'y' ? 4 : (match == 'o' ? 3 : 2))));
+ var digits = new RegExp('^\\d{1,' + size + '}');
+ var num = value.substring(iValue).match(digits);
+ if (!num)
+ throw 'Missing number at position ' + iValue;
+ iValue += num[0].length;
+ return parseInt(num[0], 10);
+ };
+ // Extract a name from the string value and convert to an index
+ var getName = function(match, shortNames, longNames) {
+ var names = (lookAhead(match) ? longNames : shortNames);
+ for (var i = 0; i < names.length; i++) {
+ if (value.substr(iValue, names[i].length) == names[i]) {
+ iValue += names[i].length;
+ return i + 1;
+ }
+ }
+ throw 'Unknown name at position ' + iValue;
+ };
+ // Confirm that a literal character matches the string value
+ var checkLiteral = function() {
+ if (value.charAt(iValue) != format.charAt(iFormat))
+ throw 'Unexpected literal at position ' + iValue;
+ iValue++;
+ };
+ var iValue = 0;
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ checkLiteral();
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ day = getNumber('d');
+ break;
+ case 'D':
+ getName('D', dayNamesShort, dayNames);
+ break;
+ case 'o':
+ doy = getNumber('o');
+ break;
+ case 'm':
+ month = getNumber('m');
+ break;
+ case 'M':
+ month = getName('M', monthNamesShort, monthNames);
+ break;
+ case 'y':
+ year = getNumber('y');
+ break;
+ case '@':
+ var date = new Date(getNumber('@'));
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case '!':
+ var date = new Date((getNumber('!') - this._ticksTo1970) / 10000);
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case "'":
+ if (lookAhead("'"))
+ checkLiteral();
+ else
+ literal = true;
+ break;
+ default:
+ checkLiteral();
+ }
+ }
+ if (year == -1)
+ year = new Date().getFullYear();
+ else if (year < 100)
+ year += new Date().getFullYear() - new Date().getFullYear() % 100 +
+ (year <= shortYearCutoff ? 0 : -100);
+ if (doy > -1) {
+ month = 1;
+ day = doy;
+ do {
+ var dim = this._getDaysInMonth(year, month - 1);
+ if (day <= dim)
+ break;
+ month++;
+ day -= dim;
+ } while (true);
+ }
+ var date = this._daylightSavingAdjust(new Date(year, month - 1, day));
+ if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day)
+ throw 'Invalid date'; // E.g. 31/02/*
+ return date;
+ },
+
+ /* Standard date formats. */
+ ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
+ COOKIE: 'D, dd M yy',
+ ISO_8601: 'yy-mm-dd',
+ RFC_822: 'D, d M y',
+ RFC_850: 'DD, dd-M-y',
+ RFC_1036: 'D, d M y',
+ RFC_1123: 'D, d M yy',
+ RFC_2822: 'D, d M yy',
+ RSS: 'D, d M y', // RFC 822
+ TICKS: '!',
+ TIMESTAMP: '@',
+ W3C: 'yy-mm-dd', // ISO 8601
+
+ _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) +
+ Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000),
+
+ /* Format a date object into a string value.
+ The format can be combinations of the following:
+ d - day of month (no leading zero)
+ dd - day of month (two digit)
+ o - day of year (no leading zeros)
+ oo - day of year (three digit)
+ D - day name short
+ DD - day name long
+ m - month of year (no leading zero)
+ mm - month of year (two digit)
+ M - month name short
+ MM - month name long
+ y - year (two digit)
+ yy - year (four digit)
+ @ - Unix timestamp (ms since 01/01/1970)
+ ! - Windows ticks (100ns since 01/01/0001)
+ '...' - literal text
+ '' - single quote
+
+ @param format string - the desired format of the date
+ @param date Date - the date value to format
+ @param settings Object - attributes include:
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return string - the date in the above format */
+ formatDate: function (format, date, settings) {
+ if (!date)
+ return '';
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Format a number, with leading zero if necessary
+ var formatNumber = function(match, value, len) {
+ var num = '' + value;
+ if (lookAhead(match))
+ while (num.length < len)
+ num = '0' + num;
+ return num;
+ };
+ // Format a name, short or long as requested
+ var formatName = function(match, value, shortNames, longNames) {
+ return (lookAhead(match) ? longNames[value] : shortNames[value]);
+ };
+ var output = '';
+ var literal = false;
+ if (date)
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ output += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ output += formatNumber('d', date.getDate(), 2);
+ break;
+ case 'D':
+ output += formatName('D', date.getDay(), dayNamesShort, dayNames);
+ break;
+ case 'o':
+ output += formatNumber('o',
+ (date.getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000, 3);
+ break;
+ case 'm':
+ output += formatNumber('m', date.getMonth() + 1, 2);
+ break;
+ case 'M':
+ output += formatName('M', date.getMonth(), monthNamesShort, monthNames);
+ break;
+ case 'y':
+ output += (lookAhead('y') ? date.getFullYear() :
+ (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100);
+ break;
+ case '@':
+ output += date.getTime();
+ break;
+ case '!':
+ output += date.getTime() * 10000 + this._ticksTo1970;
+ break;
+ case "'":
+ if (lookAhead("'"))
+ output += "'";
+ else
+ literal = true;
+ break;
+ default:
+ output += format.charAt(iFormat);
+ }
+ }
+ return output;
+ },
+
+ /* Extract all possible characters from the date format. */
+ _possibleChars: function (format) {
+ var chars = '';
+ var literal = false;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ for (var iFormat = 0; iFormat < format.length; iFormat++)
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ chars += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd': case 'm': case 'y': case '@':
+ chars += '0123456789';
+ break;
+ case 'D': case 'M':
+ return null; // Accept anything
+ case "'":
+ if (lookAhead("'"))
+ chars += "'";
+ else
+ literal = true;
+ break;
+ default:
+ chars += format.charAt(iFormat);
+ }
+ return chars;
+ },
+
+ /* Get a setting value, defaulting if necessary. */
+ _get: function(inst, name) {
+ return inst.settings[name] !== undefined ?
+ inst.settings[name] : this._defaults[name];
+ },
+
+ /* Parse existing date and initialise date picker. */
+ _setDateFromField: function(inst, noDefault) {
+ if (inst.input.val() == inst.lastVal) {
+ return;
+ }
+ var dateFormat = this._get(inst, 'dateFormat');
+ var dates = inst.lastVal = inst.input ? inst.input.val() : null;
+ var date, defaultDate;
+ date = defaultDate = this._getDefaultDate(inst);
+ var settings = this._getFormatConfig(inst);
+ try {
+ date = this.parseDate(dateFormat, dates, settings) || defaultDate;
+ } catch (event) {
+ this.log(event);
+ dates = (noDefault ? '' : dates);
+ }
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ inst.currentDay = (dates ? date.getDate() : 0);
+ inst.currentMonth = (dates ? date.getMonth() : 0);
+ inst.currentYear = (dates ? date.getFullYear() : 0);
+ this._adjustInstDate(inst);
+ },
+
+ /* Retrieve the default date shown on opening. */
+ _getDefaultDate: function(inst) {
+ return this._restrictMinMax(inst,
+ this._determineDate(inst, this._get(inst, 'defaultDate'), new Date()));
+ },
+
+ /* A date may be specified as an exact value or a relative one. */
+ _determineDate: function(inst, date, defaultDate) {
+ var offsetNumeric = function(offset) {
+ var date = new Date();
+ date.setDate(date.getDate() + offset);
+ return date;
+ };
+ var offsetString = function(offset) {
+ try {
+ return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
+ offset, $.datepicker._getFormatConfig(inst));
+ }
+ catch (e) {
+ // Ignore
+ }
+ var date = (offset.toLowerCase().match(/^c/) ?
+ $.datepicker._getDate(inst) : null) || new Date();
+ var year = date.getFullYear();
+ var month = date.getMonth();
+ var day = date.getDate();
+ var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;
+ var matches = pattern.exec(offset);
+ while (matches) {
+ switch (matches[2] || 'd') {
+ case 'd' : case 'D' :
+ day += parseInt(matches[1],10); break;
+ case 'w' : case 'W' :
+ day += parseInt(matches[1],10) * 7; break;
+ case 'm' : case 'M' :
+ month += parseInt(matches[1],10);
+ day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
+ break;
+ case 'y': case 'Y' :
+ year += parseInt(matches[1],10);
+ day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
+ break;
+ }
+ matches = pattern.exec(offset);
+ }
+ return new Date(year, month, day);
+ };
+ date = (date == null ? defaultDate : (typeof date == 'string' ? offsetString(date) :
+ (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : date)));
+ date = (date && date.toString() == 'Invalid Date' ? defaultDate : date);
+ if (date) {
+ date.setHours(0);
+ date.setMinutes(0);
+ date.setSeconds(0);
+ date.setMilliseconds(0);
+ }
+ return this._daylightSavingAdjust(date);
+ },
+
+ /* Handle switch to/from daylight saving.
+ Hours may be non-zero on daylight saving cut-over:
+ > 12 when midnight changeover, but then cannot generate
+ midnight datetime, so jump to 1AM, otherwise reset.
+ @param date (Date) the date to check
+ @return (Date) the corrected date */
+ _daylightSavingAdjust: function(date) {
+ if (!date) return null;
+ date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
+ return date;
+ },
+
+ /* Set the date(s) directly. */
+ _setDate: function(inst, date, noChange) {
+ var clear = !(date);
+ var origMonth = inst.selectedMonth;
+ var origYear = inst.selectedYear;
+ date = this._restrictMinMax(inst, this._determineDate(inst, date, new Date()));
+ inst.selectedDay = inst.currentDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = inst.currentYear = date.getFullYear();
+ if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange)
+ this._notifyChange(inst);
+ this._adjustInstDate(inst);
+ if (inst.input) {
+ inst.input.val(clear ? '' : this._formatDate(inst));
+ }
+ },
+
+ /* Retrieve the date(s) directly. */
+ _getDate: function(inst) {
+ var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null :
+ this._daylightSavingAdjust(new Date(
+ inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return startDate;
+ },
+
+ /* Generate the HTML for the current state of the date picker. */
+ _generateHTML: function(inst) {
+ var today = new Date();
+ today = this._daylightSavingAdjust(
+ new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time
+ var isRTL = this._get(inst, 'isRTL');
+ var showButtonPanel = this._get(inst, 'showButtonPanel');
+ var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext');
+ var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat');
+ var numMonths = this._getNumberOfMonths(inst);
+ var showCurrentAtPos = this._get(inst, 'showCurrentAtPos');
+ var stepMonths = this._get(inst, 'stepMonths');
+ var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1);
+ var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
+ new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ var drawMonth = inst.drawMonth - showCurrentAtPos;
+ var drawYear = inst.drawYear;
+ if (drawMonth < 0) {
+ drawMonth += 12;
+ drawYear--;
+ }
+ if (maxDate) {
+ var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
+ maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate()));
+ maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
+ while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
+ drawMonth--;
+ if (drawMonth < 0) {
+ drawMonth = 11;
+ drawYear--;
+ }
+ }
+ }
+ inst.drawMonth = drawMonth;
+ inst.drawYear = drawYear;
+ var prevText = this._get(inst, 'prevText');
+ prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' +
+ ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
+ var nextText = this._get(inst, 'nextText');
+ nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' +
+ ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
+ var currentText = this._get(inst, 'currentText');
+ var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
+ currentText = (!navigationAsDateFormat ? currentText :
+ this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
+ var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : '');
+ var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
+ (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._gotoToday(\'#' + inst.id + '\');"' +
+ '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
+ var firstDay = parseInt(this._get(inst, 'firstDay'),10);
+ firstDay = (isNaN(firstDay) ? 0 : firstDay);
+ var showWeek = this._get(inst, 'showWeek');
+ var dayNames = this._get(inst, 'dayNames');
+ var dayNamesShort = this._get(inst, 'dayNamesShort');
+ var dayNamesMin = this._get(inst, 'dayNamesMin');
+ var monthNames = this._get(inst, 'monthNames');
+ var monthNamesShort = this._get(inst, 'monthNamesShort');
+ var beforeShowDay = this._get(inst, 'beforeShowDay');
+ var showOtherMonths = this._get(inst, 'showOtherMonths');
+ var selectOtherMonths = this._get(inst, 'selectOtherMonths');
+ var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week;
+ var defaultDate = this._getDefaultDate(inst);
+ var html = '';
+ for (var row = 0; row < numMonths[0]; row++) {
+ var group = '';
+ for (var col = 0; col < numMonths[1]; col++) {
+ var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
+ var cornerClass = ' ui-corner-all';
+ var calender = '';
+ if (isMultiMonth) {
+ calender += '<div class="ui-datepicker-group';
+ if (numMonths[1] > 1)
+ switch (col) {
+ case 0: calender += ' ui-datepicker-group-first';
+ cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break;
+ case numMonths[1]-1: calender += ' ui-datepicker-group-last';
+ cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break;
+ default: calender += ' ui-datepicker-group-middle'; cornerClass = ''; break;
+ }
+ calender += '">';
+ }
+ calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' +
+ (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') +
+ (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') +
+ this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
+ row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
+ '</div><table class="ui-datepicker-calendar"><thead>' +
+ '<tr>';
+ var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : '');
+ for (var dow = 0; dow < 7; dow++) { // days of the week
+ var day = (dow + firstDay) % 7;
+ thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' +
+ '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>';
+ }
+ calender += thead + '</tr></thead><tbody>';
+ var daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
+ if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth)
+ inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
+ var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
+ var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate
+ var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
+ for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows
+ calender += '<tr>';
+ var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' +
+ this._get(inst, 'calculateWeek')(printDate) + '</td>');
+ for (var dow = 0; dow < 7; dow++) { // create date picker days
+ var daySettings = (beforeShowDay ?
+ beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']);
+ var otherMonth = (printDate.getMonth() != drawMonth);
+ var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] ||
+ (minDate && printDate < minDate) || (maxDate && printDate > maxDate);
+ tbody += '<td class="' +
+ ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
+ (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
+ ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key
+ (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ?
+ // or defaultDate is current printedDate and defaultDate is selectedDate
+ ' ' + this._dayOverClass : '') + // highlight selected day
+ (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days
+ (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates
+ (printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day
+ (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
+ ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
+ (unselectable ? '' : ' onclick="DP_jQuery_' + dpuuid + '.datepicker._selectDay(\'#' +
+ inst.id + '\',' + printDate.getMonth() + ',' + printDate.getFullYear() + ', this);return false;"') + '>' + // actions
+ (otherMonth && !showOtherMonths ? ' ' : // display for other months
+ (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
+ (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
+ (printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day
+ (otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months
+ '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date
+ printDate.setDate(printDate.getDate() + 1);
+ printDate = this._daylightSavingAdjust(printDate);
+ }
+ calender += tbody + '</tr>';
+ }
+ drawMonth++;
+ if (drawMonth > 11) {
+ drawMonth = 0;
+ drawYear++;
+ }
+ calender += '</tbody></table>' + (isMultiMonth ? '</div>' +
+ ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : '');
+ group += calender;
+ }
+ html += group;
+ }
+ html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
+ '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
+ inst._keyEvent = false;
+ return html;
+ },
+
+ /* Generate the month and year header. */
+ _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
+ secondary, monthNames, monthNamesShort) {
+ var changeMonth = this._get(inst, 'changeMonth');
+ var changeYear = this._get(inst, 'changeYear');
+ var showMonthAfterYear = this._get(inst, 'showMonthAfterYear');
+ var html = '<div class="ui-datepicker-title">';
+ var monthHtml = '';
+ // month selection
+ if (secondary || !changeMonth)
+ monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span>';
+ else {
+ var inMinYear = (minDate && minDate.getFullYear() == drawYear);
+ var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
+ monthHtml += '<select class="ui-datepicker-month" ' +
+ 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' +
+ 'onclick="DP_jQuery_' + dpuuid + '.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (var month = 0; month < 12; month++) {
+ if ((!inMinYear || month >= minDate.getMonth()) &&
+ (!inMaxYear || month <= maxDate.getMonth()))
+ monthHtml += '<option value="' + month + '"' +
+ (month == drawMonth ? ' selected="selected"' : '') +
+ '>' + monthNamesShort[month] + '</option>';
+ }
+ monthHtml += '</select>';
+ }
+ if (!showMonthAfterYear)
+ html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : '');
+ // year selection
+ if (secondary || !changeYear)
+ html += '<span class="ui-datepicker-year">' + drawYear + '</span>';
+ else {
+ // determine range of years to display
+ var years = this._get(inst, 'yearRange').split(':');
+ var thisYear = new Date().getFullYear();
+ var determineYear = function(value) {
+ var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) :
+ (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) :
+ parseInt(value, 10)));
+ return (isNaN(year) ? thisYear : year);
+ };
+ var year = determineYear(years[0]);
+ var endYear = Math.max(year, determineYear(years[1] || ''));
+ year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
+ endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
+ html += '<select class="ui-datepicker-year" ' +
+ 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' +
+ 'onclick="DP_jQuery_' + dpuuid + '.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (; year <= endYear; year++) {
+ html += '<option value="' + year + '"' +
+ (year == drawYear ? ' selected="selected"' : '') +
+ '>' + year + '</option>';
+ }
+ html += '</select>';
+ }
+ html += this._get(inst, 'yearSuffix');
+ if (showMonthAfterYear)
+ html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml;
+ html += '</div>'; // Close datepicker_header
+ return html;
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustInstDate: function(inst, offset, period) {
+ var year = inst.drawYear + (period == 'Y' ? offset : 0);
+ var month = inst.drawMonth + (period == 'M' ? offset : 0);
+ var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
+ (period == 'D' ? offset : 0);
+ var date = this._restrictMinMax(inst,
+ this._daylightSavingAdjust(new Date(year, month, day)));
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ if (period == 'M' || period == 'Y')
+ this._notifyChange(inst);
+ },
+
+ /* Ensure a date is within any min/max bounds. */
+ _restrictMinMax: function(inst, date) {
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ date = (minDate && date < minDate ? minDate : date);
+ date = (maxDate && date > maxDate ? maxDate : date);
+ return date;
+ },
+
+ /* Notify change of month/year. */
+ _notifyChange: function(inst) {
+ var onChange = this._get(inst, 'onChangeMonthYear');
+ if (onChange)
+ onChange.apply((inst.input ? inst.input[0] : null),
+ [inst.selectedYear, inst.selectedMonth + 1, inst]);
+ },
+
+ /* Determine the number of months to show. */
+ _getNumberOfMonths: function(inst) {
+ var numMonths = this._get(inst, 'numberOfMonths');
+ return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths));
+ },
+
+ /* Determine the current maximum date - ensure no time components are set. */
+ _getMinMaxDate: function(inst, minMax) {
+ return this._determineDate(inst, this._get(inst, minMax + 'Date'), null);
+ },
+
+ /* Find the number of days in a given month. */
+ _getDaysInMonth: function(year, month) {
+ return 32 - new Date(year, month, 32).getDate();
+ },
+
+ /* Find the day of the week of the first of a month. */
+ _getFirstDayOfMonth: function(year, month) {
+ return new Date(year, month, 1).getDay();
+ },
+
+ /* Determines if we should allow a "next/prev" month display change. */
+ _canAdjustMonth: function(inst, offset, curYear, curMonth) {
+ var numMonths = this._getNumberOfMonths(inst);
+ var date = this._daylightSavingAdjust(new Date(curYear,
+ curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1));
+ if (offset < 0)
+ date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
+ return this._isInRange(inst, date);
+ },
+
+ /* Is the given date in the accepted range? */
+ _isInRange: function(inst, date) {
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ return ((!minDate || date.getTime() >= minDate.getTime()) &&
+ (!maxDate || date.getTime() <= maxDate.getTime()));
+ },
+
+ /* Provide the configuration settings for formatting/parsing. */
+ _getFormatConfig: function(inst) {
+ var shortYearCutoff = this._get(inst, 'shortYearCutoff');
+ shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
+ new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
+ return {shortYearCutoff: shortYearCutoff,
+ dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'),
+ monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')};
+ },
+
+ /* Format the given date for display. */
+ _formatDate: function(inst, day, month, year) {
+ if (!day) {
+ inst.currentDay = inst.selectedDay;
+ inst.currentMonth = inst.selectedMonth;
+ inst.currentYear = inst.selectedYear;
+ }
+ var date = (day ? (typeof day == 'object' ? day :
+ this._daylightSavingAdjust(new Date(year, month, day))) :
+ this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst));
+ }
+});
+
+/* jQuery extend now ignores nulls! */
+function extendRemove(target, props) {
+ $.extend(target, props);
+ for (var name in props)
+ if (props[name] == null || props[name] == undefined)
+ target[name] = props[name];
+ return target;
+};
+
+/* Determine whether an object is an array. */
+function isArray(a) {
+ return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
+ (a.constructor && a.constructor.toString().match(/\Array\(\)/))));
+};
+
+/* Invoke the datepicker functionality.
+ @param options string - a command, optionally followed by additional parameters or
+ Object - settings for attaching new datepicker functionality
+ @return jQuery object */
+$.fn.datepicker = function(options){
+
+ /* Initialise the date picker. */
+ if (!$.datepicker.initialized) {
+ $(document).mousedown($.datepicker._checkExternalClick).
+ find('body').append($.datepicker.dpDiv);
+ $.datepicker.initialized = true;
+ }
+
+ var otherArgs = Array.prototype.slice.call(arguments, 1);
+ if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget'))
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string')
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ return this.each(function() {
+ typeof options == 'string' ?
+ $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this].concat(otherArgs)) :
+ $.datepicker._attachDatepicker(this, options);
+ });
+};
+
+$.datepicker = new Datepicker(); // singleton instance
+$.datepicker.initialized = false;
+$.datepicker.uuid = new Date().getTime();
+$.datepicker.version = "1.8";
+
+// Workaround for #4055
+// Add another global to avoid noConflict issues with inline event handlers
+window['DP_jQuery_' + dpuuid] = $;
+
+})(jQuery);
+/*
+ * jQuery UI Progressbar 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Progressbar
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function( $ ) {
+
+$.widget( "ui.progressbar", {
+ options: {
+ value: 0
+ },
+ _create: function() {
+ this.element
+ .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
+ .attr({
+ role: "progressbar",
+ "aria-valuemin": this._valueMin(),
+ "aria-valuemax": this._valueMax(),
+ "aria-valuenow": this._value()
+ });
+
+ this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" )
+ .appendTo( this.element );
+
+ this._refreshValue();
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-valuemin" )
+ .removeAttr( "aria-valuemax" )
+ .removeAttr( "aria-valuenow" );
+
+ this.valueDiv.remove();
+
+ $.Widget.prototype.destroy.apply( this, arguments );
+ },
+
+ value: function( newValue ) {
+ if ( newValue === undefined ) {
+ return this._value();
+ }
+
+ this._setOption( "value", newValue );
+ return this;
+ },
+
+ _setOption: function( key, value ) {
+ switch ( key ) {
+ case "value":
+ this.options.value = value;
+ this._refreshValue();
+ this._trigger( "change" );
+ break;
+ }
+
+ $.Widget.prototype._setOption.apply( this, arguments );
+ },
+
+ _value: function() {
+ var val = this.options.value;
+ // normalize invalid value
+ if ( typeof val !== "number" ) {
+ val = 0;
+ }
+ if ( val < this._valueMin() ) {
+ val = this._valueMin();
+ }
+ if ( val > this._valueMax() ) {
+ val = this._valueMax();
+ }
+
+ return val;
+ },
+
+ _valueMin: function() {
+ return 0;
+ },
+
+ _valueMax: function() {
+ return 100;
+ },
+
+ _refreshValue: function() {
+ var value = this.value();
+ this.valueDiv
+ [ value === this._valueMax() ? "addClass" : "removeClass"]( "ui-corner-right" )
+ .width( value + "%" );
+ this.element.attr( "aria-valuenow", value );
+ }
+});
+
+$.extend( $.ui.progressbar, {
+ version: "1.8"
+});
+
+})( jQuery );
+/*
+ * jQuery UI Effects 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */
+;jQuery.effects || (function($) {
+
+$.effects = {};
+
+
+
+/******************************************************************************/
+/****************************** COLOR ANIMATIONS ******************************/
+/******************************************************************************/
+
+// override the animation for color styles
+$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor',
+ 'borderRightColor', 'borderTopColor', 'color', 'outlineColor'],
+function(i, attr) {
+ $.fx.step[attr] = function(fx) {
+ if (!fx.colorInit) {
+ fx.start = getColor(fx.elem, attr);
+ fx.end = getRGB(fx.end);
+ fx.colorInit = true;
+ }
+
+ fx.elem.style[attr] = 'rgb(' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')';
+ };
+});
+
+// Color Conversion functions from highlightFade
+// By Blair Mitchelmore
+// http://jquery.offput.ca/highlightFade/
+
+// Parse strings looking for color tuples [255,255,255]
+function getRGB(color) {
+ var result;
+
+ // Check if we're already dealing with an array of colors
+ if ( color && color.constructor == Array && color.length == 3 )
+ return color;
+
+ // Look for rgb(num,num,num)
+ if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
+ return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];
+
+ // Look for rgb(num%,num%,num%)
+ if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
+ return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];
+
+ // Look for #a0b1c2
+ if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
+ return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];
+
+ // Look for #fff
+ if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
+ return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];
+
+ // Look for rgba(0, 0, 0, 0) == transparent in Safari 3
+ if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
+ return colors['transparent'];
+
+ // Otherwise, we're most likely dealing with a named color
+ return colors[$.trim(color).toLowerCase()];
+}
+
+function getColor(elem, attr) {
+ var color;
+
+ do {
+ color = $.curCSS(elem, attr);
+
+ // Keep going until we find an element that has color, or we hit the body
+ if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
+ break;
+
+ attr = "backgroundColor";
+ } while ( elem = elem.parentNode );
+
+ return getRGB(color);
+};
+
+// Some named colors to work with
+// From Interface by Stefan Petre
+// http://interface.eyecon.ro/
+
+var colors = {
+ aqua:[0,255,255],
+ azure:[240,255,255],
+ beige:[245,245,220],
+ black:[0,0,0],
+ blue:[0,0,255],
+ brown:[165,42,42],
+ cyan:[0,255,255],
+ darkblue:[0,0,139],
+ darkcyan:[0,139,139],
+ darkgrey:[169,169,169],
+ darkgreen:[0,100,0],
+ darkkhaki:[189,183,107],
+ darkmagenta:[139,0,139],
+ darkolivegreen:[85,107,47],
+ darkorange:[255,140,0],
+ darkorchid:[153,50,204],
+ darkred:[139,0,0],
+ darksalmon:[233,150,122],
+ darkviolet:[148,0,211],
+ fuchsia:[255,0,255],
+ gold:[255,215,0],
+ green:[0,128,0],
+ indigo:[75,0,130],
+ khaki:[240,230,140],
+ lightblue:[173,216,230],
+ lightcyan:[224,255,255],
+ lightgreen:[144,238,144],
+ lightgrey:[211,211,211],
+ lightpink:[255,182,193],
+ lightyellow:[255,255,224],
+ lime:[0,255,0],
+ magenta:[255,0,255],
+ maroon:[128,0,0],
+ navy:[0,0,128],
+ olive:[128,128,0],
+ orange:[255,165,0],
+ pink:[255,192,203],
+ purple:[128,0,128],
+ violet:[128,0,128],
+ red:[255,0,0],
+ silver:[192,192,192],
+ white:[255,255,255],
+ yellow:[255,255,0],
+ transparent: [255,255,255]
+};
+
+
+
+/******************************************************************************/
+/****************************** CLASS ANIMATIONS ******************************/
+/******************************************************************************/
+
+var classAnimationActions = ['add', 'remove', 'toggle'],
+ shorthandStyles = {
+ border: 1,
+ borderBottom: 1,
+ borderColor: 1,
+ borderLeft: 1,
+ borderRight: 1,
+ borderTop: 1,
+ borderWidth: 1,
+ margin: 1,
+ padding: 1
+ };
+
+function getElementStyles() {
+ var style = document.defaultView
+ ? document.defaultView.getComputedStyle(this, null)
+ : this.currentStyle,
+ newStyle = {},
+ key,
+ camelCase;
+
+ // webkit enumerates style porperties
+ if (style && style.length && style[0] && style[style[0]]) {
+ var len = style.length;
+ while (len--) {
+ key = style[len];
+ if (typeof style[key] == 'string') {
+ camelCase = key.replace(/\-(\w)/g, function(all, letter){
+ return letter.toUpperCase();
+ });
+ newStyle[camelCase] = style[key];
+ }
+ }
+ } else {
+ for (key in style) {
+ if (typeof style[key] === 'string') {
+ newStyle[key] = style[key];
+ }
+ }
+ }
+
+ return newStyle;
+}
+
+function filterStyles(styles) {
+ var name, value;
+ for (name in styles) {
+ value = styles[name];
+ if (
+ // ignore null and undefined values
+ value == null ||
+ // ignore functions (when does this occur?)
+ $.isFunction(value) ||
+ // shorthand styles that need to be expanded
+ name in shorthandStyles ||
+ // ignore scrollbars (break in IE)
+ (/scrollbar/).test(name) ||
+
+ // only colors or values that can be converted to numbers
+ (!(/color/i).test(name) && isNaN(parseFloat(value)))
+ ) {
+ delete styles[name];
+ }
+ }
+
+ return styles;
+}
+
+function styleDifference(oldStyle, newStyle) {
+ var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459
+ name;
+
+ for (name in newStyle) {
+ if (oldStyle[name] != newStyle[name]) {
+ diff[name] = newStyle[name];
+ }
+ }
+
+ return diff;
+}
+
+$.effects.animateClass = function(value, duration, easing, callback) {
+ if ($.isFunction(easing)) {
+ callback = easing;
+ easing = null;
+ }
+
+ return this.each(function() {
+
+ var that = $(this),
+ originalStyleAttr = that.attr('style') || ' ',
+ originalStyle = filterStyles(getElementStyles.call(this)),
+ newStyle,
+ className = that.attr('className');
+
+ $.each(classAnimationActions, function(i, action) {
+ if (value[action]) {
+ that[action + 'Class'](value[action]);
+ }
+ });
+ newStyle = filterStyles(getElementStyles.call(this));
+ that.attr('className', className);
+
+ that.animate(styleDifference(originalStyle, newStyle), duration, easing, function() {
+ $.each(classAnimationActions, function(i, action) {
+ if (value[action]) { that[action + 'Class'](value[action]); }
+ });
+ // work around bug in IE by clearing the cssText before setting it
+ if (typeof that.attr('style') == 'object') {
+ that.attr('style').cssText = '';
+ that.attr('style').cssText = originalStyleAttr;
+ } else {
+ that.attr('style', originalStyleAttr);
+ }
+ if (callback) { callback.apply(this, arguments); }
+ });
+ });
+};
+
+$.fn.extend({
+ _addClass: $.fn.addClass,
+ addClass: function(classNames, speed, easing, callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
+ },
+
+ _removeClass: $.fn.removeClass,
+ removeClass: function(classNames,speed,easing,callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
+ },
+
+ _toggleClass: $.fn.toggleClass,
+ toggleClass: function(classNames, force, speed, easing, callback) {
+ if ( typeof force == "boolean" || force === undefined ) {
+ if ( !speed ) {
+ // without speed parameter;
+ return this._toggleClass(classNames, force);
+ } else {
+ return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]);
+ }
+ } else {
+ // without switch parameter;
+ return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]);
+ }
+ },
+
+ switchClass: function(remove,add,speed,easing,callback) {
+ return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
+ }
+});
+
+
+
+/******************************************************************************/
+/*********************************** EFFECTS **********************************/
+/******************************************************************************/
+
+$.extend($.effects, {
+ version: "1.8",
+
+ // Saves a set of properties in a data storage
+ save: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
+ }
+ },
+
+ // Restores a set of previously saved properties from a data storage
+ restore: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
+ }
+ },
+
+ setMode: function(el, mode) {
+ if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
+ return mode;
+ },
+
+ getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
+ // this should be a little more flexible in the future to handle a string & hash
+ var y, x;
+ switch (origin[0]) {
+ case 'top': y = 0; break;
+ case 'middle': y = 0.5; break;
+ case 'bottom': y = 1; break;
+ default: y = origin[0] / original.height;
+ };
+ switch (origin[1]) {
+ case 'left': x = 0; break;
+ case 'center': x = 0.5; break;
+ case 'right': x = 1; break;
+ default: x = origin[1] / original.width;
+ };
+ return {x: x, y: y};
+ },
+
+ // Wraps the element around a wrapper that copies position properties
+ createWrapper: function(element) {
+
+ // if the element is already wrapped, return it
+ if (element.parent().is('.ui-effects-wrapper')) {
+ return element.parent();
+ }
+
+ // wrap the element
+ var props = {
+ width: element.outerWidth(true),
+ height: element.outerHeight(true),
+ 'float': element.css('float')
+ },
+ wrapper = $('<div></div>')
+ .addClass('ui-effects-wrapper')
+ .css({
+ fontSize: '100%',
+ background: 'transparent',
+ border: 'none',
+ margin: 0,
+ padding: 0
+ });
+
+ element.wrap(wrapper);
+ wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element
+
+ // transfer positioning properties to the wrapper
+ if (element.css('position') == 'static') {
+ wrapper.css({ position: 'relative' });
+ element.css({ position: 'relative' });
+ } else {
+ $.extend(props, {
+ position: element.css('position'),
+ zIndex: element.css('z-index')
+ });
+ $.each(['top', 'left', 'bottom', 'right'], function(i, pos) {
+ props[pos] = element.css(pos);
+ if (isNaN(parseInt(props[pos], 10))) {
+ props[pos] = 'auto';
+ }
+ });
+ element.css({position: 'relative', top: 0, left: 0 });
+ }
+
+ return wrapper.css(props).show();
+ },
+
+ removeWrapper: function(element) {
+ if (element.parent().is('.ui-effects-wrapper'))
+ return element.parent().replaceWith(element);
+ return element;
+ },
+
+ setTransition: function(element, list, factor, value) {
+ value = value || {};
+ $.each(list, function(i, x){
+ unit = element.cssUnit(x);
+ if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
+ });
+ return value;
+ }
+});
+
+
+function _normalizeArguments(effect, options, speed, callback) {
+ // shift params for method overloading
+ if (typeof effect == 'object') {
+ callback = options;
+ speed = null;
+ options = effect;
+ effect = options.effect;
+ }
+ if ($.isFunction(options)) {
+ callback = options;
+ speed = null;
+ options = {};
+ }
+ if ($.isFunction(speed)) {
+ callback = speed;
+ speed = null;
+ }
+ if (typeof options == 'number' || $.fx.speeds[options]) {
+ callback = speed;
+ speed = options;
+ options = {};
+ }
+
+ options = options || {};
+
+ speed = speed || options.duration;
+ speed = $.fx.off ? 0 : typeof speed == 'number'
+ ? speed : $.fx.speeds[speed] || $.fx.speeds._default;
+
+ callback = callback || options.complete;
+
+ return [effect, options, speed, callback];
+}
+
+$.fn.extend({
+ effect: function(effect, options, speed, callback) {
+ var args = _normalizeArguments.apply(this, arguments),
+ // TODO: make effects takes actual parameters instead of a hash
+ args2 = {
+ options: args[1],
+ duration: args[2],
+ callback: args[3]
+ },
+ effectMethod = $.effects[effect];
+
+ return effectMethod && !$.fx.off ? effectMethod.call(this, args2) : this;
+ },
+
+ _show: $.fn.show,
+ show: function(speed) {
+ if (!speed || typeof speed == 'number' || $.fx.speeds[speed]) {
+ return this._show.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'show';
+ return this.effect.apply(this, args);
+ }
+ },
+
+ _hide: $.fn.hide,
+ hide: function(speed) {
+ if (!speed || typeof speed == 'number' || $.fx.speeds[speed]) {
+ return this._hide.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'hide';
+ return this.effect.apply(this, args);
+ }
+ },
+
+ // jQuery core overloads toggle and create _toggle
+ __toggle: $.fn.toggle,
+ toggle: function(speed) {
+ if (!speed || typeof speed == 'number' || $.fx.speeds[speed] ||
+ typeof speed == 'boolean' || $.isFunction(speed)) {
+ return this.__toggle.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'toggle';
+ return this.effect.apply(this, args);
+ }
+ },
+
+ // helper functions
+ cssUnit: function(key) {
+ var style = this.css(key), val = [];
+ $.each( ['em','px','%','pt'], function(i, unit){
+ if(style.indexOf(unit) > 0)
+ val = [parseFloat(style), unit];
+ });
+ return val;
+ }
+});
+
+
+
+/******************************************************************************/
+/*********************************** EASING ***********************************/
+/******************************************************************************/
+
+/*
+ * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
+ *
+ * Uses the built in easing capabilities added In jQuery 1.1
+ * to offer multiple easing options
+ *
+ * TERMS OF USE - jQuery Easing
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2008 George McGinley Smith
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+*/
+
+// t: current time, b: begInnIng value, c: change In value, d: duration
+$.easing.jswing = $.easing.swing;
+
+$.extend($.easing,
+{
+ def: 'easeOutQuad',
+ swing: function (x, t, b, c, d) {
+ //alert($.easing.default);
+ return $.easing[$.easing.def](x, t, b, c, d);
+ },
+ easeInQuad: function (x, t, b, c, d) {
+ return c*(t/=d)*t + b;
+ },
+ easeOutQuad: function (x, t, b, c, d) {
+ return -c *(t/=d)*(t-2) + b;
+ },
+ easeInOutQuad: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t + b;
+ return -c/2 * ((--t)*(t-2) - 1) + b;
+ },
+ easeInCubic: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t + b;
+ },
+ easeOutCubic: function (x, t, b, c, d) {
+ return c*((t=t/d-1)*t*t + 1) + b;
+ },
+ easeInOutCubic: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t + b;
+ return c/2*((t-=2)*t*t + 2) + b;
+ },
+ easeInQuart: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t*t + b;
+ },
+ easeOutQuart: function (x, t, b, c, d) {
+ return -c * ((t=t/d-1)*t*t*t - 1) + b;
+ },
+ easeInOutQuart: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
+ return -c/2 * ((t-=2)*t*t*t - 2) + b;
+ },
+ easeInQuint: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t*t*t + b;
+ },
+ easeOutQuint: function (x, t, b, c, d) {
+ return c*((t=t/d-1)*t*t*t*t + 1) + b;
+ },
+ easeInOutQuint: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
+ return c/2*((t-=2)*t*t*t*t + 2) + b;
+ },
+ easeInSine: function (x, t, b, c, d) {
+ return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
+ },
+ easeOutSine: function (x, t, b, c, d) {
+ return c * Math.sin(t/d * (Math.PI/2)) + b;
+ },
+ easeInOutSine: function (x, t, b, c, d) {
+ return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
+ },
+ easeInExpo: function (x, t, b, c, d) {
+ return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
+ },
+ easeOutExpo: function (x, t, b, c, d) {
+ return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
+ },
+ easeInOutExpo: function (x, t, b, c, d) {
+ if (t==0) return b;
+ if (t==d) return b+c;
+ if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
+ return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
+ },
+ easeInCirc: function (x, t, b, c, d) {
+ return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
+ },
+ easeOutCirc: function (x, t, b, c, d) {
+ return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
+ },
+ easeInOutCirc: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
+ return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
+ },
+ easeInElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+ },
+ easeOutElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
+ },
+ easeInOutElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5);
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+ return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
+ },
+ easeInBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ return c*(t/=d)*t*((s+1)*t - s) + b;
+ },
+ easeOutBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
+ },
+ easeInOutBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
+ return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
+ },
+ easeInBounce: function (x, t, b, c, d) {
+ return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b;
+ },
+ easeOutBounce: function (x, t, b, c, d) {
+ if ((t/=d) < (1/2.75)) {
+ return c*(7.5625*t*t) + b;
+ } else if (t < (2/2.75)) {
+ return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
+ } else if (t < (2.5/2.75)) {
+ return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
+ } else {
+ return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
+ }
+ },
+ easeInOutBounce: function (x, t, b, c, d) {
+ if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
+ return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
+ }
+});
+
+/*
+ *
+ * TERMS OF USE - EASING EQUATIONS
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2001 Robert Penner
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+ */
+
+})(jQuery);
+/*
+ * jQuery UI Effects Blind 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Blind
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.blind = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'vertical') ? 'height' : 'width';
+ var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width();
+ if(mode == 'show') wrapper.css(ref, 0); // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref] = mode == 'show' ? distance : 0;
+
+ // Animate
+ wrapper.animate(animation, o.duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Bounce 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Bounce
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.bounce = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'up'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 5; // Default # of times
+ var speed = o.duration || 250; // Default speed per bounce
+ if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+ if (mode == 'hide') distance = distance / (times * 2);
+ if (mode != 'hide') times--;
+
+ // Animate
+ if (mode == 'show') { // Show Bounce
+ var animation = {opacity: 1};
+ animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation, speed / 2, o.options.easing);
+ distance = distance / 2;
+ times--;
+ };
+ for (var i = 0; i < times; i++) { // Bounces
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing);
+ distance = (mode == 'hide') ? distance * 2 : distance / 2;
+ };
+ if (mode == 'hide') { // Last Bounce
+ var animation = {opacity: 0};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ el.animate(animation, speed / 2, o.options.easing, function(){
+ el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ } else {
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ };
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Clip 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Clip
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.clip = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','height','width'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var animate = el[0].tagName == 'IMG' ? wrapper : el;
+ var ref = {
+ size: (direction == 'vertical') ? 'height' : 'width',
+ position: (direction == 'vertical') ? 'top' : 'left'
+ };
+ var distance = (direction == 'vertical') ? animate.height() : animate.width();
+ if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref.size] = mode == 'show' ? distance : 0;
+ animation[ref.position] = mode == 'show' ? 0 : distance / 2;
+
+ // Animate
+ animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Drop 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Drop
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.drop = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','opacity'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+
+ // Animation
+ var animation = {opacity: mode == 'show' ? 1 : 0};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Explode 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Explode
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.explode = function(o) {
+
+ return this.queue(function() {
+
+ var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+ var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+
+ o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode;
+ var el = $(this).show().css('visibility', 'hidden');
+ var offset = el.offset();
+
+ //Substract the margins - not fixing the problem yet.
+ offset.top -= parseInt(el.css("marginTop"),10) || 0;
+ offset.left -= parseInt(el.css("marginLeft"),10) || 0;
+
+ var width = el.outerWidth(true);
+ var height = el.outerHeight(true);
+
+ for(var i=0;i<rows;i++) { // =
+ for(var j=0;j<cells;j++) { // ||
+ el
+ .clone()
+ .appendTo('body')
+ .wrap('<div></div>')
+ .css({
+ position: 'absolute',
+ visibility: 'visible',
+ left: -j*(width/cells),
+ top: -i*(height/rows)
+ })
+ .parent()
+ .addClass('ui-effects-explode')
+ .css({
+ position: 'absolute',
+ overflow: 'hidden',
+ width: width/cells,
+ height: height/rows,
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0),
+ opacity: o.options.mode == 'show' ? 0 : 1
+ }).animate({
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)),
+ opacity: o.options.mode == 'show' ? 1 : 0
+ }, o.duration || 500);
+ }
+ }
+
+ // Set a timeout, to call the callback approx. when the other animations have finished
+ setTimeout(function() {
+
+ o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide();
+ if(o.callback) o.callback.apply(el[0]); // Callback
+ el.dequeue();
+
+ $('div.ui-effects-explode').remove();
+
+ }, o.duration || 500);
+
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Fold 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.fold = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var size = o.options.size || 15; // Default fold size
+ var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value
+ var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var widthFirst = ((mode == 'show') != horizFirst);
+ var ref = widthFirst ? ['width', 'height'] : ['height', 'width'];
+ var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];
+ var percent = /([0-9]+)%/.exec(size);
+ if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1];
+ if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift
+
+ // Animation
+ var animation1 = {}, animation2 = {};
+ animation1[ref[0]] = mode == 'show' ? distance[0] : size;
+ animation2[ref[1]] = mode == 'show' ? distance[1] : 0;
+
+ // Animate
+ wrapper.animate(animation1, duration, o.options.easing)
+ .animate(animation2, duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Highlight 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.highlight = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ props = ['backgroundImage', 'backgroundColor', 'opacity'],
+ mode = $.effects.setMode(elem, o.options.mode || 'show'),
+ animation = {
+ backgroundColor: elem.css('backgroundColor')
+ };
+
+ if (mode == 'hide') {
+ animation.opacity = 0;
+ }
+
+ $.effects.save(elem, props);
+ elem
+ .show()
+ .css({
+ backgroundImage: 'none',
+ backgroundColor: o.options.color || '#ffff99'
+ })
+ .animate(animation, {
+ queue: false,
+ duration: o.duration,
+ easing: o.options.easing,
+ complete: function() {
+ (mode == 'hide' && elem.hide());
+ $.effects.restore(elem, props);
+ (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter'));
+ (o.callback && o.callback.apply(this, arguments));
+ elem.dequeue();
+ }
+ });
+ });
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Pulsate 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.pulsate = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ mode = $.effects.setMode(elem, o.options.mode || 'show');
+ times = ((o.options.times || 5) * 2) - 1;
+ duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2,
+ isVisible = elem.is(':visible'),
+ animateTo = 0;
+
+ if (!isVisible) {
+ elem.css('opacity', 0).show();
+ animateTo = 1;
+ }
+
+ if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) {
+ times--;
+ }
+
+ for (var i = 0; i < times; i++) {
+ elem.animate({ opacity: animateTo }, duration, o.options.easing);
+ animateTo = (animateTo + 1) % 2;
+ }
+
+ elem.animate({ opacity: animateTo }, duration, o.options.easing, function() {
+ if (animateTo == 0) {
+ elem.hide();
+ }
+ (o.callback && o.callback.apply(this, arguments));
+ });
+
+ elem
+ .queue('fx', function() { elem.dequeue(); })
+ .dequeue();
+ });
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Scale 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Scale
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.puff = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ mode = $.effects.setMode(elem, o.options.mode || 'hide'),
+ percent = parseInt(o.options.percent, 10) || 150,
+ factor = percent / 100,
+ original = { height: elem.height(), width: elem.width() };
+
+ $.extend(o.options, {
+ fade: true,
+ mode: mode,
+ percent: mode == 'hide' ? percent : 100,
+ from: mode == 'hide'
+ ? original
+ : {
+ height: original.height * factor,
+ width: original.width * factor
+ }
+ });
+
+ elem.effect('scale', o.options, o.duration, o.callback);
+ elem.dequeue();
+ });
+};
+
+$.effects.scale = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var options = $.extend(true, {}, o.options);
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent
+ var direction = o.options.direction || 'both'; // Set default axis
+ var origin = o.options.origin; // The origin of the scaling
+ if (mode != 'effect') { // Set default origin and restore for show/hide
+ options.origin = origin || ['middle','center'];
+ options.restore = true;
+ }
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state
+
+ // Adjust
+ var factor = { // Set scaling factor
+ y: direction != 'horizontal' ? (percent / 100) : 1,
+ x: direction != 'vertical' ? (percent / 100) : 1
+ };
+ el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state
+
+ if (o.options.fade) { // Fade option to support puff
+ if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;};
+ if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;};
+ };
+
+ // Animation
+ options.from = el.from; options.to = el.to; options.mode = mode;
+
+ // Animate
+ el.effect('size', options, o.duration, o.callback);
+ el.dequeue();
+ });
+
+};
+
+$.effects.size = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','width','height','overflow','opacity'];
+ var props1 = ['position','top','left','overflow','opacity']; // Always restore
+ var props2 = ['width','height','overflow']; // Copy for children
+ var cProps = ['fontSize'];
+ var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'];
+ var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var restore = o.options.restore || false; // Default restore
+ var scale = o.options.scale || 'both'; // Default scale mode
+ var origin = o.options.origin; // The origin of the sizing
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || original; // Default from state
+ el.to = o.options.to || original; // Default to state
+ // Adjust
+ if (origin) { // Calculate baseline shifts
+ var baseline = $.effects.getBaseline(origin, original);
+ el.from.top = (original.height - el.from.height) * baseline.y;
+ el.from.left = (original.width - el.from.width) * baseline.x;
+ el.to.top = (original.height - el.to.height) * baseline.y;
+ el.to.left = (original.width - el.to.width) * baseline.x;
+ };
+ var factor = { // Set scaling factor
+ from: {y: el.from.height / original.height, x: el.from.width / original.width},
+ to: {y: el.to.height / original.height, x: el.to.width / original.width}
+ };
+ if (scale == 'box' || scale == 'both') { // Scale the css box
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(vProps);
+ el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ props = props.concat(hProps);
+ el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
+ el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
+ };
+ };
+ if (scale == 'content' || scale == 'both') { // Scale the content
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(cProps);
+ el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
+ };
+ };
+ $.effects.save(el, restore ? props : props1); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ el.css('overflow','hidden').css(el.from); // Shift
+
+ // Animate
+ if (scale == 'content' || scale == 'both') { // Scale the children
+ vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size
+ hProps = hProps.concat(['marginLeft','marginRight']); // Add margins
+ props2 = props.concat(vProps).concat(hProps); // Concat
+ el.find("*[width]").each(function(){
+ child = $(this);
+ if (restore) $.effects.save(child, props2);
+ var c_original = {height: child.height(), width: child.width()}; // Save original
+ child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x};
+ child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x};
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
+ child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
+ child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
+ };
+ child.css(child.from); // Shift children
+ child.animate(child.to, o.duration, o.options.easing, function(){
+ if (restore) $.effects.restore(child, props2); // Restore children
+ }); // Animate children
+ });
+ };
+
+ // Animate
+ el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if (el.to.opacity === 0) {
+ el.css('opacity', el.from.opacity);
+ }
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Shake 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Shake
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.shake = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 3; // Default # of times
+ var speed = o.duration || o.options.duration || 140; // Default speed per shake
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+
+ // Animation
+ var animation = {}, animation1 = {}, animation2 = {};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2;
+ animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2;
+
+ // Animate
+ el.animate(animation, speed, o.options.easing);
+ for (var i = 1; i < times; i++) { // Shakes
+ el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing);
+ };
+ el.animate(animation1, speed, o.options.easing).
+ animate(animation, speed / 2, o.options.easing, function(){ // Last shake
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Slide 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Slide
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.slide = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true}));
+ if (mode == 'show') el.css(ref, motion == 'pos' ? -distance : distance); // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Transfer 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Transfer
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.transfer = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ target = $(o.options.to),
+ endPosition = target.offset(),
+ animation = {
+ top: endPosition.top,
+ left: endPosition.left,
+ height: target.innerHeight(),
+ width: target.innerWidth()
+ },
+ startPosition = elem.offset(),
+ transfer = $('<div class="ui-effects-transfer"></div>')
+ .appendTo(document.body)
+ .addClass(o.options.className)
+ .css({
+ top: startPosition.top,
+ left: startPosition.left,
+ height: elem.innerHeight(),
+ width: elem.innerWidth(),
+ position: 'absolute'
+ })
+ .animate(animation, o.duration, o.options.easing, function() {
+ transfer.remove();
+ (o.callback && o.callback.apply(elem[0], arguments));
+ elem.dequeue();
+ });
+ });
+};
+
+})(jQuery);
diff --git a/js/jquery/jquery-ui-1.8.custom.min.js b/js/jquery/jquery-ui-1.8.custom.min.js
deleted file mode 100644
index 71d28f5..0000000
--- a/js/jquery/jquery-ui-1.8.custom.min.js
+++ /dev/null
@@ -1,42 +0,0 @@
-/*
- * jQuery UI Effects 1.8
- *
- * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/
- */
jQuery.effects||(function(g){g.effects={};g.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","color","outlineColor"],function(l,k){g.fx.step[k]=function(m){if(!m.colorInit){m.start=j(m.elem,k);m.end=i(m.end);m.colorInit=true}m.elem.style[k]="rgb("+Math.max(Math.min(parseInt((m.pos*(m.end[0]-m.start[0]))+m.start[0],10),255),0)+","+Math.max(Math.min(parseInt((m.pos*(m.end[1]-m.start[1]))+m.start[1],10),255),0)+","+Math.max(Math.min(parseInt((m.pos*(m.end[2]-m.start[2]))+m.start[2],10),255),0)+")"}});function i(l){var k;if(l&&l.constructor==Array&&l.length==3){return l}if(k=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(l)){return[parseInt(k[1],10),parseInt(k[2],10),parseInt(k[3],10)]}if(k=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(l)){return[parseFloat(k[1])*2.55,parseFloat(k[2])*2.55,parseFloat(k[3])*2.55]}if(k=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(l)){return[parseInt(k[1],16),parseInt(k[2],16),parseInt(k[3],16)]}if(k=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(l)){return[parseInt(k[1]+k[1],16),parseInt(k[2]+k[2],16),parseInt(k[3]+k[3],16)]}if(k=/rgba\(0, 0, 0, 0\)/.exec(l)){return a.transparent}return a[g.trim(l).toLowerCase()]}function j(m,k){var l;do{l=g.curCSS(m,k);if(l!=""&&l!="transparent"||g.nodeName(m,"body")){break}k="backgroundColor"}while(m=m.parentNode);return i(l)}var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211]
ghtpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]};var e=["add","remove","toggle"],c={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};function f(){var n=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,o={},l,m;if(n&&n.length&&n[0]&&n[n[0]]){var k=n.length;while(k--){l=n[k];if(typeof n[l]=="string"){m=l.replace(/\-(\w)/g,function(p,q){return q.toUpperCase()});o[m]=n[l]}}}else{for(l in n){if(typeof n[l]==="string"){o[l]=n[l]}}}return o}function b(l){var k,m;for(k in l){m=l[k];if(m==null||g.isFunction(m)||k in c||(/scrollbar/).test(k)||(!(/color/i).test(k)&&isNaN(parseFloat(m)))){delete l[k]}}return l}function h(k,m){var n={_:0},l;for(l in m){if(k[l]!=m[l]){n[l]=m[l]}}return n}g.effects.animateClass=function(k,l,n,m){if(g.isFunction(n)){m=n;n=null}return this.each(function(){var r=g(this),o=r.attr("style")||" ",s=b(f.call(this)),q,p=r.attr("className");g.each(e,function(t,u){if(k[u]){r[u+"Class"](k[u])}});q=b(f.call(this));r.attr("className",p);r.animate(h(s,q),l,n,function(){g.each(e,function(t,u){if(k[u]){r[u+"Class"](k[u])}});if(typeof r.attr("style")=="object"){r.attr("style").cssText="";r.attr("style").cssText=o}else{r.attr("style",o)}if(m){m.apply(this,arguments)}})})};g.fn.extend({_addClass:g.fn.addClass,addClass:function(l,k,n,m){return k?g.effects.animateClass.apply(this,[{add:l},k,n,m]):this._addClass(l)},_removeClass:g.fn.removeClass,removeClass:function(l,k,n,m){return k?g.effects.animateClass.apply(this,[{remove:l},k,n,m]):this._removeClass(l)},_toggleClass:g.fn.toggleClass,toggleClass:function(m,l,k,o,n){if(typeof l=="boolean"||l===undefined){if(!k){return this._toggleClass(m,l)}else{return g.effects.animateClass.apply(this,[(l?{add:m}:{remove:
,k,o,n])}}else{return g.effects.animateClass.apply(this,[{toggle:m},l,k,o])}},switchClass:function(k,m,l,o,n){return g.effects.animateClass.apply(this,[{add:m,remove:k},l,o,n])}});g.extend(g.effects,{version:"1.8",save:function(l,m){for(var k=0;k<m.length;k++){if(m[k]!==null){l.data("ec.storage."+m[k],l[0].style[m[k]])}}},restore:function(l,m){for(var k=0;k<m.length;k++){if(m[k]!==null){l.css(m[k],l.data("ec.storage."+m[k]))}}},setMode:function(k,l){if(l=="toggle"){l=k.is(":hidden")?"show":"hide"}return l},getBaseline:function(l,m){var n,k;switch(l[0]){case"top":n=0;break;case"middle":n=0.5;break;case"bottom":n=1;break;default:n=l[0]/m.height}switch(l[1]){case"left":k=0;break;case"center":k=0.5;break;case"right":k=1;break;default:k=l[1]/m.width}return{x:k,y:n}},createWrapper:function(k){if(k.parent().is(".ui-effects-wrapper")){return k.parent()}var l={width:k.outerWidth(true),height:k.outerHeight(true),"float":k.css("float")},m=g("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0});k.wrap(m);m=k.parent();if(k.css("position")=="static"){m.css({position:"relative"});k.css({position:"relative"})}else{g.extend(l,{position:k.css("position"),zIndex:k.css("z-index")});g.each(["top","left","bottom","right"],function(n,o){l[o]=k.css(o);if(isNaN(parseInt(l[o],10))){l[o]="auto"}});k.css({position:"relative",top:0,left:0})}return m.css(l).show()},removeWrapper:function(k){if(k.parent().is(".ui-effects-wrapper")){return k.parent().replaceWith(k)}return k},setTransition:function(l,n,k,m){m=m||{};g.each(n,function(p,o){unit=l.cssUnit(o);if(unit[0]>0){m[o]=unit[0]*k+unit[1]}});return m}});function d(l,k,m,n){if(typeof l=="object"){n=k;m=null;k=l;l=k.effect}if(g.isFunction(k)){n=k;m=null;k={}}if(g.isFunction(m)){n=m;m=null}if(typeof k=="number"||g.fx.speeds[k]){n=m;m=k;k={}}k=k||{};m=m||k.duration;m=g.fx.off?0:typeof m=="number"?m:g.fx.speeds[m]||g.fx.speeds._default;n=n||k.complete;return[l,k,m,n]}g.fn.extend({effect:function(n,m,p,q){var l=d.apply(this
guments),o={options:l[1],duration:l[2],callback:l[3]},k=g.effects[n];return k&&!g.fx.off?k.call(this,o):this},_show:g.fn.show,show:function(l){if(!l||typeof l=="number"||g.fx.speeds[l]){return this._show.apply(this,arguments)}else{var k=d.apply(this,arguments);k[1].mode="show";return this.effect.apply(this,k)}},_hide:g.fn.hide,hide:function(l){if(!l||typeof l=="number"||g.fx.speeds[l]){return this._hide.apply(this,arguments)}else{var k=d.apply(this,arguments);k[1].mode="hide";return this.effect.apply(this,k)}},__toggle:g.fn.toggle,toggle:function(l){if(!l||typeof l=="number"||g.fx.speeds[l]||typeof l=="boolean"||g.isFunction(l)){return this.__toggle.apply(this,arguments)}else{var k=d.apply(this,arguments);k[1].mode="toggle";return this.effect.apply(this,k)}},cssUnit:function(k){var l=this.css(k),m=[];g.each(["em","px","%","pt"],function(n,o){if(l.indexOf(o)>0){m=[parseFloat(l),o]}});return m}});g.easing.jswing=g.easing.swing;g.extend(g.easing,{def:"easeOutQuad",swing:function(l,m,k,o,n){return g.easing[g.easing.def](l,m,k,o,n)},easeInQuad:function(l,m,k,o,n){return o*(m/=n)*m+k},easeOutQuad:function(l,m,k,o,n){return -o*(m/=n)*(m-2)+k},easeInOutQuad:function(l,m,k,o,n){if((m/=n/2)<1){return o/2*m*m+k}return -o/2*((--m)*(m-2)-1)+k},easeInCubic:function(l,m,k,o,n){return o*(m/=n)*m*m+k},easeOutCubic:function(l,m,k,o,n){return o*((m=m/n-1)*m*m+1)+k},easeInOutCubic:function(l,m,k,o,n){if((m/=n/2)<1){return o/2*m*m*m+k}return o/2*((m-=2)*m*m+2)+k},easeInQuart:function(l,m,k,o,n){return o*(m/=n)*m*m*m+k},easeOutQuart:function(l,m,k,o,n){return -o*((m=m/n-1)*m*m*m-1)+k},easeInOutQuart:function(l,m,k,o,n){if((m/=n/2)<1){return o/2*m*m*m*m+k}return -o/2*((m-=2)*m*m*m-2)+k},easeInQuint:function(l,m,k,o,n){return o*(m/=n)*m*m*m*m+k},easeOutQuint:function(l,m,k,o,n){return o*((m=m/n-1)*m*m*m*m+1)+k},easeInOutQuint:function(l,m,k,o,n){if((m/=n/2)<1){return o/2*m*m*m*m*m+k}return o/2*((m-=2)*m*m*m*m+2)+k},easeInSine:function(l,m,k,o,n){return -o*Math.cos(m/n*(Math.PI/2))+o+k},easeOutSine:function(l,m,k,o,n){return o*Math.si
/n*(Math.PI/2))+k},easeInOutSine:function(l,m,k,o,n){return -o/2*(Math.cos(Math.PI*m/n)-1)+k},easeInExpo:function(l,m,k,o,n){return(m==0)?k:o*Math.pow(2,10*(m/n-1))+k},easeOutExpo:function(l,m,k,o,n){return(m==n)?k+o:o*(-Math.pow(2,-10*m/n)+1)+k},easeInOutExpo:function(l,m,k,o,n){if(m==0){return k}if(m==n){return k+o}if((m/=n/2)<1){return o/2*Math.pow(2,10*(m-1))+k}return o/2*(-Math.pow(2,-10*--m)+2)+k},easeInCirc:function(l,m,k,o,n){return -o*(Math.sqrt(1-(m/=n)*m)-1)+k},easeOutCirc:function(l,m,k,o,n){return o*Math.sqrt(1-(m=m/n-1)*m)+k},easeInOutCirc:function(l,m,k,o,n){if((m/=n/2)<1){return -o/2*(Math.sqrt(1-m*m)-1)+k}return o/2*(Math.sqrt(1-(m-=2)*m)+1)+k},easeInElastic:function(l,n,k,u,r){var o=1.70158;var q=0;var m=u;if(n==0){return k}if((n/=r)==1){return k+u}if(!q){q=r*0.3}if(m<Math.abs(u)){m=u;var o=q/4}else{var o=q/(2*Math.PI)*Math.asin(u/m)}return -(m*Math.pow(2,10*(n-=1))*Math.sin((n*r-o)*(2*Math.PI)/q))+k},easeOutElastic:function(l,n,k,u,r){var o=1.70158;var q=0;var m=u;if(n==0){return k}if((n/=r)==1){return k+u}if(!q){q=r*0.3}if(m<Math.abs(u)){m=u;var o=q/4}else{var o=q/(2*Math.PI)*Math.asin(u/m)}return m*Math.pow(2,-10*n)*Math.sin((n*r-o)*(2*Math.PI)/q)+u+k},easeInOutElastic:function(l,n,k,u,r){var o=1.70158;var q=0;var m=u;if(n==0){return k}if((n/=r/2)==2){return k+u}if(!q){q=r*(0.3*1.5)}if(m<Math.abs(u)){m=u;var o=q/4}else{var o=q/(2*Math.PI)*Math.asin(u/m)}if(n<1){return -0.5*(m*Math.pow(2,10*(n-=1))*Math.sin((n*r-o)*(2*Math.PI)/q))+k}return m*Math.pow(2,-10*(n-=1))*Math.sin((n*r-o)*(2*Math.PI)/q)*0.5+u+k},easeInBack:function(l,m,k,p,o,n){if(n==undefined){n=1.70158}return p*(m/=o)*m*((n+1)*m-n)+k},easeOutBack:function(l,m,k,p,o,n){if(n==undefined){n=1.70158}return p*((m=m/o-1)*m*((n+1)*m+n)+1)+k},easeInOutBack:function(l,m,k,p,o,n){if(n==undefined){n=1.70158}if((m/=o/2)<1){return p/2*(m*m*(((n*=(1.525))+1)*m-n))+k}return p/2*((m-=2)*m*(((n*=(1.525))+1)*m+n)+2)+k},easeInBounce:function(l,m,k,o,n){return o-g.easing.easeOutBounce(l,n-m,0,o,n)+k},easeOutBounce:function(l,m,k,o,n){if((m/=n)<(1/2.7
{return o*(7.5625*m*m)+k}else{if(m<(2/2.75)){return o*(7.5625*(m-=(1.5/2.75))*m+0.75)+k}else{if(m<(2.5/2.75)){return o*(7.5625*(m-=(2.25/2.75))*m+0.9375)+k}else{return o*(7.5625*(m-=(2.625/2.75))*m+0.984375)+k}}}},easeInOutBounce:function(l,m,k,o,n){if(m<n/2){return g.easing.easeInBounce(l,m*2,0,o,n)*0.5+k}return g.easing.easeOutBounce(l,m*2-n,0,o,n)*0.5+o*0.5+k}})})(jQuery);;/*
- * jQuery UI Effects Clip 1.8
- *
- * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Clip
- *
- * Depends:
- * jquery.effects.core.js
- */
(function(a){a.effects.clip=function(b){return this.queue(function(){var f=a(this),j=["position","top","left","height","width"];var i=a.effects.setMode(f,b.options.mode||"hide");var k=b.options.direction||"vertical";a.effects.save(f,j);f.show();var c=a.effects.createWrapper(f).css({overflow:"hidden"});var e=f[0].tagName=="IMG"?c:f;var g={size:(k=="vertical")?"height":"width",position:(k=="vertical")?"top":"left"};var d=(k=="vertical")?e.height():e.width();if(i=="show"){e.css(g.size,0);e.css(g.position,d/2)}var h={};h[g.size]=i=="show"?d:0;h[g.position]=i=="show"?0:d/2;e.animate(h,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(i=="hide"){f.hide()}a.effects.restore(f,j);a.effects.removeWrapper(f);if(b.callback){b.callback.apply(f[0],arguments)}f.dequeue()}})})}})(jQuery);;/*
- * jQuery UI Effects Drop 1.8
- *
- * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Drop
- *
- * Depends:
- * jquery.effects.core.js
- */
(function(a){a.effects.drop=function(b){return this.queue(function(){var e=a(this),d=["position","top","left","opacity"];var i=a.effects.setMode(e,b.options.mode||"hide");var h=b.options.direction||"left";a.effects.save(e,d);e.show();a.effects.createWrapper(e);var f=(h=="up"||h=="down")?"top":"left";var c=(h=="up"||h=="left")?"pos":"neg";var j=b.options.distance||(f=="top"?e.outerHeight({margin:true})/2:e.outerWidth({margin:true})/2);if(i=="show"){e.css("opacity",0).css(f,c=="pos"?-j:j)}var g={opacity:i=="show"?1:0};g[f]=(i=="show"?(c=="pos"?"+=":"-="):(c=="pos"?"-=":"+="))+j;e.animate(g,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(i=="hide"){e.hide()}a.effects.restore(e,d);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}e.dequeue()}})})}})(jQuery);;/*
- * jQuery UI Effects Slide 1.8
- *
- * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Slide
- *
- * Depends:
- * jquery.effects.core.js
- */
(function(a){a.effects.slide=function(b){return this.queue(function(){var e=a(this),d=["position","top","left"];var i=a.effects.setMode(e,b.options.mode||"show");var h=b.options.direction||"left";a.effects.save(e,d);e.show();a.effects.createWrapper(e).css({overflow:"hidden"});var f=(h=="up"||h=="down")?"top":"left";var c=(h=="up"||h=="left")?"pos":"neg";var j=b.options.distance||(f=="top"?e.outerHeight({margin:true}):e.outerWidth({margin:true}));if(i=="show"){e.css(f,c=="pos"?-j:j)}var g={};g[f]=(i=="show"?(c=="pos"?"+=":"-="):(c=="pos"?"-=":"+="))+j;e.animate(g,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(i=="hide"){e.hide()}a.effects.restore(e,d);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}e.dequeue()}})})}})(jQuery);;
\ No newline at end of file
diff --git a/setup/index.php b/setup/index.php
index 2bd3d48..0d16e5f 100644
--- a/setup/index.php
+++ b/setup/index.php
@@ -35,7 +35,7 @@ require './libraries/header_http.inc.php';
<link href="../favicon.ico" rel="shortcut icon" type="image/x-icon" />
<link href="styles.css" rel="stylesheet" type="text/css" />
<script type="text/javascript" src="../js/jquery/jquery-1.4.2.js"></script>
-<script type="text/javascript" src="../js/jquery/jquery-ui-1.8.custom.min.js"></script>
+<script type="text/javascript" src="../js/jquery/jquery-ui-1.8.custom.js"></script>
<script type="text/javascript" src="../js/jquery/jquery.json-2.2.js"></script>
<script type="text/javascript" src="scripts.js"></script>
</head>
diff --git a/sql.php b/sql.php
index 16f47ac..3046c5b 100644
--- a/sql.php
+++ b/sql.php
@@ -15,7 +15,7 @@ require_once './libraries/Table.class.php';
require_once './libraries/check_user_privileges.lib.php';
require_once './libraries/bookmark.lib.php';
-$GLOBALS['js_include'][] = 'jquery/jquery-ui-1.8.custom.min.js';
+$GLOBALS['js_include'][] = 'jquery/jquery-ui-1.8.custom.js';
/**
* Defines the url to return to in case of error in a sql statement
diff --git a/tbl_replace.php b/tbl_replace.php
index 39bf6a2..f19049b 100644
--- a/tbl_replace.php
+++ b/tbl_replace.php
@@ -431,7 +431,7 @@ if (isset($return_to_sql_query)) {
$GLOBALS['js_include'][] = 'tbl_change.js';
$GLOBALS['js_include'][] = 'functions.js';
// in case we call sql.php which needs those:
-$GLOBALS['js_include'][] = 'jquery/jquery-ui-1.8.custom.min.js';
+$GLOBALS['js_include'][] = 'jquery/jquery-ui-1.8.custom.js';
$active_page = $goto_include;
diff --git a/tbl_select.php b/tbl_select.php
index 8d23c95..879c0e6 100644
--- a/tbl_select.php
+++ b/tbl_select.php
@@ -19,7 +19,7 @@ require_once './libraries/relation.lib.php'; // foreign keys
require_once './libraries/mysql_charsets.lib.php';
$GLOBALS['js_include'][] = 'tbl_change.js';
-$GLOBALS['js_include'][] = 'jquery/jquery-ui-1.8.custom.min.js';
+$GLOBALS['js_include'][] = 'jquery/jquery-ui-1.8.custom.js';
if ($GLOBALS['cfg']['PropertiesIconic'] == true) {
$titles['Browse'] =
diff --git a/tbl_structure.php b/tbl_structure.php
index 001ac33..c44fa1a 100644
--- a/tbl_structure.php
+++ b/tbl_structure.php
@@ -14,7 +14,7 @@ require_once './libraries/common.inc.php';
require_once './libraries/mysql_charsets.lib.php';
require_once './libraries/relation.lib.php';
-$GLOBALS['js_include'][] = 'jquery/jquery-ui-1.8.custom.min.js';
+$GLOBALS['js_include'][] = 'jquery/jquery-ui-1.8.custom.js';
/**
* handle multiple field commands if required
hooks/post-receive
--
phpMyAdmin
1
0
[Phpmyadmin-git] [SCM] phpMyAdmin branch, master, updated. RELEASE_3_3_2-1584-g979cc56
by Michal Čihař 15 Apr '10
by Michal Čihař 15 Apr '10
15 Apr '10
The branch, master has been updated
via 979cc56f424baefc65ea8ebbcdf4a92118e4bc17 (commit)
via b6132c51540b24d821641d0a2c7a749bbc55d813 (commit)
via 30acade5a799a77321a9a1e2f7f97681f4e8b401 (commit)
via 48cf4d398d3b5667522ceb702827fe24061d43f0 (commit)
from 72b18cbb9d216cb850700589a184e9ea3e9fc458 (commit)
- Log -----------------------------------------------------------------
commit 979cc56f424baefc65ea8ebbcdf4a92118e4bc17
Merge: 72b18cbb9d216cb850700589a184e9ea3e9fc458 b6132c51540b24d821641d0a2c7a749bbc55d813
Author: Michal Čihař <mcihar(a)novell.com>
Date: Thu Apr 15 09:21:23 2010 +0200
Merge branch 'QA_3_3'
-----------------------------------------------------------------------
Summary of changes:
Documentation.html | 2 +-
translators.html | 2 +-
2 files changed, 2 insertions(+), 2 deletions(-)
diff --git a/Documentation.html b/Documentation.html
index 5e07feb..6805a48 100644
--- a/Documentation.html
+++ b/Documentation.html
@@ -5038,7 +5038,7 @@ Jakub Wilk, Thomas Michael Winningham, Vilius Zigmantas, "Manuzhai".
</div>
<ul id="footer">
- <li>Copyright © 2003 - 2009 <a href="http://www.phpmyadmin.net/home_page/team.php">phpMyAdmin devel team</a></li>
+ <li>Copyright © 2003 - 2010 <a href="http://www.phpmyadmin.net/home_page/team.php">phpMyAdmin devel team</a></li>
<li><a href="LICENSE">License</a></li>
<li><a href="http://www.phpmyadmin.net/home_page/donate.php">Donate</a></li>
<li class="last">Valid <a href="http://validator.w3.org/check/referer">HTML</a> and <a href="http://jigsaw.w3.org/css-validator/check/referer">CSS</a></li>
diff --git a/translators.html b/translators.html
index b4acff5..2cf9227 100644
--- a/translators.html
+++ b/translators.html
@@ -460,7 +460,7 @@
</div>
<ul id="footer">
- <li>Copyright © 2003 - 2009 <a href="http://www.phpmyadmin.net/home_page/team.php">phpMyAdmin devel team</a></li>
+ <li>Copyright © 2003 - 2010 <a href="http://www.phpmyadmin.net/home_page/team.php">phpMyAdmin devel team</a></li>
<li><a href="LICENSE">License</a></li>
<li><a href="http://www.phpmyadmin.net/home_page/donate.php">Donate</a></li>
<li class="last">Valid <a href="http://validator.w3.org/check/referer">HTML</a> and <a href="http://jigsaw.w3.org/css-validator/check/referer">CSS</a></li>
hooks/post-receive
--
phpMyAdmin
1
0
[Phpmyadmin-git] [SCM] phpMyAdmin branch, QA_3_3, updated. RELEASE_3_3_2-18-gb6132c5
by Michal Čihař 15 Apr '10
by Michal Čihař 15 Apr '10
15 Apr '10
The branch, QA_3_3 has been updated
via b6132c51540b24d821641d0a2c7a749bbc55d813 (commit)
via 30acade5a799a77321a9a1e2f7f97681f4e8b401 (commit)
via 48cf4d398d3b5667522ceb702827fe24061d43f0 (commit)
from 55572a531ca411d9a449f409150ffb0836a111d9 (commit)
- Log -----------------------------------------------------------------
-----------------------------------------------------------------------
Summary of changes:
Documentation.html | 2 +-
translators.html | 2 +-
2 files changed, 2 insertions(+), 2 deletions(-)
diff --git a/Documentation.html b/Documentation.html
index 8848f90..c72c690 100644
--- a/Documentation.html
+++ b/Documentation.html
@@ -4999,7 +4999,7 @@ Jakub Wilk, Thomas Michael Winningham, Vilius Zigmantas, "Manuzhai".
</div>
<ul id="footer">
- <li>Copyright © 2003 - 2009 <a href="http://www.phpmyadmin.net/home_page/team.php">phpMyAdmin devel team</a></li>
+ <li>Copyright © 2003 - 2010 <a href="http://www.phpmyadmin.net/home_page/team.php">phpMyAdmin devel team</a></li>
<li><a href="LICENSE">License</a></li>
<li><a href="http://www.phpmyadmin.net/home_page/donate.php">Donate</a></li>
<li class="last">Valid <a href="http://validator.w3.org/check/referer">HTML</a> and <a href="http://jigsaw.w3.org/css-validator/check/referer">CSS</a></li>
diff --git a/translators.html b/translators.html
index ee017b6..fbbe5f9 100644
--- a/translators.html
+++ b/translators.html
@@ -446,7 +446,7 @@
</div>
<ul id="footer">
- <li>Copyright © 2003 - 2009 <a href="http://www.phpmyadmin.net/home_page/team.php">phpMyAdmin devel team</a></li>
+ <li>Copyright © 2003 - 2010 <a href="http://www.phpmyadmin.net/home_page/team.php">phpMyAdmin devel team</a></li>
<li><a href="LICENSE">License</a></li>
<li><a href="http://www.phpmyadmin.net/home_page/donate.php">Donate</a></li>
<li class="last">Valid <a href="http://validator.w3.org/check/referer">HTML</a> and <a href="http://jigsaw.w3.org/css-validator/check/referer">CSS</a></li>
hooks/post-receive
--
phpMyAdmin
1
0
[Phpmyadmin-git] [SCM] phpMyAdmin branch, master, updated. RELEASE_3_3_2RC1-1588-g72b18cb
by Herman van Rink 14 Apr '10
by Herman van Rink 14 Apr '10
14 Apr '10
The branch, master has been updated
via 72b18cbb9d216cb850700589a184e9ea3e9fc458 (commit)
via 55572a531ca411d9a449f409150ffb0836a111d9 (commit)
via 96071655352ab316d2760c141613bebb72c8b2db (commit)
from e2ef709f49e647b190f28f4a991b94c7b466a765 (commit)
- Log -----------------------------------------------------------------
commit 72b18cbb9d216cb850700589a184e9ea3e9fc458
Merge: e2ef709f49e647b190f28f4a991b94c7b466a765 55572a531ca411d9a449f409150ffb0836a111d9
Author: Herman van Rink <rink(a)initfour.nl>
Date: Wed Apr 14 14:10:12 2010 +0200
Merge branch 'QA_3_3'
-----------------------------------------------------------------------
Summary of changes:
ChangeLog | 2 ++
tbl_operations.php | 2 +-
2 files changed, 3 insertions(+), 1 deletions(-)
diff --git a/ChangeLog b/ChangeLog
index d0ecb1e..3f18b26 100644
--- a/ChangeLog
+++ b/ChangeLog
@@ -77,6 +77,8 @@ $Id$
thanks to Madhura Jayaratne - madhuracj
- bug #2974687, bug #2974692 [compatibility] PHPExcel : IBM AIX iconv() does not work,
thanks to Björn Wiberg - bwiberg
+- bug #2983066 [interface] Flush table on table operations shows the query twice,
+ thanks to Martynas Mickevičius - BlinK_
3.3.2.0 (2010-04-13)
- patch #2969449 [core] Name for MERGE engine varies depending on the
diff --git a/tbl_operations.php b/tbl_operations.php
index ad26638..7054bbc 100644
--- a/tbl_operations.php
+++ b/tbl_operations.php
@@ -193,7 +193,7 @@ unset($reread_info);
*/
require_once './libraries/tbl_links.inc.php';
-if (isset($result)) {
+if (isset($result) && empty($zero_rows)) {
// set to success by default, because result set could be empty
// (for example, a table rename)
$_type = 'success';
hooks/post-receive
--
phpMyAdmin
1
0
[Phpmyadmin-git] [SCM] phpMyAdmin branch, QA_3_3, updated. RELEASE_3_3_2RC1-23-g55572a5
by Herman van Rink 14 Apr '10
by Herman van Rink 14 Apr '10
14 Apr '10
The branch, QA_3_3 has been updated
via 55572a531ca411d9a449f409150ffb0836a111d9 (commit)
from 96071655352ab316d2760c141613bebb72c8b2db (commit)
- Log -----------------------------------------------------------------
-----------------------------------------------------------------------
Summary of changes:
ChangeLog | 2 ++
tbl_operations.php | 2 +-
2 files changed, 3 insertions(+), 1 deletions(-)
diff --git a/ChangeLog b/ChangeLog
index 7210b82..5df54a1 100644
--- a/ChangeLog
+++ b/ChangeLog
@@ -14,6 +14,8 @@ $HeadURL: https://phpmyadmin.svn.sourceforge.net/svnroot/phpmyadmin/trunk/phpMyA
thanks to Madhura Jayaratne - madhuracj
- bug #2974687, bug #2974692 [compatibility] PHPExcel : IBM AIX iconv() does not work,
thanks to Björn Wiberg - bwiberg
+- bug #2983066 [interface] Flush table on table operations shows the query twice,
+ thanks to Martynas Mickevičius - BlinK_
3.3.2.0 (2010-04-13)
- patch #2969449 [core] Name for MERGE engine varies depending on the
diff --git a/tbl_operations.php b/tbl_operations.php
index d045307..a0e9514 100644
--- a/tbl_operations.php
+++ b/tbl_operations.php
@@ -193,7 +193,7 @@ unset($reread_info);
*/
require_once './libraries/tbl_links.inc.php';
-if (isset($result)) {
+if (isset($result) && empty($zero_rows)) {
// set to success by default, because result set could be empty
// (for example, a table rename)
$_type = 'success';
hooks/post-receive
--
phpMyAdmin
1
0
[Phpmyadmin-git] [SCM] phpMyAdmin branch, TESTING, updated. RELEASE_3_3_2-3-g6e17d86
by Marc Delisle 14 Apr '10
by Marc Delisle 14 Apr '10
14 Apr '10
The branch, TESTING has been updated
via 6e17d8629c46da6cd88fa91f4be6dcb732169ebe (commit)
via 48cf4d398d3b5667522ceb702827fe24061d43f0 (commit)
via e5ceb497df8563f73296d7fc894ff00101e21bde (commit)
via b68b7d1cdd48d48e4b2009a1cfd24e81a09a127d (commit)
via c0b12a1eeac7b9acb46063236b772b5d5b14b3a3 (commit)
via 95f6c0a13756c25fa8b98f7153324152a6db4378 (commit)
via 7e40035275d28fa38fef7f7628bdda3a44d83de5 (commit)
via 7d217c9f57d5b97b62439c89f0010d36dac73d28 (commit)
via ee26cd1a4001d63c34881ffe2abfff89cebcefac (commit)
from d550baf9af9d2f559999c5ab1bb52a9303ba93b6 (commit)
- Log -----------------------------------------------------------------
commit 6e17d8629c46da6cd88fa91f4be6dcb732169ebe
Merge: d550baf9af9d2f559999c5ab1bb52a9303ba93b6 48cf4d398d3b5667522ceb702827fe24061d43f0
Author: Marc Delisle <marc(a)infomarc.info>
Date: Tue Apr 13 18:33:59 2010 -0400
Merge branch 'MAINT_3_3_2' into TESTING
-----------------------------------------------------------------------
Summary of changes:
ChangeLog | 3 +-
Documentation.html | 59 +++++++++++++++++++++++++++++++++++---------
README | 4 +-
libraries/Config.class.php | 2 +-
libraries/export/xlsx.php | 1 -
translators.html | 4 +-
6 files changed, 54 insertions(+), 19 deletions(-)
diff --git a/ChangeLog b/ChangeLog
index eb437d1..a5c87d3 100644
--- a/ChangeLog
+++ b/ChangeLog
@@ -5,7 +5,7 @@ phpMyAdmin - ChangeLog
$Id$
$HeadURL: https://phpmyadmin.svn.sourceforge.net/svnroot/phpmyadmin/trunk/phpMyAdmin/… $
-3.3.2.0 (not yet released)
+3.3.2.0 (2010-04-13)
- patch #2969449 [core] Name for MERGE engine varies depending on the
MySQL version, thanks to Dieter Adriaenssens - ruleant
- bug #2966078 [browse] Incorrect LIMIT is saved and sticks while browsing
@@ -24,6 +24,7 @@ $HeadURL: https://phpmyadmin.svn.sourceforge.net/svnroot/phpmyadmin/trunk/phpMyA
- bug #2980582 [interface] Properly format server status parameter.
- bug #2973949 [session] SQL History broken (revert patch #2899969),
thanks to Dieter Adriaenssens - ruleant
+- [doc] Be more specific about problems with Suhosin.
3.3.1.0 (2010-03-16)
- bug #2941037 [core] Database structure not sorted by table correctly
diff --git a/Documentation.html b/Documentation.html
index f6b45d0..330161f 100644
--- a/Documentation.html
+++ b/Documentation.html
@@ -10,7 +10,7 @@ vim: expandtab ts=4 sw=4 sts=4 tw=78
<link rel="icon" href="./favicon.ico" type="image/x-icon" />
<link rel="shortcut icon" href="./favicon.ico" type="image/x-icon" />
<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
- <title>phpMyAdmin 3.3.2-rc1 - Documentation</title>
+ <title>phpMyAdmin 3.3.2 - Documentation</title>
<link rel="stylesheet" type="text/css" href="docs.css" />
</head>
@@ -18,7 +18,7 @@ vim: expandtab ts=4 sw=4 sts=4 tw=78
<div id="header">
<h1>
<a href="http://www.phpmyadmin.net/">php<span class="myadmin">MyAdmin</span></a>
- 3.3.2-rc1
+ 3.3.2
Documentation
</h1>
</div>
@@ -1379,6 +1379,12 @@ CREATE DATABASE,ALTER DATABASE,DROP DATABASE</pre>
<abbr title="HyperText Transfer Protocol">HTTP</abbr> server is placed.
</dd>
+ <dt id ="cfg_Error_Handler_display">$cfg['Error_Handler']['display'] boolean</dt>
+ <dd>Whether to display errors from PHP or not.</dd>
+
+ <dt id ="cfg_Error_Handler_gather">$cfg['Error_Handler']['gather'] boolean</dt>
+ <dd>Whether to gather errors from PHP or not.</dd>
+
<dt id="cfg_LeftFrameLight">$cfg['LeftFrameLight'] boolean</dt>
<dd>Defines whether to use a select-based menu and display only the current
tables in the left frame (smaller page). Only in Non-Lightmode you can
@@ -1883,20 +1889,20 @@ $cfg['TrustedProxies'] =
name of the field. The comment is shown as a tool-tip for that field.
</dd>
- <dt id ="cfb_SQLQuery_Edit">$cfg['SQLQuery']['Edit'] boolean</dt>
+ <dt id ="cfg_SQLQuery_Edit">$cfg['SQLQuery']['Edit'] boolean</dt>
<dd>Whether to display an edit link to change a query in any SQL Query box.</dd>
- <dt id ="cfb_SQLQuery_Explain">$cfg['SQLQuery']['Explain'] boolean</dt>
+ <dt id ="cfg_SQLQuery_Explain">$cfg['SQLQuery']['Explain'] boolean</dt>
<dd>Whether to display a link to explain a SELECT query in any SQL Query box.</dd>
- <dt id ="cfb_SQLQuery_ShowAsPHP">$cfg['SQLQuery']['ShowAsPHP'] boolean</dt>
+ <dt id ="cfg_SQLQuery_ShowAsPHP">$cfg['SQLQuery']['ShowAsPHP'] boolean</dt>
<dd>Whether to display a link to wrap a query in PHP code in any SQL Query box.</dd>
- <dt id ="cfb_SQLQuery_Validate">$cfg['SQLQuery']['Validate'] boolean</dt>
+ <dt id ="cfg_SQLQuery_Validate">$cfg['SQLQuery']['Validate'] boolean</dt>
<dd>Whether to display a link to validate a query in any SQL Query box.
See also <tt><a href="#cfg_SQLValidator">$cfg_SQLValidator</a></tt>.</dd>
- <dt id ="cfb_SQLQuery_Refresh">$cfg['SQLQuery']['Refresh'] boolean</dt>
+ <dt id ="cfg_SQLQuery_Refresh">$cfg['SQLQuery']['Refresh'] boolean</dt>
<dd>Whether to display a link to refresh a query in any SQL Query box.</dd>
<dt id="cfg_UploadDir">$cfg['UploadDir'] string</dt>
@@ -3055,11 +3061,37 @@ RewriteRule .* - [E=REMOTE_USER:%{HTTP:Authorization},L]
<p> Yes but the default configuration values of Suhosin are known to cause
problems with some operations, for example editing a table with many
- columns and no primary key. Tuning information is available at
- <a href="http://www.hardened-php.net/hphp/troubleshooting.html">
- http://www.hardened-php.net/hphp/troubleshooting.html</a>,
- although the parameter names have changed (<tt>suhosin</tt> instead
- of <tt>hphp</tt>). See also the <a href="#cfg_SuhosinDisableWarning">
+ columns and no primary key or with textual primary key.
+</p>
+<p>
+ Suhosin configuration might lead to malfunction in some cases and it can
+ not be fully avoided as phpMyAdmin is kind of application which needs to
+ transfer big amounts of fields in single HTTP request, what is something
+ what Suhosin tries to prevent. Generally all
+ <code>suhosin.request.*</code>, <code>suhosin.post.*</code> and
+ <code>suhosin.get.*</code> directives can have negative effect on
+ phpMyAdmin usability. You can always find in your error logs which limit
+ did cause dropping of variable, so you can diagnose the problem and adjust
+ matching configuration variable.
+</p>
+<p>
+ The default values for most Suhosin configuration options will work in most
+ scenarios, however you might want to adjust at least following parameters:
+</p>
+
+<ul>
+ <li><a href="http://www.hardened-php.net/suhosin/configuration.html#suhosin.request.max_…">suhosin.request.max_vars</a> should be increased (eg. 2048)</li>
+ <li><a href="http://www.hardened-php.net/suhosin/configuration.html#suhosin.post.max_vars">suhosin.post.max_vars</a> should be increased (eg. 2048)</li>
+ <li><a href="http://www.hardened-php.net/suhosin/configuration.html#suhosin.request.max_…">suhosin.request.max_array_index_length</a> should be increased (eg. 256)</li>
+ <li><a href="http://www.hardened-php.net/suhosin/configuration.html#suhosin.post.max_arr…">suhosin.post.max_array_index_length</a> should be increased (eg. 256)</li>
+ <li><a href="http://www.hardened-php.net/suhosin/configuration.html#suhosin.request.max_…">suhosin.request.max_totalname_length</a> should be increased (eg. 8192)</li>
+ <li><a href="http://www.hardened-php.net/suhosin/configuration.html#suhosin.post.max_tot…">suhosin.post.max_totalname_length</a> should be increased (eg. 8192)</li>
+ <li><a href="http://www.hardened-php.net/suhosin/configuration.html#suhosin.sql.bailout_…">suhosin.sql.bailout_on_error</a> needs to be disabled (the default)</li>
+ <li><a href="http://www.hardened-php.net/suhosin/configuration.html#logging_configuration">suhosin.log.*</a> should not include SQL, otherwise you get big slowdown</li>
+</ul>
+
+ <p>
+ You can also disable the warning using the <a href="#cfg_SuhosinDisableWarning">
<tt>SuhosinDisableWarning</tt> directive</a>.
</p>
@@ -4425,6 +4457,9 @@ now synchronize your databases placed on the same server or some remote server.
<abbr title="PHP Extension and Application Repository">PEAR</abbr>
coding standards</a>
on the other hand. Please pay attention to this.</li>
+ <li>Please enable showing PHP errors and warnings by the
+ <code><a href="#cfg_Error_Handler_display">$cfg['Error_Handler']['display']</a></code>
+ configuration directive.</li>
<li>Please try to keep up the file-naming conventions. Table-related stuff
goes to <i>tbl_*.php</i>, db-related code to <i>db_*.php</i>,
server-related tools to <i>server_*.php</i> and so on.</li>
diff --git a/README b/README
index 1ca0c38..ae0af44 100644
--- a/README
+++ b/README
@@ -5,8 +5,8 @@ phpMyAdmin - Readme
A set of PHP-scripts to manage MySQL over the web.
- Version 3.3.2-rc1
- -----------------
+ Version 3.3.2
+ -------------
http://www.phpmyadmin.net/
Copyright (C) 1998-2000 Tobias Ratschiller <tobias_at_ratschiller.com>
diff --git a/libraries/Config.class.php b/libraries/Config.class.php
index 6250215..89ef2cf 100644
--- a/libraries/Config.class.php
+++ b/libraries/Config.class.php
@@ -92,7 +92,7 @@ class PMA_Config
*/
function checkSystem()
{
- $this->set('PMA_VERSION', '3.3.2-rc1');
+ $this->set('PMA_VERSION', '3.3.2');
/**
* @deprecated
*/
diff --git a/libraries/export/xlsx.php b/libraries/export/xlsx.php
index 86a17a9..1b24c4c 100644
--- a/libraries/export/xlsx.php
+++ b/libraries/export/xlsx.php
@@ -59,7 +59,6 @@ function PMA_exportFooter() {
$tmp_filename = tempnam(realpath($GLOBALS['cfg']['TempDir']), 'pma_xlsx_');
$workbookWriter = new PHPExcel_Writer_Excel2007($workbook);
- $workbookWriter->setTempDir(realpath($GLOBALS['cfg']['TempDir']));
$workbookWriter->save($tmp_filename);
if (!PMA_exportOutputHandler(file_get_contents($tmp_filename))) {
diff --git a/translators.html b/translators.html
index bca8cd5..00f7ab3 100644
--- a/translators.html
+++ b/translators.html
@@ -11,7 +11,7 @@
<link rel="icon" href="./favicon.ico" type="image/x-icon" />
<link rel="shortcut icon" href="./favicon.ico" type="image/x-icon" />
<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
- <title>phpMyAdmin 3.3.2-rc1 - Official translators</title>
+ <title>phpMyAdmin 3.3.2 - Official translators</title>
<link rel="stylesheet" type="text/css" href="docs.css" />
</head>
@@ -19,7 +19,7 @@
<div id="header">
<h1>
<a href="http://www.phpmyadmin.net/">php<span class="myadmin">MyAdmin</span></a>
- 3.3.2-rc1
+ 3.3.2
official translators list
</h1>
</div>
hooks/post-receive
--
phpMyAdmin
1
0
[Phpmyadmin-git] [SCM] phpMyAdmin branch, STABLE, updated. RELEASE_3_3_2-2-g3fe8209
by Marc Delisle 14 Apr '10
by Marc Delisle 14 Apr '10
14 Apr '10
The branch, STABLE has been updated
via 3fe82098c91f784c312ca27d01a07a14515a641d (commit)
via 48cf4d398d3b5667522ceb702827fe24061d43f0 (commit)
via e5ceb497df8563f73296d7fc894ff00101e21bde (commit)
via b68b7d1cdd48d48e4b2009a1cfd24e81a09a127d (commit)
via c0b12a1eeac7b9acb46063236b772b5d5b14b3a3 (commit)
via 95f6c0a13756c25fa8b98f7153324152a6db4378 (commit)
via 7e40035275d28fa38fef7f7628bdda3a44d83de5 (commit)
via 7d217c9f57d5b97b62439c89f0010d36dac73d28 (commit)
via ee26cd1a4001d63c34881ffe2abfff89cebcefac (commit)
via a0d1071ec314de73e162839b629e0285c96d606f (commit)
via 1f62ea1932a3b4d39cbc64d5b2dcaab81ead78d7 (commit)
via 44ec2ede9560fdb63d7d61708dfdffd5813869b6 (commit)
via 366d50a79b53c827926f97e14ee2f6937f161909 (commit)
via acb30d5a2ae4d4235f95fe1087065c5562ae194f (commit)
via 58c33c410e2699484d6183b3fb0318d108cebd8d (commit)
via eb5e03880e579d572ec8e45a8fc0777929defddc (commit)
via 1e984375b6ab0253b8c1860b55a11e705be772c0 (commit)
via 428ed49d17533adb5444d85e8b194883fea99bb5 (commit)
via fad777ecb23ac323ba4b1a86220f8b4b7c612306 (commit)
via bb0ad40413a0d049126bfa4f040e5bdc43a9f488 (commit)
via 86cd86fc513aa79eafdf9910b60976ac5750d4eb (commit)
via a78fc120480240f8bbd7492b250215530978c396 (commit)
via a4ca1638e95cb7892c878394440a103d015be6fa (commit)
via 589504fe8a423b794797f72cf61b60fc8b770b3e (commit)
via 291f2a1d1d97299b3b47dc2b9871e3646ae7d3f8 (commit)
via 459fe9e905be784bcb0d3ce8ad54486c906be938 (commit)
via cdef72f707e0f2a5ebf0a6a897811795f7dea165 (commit)
via c70bd771719efa2fd1711f163e2aabb6bb304325 (commit)
via 9f155b618c65ba2bf49f8a6dbf51d7e6f562087c (commit)
via e8d86a5869d45a5e019bf9460d5fb0c9b398216f (commit)
via 6810e568f61cab1adbb23f34f6b4d07cbd971184 (commit)
via 82905fa361f54701226cc580e3dc2561e4427ca4 (commit)
via 0f6215f70ed47a1c26743dab636fb74042d98833 (commit)
via e859e311496ae25e1c6de6412084bc336f0798b9 (commit)
via cdfc277bb7bd3b8fad0e45d9317fdd4578282206 (commit)
via 142b1e2183660d25cb4827c56f8760f4cb66e714 (commit)
via e2aaeaf1d621f5dd0ae4d97af383f8afe5b1ba73 (commit)
via 13cb9e7e3e18208962f50e751891af3bcde3ec00 (commit)
via b90805f7eb266967480295c02c9eb94680c4f7fb (commit)
via 7b831bc8777c3f8195d33f3e7720d8123f3d9ce2 (commit)
via f0672d82c38af1593523e2271f4cadcd27e64e39 (commit)
via 7a366c3f088cc060b769d56378605c6473b185e8 (commit)
via 337b2254d85808c5d35df59174250d25a47d5599 (commit)
via b686640a06916ddc65bc46f5a057990914ac091a (commit)
via 7c818d046a4c9f01a8e94b55a0726a1cc3d6a60d (commit)
via 4a53eb19160936770d32244939ee82906e0f88c8 (commit)
via 0db3d899eed5dd09d6e0e018e5c175c1b4d53e08 (commit)
via 4ac7e466053422ae48b328b6be2aa9a17812d1dd (commit)
via d659f3ba2b6dafbd818caca1f22a45455690198c (commit)
via 47ec6a7b7eb899533213136ea7f22cb690dc137c (commit)
via 3f5d1063ff6af5aa036be26a4d5fac9806eccfac (commit)
via 09896700e4c90916997da5d5d0579ea92a1f6d5a (commit)
via 7443d8286dfe655dfd38ed20cf26099ae65d2ab2 (commit)
via 05477fff976073aa2074e905bdfa249779e1fcca (commit)
via 861dd5c0c2fed019954ab2129db2d27adfe958a9 (commit)
via 0d16251c6b9ad831daed75df4db73d8e7e5a3b64 (commit)
via bc908c732a577b054a3046b2386afe77edd8a8cd (commit)
via 0fa6c3d985160ccb857ffe311267a7df22435f75 (commit)
via 9bcc37451d42dce0f522bf0d51462bb82abc14d8 (commit)
via f4d129ac03ff7011d6e54d60243c88aebf790e52 (commit)
via d24640d62ef13e733f22445a7d3fb5e4cc32a9ca (commit)
via bf857315b9ca14ebb9dad2d3f1d195fe1a14d331 (commit)
via b9daf34b79b0271e62e4de3bc7b6bf9008e719c5 (commit)
via f900210a0f05511658a8d64d8876b935ab7a5972 (commit)
via 66c830e2a5deaa4196fe82e1df45f1f89bbc5a60 (commit)
via 548d96d611b100ef1bf10165eaacb8cd2c5d75f9 (commit)
via cbe8f389821d2fb0a107478e73b654309566380d (commit)
via 326deca827d87eb148afb96fa6ec7ce29644cb93 (commit)
via a239f9bb3ebe0994a76d5d946418bdce4a9298e4 (commit)
via 5fd02248cd4f410d963daf55150c33e8d4e01850 (commit)
via fd739840cdb07739c8b971363291c9d0534764ec (commit)
via 624dde89ef6ac51adea3f1be045128bcbcd7eeb8 (commit)
via 644b56f65594244fc0f8ec5f25398ab9b3678e7c (commit)
via e5a58432b523ea22d1ec1332e55a758bd7adced2 (commit)
via 0a6badd2d60b6cc216f714ea777905566de14e60 (commit)
via f1b8b850eb559ae202fb7220c5cf3d7703df5e60 (commit)
via aecbb213aaf4f779f8feaa4ad4cc3fa9d59ce673 (commit)
via c67fd7f732e56d668399a4d44bcdf5f2a803a7c3 (commit)
via fe5e8999b42b98873a032a937cb873f2d47a1826 (commit)
via 182ca44769a3940616e42de5b90ad97693dec362 (commit)
via 8adc82666bca869bdf73f2b92d40df532fe10f57 (commit)
via e16be872b64cab229784a0700a329871454f8baf (commit)
via 4beb8bdff67ad57e27ed1d1ae02451fc356a5df7 (commit)
via 079cb404c776821bc9b161bd297b956a6e6418a4 (commit)
via 6b56175cd1b8e9bbaca5ab56266039b8129b34af (commit)
via cd6b2795d3168aba7c8c0ff7069b99d86e98c6a7 (commit)
via 867782d82ffe888feb40091aa417818e115090b8 (commit)
via 994381d3c827271b61ccd203f5c953b434a6b772 (commit)
via b10d8c63abb010c9917f3a20b192b22da62bf478 (commit)
via db93a7fb0dfc674934d72e3174d024c99b7a0ff1 (commit)
via 34fbba8ef5a04ad182687bb9a0a5349243cd9790 (commit)
via f92e4dfad9c33f1c822d375b638ad65fcdd815d1 (commit)
via 1f56635db547a7440b6463fc4d9d8d5bb1ed65ec (commit)
via 78ee46662ac7e0371109fef2ad5a782a1aa7cc72 (commit)
via c3259a276c5a455c6e0907cd42edd94f644df7d6 (commit)
via 93bebe47bc8c3b68e2b9df1c3cb6885503aee17b (commit)
via a2fa8219c85f49b1aeadc5edf37ad4afb89ae6cf (commit)
from 123c3c3656565babbb8cb4442d1e2feb43e6c503 (commit)
- Log -----------------------------------------------------------------
commit 3fe82098c91f784c312ca27d01a07a14515a641d
Merge: 123c3c3656565babbb8cb4442d1e2feb43e6c503 48cf4d398d3b5667522ceb702827fe24061d43f0
Author: Marc Delisle <marc(a)infomarc.info>
Date: Tue Apr 13 18:34:00 2010 -0400
Merge branch 'MAINT_3_3_2' into STABLE
-----------------------------------------------------------------------
Summary of changes:
.gitignore | 1 +
ChangeLog | 261 +++--------------------------------
Documentation.html | 78 ++++++++---
README | 2 +-
db_operations.php | 2 +-
db_printview.php | 2 +-
db_structure.php | 6 +-
export.php | 7 +-
lang/belarusian_latin-utf-8.inc.php | 66 ++++-----
libraries/Config.class.php | 2 +-
libraries/Table.class.php | 32 ++++-
libraries/common.lib.php | 5 +
libraries/config.default.php | 8 +-
libraries/db_events.inc.php | 2 +-
libraries/display_export.lib.php | 5 +-
libraries/display_tbl.lib.php | 17 ++-
libraries/export/xls.php | 1 +
libraries/export/xlsx.php | 36 +++---
libraries/export/xml.php | 2 +-
libraries/import.lib.php | 2 +-
libraries/import/ods.php | 2 +-
libraries/select_lang.lib.php | 2 +-
libraries/server_links.inc.php | 6 +-
libraries/tbl_links.inc.php | 1 +
main.php | 4 +-
navigation.php | 3 +-
pdf_schema.php | 60 +++++---
server_status.php | 4 +
setup/lib/FormDisplay.class.php | 2 +-
sql.php | 7 -
tbl_change.php | 6 +
tbl_printview.php | 7 +-
tbl_row_action.php | 2 +-
tbl_structure.php | 7 +-
translators.html | 4 +-
35 files changed, 259 insertions(+), 395 deletions(-)
diff --git a/.gitignore b/.gitignore
index 83fc036..8a1aa74 100644
--- a/.gitignore
+++ b/.gitignore
@@ -20,3 +20,4 @@ phpmyadmin.wpj
.buildpath
.cache
*.sw[op]
+locale
diff --git a/ChangeLog b/ChangeLog
index 774c13a..a5c87d3 100644
--- a/ChangeLog
+++ b/ChangeLog
@@ -5,6 +5,27 @@ phpMyAdmin - ChangeLog
$Id$
$HeadURL: https://phpmyadmin.svn.sourceforge.net/svnroot/phpmyadmin/trunk/phpMyAdmin/… $
+3.3.2.0 (2010-04-13)
+- patch #2969449 [core] Name for MERGE engine varies depending on the
+ MySQL version, thanks to Dieter Adriaenssens - ruleant
+- bug #2966078 [browse] Incorrect LIMIT is saved and sticks while browsing
+- bug #2967366 [Structure] Some results of Propose table structure are
+ shown in hex
+- bug #2967565 [insert] UNHEX not selected by default when inserting BINARY
+- [navi] Changed link to git repository on main page
+- bug #2972232 [menu] Import menu tab not present on main page
+- patch #2976790 [menu] Go to the upper level after table DROP,
+ thanks to Kaarel Nummert - kaarelnu
+- patch #2978815 [pdf] Fix generating PDF with table dimensions, thanks to BlinK_
+- patch #2977725 [export] XML wrongly encoded, thanks to Victor Volkov - hanut
+- patch #2979234 [import] Create tables with current charset and collation.
+- patch #2979234, bug #2960105 [import] Properly import unicode text from ODS.
+- bug #2973280 [export] Proper handling of temporary directory in XLS export.
+- bug #2980582 [interface] Properly format server status parameter.
+- bug #2973949 [session] SQL History broken (revert patch #2899969),
+ thanks to Dieter Adriaenssens - ruleant
+- [doc] Be more specific about problems with Suhosin.
+
3.3.1.0 (2010-03-16)
- bug #2941037 [core] Database structure not sorted by table correctly
- bug #2948492 [interface] Slide effect masks some fields on search page
@@ -98,246 +119,6 @@ $HeadURL: https://phpmyadmin.svn.sourceforge.net/svnroot/phpmyadmin/trunk/phpMyA
in a BLOB, thanks to Vincent van der Tuin
- [privileges] Improve escaping of hostname
-3.2.4.0 (2009-12-02)
-- bug [engines] Innodb_buffer_pool_pages_latched no longer returned in status
-- bug #2890451 [setup] Inconsistent generated "designer_coords"
-- bug #2890443 [mysqli] "No index used in query" exception is reported
-- bug #2891250 [ob] Garbled data in navi frame (PHP 5.2.11 bug)
-- bug #2887357 [core] Slow loading times with large databases (partial fix)
-- bug #2893931 [lang] Typo and empty message
-+ [lang] Russian update, thanks to Victor Volkov
-- bug #2823599 [edit] UUID Primary Key wrongly updated
-- bug #2895894 [structure] Empty default value not set properly
-- bug #2897536 [parser] Copying table with bit field with default
-- bug #2893221 [core] Statement may not be safe to log in statement format
-
-3.2.3.0 (2009-10-30)
-- patch #2856664 [export] Date, time, and datetime column types now export correctly to
- OpenOffice Spreadsheet, thanks to Thomas Pulickal - jemajoign
-- patch #2859788 [parser] Double-character delimiters (bug #2846239),
- thanks to Thomas Pulickal - jemajoign
-- bug #2832600 [export] Slow export when having lots of databases
-- bug #2537766 [import] Comments are stripped when editing store procedures
-- bug #2852370 [operations] Renaming database deletes triggers
-- bug #2872247 [interface] Failed opening required 'mysql_charsets.lib.php', thanks to CyberLeo Kitsana - cyberleo
-- bug [structure] "In use" table incorrectly reported as "view"
-- bug #2879909 [interface] Removed double htmlspecialchars when editing enum column
-- bug #2868328 [relations] Adding foreign key when table name contains a dot
-- bug #2883381 [doc] Side effects of MemoryLimit setting
-- bug #2826128 [display] Inverting sort order when expression contains a function name
-
-3.2.2.1 (2009-10-12)
-- [security] XSS and SQL injection, thanks to Herman van Rink
-
-3.2.2.0 (2009-09-13)
-- bug #2825293 [structure] Default value for a BIT column
-- bug [display] Red arrows were reversed in the list of tables
-- bug #2813879 [export] Duplicate empty lines when exporting without comments
-- bug #2825919 [export] Trigger export with database name
-- bug #2823996 [data] Cannot edit row with no PK and a BIT field
-- bug [export] Exporting results of a query which contains a LIMIT clause
- inside a subquery
-- bug #2837722 [export] Run complex SQL then export does not work
-- bug #2839548 [export] Triggers order on export
-- bug #2826986 [display] Order by BLOB and range display
-- bug [display] After clicking on Show Function or Function, the UPDATE query
- is not shown after execution
-- bug [structure] Missing validation for BINARY and VARBINARY
-
-3.2.1.0 (2009-08-09)
-- bug #2799009 Login with ipv6 IP address breaks redirect
-- bug #2796066 [priv] Inconsistent display of databases list
-- bug #2802870 [display] Incorrect overhead value for InnoDB
-- bug [display] Incorrect display in replication status,
- thanks to Tomas Srnka - tomassrnka
-- bug #1601625 [display] The Ignore checkbox is not unchecked for ENUM
-- bug #2809930 [setup] Notice: Undefined variable: k in setup/index.php
-- bug [features] Incorrect report of missing relational features
-- [security] XSS: Insufficient output sanitizing (not exploitable without a valid token)
- thanks to Sven Vetsch/Disenchant for informing us in a responsible manner
-- bug #2634827 [import] Using DELIMITER produces infinite cycle
-+ new language files: uzbek_cyrillic and urbek_latin
-- bug #2814109 [search] Right frame is blank
-- bug #2816840 [priv] Cannot change a user's details
-- bug #2816165 [display] Executed query not always displayed
-- bug #2819944 [setup] Incorrect mention of designer_coords
-- bug #2821757 [insert] "Insert another new row" no longer worked
-+ [lang] Norwegian update, thanks to Sven-Erik Andersen
-- bug [core] PMA_pow() can support negative exponents in the pow() case
-+ [lang] Brazilian Portuguese update, thanks to Fabio Bucior - fabiobucior
-- patch #2822384 [docs] Missing auth_type in docs-example,
- thanks to Jürgen Wind - windkiel
-- patch #2819728 [display] Slider effect jumping to top of page,
- thanks to Jan Radem - summsel
-- bug [display] Incorrect computation of overhead stats in server view
- for tables under the InnoDB engine
-+ [lang] Swedish update, thanks to Björn T. Hallberg
-
-3.2.0.1 (2009-06-30)
-- [security] XSS: Insufficient output sanitizing in bookmarks
-
-3.2.0.0 (2009-06-15)
-- [core] better support for vendor customisation (based on what Debian needs)
-+ rfe #2127987 warn when session.gc_maxlifetime is less than cookie validity
-+ rfe #2100910 configurable default charset for import
-+ rfe #1913541 link to InnoDB status when error 150 occurs
-+ rfe #1927189 strip ` from column names on import
-+ rfe #1821619 LeftFrameDBSeparator can be an array
-+ patch #1821619 [privileges] Extra back reference when editing table-specific
- privileges, thanks to Herman van Rink - helmo
-+ patch #2356575 [display] Sortable database columns,
- thanks to Bryce Thornton - brycethornton
-- patch #2486825 [lang] Wrong string in setup script hints,
- thanks to Isaac Bennetch - ibennetch
-- patch #2498350 [cleanup] XHTML cleanup, thanks to Virsacer - virsacer
-+ patch #2494192 [display] Possibility of disabling the sliders,
- thanks to Virsacer - virsacer
-+ patch #2506831 [privileges] Create user for existing database,
- thanks to Herman van Rink and Virsacer
-+ patch #2505255 [privileges] Cleanup, thanks to Virsacer - virsacer
-- bug #2414056 [auth] AllowNoPasswordRoot error message is too vague
-- patch #2596230 [XHTML] View table headers/footers completely,
- thanks to Virsacer - virsacer
-- patch #2602633 [core] support column name having square brackets,
- thanks to Herman van Rink - helmo
-+ [lang] Lithuanian update, thanks to Rytis Slatkevicius - rytis_s
-+ [auth] New setting AllowNoPassword (supercedes AllowNoPasswordRoot) that
- applies to all accounts (even the anonymous user)
-- patch #2652972 [relation] Missing code with hashing for relationship
- editing, thanks to knittl - knittl
-+ rfe #2123386 Added option to disable mcrypt warning.
-- bug #2648502 Request-URI Too Large error from Location header
-+ rfe #1731967 Check for relations support on main page.
-+ rfe #2186820 Explanation for using Host table.
-+ rfe #1369509 Link to download more themes.
-+ rfe #1666487 Add option to generate password on change password page.
-+ rfe #1694104 Allow logging of user status with Apache.
-- patch #2649087 None default is different than other None in some languages.
-+ [lang] Chinese Simplified update, thanks to Shanyan Baishui - rimyxp
-- patch #2550286 [display] Sort arrows problem, thanks to Virsacer - virsacer
-- [security] warn about existence of config directory on main page
-+ patch #2706761 [lang] Polish update,
- thanks to Pawel Smolinski - zipoking
-+ patch #2715142 [export] (rfe 2416960, escape new line in CSV export)
- thanks to Derek Schaefer - drummingds1
-- patch #2727250 Optimizations for PHP loops
- thanks to Haeber
-- bug #2650776 [import] SQL_MODE not saved during Partial Import
-- patch #1863739 [auth] cache control missing (PHP-CGI), thanks to stmfd
-- patch #2750541 [parser] Incorrect parsing of constraints in ALTER TABLE,
- thanks to Yannick Betemps - arkhee
-+ patch #2735162 [status] Server status - replication,
- thanks to Tomas Srnka - tomassrnka
-+ patch #2745215 [edit] Multi-row change with "]" improved,
- thanks to Virsacer - virsacer
-+ rfe #2657696 Automatically copy generated password
-- bug #2787162 [interface] Table with name 'log_views' is incorrectly displayed as a view
-+ patch #2665440 Detect mcrypt initialization failure
-+ [lang] Galician update, thanks to Xosé Calvo - xosecalvo
-+ [lang] Swedish update, thanks to Björn T. Hallberg
-+ [lang] Norwegian update, thanks to Sven-Erik Andersen
-+ [lang] Catalan update, thanks to Xavier Navarro
-+ [lang] Finnish update, thanks to Jouni Kahkonen
-+ [lang] Hungarian update, thanks to Jozsef Tamas Herczeg - dodika
-
-3.1.6.0 (not released)
-- bug #2785912 [doc] no ON UPDATE CURRENT_TIMESTAMP in list of attributes
-
-3.1.5.0 (2009-05-15)
-- patch #2739001 [export] XML does not allow spaces in element names,
- thanks to Derek Schaefer - drummingds1
-- bug #2780722 [import] Incorrect maximum file size
-- bug #2780356 [calendar] Null checkbox not unchecked when date is chosen
-- bug [calendar] js error "window.parent.addEvent is not a function"
-- patch #2773818 [export] Invalid "Content-Encoding" header,
- thanks to abignale - abignale
-- bug #2787162 [interface] Table with name 'log_views' is incorrectly displayed as a view
-- bug #2784400 [parser] INVOKER not understood by parser
-- [core] Compatibility with PHP 5.3.0RC2
-
-3.1.4.0 (2009-04-25)
-+ patch #1808339 [doc] Apache SSLOptions and StdEnvVars FAQ,
- thanks to JT Justman - jtjustman
-- bug #2491017 [operations] ANSI mode not supported (db rename and table move)
-- bug #2609346 [operations] Fix copying views.
-- rfe #2127983 Readd documentation link, it does not protect against anything.
-- bug #1675249 [doc] Apache reverse proxy and cookies FAQ
-- bug #2682140 UUID() and CURRENT_USER() should not accept arguments
-- patch #2682833 [core] Fatal error: Call to a member function isDisplayed(),
- thanks to Christian Rodriguez - judas_iscariote
-- patch #2702772 [lang] Duplicate sentence in Polish,
- thanks to Pawel Smolinski - zipoking
-- patch #2709040 [doc] Wrong link in ChangeLog formatter,
- thanks to Petr Vorel - pevik
-- patch #2715417 [interface] Fixed truncation of enum/set values containing parenthesis
- thanks to Marco Moreno - mmoreno
-+ [lang] Spanish update, thanks to Daniel Hinostroza
-- bug #2724844 Add Fields: Add index is missing quotes
- thanks to Luke Armstrong
-- bug #2740550 [interface] Using textarea CharEditing drops default values
-- bug #2729191 [config] CheckConfigurationPermissions = false is worthless
-- bug #2687046 [export] Structure export: Null always YES
-- [doc] typos, thanks to Cédric Corazza
-
-3.1.3.2 (2009-04-14)
-- [security] Insufficient output sanitizing when generating configuration file
-
-3.1.3.1 (2009-03-24)
-- [security] HTTP Response Splitting and file inclusion vulnerabilities
-- [security] XSS vulnerability on export page
-- [security] Insufficient output sanitizing when generating configuration file
-
-3.1.3.0 (2009-02-28)
-+ [lang] Turkish update, thanks to Burak Yavuz
-- patch #2496403 [display] Multi-row change with "]",
- thanks to Virsacer - virsacer
-- bug #2027720 [parser] Missing space after BINARY used as cast
-- patch #2520747 [core] E_DEPRECATED compatibility for PHP 5.3,
- thanks to Giovanni Giacobbi - themnemonic
-- bug [display] Message "Bookmark created" is not displaying
-+ [display] Show AUTO_INCREMENT instead of A_I when in vertical mode
-- patch #2538358 [display] Conditions for relational display field,
- thanks to Virsacer - virsacer
-+ [lang] Mongolian update, thanks to Bayarsaikhan Enkhtaivan - bayaraa
-- patch #2553372 [display] DB comment tooltips not shown on navi,
- thanks to Erdem - ahard
-- patch #2561433 [structure] Display true number of rows in a view
- if it contains less than MaxExactCountViews,
- thanks to Virsacer - virsacer
-+ [lang] Polish update, thanks to Fixer - fixeron
-- bug #2568722 [designer] Compound key not shown
-- patch #2550323 [XHTML] in server_databases.php, thanks to Virsacer - virsacer
-- patch #2358861 [navi] Row count tooltip wrong for information_schema,
- thanks to Herman van Rink - helmo
-- bug #2565948 [core] Changing the connection collation changed the client
- charset.
-+ [lang] Romanian update, thanks to Sergiu Bivol - sbivol
-- patch #1760205 [data] Insert as new row: BLOB is lost,
- thanks to Herman van Rink - helmo
-+ [lang] Georgian update, thanks to George Machitidze
-
-3.1.2.0 (2009-01-19)
-- bug #1253252 [display] Can't NULL a column with relation defined
-- bug #2009500 [SQL] Small improvements in generated SQL (partial fix)
-- bug #1963184 [export] YAML export improvement,
- thanks to Bryce Thornton - brycethornton
-+ [lang] Dutch update, thanks to Herman van Rink - helmo
-- patch #2407785 [cleanup] ereg*() deprecated in PHP 5.3,
- thanks to Alex Frase - atfrase
-- bug #2417058 [properties] Edit fields: losing auto-increment setting
-- patch #2444082 [changelog] changelog.php linkifies one link wrong,
- thanks to Robert Xiao - nneonneo
-- bug #2363653 [properties] Various problems with table structure
-- bug [display] BIT field contents disappear when edited
-+ [lang] Czech update, thanks to Ondřej Vadinský.
-- bug #2461735 [operations] Table operations adds "row_format"
-- bug #2445213 [export] Commas for CSV Excel 2008 for Mac
-- bug #2397877 [core] ForceSSL and http auth_type
-- bug #2473127 [display] Deleting rows displays tbl structure, not contents
-- patch #2478940 [core] PHP 5.2+ warning does not work,
- thanks to Jürgen Wind - windkiel
-- bug #2416418 [privileges] Escaping special characters
-
--- Older ChangeLogs can be found on our project website ---
http://www.phpmyadmin.net/old-stuff/ChangeLogs/
diff --git a/Documentation.html b/Documentation.html
index 44dafe5..330161f 100644
--- a/Documentation.html
+++ b/Documentation.html
@@ -10,7 +10,7 @@ vim: expandtab ts=4 sw=4 sts=4 tw=78
<link rel="icon" href="./favicon.ico" type="image/x-icon" />
<link rel="shortcut icon" href="./favicon.ico" type="image/x-icon" />
<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
- <title>phpMyAdmin 3.3.1 - Documentation</title>
+ <title>phpMyAdmin 3.3.2 - Documentation</title>
<link rel="stylesheet" type="text/css" href="docs.css" />
</head>
@@ -18,7 +18,7 @@ vim: expandtab ts=4 sw=4 sts=4 tw=78
<div id="header">
<h1>
<a href="http://www.phpmyadmin.net/">php<span class="myadmin">MyAdmin</span></a>
- 3.3.1
+ 3.3.2
Documentation
</h1>
</div>
@@ -1103,7 +1103,7 @@ CREATE DATABASE,ALTER DATABASE,DROP DATABASE</pre>
<span id="cfg_Servers_tracking_drop_view">$cfg['Servers'][$i]['tracking_version_drop_view']</span> boolean
</dt>
<dd>
- Whether a DROP VIEW IF EXISTS statement will added as first line to the log when creating a view. Default value is true.
+ Whether a DROP VIEW IF EXISTS statement will be added as first line to the log when creating a view. Default value is true.
<br/><br/>
</dd>
@@ -1112,7 +1112,7 @@ CREATE DATABASE,ALTER DATABASE,DROP DATABASE</pre>
<span id="cfg_Servers_tracking_drop_table">$cfg['Servers'][$i]['tracking_version_drop_table']</span> boolean
</dt>
<dd>
- Whether a DROP TABLE IF EXISTS statement will added as first line to the log when creating a table. Default value is true.
+ Whether a DROP TABLE IF EXISTS statement will be added as first line to the log when creating a table. Default value is true.
<br/><br/>
</dd>
@@ -1120,7 +1120,7 @@ CREATE DATABASE,ALTER DATABASE,DROP DATABASE</pre>
<span id="cfg_Servers_tracking_drop_database">$cfg['Servers'][$i]['tracking_version_drop_database']</span> boolean
</dt>
<dd>
- Whether a DROP DATABASE IF EXISTS statement will added as first line to the log when creating a database. Default value is true.
+ Whether a DROP DATABASE IF EXISTS statement will be added as first line to the log when creating a database. Default value is true.
<br/><br/>
</dd>
@@ -1379,6 +1379,12 @@ CREATE DATABASE,ALTER DATABASE,DROP DATABASE</pre>
<abbr title="HyperText Transfer Protocol">HTTP</abbr> server is placed.
</dd>
+ <dt id ="cfg_Error_Handler_display">$cfg['Error_Handler']['display'] boolean</dt>
+ <dd>Whether to display errors from PHP or not.</dd>
+
+ <dt id ="cfg_Error_Handler_gather">$cfg['Error_Handler']['gather'] boolean</dt>
+ <dd>Whether to gather errors from PHP or not.</dd>
+
<dt id="cfg_LeftFrameLight">$cfg['LeftFrameLight'] boolean</dt>
<dd>Defines whether to use a select-based menu and display only the current
tables in the left frame (smaller page). Only in Non-Lightmode you can
@@ -1883,20 +1889,20 @@ $cfg['TrustedProxies'] =
name of the field. The comment is shown as a tool-tip for that field.
</dd>
- <dt id ="cfb_SQLQuery_Edit">$cfg['SQLQuery']['Edit'] boolean</dt>
+ <dt id ="cfg_SQLQuery_Edit">$cfg['SQLQuery']['Edit'] boolean</dt>
<dd>Whether to display an edit link to change a query in any SQL Query box.</dd>
- <dt id ="cfb_SQLQuery_Explain">$cfg['SQLQuery']['Explain'] boolean</dt>
+ <dt id ="cfg_SQLQuery_Explain">$cfg['SQLQuery']['Explain'] boolean</dt>
<dd>Whether to display a link to explain a SELECT query in any SQL Query box.</dd>
- <dt id ="cfb_SQLQuery_ShowAsPHP">$cfg['SQLQuery']['ShowAsPHP'] boolean</dt>
+ <dt id ="cfg_SQLQuery_ShowAsPHP">$cfg['SQLQuery']['ShowAsPHP'] boolean</dt>
<dd>Whether to display a link to wrap a query in PHP code in any SQL Query box.</dd>
- <dt id ="cfb_SQLQuery_Validate">$cfg['SQLQuery']['Validate'] boolean</dt>
+ <dt id ="cfg_SQLQuery_Validate">$cfg['SQLQuery']['Validate'] boolean</dt>
<dd>Whether to display a link to validate a query in any SQL Query box.
See also <tt><a href="#cfg_SQLValidator">$cfg_SQLValidator</a></tt>.</dd>
- <dt id ="cfb_SQLQuery_Refresh">$cfg['SQLQuery']['Refresh'] boolean</dt>
+ <dt id ="cfg_SQLQuery_Refresh">$cfg['SQLQuery']['Refresh'] boolean</dt>
<dd>Whether to display a link to refresh a query in any SQL Query box.</dd>
<dt id="cfg_UploadDir">$cfg['UploadDir'] string</dt>
@@ -3055,11 +3061,37 @@ RewriteRule .* - [E=REMOTE_USER:%{HTTP:Authorization},L]
<p> Yes but the default configuration values of Suhosin are known to cause
problems with some operations, for example editing a table with many
- columns and no primary key. Tuning information is available at
- <a href="http://www.hardened-php.net/hphp/troubleshooting.html">
- http://www.hardened-php.net/hphp/troubleshooting.html</a>,
- although the parameter names have changed (<tt>suhosin</tt> instead
- of <tt>hphp</tt>). See also the <a href="#cfg_SuhosinDisableWarning">
+ columns and no primary key or with textual primary key.
+</p>
+<p>
+ Suhosin configuration might lead to malfunction in some cases and it can
+ not be fully avoided as phpMyAdmin is kind of application which needs to
+ transfer big amounts of fields in single HTTP request, what is something
+ what Suhosin tries to prevent. Generally all
+ <code>suhosin.request.*</code>, <code>suhosin.post.*</code> and
+ <code>suhosin.get.*</code> directives can have negative effect on
+ phpMyAdmin usability. You can always find in your error logs which limit
+ did cause dropping of variable, so you can diagnose the problem and adjust
+ matching configuration variable.
+</p>
+<p>
+ The default values for most Suhosin configuration options will work in most
+ scenarios, however you might want to adjust at least following parameters:
+</p>
+
+<ul>
+ <li><a href="http://www.hardened-php.net/suhosin/configuration.html#suhosin.request.max_…">suhosin.request.max_vars</a> should be increased (eg. 2048)</li>
+ <li><a href="http://www.hardened-php.net/suhosin/configuration.html#suhosin.post.max_vars">suhosin.post.max_vars</a> should be increased (eg. 2048)</li>
+ <li><a href="http://www.hardened-php.net/suhosin/configuration.html#suhosin.request.max_…">suhosin.request.max_array_index_length</a> should be increased (eg. 256)</li>
+ <li><a href="http://www.hardened-php.net/suhosin/configuration.html#suhosin.post.max_arr…">suhosin.post.max_array_index_length</a> should be increased (eg. 256)</li>
+ <li><a href="http://www.hardened-php.net/suhosin/configuration.html#suhosin.request.max_…">suhosin.request.max_totalname_length</a> should be increased (eg. 8192)</li>
+ <li><a href="http://www.hardened-php.net/suhosin/configuration.html#suhosin.post.max_tot…">suhosin.post.max_totalname_length</a> should be increased (eg. 8192)</li>
+ <li><a href="http://www.hardened-php.net/suhosin/configuration.html#suhosin.sql.bailout_…">suhosin.sql.bailout_on_error</a> needs to be disabled (the default)</li>
+ <li><a href="http://www.hardened-php.net/suhosin/configuration.html#logging_configuration">suhosin.log.*</a> should not include SQL, otherwise you get big slowdown</li>
+</ul>
+
+ <p>
+ You can also disable the warning using the <a href="#cfg_SuhosinDisableWarning">
<tt>SuhosinDisableWarning</tt> directive</a>.
</p>
@@ -4326,20 +4358,23 @@ chmod o+rwx tmp
<p> The following method is preferred for new developers:</p>
-<ol><li>fetch the current SVN tree over anonymous SVN:<br />
- <tt>svn co https://phpmyadmin.svn.sourceforge.net/svnroot/phpmyadmin/trunk/phpMyAdmin</tt><br />
+<ol><li>fetch the current git repository over anonymous git:<br />
+ <tt>git clone
+ git://phpmyadmin.git.sourceforge.net/gitroot/phpmyadmin/phpmyadmin</tt><br />
</li>
<li>add your stuff</li>
<li>generate patch with your changes:
- <tt>svn diff</tt><br />
+ <tt>git diff > xxx.diff</tt><br />
</li>
- <li>put the patch inside the <a
+ <li>submit your patch via the <a
href="https://sourceforge.net/tracker/?group_id=23067&atid=377410">patch
tracker of the phpMyAdmin project</a>.
</li>
</ol>
-<p> Write access to the SVN tree is granted only to experienced developers who
+<p>More details on git are available on <a href="http://wiki.phpmyadmin.net/pma/Devel:Git">our wiki</a>.</p>
+
+<p> Write access to the repository is granted only to experienced developers who
have already contributed something useful to phpMyAdmin.<br />
Also, have a look at the <a href="#developers">Developers section</a>.</p>
@@ -4422,6 +4457,9 @@ now synchronize your databases placed on the same server or some remote server.
<abbr title="PHP Extension and Application Repository">PEAR</abbr>
coding standards</a>
on the other hand. Please pay attention to this.</li>
+ <li>Please enable showing PHP errors and warnings by the
+ <code><a href="#cfg_Error_Handler_display">$cfg['Error_Handler']['display']</a></code>
+ configuration directive.</li>
<li>Please try to keep up the file-naming conventions. Table-related stuff
goes to <i>tbl_*.php</i>, db-related code to <i>db_*.php</i>,
server-related tools to <i>server_*.php</i> and so on.</li>
diff --git a/README b/README
index 3581064..ae0af44 100644
--- a/README
+++ b/README
@@ -5,7 +5,7 @@ phpMyAdmin - Readme
A set of PHP-scripts to manage MySQL over the web.
- Version 3.3.1
+ Version 3.3.2
-------------
http://www.phpmyadmin.net/
diff --git a/db_operations.php b/db_operations.php
index 624007e..f051877 100644
--- a/db_operations.php
+++ b/db_operations.php
@@ -110,7 +110,7 @@ if (strlen($db) && (! empty($db_rename) || ! empty($db_copy))) {
// do not copy the data from a Merge table
// note: on the calling FORM, 'data' means 'structure and data'
- if ($tables_full[$each_table]['Engine'] == 'MRG_MyISAM') {
+ if (PMA_Table::isMerge($db, $each_table)) {
if ($this_what == 'data') {
$this_what = 'structure';
}
diff --git a/db_printview.php b/db_printview.php
index bf51015..d656f0e 100644
--- a/db_printview.php
+++ b/db_printview.php
@@ -117,7 +117,7 @@ else {
$sum_entries = $sum_size = 0;
$odd_row = true;
foreach ($tables as $sts_data) {
- if (strtoupper($sts_data['ENGINE']) == 'MRG_MYISAM'
+ if (PMA_Table::isMerge($db, $sts_data['TABLE_NAME'])
|| strtoupper($sts_data['ENGINE']) == 'FEDERATED') {
$merged_size = true;
} else {
diff --git a/db_structure.php b/db_structure.php
index fa18390..845ffd3 100644
--- a/db_structure.php
+++ b/db_structure.php
@@ -226,7 +226,11 @@ foreach ($tables as $keyname => $each_table) {
}
//$display_rows = ' - ';
break;
+ // Mysql 5.0.x (and lower) uses MRG_MyISAM and MySQL 5.1.x (and higher) uses MRG_MYISAM
+ // Both are aliases for MERGE
+ case 'MRG_MyISAM' :
case 'MRG_MYISAM' :
+ case 'MERGE' :
case 'BerkeleyDB' :
// Merge or BerkleyDB table: Only row count is accurate.
if ($is_show_stats) {
@@ -255,7 +259,7 @@ foreach ($tables as $keyname => $each_table) {
}
} // end switch
- if ('MRG_MYISAM' != $each_table['ENGINE']) {
+ if (! PMA_Table::isMerge($db, $each_table['TABLE_NAME'])) {
$sum_entries += $each_table['TABLE_ROWS'];
}
diff --git a/export.php b/export.php
index f8c9914..dae4cf4 100644
--- a/export.php
+++ b/export.php
@@ -439,7 +439,7 @@ if ($export_type == 'server') {
}
}
// if this is a view or a merge table, don't export data
- if (isset($GLOBALS[$what . '_data']) && !($is_view || (strcasecmp(PMA_Table::sGetStatusInfo($current_db, $table, 'Engine'),'MRG_MYISAM') == 0))) {
+ if (isset($GLOBALS[$what . '_data']) && !($is_view || PMA_Table::isMerge($current_db, $table))) {
$local_query = 'SELECT * FROM ' . PMA_backquote($current_db) . '.' . PMA_backquote($table);
if (!PMA_exportData($current_db, $table, $crlf, $err_url, $local_query)) {
break 3;
@@ -488,7 +488,7 @@ if ($export_type == 'server') {
}
}
// if this is a view or a merge table, don't export data
- if (isset($GLOBALS[$what . '_data']) && !($is_view || (strcasecmp(PMA_Table::sGetStatusInfo($db, $table, 'Engine'),'MRG_MYISAM') == 0))) {
+ if (isset($GLOBALS[$what . '_data']) && !($is_view || PMA_Table::isMerge($db, $table))) {
$local_query = 'SELECT * FROM ' . PMA_backquote($db) . '.' . PMA_backquote($table);
if (!PMA_exportData($db, $table, $crlf, $err_url, $local_query)) {
break 2;
@@ -537,8 +537,7 @@ if ($export_type == 'server') {
// If this is an export of a single view, we have to export data;
// for example, a PDF report
// if it is a merge table, no data is exported
- $is_merge = ! PMA_Table::isView($db, $table) && (strcasecmp(PMA_Table::sGetStatusInfo($db, $table, 'Engine'),'MRG_MYISAM') == 0);
- if (isset($GLOBALS[$what . '_data']) && ! $is_merge) {
+ if (isset($GLOBALS[$what . '_data']) && ! PMA_Table::isMerge($db, $table)) {
if (!empty($sql_query)) {
// only preg_replace if needed
if (!empty($add_query)) {
diff --git a/lang/belarusian_latin-utf-8.inc.php b/lang/belarusian_latin-utf-8.inc.php
index de2985e..bb0bc70 100644
--- a/lang/belarusian_latin-utf-8.inc.php
+++ b/lang/belarusian_latin-utf-8.inc.php
@@ -21,18 +21,6 @@ $month = array('Stu', 'Lut', 'Sak', 'Kra', 'Tra', 'Čer', 'Lip', 'Žni', 'Vier',
$datefmt = '%d %B %Y, %H:%M';
$timespanfmt = '%s dzion, %s hadzinaŭ, %s chvilinaŭ i %s sekundaŭ';
-kali łaska, praviercie kanfihuracyju PHP';
-Heta moža adbycca ŭ vypadku, kali PHP znojdzie syntaksyčnuju pamyłku ŭ im abo kali PHP nia moža znajści fajł.
-Kali łaska, zahruzicie kanfihuracyjny fajł niepasredna, vykarystoŭvajučy spasyłku, pryviedzienuju nižej, i pračytajcie paviedamleńni PHP pra pamyłki. U bolšaści vypadkaŭ, niedzie prapuščany apostraf abo kropka z koskaj.
-Kali vy atrymajecie čystuju staronku, značyć, usio dobra.';
-
-Kali łaska, spytajcie aŭtara, što robić %s.';
-Kali vam treba ŭžyć zvarotny słeš ("\") abo apostraf ("\'") u hetych značeńniach, ustaŭcie zvarotny słeš pierad imi (naprykład, \'\\\\xyz\' abo \'a\\\'b\').';
-
-Kali vam patrebna ŭžyć zvarotny słeš ("\") abo apostraf ("\'") siarod hetych značeńniaŭ, pastaŭcie pierad imi zvarotny słeš (naprykład, \'\\\\xyz\' abo \'a\\\'b\').';
-
-hetaje pole nia moža być adredagavanaje ';
-
$strAbortedClients = 'Spyniena';
$strAccessDeniedCreateConfig = 'Imavierna, pryčyna hetaha ŭ tym, što nia stvorany kanfihuracyjny fajł. Kab jaho stvaryć, možna vykarystać %1$snaładačny skrypt%2$s.';
$strAccessDeniedExplanation = 'phpMyAdmin pasprabavaŭ padłučycca da servera MySQL, ale server adchiliŭ złučeńnie. Praviercie imia chostu, karystalnika i parol u config.inc.php i ŭpeŭniciesia, što jany adpaviadajuć infarmacyi, jakuju daŭ administratar MySQL-servera.';
@@ -124,7 +112,7 @@ $strCancel = 'Skasavać';
$strCanNotLoadExportPlugins = 'Niemahčyma zahruzić płahiny ekspartavańnia, kali łaska, praviercie ŭstalavanyja fajły!';
$strCanNotLoadImportPlugins = 'Niemahčyma zahruzić płahiny impartavańnia, kali łaska, praviercie ŭstaloŭku!';
$strCannotLogin = 'Niemahčyma załahavacca na server MySQL';
-$strCantLoad = 'niemahčyma zahruzić pašyreńnie %s;
+$strCantLoad = 'niemahčyma zahruzić pašyreńnie %s; kali łaska, praviercie kanfihuracyju PHP';
$strCantLoadRecodeIconv = 'Niemahčyma zahruzić pašyreńnie iconv abo pašyreńnie recode, nieabchodnyja dla pierakadavańnia symbalaŭ. Naładźcie PHP na vykarystańnie hetych pašyreńniaŭ abo ŭvohule adklučycie pierakadavańnie symbalaŭ u phpMyAdmin.';
$strCantRenameIdxToPrimary = 'Niemahčyma pierajmienavać indeks u PRIMARY!';
$strCantUseRecodeIconv = 'Niemahčyma vykarystać ni funkcyju iconv, ni libiconvr, ni recode_string u toj čas, jak pašyreńnie paviedamlaje, što jano zahružanaje. Praviercie vašuju kanfihuracyju PHP.';
@@ -164,7 +152,7 @@ $strCompleteInserts = 'Poŭnaja ŭstaŭka';
$strCompression = 'Ścisk';
$strCompressionWillBeDetected = 'Metad ścisku impartavanaha fajła budzie vyznačanaja aŭtamatyčna z: %s';
$strConfigDefaultFileError = 'Niemahčyma zahruzić kanfihuracyju pa zmoŭčańni z: "%1$s"';
-$strConfigFileError = 'phpMyAdmin nia moža pračytać kanfihuracyjny fajł!
+$strConfigFileError = 'phpMyAdmin nia moža pračytać kanfihuracyjny fajł! Heta moža adbycca ŭ vypadku, kali PHP znojdzie syntaksyčnuju pamyłku ŭ im abo kali PHP nia moža znajści fajł. Kali łaska, zahruzicie kanfihuracyjny fajł niepasredna, vykarystoŭvajučy spasyłku, pryviedzienuju nižej, i pračytajcie paviedamleńni PHP pra pamyłki. U bolšaści vypadkaŭ, niedzie prapuščany apostraf abo kropka z koskaj. Kali vy atrymajecie čystuju staronku, značyć, usio dobra.';
$strConfigureTableCoord = 'Kali łaska, skanfihurujcie kaardynaty dla tablicy %s';
$strConnectionError = 'Niemahčyma padłučycca: niapravilnyja nałady.';
$strConnections = 'Padłučeńni';
@@ -352,13 +340,13 @@ $strHaveToShow = 'Vam nieabchodna vybrać prynamsi adnu kalonku dla adlustravań
$strHebrew = 'Habrejskaja';
$strHelp = 'Dapamoha';
$strHexForBLOB = 'Šasnaccatkovyja značeńni dla polaŭ typu BLOB';
-$strHide = 'Schavać';
$strHideShowAll = 'Schavać/pakazać usie tablicy';
$strHideShowNoRelation = 'Schavać/pakazać tablicy biaz suviaziaŭ';
+$strHide = 'Schavać';
$strHome = 'Da pačatku';
$strHomepageOfficial = 'Aficyjnaja staronka phpMyAdmin';
-$strHost = 'Chost';
$strHostEmpty = 'Pustoje imia chostu!';
+$strHost = 'Chost';
$strHTMLExcel = 'Microsoft Excel 2000';
$strHTMLWord = 'Microsoft Word 2000';
$strHungarian = 'Vuhorskaja';
@@ -387,8 +375,8 @@ $strInnoDBAutoextendIncrementDesc = ' Pamier pryraščeńnia dla pašyreńnia pa
$strInnoDBBufferPoolSizeDesc = 'Pamier buferu ŭ pamiaci, jaki InnoDB vykarystoŭvaje dla kešavańnia dadzienych i indeksaŭ tablic.';
$strInnoDBBufferPoolSize = 'Pamier pułu buferu';
$strInnoDBDataFilePath = 'Fajły dadzienych';
-$strInnoDBDataHomeDir = 'Chatniaja tečka dadzienych';
$strInnoDBDataHomeDirDesc = 'Ahulnaja častka šlachu tečki da ŭsich fajłaŭ dadzienych InnoDB.';
+$strInnoDBDataHomeDir = 'Chatniaja tečka dadzienych';
$strInnoDBPages = 'staronak';
$strInnodbStat = 'Stan InnoDB';
$strInsecureMySQL = 'Vaš kanfihuracyjny fajł utrymlivaje nałady (karystalnik root biez parolu), jakija adpaviadajuć pryvilejavanamu karystalniku MySQL pa zmoŭčańni. Vaš server MySQL pracuje z hetaj naładaj pa zmoŭčańni i źjaŭlajecca adkrytym dla źniešniaha ŭryvańnia, i tamu vam abaviazkova treba vypravić hetuju chibu ŭ biaśpiecy.';
@@ -431,7 +419,6 @@ $strKorean = 'Karejskaja';
$strLandscape = 'Krajavid';
$strLanguage = 'Mova';
$strLanguageUnknown = 'Nieviadomaja mova: %1$s.';
-$strLatchedPages = 'Fiksavanyja staronki';
$strLatexCaption = 'Zahałovak tablicy';
$strLatexContent = 'Źmieściva tablicy __TABLE__';
$strLatexContinuedCaption = 'Praciahnuty zahałovak tablicy';
@@ -440,6 +427,7 @@ $strLatexIncludeCaption = 'Uklučyć zahałovak tablicy';
$strLatexLabel = 'Kluč mietki';
$strLaTeX = 'LaTeX';
$strLatexStructure = 'Struktura tablicy __TABLE__';
+$strLatchedPages = 'Fiksavanyja staronki';
$strLatvian = 'Łatvijskaja';
$strLDI = 'CSV z vykarystańniem LOAD DATA';
$strLDILocal = 'Vykarystoŭvać klučavoje słova LOCAL';
@@ -468,9 +456,9 @@ $strMIME_available_mime = 'Dastupnyja MIME-typy';
$strMIME_available_transform = 'Dastupnyja pieraŭtvareńni';
$strMIME_description = 'Apisańnie';
$strMIME_MIMEtype = 'MIME-typ';
-$strMIME_nodescription = 'Niama dastupnych apisańniaŭ dla hetaha pieraŭtvareńnia.
+$strMIME_nodescription = 'Niama dastupnych apisańniaŭ dla hetaha pieraŭtvareńnia. Kali łaska, spytajcie aŭtara, što robić %s.';
$strMIME_transformation_note = 'Dla atrymańnia śpisu dastupnych opcyjaŭ transfarmacyi i pieraŭtvareńniaŭ ichnych MIME-typaŭ, naciśnicie na %sapisańni pieraŭtvareńniaŭ%s';
-$strMIME_transformation_options_note = 'Kali łaska, uvodźcie značeńni opcyjaŭ pieraŭtvareńnia vykarystoŭvajučy hety farmat: \'a\', 100, b,\'c\'...
+$strMIME_transformation_options_note = 'Kali łaska, uvodźcie značeńni opcyjaŭ pieraŭtvareńnia vykarystoŭvajučy hety farmat: \'a\', 100, b,\'c\'... Kali vam treba ŭžyć zvarotny słeš ("\") abo apostraf ("\'") u hetych značeńniach, ustaŭcie zvarotny słeš pierad imi (naprykład, \'\\\\xyz\' abo \'a\\\'b\').';
$strMIME_transformation_options = 'Opcyi pieraŭtvareńnia';
$strMIME_transformation = 'Pieraŭtvareńnie MIME-typu braŭzeram';
$strMIMETypesForTable = 'MIME-typy tablicy';
@@ -776,7 +764,7 @@ $strServerVars = 'Nałady i źmiennyja servera';
$strServerVersion = 'Versija servera';
$strSessionStartupErrorGeneral = 'Niemahčyma biez pamyłak raspačać sesiju. Kali łaska, praviercie pamyłki ŭ vašym łogu PHP i, mahčyma, taksama ŭ łogu web-servera i skanfihurujcie PHP pravilna.';
$strSessionValue = 'Značeńnie sesii';
-$strSetEnumVal = 'Kali typ pola "enum" abo "set", kali łaska, uvodźcie značeńni vykarystoŭvajučy hety farmat: \'a\',\'b\',\'c\'...
+$strSetEnumVal = 'Kali typ pola "enum" abo "set", kali łaska, uvodźcie značeńni vykarystoŭvajučy hety farmat: \'a\',\'b\',\'c\'... Kali vam patrebna ŭžyć zvarotny słeš ("\") abo apostraf ("\'") siarod hetych značeńniaŭ, pastaŭcie pierad imi zvarotny słeš (naprykład, \'\\\\xyz\' abo \'a\\\'b\').';
$strShowAll = 'Pakazać usie';
$strShowColor = 'Pakazać koler';
$strShowDatadictAs = 'Farmat słoŭnika dadzienych';
@@ -928,9 +916,9 @@ $strSQPBugInvalidIdentifer = 'Niapravilny identyfikatar';
$strSQPBugUnclosedQuote = 'Niezakrytaje dvukośsie';
$strSQPBugUnknownPunctuation = 'Nieviadomy symbal punktuacyi';
$strStandInStructureForView = 'Zamianialnaja struktura dla prahladu';
-$strStatCheckTime = 'Apošniaja pravierka';
$strStatCreateTime = 'Stvoranaja';
$strStatement = 'Vyrazy';
+$strStatCheckTime = 'Apošniaja pravierka';
$strStatisticsOverrun = 'Na zahružanym servery bajtavyja ličylniki mohuć pieraskokvać koła, tamu statystyka, jakuju pakazvaje MySQL-server, moža być niapravilnaj.';
$strStatUpdateTime = 'Apošniaje abnaŭleńnie';
$strStatus = 'Stan';
@@ -975,7 +963,7 @@ $strTable = 'Tablica';
$strTakeIt = 'hetaja';
$strTblPrivileges = 'Pryvilei, specyfičnyja dla tablicy';
$strTempData = 'Časovyja dadzienyja';
-$strTextAreaLength = ' Z-za vialikaj daŭžyni,
+$strTextAreaLength = ' Z-za vialikaj daŭžyni, hetaje pole nia moža być adredagavanaje ';
$strTexyText = 'Tekst Texy!';
$strThai = 'Tajlandzkaja';
$strThemeDefaultNotFound = 'Tema pa zmoŭčańni %s nia znojdzienaja!';
@@ -1111,7 +1099,7 @@ $strCouldNotConnectTarget = 'Could not connect to the target'; //to translate
$strCreateUserDatabasePrivileges = 'Grant all privileges on database "%s"'; //to translate
$strCurrentServer = 'Current server'; //to translate
-$strDatabaseNotExisting = '\'%s\' database does not exist.'; //to translate
+$strDatabaseNotExisting = '\'%s\' database does not exist.'; //to translate
$strDatabase_src = 'Source database'; //to translate
$strDatabase_trg = 'Target database'; //to translate
$strDataDiff = 'Data Difference'; //to translate
@@ -1166,11 +1154,11 @@ $strRemoteServer = 'Remote server'; //to translate
$strRemoveCRLF = 'Remove CRLF characters within fields'; //to translate
$strReplicationAddLines = 'Now, add the following lines at the end of your my.cnf and please restart the MySQL server afterwards.'; //to translate
$strReplicationAddSlaveUser = 'Add slave replication user'; //to translate
-$strReplicationChangedSuccesfully = 'Master server changed succesfully to %s'; //to translate
$strReplicationConfiguredMaster = 'This server is configured as master in a replication process.'; //to translate
$strReplicationControlSlave = 'Control slave:'; //to translate
$strReplicationErrorGetPosition = 'Unable to read master log position. Possible privilege problem on master.'; //to translate
$strReplicationErrorMasterConnect = 'Unable to connect to master %s.'; //to translate
+$strReplicationChangedSuccesfully = 'Master server changed succesfully to %s'; //to translate
$strReplicationMasterChooseAll = 'Replicate all databases; Ignore:'; //to translate
$strReplicationMasterChooseIgn = 'Ignore all databases; Replicate:'; //to translate
$strReplicationMasterChooseMode = 'This server is not configured as master server in a replication process. You can choose from either replicating all databases and ignoring certain (useful if you want to replicate majority of databases) or you can choose to ignore all databases by default and allow only certain databases to be replicated. Please select the mode:'; //to translate
@@ -1183,10 +1171,10 @@ $strReplicationShowConnectedSlavesNote = 'Only slaves started with the --report-
$strReplicationShowConnectedSlaves = 'Show connected slaves'; //to translate
$strReplicationShowMasterStatus = 'Show master status'; //to translate
$strReplicationSkippingErrorWarn = 'Skipping error(s) might lead into unsynchronized master and slave!'; //to translate
-$strReplicationSlaveChangeMaster = 'Change or reconfigure master server'; //to translate
$strReplicationSlaveConfiguration = 'Slave configuration'; //to translate
$strReplicationSlaveConfigured = 'Server is configured as slave in a replication process. Would you like to:'; //to translate
$strReplicationSlaveErrorManagement = 'Error management:'; //to translate
+$strReplicationSlaveChangeMaster = 'Change or reconfigure master server'; //to translate
$strReplicationSlaveIOThread = 'IO Thread %s only'; //to translate
$strReplicationSlaveNotConfigured = 'This server is not configured as slave in a replication process. Would you like to <a href="%s">configure</a> it?'; //to translate
$strReplicationSlaveReset = 'Reset slave'; //to translate
@@ -1225,13 +1213,6 @@ $strSetupBZipDump_name = 'Bzip2'; //to translate
$strSetupBZipDumpWarning = '[a@?page=form&formset=features#tab_Import_export]Bzip2 compression and decompression[/a] requires functions (%s) which are unavailable on this system.'; //to translate
$strSetupCannotLoadConfig = 'Cannot load or save configuration'; //to translate
$strSetupCannotLoadConfigMsg = 'Please create web server writable folder [em]config[/em] in phpMyAdmin top level directory as described in [a@../Documentation.html#setup_script]documentation[/a]. Otherwise you will be only able to download or display it.'; //to translate
-$strSetupCharEditing_desc = 'Defines which type of editing controls should be used for CHAR and VARCHAR fields; [kbd]input[/kbd] - allows limiting of input length, [kbd]textarea[/kbd] - allows newlines in fields'; //to translate
-$strSetupCharEditing_name = 'CHAR fields editing'; //to translate
-$strSetupCharTextareaCols_desc = 'Number of columns for CHAR/VARCHAR textareas'; //to translate
-$strSetupCharTextareaCols_name = 'CHAR textarea columns'; //to translate
-$strSetupCharTextareaRows_desc = 'Number of rows for CHAR/VARCHAR textareas'; //to translate
-$strSetupCharTextareaRows_name = 'CHAR textarea rows'; //to translate
-$strSetupCheckConfigurationPermissions_name = 'Check config file permissions'; //to translate
$strSetupClear = 'Clear'; //to translate
$strSetupCompressOnFly_desc = 'Compress gzip/bzip2 exports on the fly without the need for much memory; if you encounter problems with created gzip/bzip2 files disable this feature'; //to translate
$strSetupCompressOnFly_name = 'Compress on the fly'; //to translate
@@ -1273,12 +1254,12 @@ $strSetuperror_nan_p = 'Not a positive number'; //to translate
$strSetupExecTimeLimit_desc = 'Set the number of seconds a script is allowed to run ([kbd]0[/kbd] for no limit)'; //to translate
$strSetupExecTimeLimit_name = 'Maximum execution time'; //to translate
$strSetupExport_asfile_name = 'Save as file'; //to translate
-$strSetupExport_charset_name = 'Character set of the file'; //to translate
$strSetupExport_compression_name = 'Compression'; //to translate
$strSetupExport_file_template_database_name = 'Database name template'; //to translate
$strSetupExport_file_template_server_name = 'Server name template'; //to translate
$strSetupExport_file_template_table_name = 'Table name template'; //to translate
$strSetupExport_format_name = 'Format'; //to translate
+$strSetupExport_charset_name = 'Character set of the file'; //to translate
$strSetupExport_onserver_name = 'Save on server'; //to translate
$strSetupExport_onserver_overwrite_name = 'Overwrite existing file(s)'; //to translate
$strSetupExport_remember_file_template_name = 'Remember file name template'; //to translate
@@ -1341,6 +1322,13 @@ $strSetupGZipDump_desc = 'Enable [a@http://en.wikipedia.org/wiki/Gzip]gzip[/a] c
$strSetupGZipDump_name = 'GZip'; //to translate
$strSetupGZipDumpWarning = '[a@?page=form&formset=features#tab_Import_export]GZip compression and decompression[/a] requires functions (%s) which are unavailable on this system.'; //to translate
$strSetupHomepageLink = 'phpMyAdmin homepage'; //to translate
+$strSetupCharEditing_desc = 'Defines which type of editing controls should be used for CHAR and VARCHAR fields; [kbd]input[/kbd] - allows limiting of input length, [kbd]textarea[/kbd] - allows newlines in fields'; //to translate
+$strSetupCharEditing_name = 'CHAR fields editing'; //to translate
+$strSetupCharTextareaCols_desc = 'Number of columns for CHAR/VARCHAR textareas'; //to translate
+$strSetupCharTextareaCols_name = 'CHAR textarea columns'; //to translate
+$strSetupCharTextareaRows_desc = 'Number of rows for CHAR/VARCHAR textareas'; //to translate
+$strSetupCharTextareaRows_name = 'CHAR textarea rows'; //to translate
+$strSetupCheckConfigurationPermissions_name = 'Check config file permissions'; //to translate
$strSetupIconvExtraParams_name = 'Extra parameters for iconv'; //to translate
$strSetupIgnoreErrors = 'Ignore errors'; //to translate
$strSetupIgnoreMultiSubmitErrors_desc = 'If enabled, phpMyAdmin continues computing multiple-statement queries even if one of the queries failed'; //to translate
@@ -1388,10 +1376,10 @@ $strSetupLoginCookieStore_name = 'Login cookie store'; //to translate
$strSetupLoginCookieValidity_desc = 'Define how long (in seconds) a login cookie is valid'; //to translate
$strSetupLoginCookieValidityMsg = '[a@?page=form&formset=features#tab_Security]Login cookie validity[/a] should be should be set to 1800 seconds (30 minutes) at most. Values larger than 1800 may pose a security risk such as impersonation.'; //to translate
$strSetupLoginCookieValidity_name = 'Login cookie validity'; //to translate
-$strSetupMaxCharactersInDisplayedSQL_desc = 'Maximum number of characters used when a SQL query is displayed'; //to translate
-$strSetupMaxCharactersInDisplayedSQL_name = 'Maximum displayed SQL length'; //to translate
$strSetupMaxDbList_desc = 'Maximum number of databases displayed in left frame and database list'; //to translate
$strSetupMaxDbList_name = 'Maximum databases'; //to translate
+$strSetupMaxCharactersInDisplayedSQL_desc = 'Maximum number of characters used when a SQL query is displayed'; //to translate
+$strSetupMaxCharactersInDisplayedSQL_name = 'Maximum displayed SQL length'; //to translate
$strSetupMaxRows_desc = 'Number of rows displayed when browsing a result set. If the result set contains more rows, "Previous" and "Next" links will be shown.'; //to translate
$strSetupMaxRows_name = 'Maximum number of rows to display'; //to translate
$strSetupMaxTableList_desc = 'Maximum number of tables displayed in table list'; //to translate
@@ -1498,20 +1486,20 @@ $strSetupServers_table_info_desc = 'Table to describe the display fields, leave
$strSetupServers_table_info_name = 'Display fields table'; //to translate
$strSetupServers_user_desc = 'Leave empty if not using config auth'; //to translate
$strSetupServers_user_name = 'User for config auth'; //to translate
+$strSetupServers_verbose_desc = 'A user-friendly description of this server. Leave blank to display the hostname instead.'; //to translate
$strSetupServers_verbose_check_desc = 'Disable if you know that your pma_* tables are up to date. This prevents compatibility checks and thereby increases performance'; //to translate
$strSetupServers_verbose_check_name = 'Verbose check'; //to translate
-$strSetupServers_verbose_desc = 'A user-friendly description of this server. Leave blank to display the hostname instead.'; //to translate
$strSetupServers_verbose_name = 'Verbose name of this server'; //to translate
$strSetupSetValue = 'Set value: %s'; //to translate
$strSetupShowAll_desc = 'Whether a user should be displayed a "show all (records)" button'; //to translate
$strSetupShowAll_name = 'Allow to display all the rows'; //to translate
-$strSetupShowChgPassword_desc = 'Please note that enabling this has no effect with [kbd]config[/kbd] authentication mode because the password is hard coded in the configuration file; this does not limit the ability to execute the same command directly'; //to translate
-$strSetupShowChgPassword_name = 'Show password change form'; //to translate
$strSetupShowCreateDb_name = 'Show create database form'; //to translate
$strSetupShowForm = 'Show form'; //to translate
$strSetupShowFunctionFields_desc = 'Display the function fields in edit/insert mode'; //to translate
$strSetupShowFunctionFields_name = 'Show function fields'; //to translate
$strSetupShowHiddenMessages = 'Show hidden messages (#MSG_COUNT)'; //to translate
+$strSetupShowChgPassword_desc = 'Please note that enabling this has no effect with [kbd]config[/kbd] authentication mode because the password is hard coded in the configuration file; this does not limit the ability to execute the same command directly'; //to translate
+$strSetupShowChgPassword_name = 'Show password change form'; //to translate
$strSetupShowPhpInfo_desc = 'Shows link to [a@http://php.net/manual/function.phpinfo.php]phpinfo()[/a] output'; //to translate
$strSetupShowPhpInfo_name = 'Show phpinfo() link'; //to translate
$strSetupShowServerInfo_name = 'Show detailed MySQL server information'; //to translate
diff --git a/libraries/Config.class.php b/libraries/Config.class.php
index f5feca8..63b314a 100644
--- a/libraries/Config.class.php
+++ b/libraries/Config.class.php
@@ -92,7 +92,7 @@ class PMA_Config
*/
function checkSystem()
{
- $this->set('PMA_VERSION', '3.3.1');
+ $this->set('PMA_VERSION', '3.3.2');
/**
* @deprecated
*/
diff --git a/libraries/Table.class.php b/libraries/Table.class.php
index 0f407e7..ceed355 100644
--- a/libraries/Table.class.php
+++ b/libraries/Table.class.php
@@ -238,6 +238,31 @@ class PMA_Table
return $type == 'VIEW';
}
+ /**
+ * Checks if this is a merge table
+ *
+ * If the ENGINE of the table is MERGE or MRG_MYISAM (alias), this is a merge table.
+ *
+ * @param string the database name
+ * @param string the table name
+ * @return boolean true if it is a merge table
+ * @access public
+ */
+ static public function isMerge($db = null, $table = null)
+ {
+ // if called static, with parameters
+ if (! empty($db) && ! empty($table)) {
+ $engine = PMA_Table::sGetStatusInfo($db, $table, 'ENGINE', null, true);
+ }
+ // if called as an object
+ // does not work yet, because $this->settings[] is not filled correctly
+ else if (! empty($this)) {
+ $engine = $this->get('ENGINE');
+ }
+
+ return (! empty($engine) && ((strtoupper($engine) == 'MERGE') || (strtoupper($engine) == 'MRG_MYISAM')));
+ }
+
static public function sGetToolTip($db, $table)
{
return PMA_Table::sGetStatusInfo($db, $table, 'Comment')
@@ -254,9 +279,10 @@ class PMA_Table
* @param string $table
* @param string $info
* @param boolean $force_read
+ * @param boolean if true, disables error message
* @return mixed
*/
- static public function sGetStatusInfo($db, $table, $info = null, $force_read = false)
+ static public function sGetStatusInfo($db, $table, $info = null, $force_read = false, $disable_error = false)
{
if (! isset(PMA_Table::$cache[$db][$table]) || $force_read) {
PMA_DBI_get_tables_full($db, $table);
@@ -274,7 +300,9 @@ class PMA_Table
}
if (! isset(PMA_Table::$cache[$db][$table][$info])) {
- trigger_error('unknown table status: ' . $info, E_USER_WARNING);
+ if (! $disable_error) {
+ trigger_error('unknown table status: ' . $info, E_USER_WARNING);
+ }
return false;
}
diff --git a/libraries/common.lib.php b/libraries/common.lib.php
index 522a224..d9ff7c5 100644
--- a/libraries/common.lib.php
+++ b/libraries/common.lib.php
@@ -1591,6 +1591,11 @@ function PMA_generate_html_tab($tab, $url_params = array())
$tab['attr'] .= ' title="' . htmlspecialchars($tab['warning']) . '"';
}
+ // If there are any tab specific URL parameters, merge those with the general URL parameters
+ if(! empty($tab['url_params']) && is_array($tab['url_params'])) {
+ $url_params = array_merge($url_params, $tab['url_params']);
+ }
+
// build the link
if (!empty($tab['link'])) {
$tab['link'] = htmlentities($tab['link']);
diff --git a/libraries/config.default.php b/libraries/config.default.php
index 3450739..b1fef17 100644
--- a/libraries/config.default.php
+++ b/libraries/config.default.php
@@ -439,7 +439,7 @@ $cfg['Servers'][$i]['tracking_default_statements'] = 'CREATE TABLE,ALTER TABLE,D
'CREATE DATABASE,ALTER DATABASE,DROP DATABASE';
/**
- * Whether a DROP VIEW IF EXISTS statement will added as first line to the log when creating a view.
+ * Whether a DROP VIEW IF EXISTS statement will be added as first line to the log when creating a view.
*
* @global bool $cfg['Servers'][$i]['tracking_add_drop_view']
*/
@@ -447,7 +447,7 @@ $cfg['Servers'][$i]['tracking_default_statements'] = 'CREATE TABLE,ALTER TABLE,D
$cfg['Servers'][$i]['tracking_add_drop_view'] = true;
/**
- * Whether a DROP TABLE IF EXISTS statement will added as first line to the log when creating a table.
+ * Whether a DROP TABLE IF EXISTS statement will be added as first line to the log when creating a table.
*
* @global bool $cfg['Servers'][$i]['tracking_add_drop_table']
*/
@@ -455,7 +455,7 @@ $cfg['Servers'][$i]['tracking_add_drop_view'] = true;
$cfg['Servers'][$i]['tracking_add_drop_table'] = true;
/**
- * Whether a DROP DATABASE IF EXISTS statement will added as first line to the log when creating a database.
+ * Whether a DROP DATABASE IF EXISTS statement will be added as first line to the log when creating a database.
*
* @global bool $cfg['Servers'][$i]['tracking_add_drop_database']
*/
@@ -463,7 +463,7 @@ $cfg['Servers'][$i]['tracking_add_drop_table'] = true;
$cfg['Servers'][$i]['tracking_add_drop_database'] = true;
/**
- * Whether a DROP DATABASE IF EXISTS statement will added as first line to the log when creating a database.
+ * Whether a DROP DATABASE IF EXISTS statement will be added as first line to the log when creating a database.
*
* @global bool $cfg['Servers'][$i]['tracking_version_drop_database']
*/
diff --git a/libraries/db_events.inc.php b/libraries/db_events.inc.php
index 5f99a8b..9ff5f76 100644
--- a/libraries/db_events.inc.php
+++ b/libraries/db_events.inc.php
@@ -51,7 +51,7 @@ if ($events) {
($ct%2 == 0) ? 'even' : 'odd',
$event['EVENT_NAME'],
! empty($definition) ? PMA_linkOrButton('db_sql.php?' . $url_query . '&sql_query=' . urlencode($definition) . '&show_query=1&delimiter=' . urlencode($delimiter), $titles['Structure']) : ' ',
- '<a href="sql.php?' . $url_query . '&sql_query=' . urlencode($sqlDrop) . '" onclick="return confirmLink(this, \'' . PMA_jsFormat($sqlDrop, false) . '\')">' . $titles['Drop'] . '</a>',
+ '<a href="sql.php?' . $url_query . '&sql_query=' . urlencode($sqlDrop) . '" onclick="return confirmLink(this, \'' . PMA_jsFormat($sqlDrop, false) . '\')">' . $titles['Drop'] . '</a>',
$event['EVENT_TYPE']);
$ct++;
}
diff --git a/libraries/display_export.lib.php b/libraries/display_export.lib.php
index a680995..186b0d3 100644
--- a/libraries/display_export.lib.php
+++ b/libraries/display_export.lib.php
@@ -104,10 +104,7 @@ echo PMA_pluginGetJavascript($export_list);
//]]>
</script>
-<?php
- $is_merge = ! PMA_Table::isView($db, $table) && (strcasecmp(PMA_Table::sGetStatusInfo($db, $table, 'Engine'),'MRG_MYISAM') == 0);
- if (strlen($table) && ! isset($num_tables) && ! $is_merge) {
-?>
+<?php if (strlen($table) && ! isset($num_tables) && ! PMA_Table::isMerge($db, $table)) { ?>
<div class="formelementrow">
<?php
echo '<input type="radio" name="allrows" value="0" id="radio_allrows_0" checked="checked" />';
diff --git a/libraries/display_tbl.lib.php b/libraries/display_tbl.lib.php
index 4f16ca5..41bb987 100644
--- a/libraries/display_tbl.lib.php
+++ b/libraries/display_tbl.lib.php
@@ -1361,12 +1361,13 @@ function PMA_displayTableBody(&$dt_result, &$is_display, $map, $analyzed_sql) {
$field_flags = PMA_DBI_field_flags($dt_result, $i);
if (isset($meta->_type) && $meta->_type === MYSQLI_TYPE_BIT) {
$row[$i] = PMA_printable_bit_value($row[$i], $meta->length);
- } elseif (stristr($field_flags, 'BINARY') && $meta->type == 'string') {
- if ($_SESSION['tmp_user_values']['display_binary'] || (isset($GLOBALS['is_analyse']) && $GLOBALS['is_analyse'])) {
+ // some results of PROCEDURE ANALYSE() are reported as
+ // being BINARY but they are quite readable,
+ // so don't treat them as BINARY
+ } elseif (stristr($field_flags, 'BINARY') && $meta->type == 'string' && !(isset($GLOBALS['is_analyse']) && $GLOBALS['is_analyse'])) {
+ if ($_SESSION['tmp_user_values']['display_binary']) {
// user asked to see the real contents of BINARY
- // fields, or we detected a PROCEDURE ANALYSE in
- // the query (results are reported as being
- // binary strings)
+ // fields
if ($_SESSION['tmp_user_values']['display_binary_as_hex']) {
$row[$i] = bin2hex($row[$i]);
}
@@ -1670,7 +1671,11 @@ function PMA_displayTable_checkConfigParams()
$_SESSION['tmp_user_values']['query'][$sql_key]['repeat_cells'] = $GLOBALS['cfg']['RepeatCells'];
}
- if (PMA_isValid($_REQUEST['session_max_rows'], 'numeric') || $_REQUEST['session_max_rows'] == 'all') {
+ // as this is a form value, the type is always string so we cannot
+ // use PMA_isValid($_REQUEST['session_max_rows'], 'integer')
+ if ((PMA_isValid($_REQUEST['session_max_rows'], 'numeric')
+ && (int) $_REQUEST['session_max_rows'] == $_REQUEST['session_max_rows'])
+ || $_REQUEST['session_max_rows'] == 'all') {
$_SESSION['tmp_user_values']['query'][$sql_key]['max_rows'] = $_REQUEST['session_max_rows'];
unset($_REQUEST['session_max_rows']);
} elseif (empty($_SESSION['tmp_user_values']['query'][$sql_key]['max_rows'])) {
diff --git a/libraries/export/xls.php b/libraries/export/xls.php
index b450d6f..efbb481 100644
--- a/libraries/export/xls.php
+++ b/libraries/export/xls.php
@@ -59,6 +59,7 @@ function PMA_exportFooter() {
$tmp_filename = tempnam(realpath($GLOBALS['cfg']['TempDir']), 'pma_xls_');
$workbookWriter = new PHPExcel_Writer_Excel5($workbook);
+ $workbookWriter->setTempDir(realpath($GLOBALS['cfg']['TempDir']));
$workbookWriter->save($tmp_filename);
if (!PMA_exportOutputHandler(file_get_contents($tmp_filename))) {
diff --git a/libraries/export/xlsx.php b/libraries/export/xlsx.php
index 5a8ec70..1b24c4c 100644
--- a/libraries/export/xlsx.php
+++ b/libraries/export/xlsx.php
@@ -55,18 +55,18 @@ function PMA_exportComment($text) {
function PMA_exportFooter() {
global $workbook;
global $tmp_filename;
-
+
$tmp_filename = tempnam(realpath($GLOBALS['cfg']['TempDir']), 'pma_xlsx_');
-
+
$workbookWriter = new PHPExcel_Writer_Excel2007($workbook);
$workbookWriter->save($tmp_filename);
-
+
if (!PMA_exportOutputHandler(file_get_contents($tmp_filename))) {
return FALSE;
}
-
+
unlink($tmp_filename);
-
+
unset($GLOBALS['workbook']);
unset($GLOBALS['sheet_index']);
@@ -82,17 +82,17 @@ function PMA_exportFooter() {
*/
function PMA_exportHeader() {
global $db;
-
+
/* Initialize the workbook */
$GLOBALS['workbook'] = new PHPExcel();
$GLOBALS['sheet_index'] = 0;
global $workbook;
-
+
$workbook->getProperties()->setCreator('phpMyAdmin ' . PMA_VERSION);
$workbook->getProperties()->setLastModifiedBy('phpMyAdmin ' . PMA_VERSION);
$workbook->getProperties()->setTitle($db);
$workbook->getProperties()->setSubject('phpMyAdmin ' . PMA_VERSION . ' XLSX Dump');
-
+
return TRUE;
}
@@ -106,8 +106,8 @@ function PMA_exportHeader() {
* @access public
*/
function PMA_exportDBHeader($db) {
-
-
+
+
return TRUE;
}
@@ -153,33 +153,33 @@ function PMA_exportDBCreate($db) {
function PMA_exportData($db, $table, $crlf, $error_url, $sql_query) {
global $workbook;
global $sheet_index;
-
+
/**
* Get the data from the database using the original query
*/
$result = PMA_DBI_fetch_result($sql_query);
$row_cnt = count($result);
-
+
if ($row_cnt > 0) {
$col_names = array_keys($result[0]);
$fields_cnt = count($result[0]);
$row_offset = 1;
-
+
/* Only one sheet is created on workbook initialization */
if ($sheet_index > 0) {
$workbook->createSheet();
}
-
+
$workbook->setActiveSheetIndex($sheet_index);
$workbook->getActiveSheet()->setTitle(substr($table, 0, 31));
-
+
if (isset($GLOBALS['xlsx_columns']) && $GLOBALS['xlsx_columns']) {
for ($i = 0; $i < $fields_cnt; ++$i) {
$workbook->getActiveSheet()->setCellValueByColumnAndRow($i, $row_offset, $col_names[$i]);
}
$row_offset++;
}
-
+
for ($r = 0; ($r < 65536) && ($r < $row_cnt); ++$r) {
for ($c = 0; $c < $fields_cnt; ++$c) {
if (!isset($result[$r][$col_names[$c]]) || is_null($result[$r][$col_names[$c]])) {
@@ -194,10 +194,10 @@ function PMA_exportData($db, $table, $crlf, $error_url, $sql_query) {
}
}
}
-
+
$sheet_index++;
}
-
+
return TRUE;
}
diff --git a/libraries/export/xml.php b/libraries/export/xml.php
index 5b82ad5..aab58d0 100644
--- a/libraries/export/xml.php
+++ b/libraries/export/xml.php
@@ -337,7 +337,7 @@ function PMA_exportData($db, $table, $crlf, $error_url, $sql_query) {
if (!isset($record[$i]) || is_null($record[$i])) {
$record[$i] = 'NULL';
}
- $buffer .= ' <column name="' . $columns[$i] . '">' . htmlspecialchars(utf8_encode((string)$record[$i]))
+ $buffer .= ' <column name="' . $columns[$i] . '">' . htmlspecialchars((string)$record[$i])
. '</column>' . $crlf;
}
$buffer .= ' </table>' . $crlf;
diff --git a/libraries/import.lib.php b/libraries/import.lib.php
index ca2ac2c..2f50c5d 100644
--- a/libraries/import.lib.php
+++ b/libraries/import.lib.php
@@ -947,7 +947,7 @@ function PMA_buildSQL($db_name, &$tables, &$analyses = NULL, &$additional_sql =
$tempSQLStr .= ", ";
}
}
- $tempSQLStr .= ") ENGINE=MyISAM;";
+ $tempSQLStr .= ") ENGINE=MyISAM DEFAULT CHARACTER SET " . $charset . " COLLATE " . $collation . ";";
/**
* Each SQL statement is executed immediately
diff --git a/libraries/import/ods.php b/libraries/import/ods.php
index 89701ec..81aed5e 100644
--- a/libraries/import/ods.php
+++ b/libraries/import/ods.php
@@ -68,7 +68,7 @@ unset($data);
* result in increased performance without the need to
* alter the code in any way. It's basically a freebee.
*/
-$xml = simplexml_load_string(utf8_encode($buffer), "SimpleXMLElement", LIBXML_COMPACT);
+$xml = simplexml_load_string($buffer, "SimpleXMLElement", LIBXML_COMPACT);
unset($buffer);
diff --git a/libraries/select_lang.lib.php b/libraries/select_lang.lib.php
index 6ee5bec..c1589c4 100644
--- a/libraries/select_lang.lib.php
+++ b/libraries/select_lang.lib.php
@@ -129,7 +129,7 @@ function PMA_langSet(&$lang)
*
* @access private
*/
-function PMA_langDetect(&$str, $envType)
+function PMA_langDetect($str, $envType)
{
if (empty($str)) {
return false;
diff --git a/libraries/server_links.inc.php b/libraries/server_links.inc.php
index 1366baa..40479d2 100644
--- a/libraries/server_links.inc.php
+++ b/libraries/server_links.inc.php
@@ -87,9 +87,9 @@ $tabs['import']['icon'] = 'b_import.png';
$tabs['import']['link'] = 'server_import.php';
$tabs['import']['text'] = $strImport;
-$tabs['import']['icon'] = 's_sync.png';
-$tabs['import']['link'] = 'server_synchronize.php';
-$tabs['import']['text'] = $strSynchronize;
+$tabs['synchronize']['icon'] = 's_sync.png';
+$tabs['synchronize']['link'] = 'server_synchronize.php';
+$tabs['synchronize']['text'] = $strSynchronize;
echo PMA_generate_html_tabs($tabs, array());
unset($tabs);
diff --git a/libraries/tbl_links.inc.php b/libraries/tbl_links.inc.php
index b6c9121..4731501 100644
--- a/libraries/tbl_links.inc.php
+++ b/libraries/tbl_links.inc.php
@@ -114,6 +114,7 @@ if (! $tbl_is_view && ! (isset($db_is_information_schema) && $db_is_information_
if (! (isset($db_is_information_schema) && $db_is_information_schema)) {
$tabs['drop']['icon'] = 'b_deltbl.png';
$tabs['drop']['link'] = 'sql.php';
+ $tabs['drop']['url_params'] = array('table' => NULL);
$tabs['drop']['text'] = $strDrop;
$tabs['drop']['args']['reload'] = 1;
$tabs['drop']['args']['purge'] = 1;
diff --git a/main.php b/main.php
index bad9b9e..4bb6a75 100644
--- a/main.php
+++ b/main.php
@@ -239,8 +239,8 @@ PMA_printListItem($strHomepageOfficial, 'li_pma_homepage', 'http://www.phpMyAdmi
?>
<li><bdo xml:lang="en" dir="ltr">
[<a href="changelog.php" target="_blank">ChangeLog</a>]
- [<a href="http://phpmyadmin.svn.sourceforge.net/viewvc/phpmyadmin/"
- target="_blank">Subversion</a>]
+ [<a href="http://phpmyadmin.git.sourceforge.net/git/gitweb-index.cgi"
+ target="_blank">Git</a>]
[<a href="http://sourceforge.net/mail/?group_id=23067"
target="_blank">Lists</a>]
</bdo>
diff --git a/navigation.php b/navigation.php
index fe6fccc..fb5e52c 100644
--- a/navigation.php
+++ b/navigation.php
@@ -36,7 +36,6 @@
* @uses PMA_getTableList()
* @uses PMA_getRelationsParam()
* @uses PMA_outBufferPre()
- * @uses session_write_close()
* @uses strlen()
* @uses session_write_close()
* @uses is_array()
@@ -299,7 +298,7 @@ if ($GLOBALS['cfg']['LeftFrameLight'] && strlen($GLOBALS['db'])) {
}
echo '</a></p>';
if ($table_count) {
- echo '<span id=\'NavFilter\' style="display:none;"><span onclick="document.getElementById(\'fast_filter\').value=\'\'; fast_filter(\'\');document.getElementById(\'fast_filter\').focus();" style="background:white;color:black;cursor:pointer;padding:2px;margin:0 0 0 -20px;position:relative;float:right;" title="' . $strReset . '">X</span><input type="text" name="fast_filter" id="fast_filter" title="' . $strNavTableFilter . '" onkeyup="setTimeout(function(word){ return function(){ fast_filter(word);}}(this.value),1000);" style="width:100%;padding:0 -20px 0 0; padding:2px;" onfocus="this.select();" /></span><script type="text/javascript">document.getElementById(\'NavFilter\').style.display=\'\';</script>';
+ echo '<span id=\'NavFilter\' style="display:none;"><span onclick="document.getElementById(\'fast_filter\').value=\'\'; fast_filter(\'\');document.getElementById(\'fast_filter\').focus();" style="background:white;color:black;cursor:pointer;padding:2px;margin:0 0 0 -20px;position:relative;float:right;" title="' . $strReset . '">X</span><input type="text" name="fast_filter" id="fast_filter" title="' . $strNavTableFilter . '" onkeyup="setTimeout(function(word){ return function(){ fast_filter(word);}}(this.value),1000);" style="width:90%;padding:0 -20px 0 0; padding:2px;" onfocus="this.select();" /></span><script type="text/javascript">document.getElementById(\'NavFilter\').style.display=\'\';</script>';
}
/**
diff --git a/pdf_schema.php b/pdf_schema.php
index 82a07c1..552ee32 100644
--- a/pdf_schema.php
+++ b/pdf_schema.php
@@ -511,8 +511,19 @@ class PMA_RT_Table {
var $height_cell = 6;
var $x, $y;
var $primary = array();
+ var $show_info = false;
/**
+ * Returns title of the current table,
+ * title can have the dimensions of the table
+ *
+ * @access private
+ */
+ function getTitle()
+ {
+ return ($this->show_info ? sprintf('%.0f', $this->width) . 'x' . sprintf('%.0f', $this->height) : '') . ' ' . $this->table_name;
+ } // end of the "getTitle" function
+ /**
* Sets the width of the table
*
* @param integer $ The font size
@@ -522,8 +533,6 @@ class PMA_RT_Table {
*/
function PMA_RT_Table_setWidth($ff)
{
- // this looks buggy to me... does it really work if
- // there are fields that require wider cells than the name of the table?
global $pdf;
foreach ($this->fields AS $field) {
@@ -531,7 +540,11 @@ class PMA_RT_Table {
}
$this->width += $pdf->GetStringWidth(' ');
$pdf->SetFont($ff, 'B');
- $this->width = max($this->width, $pdf->GetStringWidth(' ' . $this->table_name));
+ // it is unknown what value must be added, because
+ // table title is affected by the tabe width value
+ while ($this->width < $pdf->GetStringWidth($this->getTitle())) {
+ $this->width += 5;
+ }
$pdf->SetFont($ff, '');
} // end of the "PMA_RT_Table_setWidth()" method
/**
@@ -546,7 +559,6 @@ class PMA_RT_Table {
/**
* Do draw the table
*
- * @param boolean $ Whether to display table position or not
* @param integer $ The font size
* @param boolean $ Whether to display color
* @param integer $ The max. with among tables
@@ -554,7 +566,7 @@ class PMA_RT_Table {
* @access private
* @see PMA_PDF
*/
- function PMA_RT_Table_draw($show_info, $ff, $setcolor = 0)
+ function PMA_RT_Table_draw($ff, $setcolor = 0)
{
global $pdf, $with_doc;
@@ -570,11 +582,7 @@ class PMA_RT_Table {
$pdf->PMA_links['doc'][$this->table_name]['-'] = '';
}
- if ($show_info) {
- $pdf->PMA_PDF_cellScale($this->width, $this->height_cell, sprintf('%.0f', $this->width) . 'x' . sprintf('%.0f', $this->height) . ' ' . $this->table_name, 1, 1, 'C', $setcolor, $pdf->PMA_links['doc'][$this->table_name]['-']);
- } else {
- $pdf->PMA_PDF_cellScale($this->width, $this->height_cell, $this->table_name, 1, 1, 'C', $setcolor, $pdf->PMA_links['doc'][$this->table_name]['-']);
- }
+ $pdf->PMA_PDF_cellScale($this->width, $this->height_cell, $this->getTitle(), 1, 1, 'C', $setcolor, $pdf->PMA_links['doc'][$this->table_name]['-']);
$pdf->PMA_PDF_setXScale($this->x);
$pdf->SetFont($ff, '');
$pdf->SetTextColor(0);
@@ -611,6 +619,8 @@ class PMA_RT_Table {
* @param string $ The table name
* @param integer $ The font size
* @param integer $ The max. with among tables
+ * @param boolean $ Whether to display keys or not
+ * @param boolean $ Whether to display table position or not
* @global object The current PDF document
* @global integer The current page number (from the
* $cfg['Servers'][$i]['table_coords'] table)
@@ -620,7 +630,7 @@ class PMA_RT_Table {
* @see PMA_PDF, PMA_RT_Table::PMA_RT_Table_setWidth,
PMA_RT_Table::PMA_RT_Table_setHeight
*/
- function __construct($table_name, $ff, &$same_wide_width, $show_keys)
+ function __construct($table_name, $ff, &$same_wide_width, $show_keys = false, $show_info = false)
{
global $pdf, $pdf_page_number, $cfgRelation, $db;
@@ -644,9 +654,14 @@ class PMA_RT_Table {
$this->fields[] = $row[0];
}
}
+
+ $this->show_info = $show_info;
+
// height and width
- $this->PMA_RT_Table_setWidth($ff);
$this->PMA_RT_Table_setHeight();
+ // setWidth must me after setHeight, because title
+ // can include table height which changes table width
+ $this->PMA_RT_Table_setWidth($ff);
if ($same_wide_width < $this->width) {
$same_wide_width = $this->width;
}
@@ -850,17 +865,18 @@ class PMA_RT {
* @param string $ The relation field in the master table
* @param string $ The foreign table name
* @param string $ The relation field in the foreign table
+ * @param boolean $ Whether to display table position or not
* @access private
* @see PMA_RT_setMinMax
*/
- function PMA_RT_addRelation($master_table, $master_field, $foreign_table, $foreign_field)
+ function PMA_RT_addRelation($master_table, $master_field, $foreign_table, $foreign_field, $show_info)
{
if (!isset($this->tables[$master_table])) {
- $this->tables[$master_table] = new PMA_RT_Table($master_table, $this->ff, $this->tablewidth);
+ $this->tables[$master_table] = new PMA_RT_Table($master_table, $this->ff, $this->tablewidth, false, $show_info);
$this->PMA_RT_setMinMax($this->tables[$master_table]);
}
if (!isset($this->tables[$foreign_table])) {
- $this->tables[$foreign_table] = new PMA_RT_Table($foreign_table, $this->ff, $this->tablewidth);
+ $this->tables[$foreign_table] = new PMA_RT_Table($foreign_table, $this->ff, $this->tablewidth, false, $show_info);
$this->PMA_RT_setMinMax($this->tables[$foreign_table]);
}
$this->relations[] = new PMA_RT_Relation($this->tables[$master_table], $master_field, $this->tables[$foreign_table], $foreign_field);
@@ -880,7 +896,7 @@ class PMA_RT {
$pdf->SetDrawColor(200, 200, 200);
// Draws horizontal lines
for ($l = 0; $l < 21; $l++) {
- $pdf->line(0, $l * 10, $pdf->fh, $l * 10);
+ $pdf->line(0, $l * 10, $pdf->getFh(), $l * 10);
// Avoid duplicates
if ($l > 0) {
$pdf->SetXY(0, $l * 10);
@@ -890,7 +906,7 @@ class PMA_RT {
} // end for
// Draws vertical lines
for ($j = 0; $j < 30 ;$j++) {
- $pdf->line($j * 10, 0, $j * 10, $pdf->fw);
+ $pdf->line($j * 10, 0, $j * 10, $pdf->getFw());
$pdf->SetXY($j * 10, 0);
$label = (string) sprintf('%.0f', ($j * 10 - $this->l_marg) * $this->scale + $this->x_min);
$pdf->Cell(5, 7, $label);
@@ -918,10 +934,10 @@ class PMA_RT {
* @access private
* @see PMA_RT_Table::PMA_RT_Table_draw()
*/
- function PMA_RT_drawTables($show_info, $draw_color = 0)
+ function PMA_RT_drawTables($draw_color = 0)
{
foreach ($this->tables AS $table) {
- $table->PMA_RT_Table_draw($show_info, $this->ff, $draw_color);
+ $table->PMA_RT_Table_draw($this->ff, $draw_color);
}
} // end of the "PMA_RT_drawTables()" method
/**
@@ -1029,7 +1045,7 @@ class PMA_RT {
foreach ($alltables AS $table) {
if (!isset($this->tables[$table])) {
- $this->tables[$table] = new PMA_RT_Table($table, $this->ff, $this->tablewidth, $show_keys);
+ $this->tables[$table] = new PMA_RT_Table($table, $this->ff, $this->tablewidth, $show_keys, $show_info);
}
if ($this->same_wide) {
@@ -1075,7 +1091,7 @@ class PMA_RT {
// (do not use array_search() because we would have to
// to do a === FALSE and this is not PHP3 compatible)
if (in_array($rel['foreign_table'], $alltables)) {
- $this->PMA_RT_addRelation($one_table, $master_field, $rel['foreign_table'], $rel['foreign_field']);
+ $this->PMA_RT_addRelation($one_table, $master_field, $rel['foreign_table'], $rel['foreign_field'], $show_info);
}
} // end while
} // end if
@@ -1093,7 +1109,7 @@ class PMA_RT {
$this->PMA_RT_drawRelations($change_color);
}
- $this->PMA_RT_drawTables($show_info, $change_color);
+ $this->PMA_RT_drawTables($change_color);
$this->PMA_RT_showRt();
} // end of the "PMA_RT()" method
diff --git a/server_status.php b/server_status.php
index 64048b3..9c8fe01 100644
--- a/server_status.php
+++ b/server_status.php
@@ -143,6 +143,10 @@ if (isset($server_status['Threads_created'])
* 100;
}
+// Format Uptime_since_flush_status : show as days, hours, minutes, seconds
+if (isset($server_status['Uptime_since_flush_status'])) {
+ $server_status['Uptime_since_flush_status'] = PMA_timespanFormat($server_status['Uptime_since_flush_status']);
+}
/**
* define some alerts
diff --git a/setup/lib/FormDisplay.class.php b/setup/lib/FormDisplay.class.php
index 5483b00..b229a1a 100644
--- a/setup/lib/FormDisplay.class.php
+++ b/setup/lib/FormDisplay.class.php
@@ -456,7 +456,7 @@ class FormDisplay
break;
case 'select':
if (!$this->_validateSelect($_POST[$key], $form->getOptionValueList($system_path))) {
- $this->errors[$work_path][] = $GLOBALS["strstrSetuperror_incorrect_value"];
+ $this->errors[$work_path][] = $GLOBALS["strSetuperror_incorrect_value"];
$result = false;
continue;
}
diff --git a/sql.php b/sql.php
index 248ebe3..4898860 100644
--- a/sql.php
+++ b/sql.php
@@ -294,13 +294,6 @@ if (isset($GLOBALS['show_as_php']) || !empty($GLOBALS['validatequery'])) {
PMA_DBI_query('SET PROFILING=1;');
}
- // fisharebest: release the session lock, otherwise we won't be able to run other
- // scripts until the query has finished (which could take a very long time).
- // Note: footer.inc.php writes debug info to $_SESSION, so debuggers will have to wait.
- if (empty($_SESSION['debug'])) {
- session_write_close();
- }
-
// garvin: Measure query time.
// TODO-Item http://sourceforge.net/tracker/index.php?func=detail&aid=571934&group_id=23…
$querytime_before = array_sum(explode(' ', microtime()));
diff --git a/tbl_change.php b/tbl_change.php
index c2fb93a..f8cc1c0 100644
--- a/tbl_change.php
+++ b/tbl_change.php
@@ -429,6 +429,7 @@ foreach ($rows as $row_id => $vrow) {
$real_null_value = FALSE;
$special_chars_encoded = '';
if (isset($vrow)) {
+ // (we are editing)
// On a BLOB that can have a NULL value, the is_null() returns
// true if it has no content but for me this is different than
// having been set explicitely to NULL so I put an exception here
@@ -464,6 +465,7 @@ foreach ($rows as $row_id => $vrow) {
. $field_name_appendix . '" value="'
. htmlspecialchars($vrow[$field['Field']]) . '" />';
} else {
+ // (we are inserting)
// loic1: display default values
if (!isset($field['Default'])) {
$field['Default'] = '';
@@ -479,6 +481,10 @@ foreach ($rows as $row_id => $vrow) {
}
$backup_field = '';
$special_chars_encoded = PMA_duplicateFirstNewline($special_chars);
+ // this will select the UNHEX function while inserting
+ if (($field['is_binary'] || $field['is_blob']) && $_SESSION['tmp_user_values']['display_binary_as_hex'] && $cfg['ShowFunctionFields']) {
+ $field['display_binary_as_hex'] = true;
+ }
}
$idindex = ($o_rows * $fields_cnt) + $i + 1;
diff --git a/tbl_printview.php b/tbl_printview.php
index 949a78a..c5b17ab 100644
--- a/tbl_printview.php
+++ b/tbl_printview.php
@@ -279,10 +279,9 @@ foreach ($the_tables as $key => $table) {
}
if ($nonisam == false) {
// Gets some sizes
- $mergetable = false;
- if (isset($showtable['Type']) && $showtable['Type'] == 'MRG_MyISAM') {
- $mergetable = true;
- }
+
+ $mergetable = PMA_Table::isMerge($db, $table);
+
list($data_size, $data_unit) = PMA_formatByteDown($showtable['Data_length']);
if ($mergetable == false) {
list($index_size, $index_unit) = PMA_formatByteDown($showtable['Index_length']);
diff --git a/tbl_row_action.php b/tbl_row_action.php
index d72c7d5..efcc74d 100644
--- a/tbl_row_action.php
+++ b/tbl_row_action.php
@@ -43,7 +43,7 @@ if (isset($_REQUEST['submit_mult'])) {
$submit_mult = 'row_export';
}
-// garvin: If the 'Ask for confirmation' button was pressed, this can only come
+// If the 'Ask for confirmation' button was pressed, this can only come
// from 'delete' mode, so we set it straight away.
if (isset($_REQUEST['mult_btn'])) {
$submit_mult = 'row_delete';
diff --git a/tbl_structure.php b/tbl_structure.php
index 750fbdc..0d966cc 100644
--- a/tbl_structure.php
+++ b/tbl_structure.php
@@ -612,10 +612,9 @@ if ($cfg['ShowStats']) {
}
// Gets some sizes
- $mergetable = false;
- if (isset($showtable['Type']) && $showtable['Type'] == 'MRG_MyISAM') {
- $mergetable = true;
- }
+
+ $mergetable = PMA_Table::isMerge($GLOBALS['db'], $GLOBALS['table']);
+
// this is to display for example 261.2 MiB instead of 268k KiB
$max_digits = 5;
$decimals = 1;
diff --git a/translators.html b/translators.html
index d3a0fbf..00f7ab3 100644
--- a/translators.html
+++ b/translators.html
@@ -11,7 +11,7 @@
<link rel="icon" href="./favicon.ico" type="image/x-icon" />
<link rel="shortcut icon" href="./favicon.ico" type="image/x-icon" />
<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
- <title>phpMyAdmin 3.3.1 - Official translators</title>
+ <title>phpMyAdmin 3.3.2 - Official translators</title>
<link rel="stylesheet" type="text/css" href="docs.css" />
</head>
@@ -19,7 +19,7 @@
<div id="header">
<h1>
<a href="http://www.phpmyadmin.net/">php<span class="myadmin">MyAdmin</span></a>
- 3.3.1
+ 3.3.2
official translators list
</h1>
</div>
hooks/post-receive
--
phpMyAdmin
1
0
[Phpmyadmin-git] [SCM] phpMyAdmin annotated tag, RELEASE_3_3_2, created. RELEASE_3_3_2
by Marc Delisle 13 Apr '10
by Marc Delisle 13 Apr '10
13 Apr '10
The annotated tag, RELEASE_3_3_2 has been created
at 325854fea1bd2cf9684a381e2523382a36b44c3a (tag)
tagging 48cf4d398d3b5667522ceb702827fe24061d43f0 (commit)
replaces RELEASE_3_3_2RC1
tagged by Marc Delisle
on Tue Apr 13 18:33:59 2010 -0400
- Log -----------------------------------------------------------------
Released 3.3.2
Marc Delisle (1):
3.3.2 release
Michal Čihař (7):
Add some hints on running with Suhosin.
Typo.
Be more specific about problems with Suhosin.
Document Error_Handler.
Fix typo (cfb -> cfg).
Document enabling error reporting in devel docs.
Revert part of eb5e03880e579d572ec8e45a8fc0777929defddc.
-----------------------------------------------------------------------
hooks/post-receive
--
phpMyAdmin
1
0